Compare commits

..

11 Commits

55 changed files with 3949 additions and 5015 deletions

Binary file not shown.

Before

Width:  |  Height:  |  Size: 181 KiB

Binary file not shown.

Before

Width:  |  Height:  |  Size: 674 KiB

Binary file not shown.

Binary file not shown.

Binary file not shown.

Binary file not shown.

Binary file not shown.

Binary file not shown.

Binary file not shown.

Binary file not shown.

Binary file not shown.

View File

@ -9,10 +9,10 @@ GameEngine::GameEngine()
{
Resources::font.loadFromFile("./assets/JetbrainsMono.ttf");
Resources::game = this;
window_title = "Crypt of Sokoban - 7DRL 2025, McRogueface Engine";
window_title = "McRogueFace - 7DRL 2024 Engine Demo";
window.create(sf::VideoMode(1024, 768), window_title, sf::Style::Titlebar | sf::Style::Close);
visible = window.getDefaultView();
window.setFramerateLimit(60);
window.setFramerateLimit(30);
scene = "uitest";
scenes["uitest"] = new UITestScene(this);
@ -59,14 +59,11 @@ void GameEngine::run()
if (!paused)
{
}
currentScene()->render();
currentScene()->sRender();
currentFrame++;
frameTime = clock.restart().asSeconds();
fps = 1 / frameTime;
int whole_fps = (int)fps;
int tenth_fps = int(fps * 100) % 10;
//window.setTitle(window_title + " " + std::to_string(fps) + " FPS");
window.setTitle(window_title + " " + std::to_string(whole_fps) + "." + std::to_string(tenth_fps) + " FPS");
window.setTitle(window_title + " " + std::to_string(fps) + " FPS");
}
}

View File

@ -9,11 +9,6 @@ std::vector<sf::SoundBuffer> McRFPy_API::soundbuffers;
sf::Music McRFPy_API::music;
sf::Sound McRFPy_API::sfx;
std::shared_ptr<PyFont> McRFPy_API::default_font;
std::shared_ptr<PyTexture> McRFPy_API::default_texture;
PyObject* McRFPy_API::mcrf_module;
static PyMethodDef mcrfpyMethods[] = {
{"registerPyAction", McRFPy_API::_registerPyAction, METH_VARARGS,
"Register a callable Python object to correspond to an action string. (actionstr, callable)"},
@ -44,15 +39,8 @@ static PyMethodDef mcrfpyMethods[] = {
};
static PyModuleDef mcrfpyModule = {
PyModuleDef_HEAD_INIT, /* m_base - Always initialize this member to PyModuleDef_HEAD_INIT. */
"mcrfpy", /* m_name */
NULL, /* m_doc - Docstring for the module; usually a docstring variable created with PyDoc_STRVAR is used. */
-1, /* m_size - Setting m_size to -1 means that the module does not support sub-interpreters, because it has global state. */
mcrfpyMethods, /* m_methods */
NULL, /* m_slots - An array of slot definitions ... When using single-phase initialization, m_slots must be NULL. */
NULL, /* traverseproc m_traverse - A traversal function to call during GC traversal of the module object */
NULL, /* inquiry m_clear - A clear function to call during GC clearing of the module object */
NULL /* freefunc m_free - A function to call during deallocation of the module object */
PyModuleDef_HEAD_INIT, "mcrfpy", NULL, -1, mcrfpyMethods,
NULL, NULL, NULL, NULL
};
// Module initializer fn, passed to PyImport_AppendInittab
@ -68,7 +56,7 @@ PyObject* PyInit_mcrfpy()
using namespace mcrfpydef;
PyTypeObject* pytypes[] = {
/*SFML exposed types*/
&PyColorType, /*&PyLinkedColorType,*/ &PyFontType, &PyTextureType, &PyVectorType,
&PyColorType, /*&PyLinkedColorType,*/ &PyFontType, &PyTextureType,
/*UI widgets*/
&PyUICaptionType, &PyUISpriteType, &PyUIFrameType, &PyUIEntityType, &PyUIGridType,
@ -84,19 +72,11 @@ PyObject* PyInit_mcrfpy()
auto t = pytypes[i];
while (t != nullptr)
{
/*std::cout << */ PyType_Ready(t); /*<< std::endl; */
PyType_Ready(t);
PyModule_AddType(m, t);
t = pytypes[i++];
}
// Add default_font and default_texture to module
McRFPy_API::default_font = std::make_shared<PyFont>("assets/JetbrainsMono.ttf");
McRFPy_API::default_texture = std::make_shared<PyTexture>("assets/kenney_tinydungeon.png", 16, 16);
//PyModule_AddObject(m, "default_font", McRFPy_API::default_font->pyObject());
//PyModule_AddObject(m, "default_texture", McRFPy_API::default_texture->pyObject());
PyModule_AddObject(m, "default_font", Py_None);
PyModule_AddObject(m, "default_texture", Py_None);
//McRFPy_API::mcrf_module = m;
return m;
}
@ -148,13 +128,9 @@ PyStatus init_python(const char *program_name)
#endif
status = Py_InitializeFromConfig(&config);
PyConfig_Clear(&config);
return status;
}
/*
void McRFPy_API::setSpriteTexture(int ti)
{
int tx = ti % texture_width, ty = ti / texture_width;
@ -163,7 +139,6 @@ void McRFPy_API::setSpriteTexture(int ti)
ty * texture_size,
texture_size, texture_size));
}
*/
// functionality
//void McRFPy_API::
@ -180,15 +155,6 @@ void McRFPy_API::api_init() {
//texture_sprite_count = texture_width * texture_height;
//texture.setSmooth(false);
// Add default_font and default_texture to module
McRFPy_API::mcrf_module = PyImport_ImportModule("mcrfpy");
std::cout << PyUnicode_AsUTF8(PyObject_Repr(McRFPy_API::mcrf_module)) << std::endl;
//PyModule_AddObject(McRFPy_API::mcrf_module, "default_font", McRFPy_API::default_font->pyObject());
PyObject_SetAttrString(McRFPy_API::mcrf_module, "default_font", McRFPy_API::default_font->pyObject());
//PyModule_AddObject(McRFPy_API::mcrf_module, "default_texture", McRFPy_API::default_texture->pyObject());
PyObject_SetAttrString(McRFPy_API::mcrf_module, "default_texture", McRFPy_API::default_texture->pyObject());
//sprite.setTexture(texture);
//sprite.setScale(sf::Vector2f(4.0f, 4.0f));
//setSpriteTexture(0);
@ -251,7 +217,7 @@ PyObject* McRFPy_API::_registerInputAction(PyObject *self, PyObject *args)
std::cout << "Unregistering\n";
success = game->currentScene()->unregisterActionInjected(action_code, std::string(actionstr) + "_py");
} else {
std::cout << "Registering " << actionstr << "_py to " << action_code << "\n";
std::cout << "Registering" << actionstr << "_py to " << action_code << "\n";
success = game->currentScene()->registerActionInjected(action_code, std::string(actionstr) + "_py");
}

View File

@ -3,9 +3,6 @@
#include "Python.h"
#include <list>
#include "PyFont.h"
#include "PyTexture.h"
class GameEngine; // forward declared (circular members)
class McRFPy_API
@ -17,14 +14,10 @@ private:
McRFPy_API();
public:
static PyObject* mcrf_module;
static std::shared_ptr<PyFont> default_font;
static std::shared_ptr<PyTexture> default_texture;
//inline static sf::Sprite sprite;
//inline static sf::Texture texture;
//static void setSpriteTexture(int);
inline static sf::Sprite sprite;
inline static sf::Texture texture;
static void setSpriteTexture(int);
inline static GameEngine* game;
static void api_init();
static void api_shutdown();

View File

@ -1,5 +1,4 @@
#include "PyColor.h"
#include "McRFPy_API.h"
PyGetSetDef PyColor::getsetters[] = {
{"r", (getter)PyColor::get_member, (setter)PyColor::set_member, "Red component", (void*)0},
@ -66,62 +65,77 @@ PyObject* PyColor::repr(PyObject* obj)
}
int PyColor::init(PyColorObject* self, PyObject* args, PyObject* kwds) {
//using namespace mcrfpydef;
int PyColor::init(PyColorObject* self, PyObject* args, PyObject* kwds)
{
using namespace mcrfpydef;
static const char* keywords[] = { "r", "g", "b", "a", nullptr };
PyObject* leader;
int r = -1, g = -1, b = -1, a = 255;
if (!PyArg_ParseTupleAndKeywords(args, kwds, "O|iii", const_cast<char**>(keywords), &leader, &g, &b, &a)) {
PyErr_SetString(PyExc_TypeError, "mcrfpy.Color requires a 3-tuple, 4-tuple, color name, or integer values within 0-255 (r, g, b, optionally a)");
if (!PyArg_ParseTupleAndKeywords, args, kwds, "O|iii", leader, &g, &b, &a)
{
PyErr_SetString(PyExc_TypeError, "mcrfpy.Color requires a color object, 3-tuple, 4-tuple, color name, or integer values within 0-255 (r, g, b, optionally a)");
return -1;
}
//std::cout << "Arg parsing succeeded. Values: " << r << " " << g << " " << b << " " << a <<std::endl;
//std::cout << PyUnicode_AsUTF8(PyObject_Repr(leader)) << std::endl;
// Tuple cases
if (PyTuple_Check(leader)) {
Py_ssize_t tupleSize = PyTuple_Size(leader);
if (tupleSize < 3 || tupleSize > 4) {
PyErr_SetString(PyExc_TypeError, "Invalid tuple length: mcrfpy.Color requires a 3-tuple, 4-tuple, color name, or integer values within 0-255 (r, g, b, optionally a)");
// if the "r" arg is already a color, yoink that color value
if (PyObject_IsInstance(leader, (PyObject*)&PyColorType))
{
self->data = ((PyColorObject*)leader)->data;
return 0;
}
// else if the "r" arg is a 3-tuple, initialize to (r, g, b, 255)
// (if the "r" arg is a 4-tuple, initialize to (r, g, b, a))
else if (PyTuple_Check(leader))
{
if (PyTuple_Size(leader) < 3 && PyTuple_Size(leader) > 4)
{
PyErr_SetString(PyExc_TypeError, "Invalid tuple length: mcrfpy.Color requires a color object, 3-tuple, 4-tuple, color name, or integer values within 0-255 (r, g, b, optionally a)");
return -1;
}
r = PyLong_AsLong(PyTuple_GetItem(leader, 0));
g = PyLong_AsLong(PyTuple_GetItem(leader, 1));
b = PyLong_AsLong(PyTuple_GetItem(leader, 2));
if (tupleSize == 4) {
//a = 255; //default value
if (PyTuple_Size(leader) == 4)
{
a = PyLong_AsLong(PyTuple_GetItem(leader, 3));
}
}
// Color name (not implemented yet)
else if (PyUnicode_Check(leader)) {
PyErr_SetString(PyExc_NotImplementedError, "Color names aren't ready yet");
return -1;
}
// Check if the leader is actually an integer for the r value
else if (PyLong_Check(leader)) {
r = PyLong_AsLong(leader);
// Additional validation not shown; g, b are required to be parsed
} else {
PyErr_SetString(PyExc_TypeError, "mcrfpy.Color requires a 3-tuple, 4-tuple, color name, or integer values within 0-255 (r, g, b, optionally a)");
return -1;
}
// Validate color values
if (r < 0 || r > 255 || g < 0 || g > 255 || b < 0 || b > 255 || a < 0 || a > 255) {
PyErr_SetString(PyExc_ValueError, "Color values must be between 0 and 255.");
// value validation
if (r < 0 || r > 255 || g < 0 || g > 255 || b < 0 || b > 255 || a < 0 || a > 255)
{
PyErr_SetString(PyExc_ValueError, "Color values must be between 0 and 255.");
return -1;
}
self->data = sf::Color(r, g, b, a);
}
// else if the "r" arg is a string, initialize to {color lookup function value}
else if (PyUnicode_Check(leader))
{
PyErr_SetString(Py_NotImplemented, "Color names aren't ready yet");
return -1;
}
// else -
else if (!PyLong_Check(leader))
{
PyErr_SetString(PyExc_TypeError, "mcrfpy.Color requires a color object, 3-tuple, 4-tuple, color name, or integer values within 0-255 (r, g, b, optionally a)");
return -1;
}
r = PyLong_AsLong(leader);
// assert r, g, b are present and ints in range (0, 255) - if not enough ints were provided to the args/kwds parsed by init, g and/or b will still hold -1.
if (r < 0 || r > 255 || g < 0 || g > 255 || b < 0 || b > 255 || a < 0 || a > 255)
{
PyErr_SetString(PyExc_ValueError, "R, G, B values are required, A value is optional; Color values must be between 0 and 255.");
return -1;
}
self->data = sf::Color(r, g, b, a);
return 0;
}
PyObject* PyColor::pynew(PyTypeObject* type, PyObject* args, PyObject* kwds)
{
auto obj = (PyObject*)type->tp_alloc(type, 0);
//Py_INCREF(obj);
return obj;
return (PyObject*)type->tp_alloc(type, 0);
}
PyObject* PyColor::get_member(PyObject* obj, void* closure)
@ -135,16 +149,3 @@ int PyColor::set_member(PyObject* obj, PyObject* value, void* closure)
// TODO
return 0;
}
PyColorObject* PyColor::from_arg(PyObject* args)
{
auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "Color");
if (PyObject_IsInstance(args, (PyObject*)type)) return (PyColorObject*)args;
auto obj = (PyColorObject*)type->tp_alloc(type, 0);
int err = init(obj, args, NULL);
if (err) {
Py_DECREF(obj);
return NULL;
}
return obj;
}

View File

@ -29,7 +29,6 @@ public:
static int set_member(PyObject*, PyObject*, void*);
static PyGetSetDef getsetters[];
static PyColorObject* from_arg(PyObject*);
};
namespace mcrfpydef {

View File

@ -1,63 +0,0 @@
#include "PyFont.h"
#include "McRFPy_API.h"
PyFont::PyFont(std::string filename)
: source(filename)
{
font = sf::Font();
font.loadFromFile(source);
}
PyObject* PyFont::pyObject()
{
auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "Font");
//PyObject* obj = PyType_GenericAlloc(&mcrfpydef::PyFontType, 0);
PyObject* obj = PyFont::pynew(type, Py_None, Py_None);
try {
((PyFontObject*)obj)->data = shared_from_this();
}
catch (std::bad_weak_ptr& e)
{
std::cout << "Bad weak ptr: shared_from_this() failed in PyFont::pyObject(); did you create a PyFont outside of std::make_shared? enjoy your segfault, soon!" << std::endl;
}
// TODO - shared_from_this will raise an exception if the object does not have a shared pointer. Constructor should be made private; write a factory function
return obj;
}
PyObject* PyFont::repr(PyObject* obj)
{
PyFontObject* self = (PyFontObject*)obj;
std::ostringstream ss;
if (!self->data)
{
ss << "<Font [invalid internal object]>";
std::string repr_str = ss.str();
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
}
auto& pfont = *(self->data);
ss << "<Font (family=" << pfont.font.getInfo().family << ") source=`" << pfont.source << "`>";
std::string repr_str = ss.str();
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
}
Py_hash_t PyFont::hash(PyObject* obj)
{
auto self = (PyFontObject*)obj;
return reinterpret_cast<Py_hash_t>(self->data.get());
}
int PyFont::init(PyFontObject* self, PyObject* args, PyObject* kwds)
{
static const char* keywords[] = { "filename", nullptr };
char* filename;
if (!PyArg_ParseTupleAndKeywords(args, kwds, "s", const_cast<char**>(keywords), &filename))
return -1;
self->data = std::make_shared<PyFont>(filename);
return 0;
}
PyObject* PyFont::pynew(PyTypeObject* type, PyObject* args, PyObject* kwds)
{
return (PyObject*)type->tp_alloc(type, 0);
}

View File

@ -1,39 +0,0 @@
#pragma once
#include "Common.h"
#include "Python.h"
class PyFont;
typedef struct {
PyObject_HEAD
std::shared_ptr<PyFont> data;
} PyFontObject;
class PyFont : public std::enable_shared_from_this<PyFont>
{
private:
std::string source;
public:
PyFont(std::string filename);
sf::Font font;
PyObject* pyObject();
static PyObject* repr(PyObject*);
static Py_hash_t hash(PyObject*);
static int init(PyFontObject*, PyObject*, PyObject*);
static PyObject* pynew(PyTypeObject* type, PyObject* args=NULL, PyObject* kwds=NULL);
};
namespace mcrfpydef {
static PyTypeObject PyFontType = {
.tp_name = "mcrfpy.Font",
.tp_basicsize = sizeof(PyFontObject),
.tp_itemsize = 0,
.tp_repr = PyFont::repr,
//.tp_hash = PyFont::hash,
.tp_flags = Py_TPFLAGS_DEFAULT,
.tp_doc = PyDoc_STR("SFML Font Object"),
//.tp_base = &PyBaseObject_Type,
.tp_init = (initproc)PyFont::init,
.tp_new = PyType_GenericNew, //PyFont::pynew,
};
}

209
src/PyLinkedColor.cpp Normal file
View File

@ -0,0 +1,209 @@
#include "PyLinkedColor.h"
#include "PyColor.h"
PyGetSetDef PyLinkedColor::getsetters[] = {
{"r", (getter)PyLinkedColor::get_member, (setter)PyLinkedColor::set_member, "Red component", (void*)0},
{"g", (getter)PyLinkedColor::get_member, (setter)PyLinkedColor::set_member, "Green component", (void*)1},
{"b", (getter)PyLinkedColor::get_member, (setter)PyLinkedColor::set_member, "Blue component", (void*)2},
{"a", (getter)PyLinkedColor::get_member, (setter)PyLinkedColor::set_member, "Alpha component", (void*)3},
{"color", (getter)PyLinkedColor::get_member, (setter)PyLinkedColor::set_member, "RGBA as mcrfpy.Color", (void*)4},
{NULL}
};
PyLinkedColor::PyLinkedColor(_PyLinkedColorData d)
{
data = d;
}
PyLinkedColor::PyLinkedColor(std::function<void(sf::Color)> _s, std::function<sf::Color()> _g, std::weak_ptr<UIDrawable> parent, int index)
{
data.setter = _s;
data.getter = _g;
data.parent = parent;
data.index = index;
}
PyObject* PyLinkedColor::pyObject()
{
PyObject* obj = PyType_GenericAlloc(&mcrfpydef::PyLinkedColorType, 0);
PyLinkedColorObject* self = (PyLinkedColorObject*)obj;
self->data = data;
return obj;
}
PyLinkedColor PyLinkedColor::fromPy(PyObject* obj)
{
PyLinkedColorObject* self = (PyLinkedColorObject*)obj;
return PyLinkedColor(self->data);
}
PyLinkedColor PyLinkedColor::fromPy(PyLinkedColorObject* self)
{
return PyLinkedColor(self->data);
}
void PyLinkedColor::set(sf::Color color)
{
std::cout << "PyLinkedColor: call to set()" << std::endl;
auto ptr = data.parent.lock();
if (ptr)
{
if (data.setter)
data.setter(color);
}
}
sf::Color PyLinkedColor::get()
{
std::cout << "PyLinkedColor: call to get()" << std::endl;
auto ptr = data.parent.lock();
if (ptr)
{
if (data.getter)
return data.getter();
}
return sf::Color(0, 0, 0, 0);
}
bool PyLinkedColor::alive()
{
return !data.parent.lock();
}
std::string PyLinkedColor::field()
{
switch (data.index)
{
case 0:
return "fill";
break;
case 1:
return "outline";
break;
case 2:
return "background";
break;
default:
return "unknown";
break;
}
}
Py_hash_t PyLinkedColor::hash(PyObject* obj)
{
auto self = (PyLinkedColorObject*)obj;
Py_hash_t value = 0;
auto ptr = self->data.parent.lock();
if (ptr)
{
auto linkedcolor = PyLinkedColor(self->data);
auto c = linkedcolor.get();
value += c.r;
value << 8; value += c.g;
value << 8; value += c.b;
value << 8; value += c.a;
}
if (ptr)
{
//value << (sizeof(*UIDrawable) * 8);
value += reinterpret_cast<Py_hash_t>(&ptr);
}
return value;
}
PyObject* PyLinkedColor::repr(PyObject* obj)
{
PyLinkedColorObject* self = (PyLinkedColorObject*)obj;
std::ostringstream ss;
PyLinkedColor color = PyLinkedColor(self->data);
sf::Color c = color.get();
ss << "<LinkedColor (" << int(c.r) << ", " << int(c.g) << ", " << int(c.b) << ", " << int(c.a) << ")";
auto ptr = self->data.parent.lock();
if (!ptr)
{
ss << " [dead link]";
}
else
{
switch (ptr->derived_type())
{
case PyObjectsEnum::UIFRAME:
break;
}
}
ss << ">";
std::string repr_str = ss.str();
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
}
/*
int PyLinkedColor::init(PyLinkedColorObject* self, PyObject* args, PyObject* kwds)
{
// TODO
static const char* keywords[] = { "r", "g", "b", "a", nullptr };
return 0;
}
*/
PyObject* PyLinkedColor::pynew(PyTypeObject* type, PyObject* args, PyObject* kwds)
{
return (PyObject*)type->tp_alloc(type, 0);
}
PyObject* PyLinkedColor::get_member(PyObject* obj, void* closure)
{
PyLinkedColorObject* self = (PyLinkedColorObject*)obj;
PyLinkedColor color = PyLinkedColor(self->data);
sf::Color c = color.get();
auto var = reinterpret_cast<long>(closure);
if (var == 0)
return PyLong_FromLong(c.r);
else if (var == 1)
return PyLong_FromLong(c.g);
else if (var == 2)
return PyLong_FromLong(c.b);
else if (var == 3)
return PyLong_FromLong(c.a);
else if (var == 4)
return PyColor(c).pyObject();
return Py_None;
}
int PyLinkedColor::set_member(PyObject* obj, PyObject* value, void* closure)
{
PyLinkedColorObject* self = (PyLinkedColorObject*)obj;
PyLinkedColor color = PyLinkedColor(self->data);
sf::Color c = color.get();
auto var = reinterpret_cast<long>(closure);
if (var == 4)
{
// cheat - call mcrfpy.Color __init__ on the value (don't duplicate arg parsing code)
PyObject* newcolor = PyType_GenericAlloc(&mcrfpydef::PyColorType, 0);
mcrfpydef::PyColorType.tp_init(newcolor, value, NULL);
if (PyErr_Occurred()) return -1;
auto newc = PyColor::fromPy(newcolor);
color.set(newc);
Py_DECREF(newcolor);
}
long val = PyLong_AsLong(value);
if (PyErr_Occurred()) return -1;
if (val > 255 || val < 0)
{
PyErr_SetString(PyExc_ValueError, "Color values must be between 0 and 255");
return -1;
}
if (var == 0)
color.set(sf::Color(val, c.g, c.b, c.a));
else if (var == 1)
color.set(sf::Color(c.r, val, c.b, c.a));
else if (var == 2)
color.set(sf::Color(c.r, c.g, val, c.a));
else if (var == 3)
color.set(sf::Color(c.r, c.g, c.b, val));
return 0;
}

89
src/PyLinkedColor.h Normal file
View File

@ -0,0 +1,89 @@
#pragma once
#include "Common.h"
#include "Python.h"
#include <functional>
class PyLinkedColor;
//class UIDrawable; // forward declare for pointer
class PyClickCallable;
// TODO - after UI.h gets broken up, this can go into a separate base class, since only derived classes use PyLinkedColor
#ifndef ui_h
enum PyObjectsEnum : int
{
UIFRAME = 1,
UICAPTION,
UISPRITE,
UIGRID
};
class UIDrawable
{
public:
void render();
virtual void render(sf::Vector2f) = 0;
virtual PyObjectsEnum derived_type() = 0;
std::unique_ptr<PyClickCallable> click_callable;
virtual UIDrawable* click_at(sf::Vector2f point) = 0;
void click_register(PyObject*);
void click_unregister();
UIDrawable();
};
#endif
typedef struct {
std::weak_ptr<UIDrawable> parent; // lifetime management: parent must still exist
int index; // specific to the parent class, which color is it?
//sf::Color(*getter)();
//void(*setter)(sf::Color);
std::function<void(sf::Color)> setter;
std::function<sf::Color()> getter;
} _PyLinkedColorData;
typedef struct {
PyObject_HEAD
_PyLinkedColorData data;
} PyLinkedColorObject;
class PyLinkedColor
{
private:
_PyLinkedColorData data;
PyLinkedColor(_PyLinkedColorData); // private constructor / for operations transferring between C++ and Python
public:
//PyLinkedColor(sf::Color (*)(), void (*)(sf::Color), std::weak_ptr<UIDrawable>, int);
PyLinkedColor(std::function<void(sf::Color)> setter, std::function<sf::Color()> getter, std::weak_ptr<UIDrawable> parent, int index);
void set(sf::Color); // change target value, behavior determined by the mode
sf::Color get(); // retrieve target value, behavior determined by the mode
PyObject* pyParent(); // UIDrawable derived parent object or None
std::string field(); // interpret the index as a field's name on UIDrawable
bool alive(); // true if SELF_OWNED or parent still exists
PyObject* pyObject();
static PyLinkedColor fromPy(PyObject*);
static PyLinkedColor fromPy(PyLinkedColorObject*);
static PyObject* repr(PyObject*);
static Py_hash_t hash(PyObject*);
static int init(PyLinkedColorObject*, PyObject*, PyObject*);
static PyObject* pynew(PyTypeObject* type, PyObject* args=NULL, PyObject* kwds=NULL);
static PyObject* get_member(PyObject*, void*);
static int set_member(PyObject*, PyObject*, void*);
static PyGetSetDef getsetters[];
};
namespace mcrfpydef {
static PyTypeObject PyLinkedColorType = {
.tp_name = "mcrfpy.LinkedColor",
.tp_basicsize = sizeof(PyLinkedColorObject),
.tp_itemsize = 0,
.tp_repr = PyLinkedColor::repr,
.tp_hash = PyLinkedColor::hash,
.tp_flags = Py_TPFLAGS_DEFAULT,
.tp_doc = PyDoc_STR("SFML Color Object - Linked to UIDrawable Field"),
.tp_getset = PyLinkedColor::getsetters,
//.tp_init = (initproc)PyLinkedColor::init,
.tp_new = PyLinkedColor::pynew,
};
}

View File

@ -11,8 +11,7 @@ PyScene::PyScene(GameEngine* g) : Scene(g)
registerAction(ActionCode::MOUSEWHEEL + ActionCode::WHEEL_DEL, "wheel_up");
registerAction(ActionCode::MOUSEWHEEL + ActionCode::WHEEL_NEG + ActionCode::WHEEL_DEL, "wheel_down");
// console (` / ~ key) - don't hard code.
//registerAction(ActionCode::KEY + sf::Keyboard::Grave, "debug_menu");
registerAction(ActionCode::KEY + sf::Keyboard::Grave, "debug_menu");
}
void PyScene::update()
@ -60,7 +59,7 @@ void PyScene::doAction(std::string name, std::string type)
}
}
void PyScene::render()
void PyScene::sRender()
{
game->getWindow().clear();

View File

@ -11,7 +11,7 @@ public:
PyScene(GameEngine*);
void update() override final;
void doAction(std::string, std::string) override final;
void render() override final;
void sRender() override final;
void do_mouse_input(std::string, std::string);
};

View File

@ -1,5 +1,5 @@
#include "PyTexture.h"
#include "McRFPy_API.h"
PyTexture::PyTexture(std::string filename, int sprite_w, int sprite_h)
: source(filename), sprite_width(sprite_w), sprite_height(sprite_h)
@ -28,9 +28,7 @@ sf::Sprite PyTexture::sprite(int index, sf::Vector2f pos, sf::Vector2f s)
PyObject* PyTexture::pyObject()
{
auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "Texture");
PyObject* obj = PyTexture::pynew(type, Py_None, Py_None);
PyObject* obj = PyType_GenericAlloc(&mcrfpydef::PyTextureType, 0);
try {
((PyTextureObject*)obj)->data = shared_from_this();
}
@ -42,22 +40,6 @@ PyObject* PyTexture::pyObject()
return obj;
}
PyObject* PyTexture::repr(PyObject* obj)
{
PyTextureObject* self = (PyTextureObject*)obj;
std::ostringstream ss;
if (!self->data)
{
ss << "<Texture [invalid internal object]>";
std::string repr_str = ss.str();
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
}
auto& ptex = *(self->data);
ss << "<Texture " << ptex.sheet_height << " rows, " << ptex.sheet_width << " columns; " << ptex.sprite_width << "x" << ptex.sprite_height << "px sprites. source='" << ptex.source << "'>";
std::string repr_str = ss.str();
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
}
Py_hash_t PyTexture::hash(PyObject* obj)
{
auto self = (PyTextureObject*)obj;

View File

@ -21,7 +21,6 @@ public:
sf::Sprite sprite(int index, sf::Vector2f pos = sf::Vector2f(0, 0), sf::Vector2f s = sf::Vector2f(1.0, 1.0));
PyObject* pyObject();
static PyObject* repr(PyObject*);
static Py_hash_t hash(PyObject*);
static int init(PyTextureObject*, PyObject*, PyObject*);
static PyObject* pynew(PyTypeObject* type, PyObject* args=NULL, PyObject* kwds=NULL);
@ -32,12 +31,10 @@ namespace mcrfpydef {
.tp_name = "mcrfpy.Texture",
.tp_basicsize = sizeof(PyTextureObject),
.tp_itemsize = 0,
.tp_repr = PyTexture::repr,
.tp_hash = PyTexture::hash,
.tp_flags = Py_TPFLAGS_DEFAULT,
.tp_doc = PyDoc_STR("SFML Texture Object"),
//.tp_base = &PyBaseObject_Type,
.tp_init = (initproc)PyTexture::init,
.tp_new = PyType_GenericNew, //PyTexture::pynew,
.tp_new = PyTexture::pynew,
};
}

View File

@ -1,124 +0,0 @@
#include "PyVector.h"
PyGetSetDef PyVector::getsetters[] = {
{"x", (getter)PyVector::get_member, (setter)PyVector::set_member, "X/horizontal component", (void*)0},
{"y", (getter)PyVector::get_member, (setter)PyVector::set_member, "Y/vertical component", (void*)1},
{NULL}
};
PyVector::PyVector(sf::Vector2f target)
:data(target) {}
PyObject* PyVector::pyObject()
{
PyObject* obj = PyType_GenericAlloc(&mcrfpydef::PyVectorType, 0);
Py_INCREF(obj);
PyVectorObject* self = (PyVectorObject*)obj;
self->data = data;
return obj;
}
sf::Vector2f PyVector::fromPy(PyObject* obj)
{
PyVectorObject* self = (PyVectorObject*)obj;
return self->data;
}
sf::Vector2f PyVector::fromPy(PyVectorObject* self)
{
return self->data;
}
Py_hash_t PyVector::hash(PyObject* obj)
{
auto self = (PyVectorObject*)obj;
Py_hash_t value = 0;
value += self->data.x;
value << 8; value += self->data.y;
return value;
}
PyObject* PyVector::repr(PyObject* obj)
{
PyVectorObject* self = (PyVectorObject*)obj;
std::ostringstream ss;
sf::Vector2f v = self->data;
ss << "<Vector (" << v.x << ", " << v.y << ")>";
std::string repr_str = ss.str();
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
}
int PyVector::init(PyVectorObject* self, PyObject* args, PyObject* kwds)
{
using namespace mcrfpydef;
static const char* keywords[] = { "x", "y", nullptr };
PyObject* leader = NULL;
float x=0, y=0;
if (!PyArg_ParseTupleAndKeywords(args, kwds, "|Of", const_cast<char**>(keywords), &leader, &y))
{
//PyErr_SetString(PyExc_TypeError, "mcrfpy.Vector requires a 2-tuple or two numeric values");
return -1;
}
if (leader == NULL || leader == Py_None)
{
self->data = sf::Vector2f();
return 0;
}
if (PyTuple_Check(leader))
{
if (PyTuple_Size(leader) != 2)
{
PyErr_SetString(PyExc_TypeError, "Invalid tuple length: mcrfpy.Vector requires a 2-tuple");
return -1;
}
x = PyFloat_AsDouble(PyTuple_GetItem(leader, 0));
y = PyFloat_AsDouble(PyTuple_GetItem(leader, 1));
self->data = sf::Vector2f(x, y);
return 0;
}
// else -
else if (!PyFloat_Check(leader) && !(PyLong_Check(leader)))
{
PyErr_SetString(PyExc_TypeError, "mcrfpy.Vector requires a 2-tuple or two numeric values");
return -1;
}
if (PyFloat_Check(leader)) x = PyFloat_AsDouble(leader);
else x = PyLong_AsDouble(leader);
self->data = sf::Vector2f(x, y);
return 0;
}
PyObject* PyVector::pynew(PyTypeObject* type, PyObject* args, PyObject* kwds)
{
return (PyObject*)type->tp_alloc(type, 0);
}
PyObject* PyVector::get_member(PyObject* obj, void* closure)
{
// TODO
return Py_None;
}
int PyVector::set_member(PyObject* obj, PyObject* value, void* closure)
{
// TODO
return 0;
}
PyVectorObject* PyVector::from_arg(PyObject* args)
{
auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "Vector");
if (PyObject_IsInstance(args, (PyObject*)type)) return (PyVectorObject*)args;
auto obj = (PyVectorObject*)type->tp_alloc(type, 0);
int err = init(obj, args, NULL);
if (err) {
Py_DECREF(obj);
return NULL;
}
return obj;
}

View File

@ -1,44 +0,0 @@
#pragma once
#include "Common.h"
#include "Python.h"
#include "McRFPy_API.h"
typedef struct {
PyObject_HEAD
sf::Vector2f data;
} PyVectorObject;
class PyVector
{
public:
sf::Vector2f data;
PyVector(sf::Vector2f);
PyVector();
PyObject* pyObject();
static sf::Vector2f fromPy(PyObject*);
static sf::Vector2f fromPy(PyVectorObject*);
static PyObject* repr(PyObject*);
static Py_hash_t hash(PyObject*);
static int init(PyVectorObject*, PyObject*, PyObject*);
static PyObject* pynew(PyTypeObject* type, PyObject* args=NULL, PyObject* kwds=NULL);
static PyObject* get_member(PyObject*, void*);
static int set_member(PyObject*, PyObject*, void*);
static PyVectorObject* from_arg(PyObject*);
static PyGetSetDef getsetters[];
};
namespace mcrfpydef {
static PyTypeObject PyVectorType = {
.tp_name = "mcrfpy.Vector",
.tp_basicsize = sizeof(PyVectorObject),
.tp_itemsize = 0,
.tp_repr = PyVector::repr,
.tp_hash = PyVector::hash,
.tp_flags = Py_TPFLAGS_DEFAULT,
.tp_doc = PyDoc_STR("SFML Vector Object"),
.tp_getset = PyVector::getsetters,
.tp_init = (initproc)PyVector::init,
.tp_new = PyVector::pynew,
};
}

View File

@ -31,7 +31,7 @@ public:
//Scene();
Scene(GameEngine*);
virtual void update() = 0;
virtual void render() = 0;
virtual void sRender() = 0;
virtual void doAction(std::string, std::string) = 0;
bool hasAction(std::string);
bool hasAction(int);

527
src/UI.cpp Normal file
View File

@ -0,0 +1,527 @@
#include "UI.h"
#include "Resources.h"
#include "GameEngine.h"
/* //callability fields & methods
PyObject* click_callable;
virtual UIDrawable* click_at(sf::Vector2f point);
void click_register(PyObject*);
void click_unregister();
*/
UIDrawable::UIDrawable() { click_callable = NULL; }
UIDrawable* UIFrame::click_at(sf::Vector2f point)
{
for (auto e: *children)
{
auto p = e->click_at(point + box.getPosition());
if (p)
return p;
}
if (click_callable)
{
float x = box.getPosition().x, y = box.getPosition().y, w = box.getSize().x, h = box.getSize().y;
if (point.x > x && point.y > y && point.x < x+w && point.y < y+h) return this;
}
return NULL;
}
UIDrawable* UICaption::click_at(sf::Vector2f point)
{
if (click_callable)
{
if (text.getGlobalBounds().contains(point)) return this;
}
return NULL;
}
UIDrawable* UISprite::click_at(sf::Vector2f point)
{
if (click_callable)
{
if(sprite.getGlobalBounds().contains(point)) return this;
}
return NULL;
}
UIDrawable* UIGrid::click_at(sf::Vector2f point)
{
if (click_callable)
{
if(box.getGlobalBounds().contains(point)) return this;
}
return NULL;
}
void UIDrawable::click_register(PyObject* callable)
{
/*
if (click_callable)
{
// decrement reference before overwriting
Py_DECREF(click_callable);
}
click_callable = callable;
Py_INCREF(click_callable);
*/
click_callable = std::make_unique<PyClickCallable>(callable);
}
void UIDrawable::click_unregister()
{
/*
if (click_callable == NULL) return;
Py_DECREF(click_callable);
click_callable = NULL;
*/
click_callable.reset();
}
void UIDrawable::render()
{
//std::cout << "Rendering base UIDrawable\n";
render(sf::Vector2f());
}
UIFrame::UIFrame():
//x(0), y(0), w(0), h(0),
outline(0)
{
children = std::make_shared<std::vector<std::shared_ptr<UIDrawable>>>();
box.setPosition(0, 0);
box.setSize(sf::Vector2f(0, 0));
/*
pyOutlineColor = NULL;
pyFillColor = NULL;
_outlineColor = NULL;
_fillColor = NULL;
*/
}
UIFrame::UIFrame(float _x, float _y, float _w, float _h):
//x(_x), y(_y), w(_w), h(_h),
outline(0)
{
box.setPosition(_x, _y);
box.setSize(sf::Vector2f(_w, _h));
children = std::make_shared<std::vector<std::shared_ptr<UIDrawable>>>();
/*
pyOutlineColor = NULL;
pyFillColor = NULL;
_outlineColor = NULL;
_fillColor = NULL;
*/
}
UIFrame::~UIFrame()
{
children.reset();
/*
if (pyOutlineColor) Py_DECREF(pyOutlineColor);
else if (_outlineColor) delete _outlineColor;
if (pyFillColor) Py_DECREF(pyFillColor);
else if (_fillColor) delete _fillColor;
*/
}
/*
sf::Color& fillColor(); // getter
void fillColor(sf::Color c); // C++ setter
void fillColor(PyObject* pyColor); // Python setter
sf::Color& outlineColor(); // getter
void outlineColor(sf::Color c); // C++ setter
void outlineColor(PyObject* pyColor); // Python setter
*/
PyObjectsEnum UIFrame::derived_type()
{
return PyObjectsEnum::UIFRAME;
}
void UIFrame::render(sf::Vector2f offset)
{
//std::cout << "Rendering UIFrame w/ offset " << offset.x << ", " << offset.y << "\n";
//std::cout << "position = " << x << ", " << y << "\n";
box.move(offset);
Resources::game->getWindow().draw(box);
box.move(-offset);
//sf::RectangleShape box = sf::RectangleShape(sf::Vector2f(w,h));
//sf::Vector2f pos = sf::Vector2f(x, y);
//box.setPosition(offset + pos);
//if (_fillColor) { box.setFillColor(fillColor()); }
//if (_outlineColor) { box.setOutlineColor(outlineColor()); }
//box.setOutlineThickness(outline);
//Resources::game->getWindow().draw(box);
for (auto drawable : *children) {
drawable->render(offset + box.getPosition());
}
}
void UICaption::render(sf::Vector2f offset)
{
//std::cout << "Rendering Caption with offset\n";
text.move(offset);
Resources::game->getWindow().draw(text);
text.move(-offset);
}
UISprite::UISprite() {}
/*
// * tearing down the old IndexTexture way of life
UISprite::UISprite(IndexTexture* _itex, int _sprite_index, float x = 0.0, float y = 0.0, float s = 1.0)
: itex(_itex), sprite_index(_sprite_index)
{
sprite.setTexture(_itex->texture);
sprite.setTextureRect(_itex->spriteCoordinates(_sprite_index));
sprite.setPosition(sf::Vector2f(x, y));
sprite.setScale(sf::Vector2f(s, s));
}
UISprite::UISprite(IndexTexture* _itex, int _sprite_index, sf::Vector2f pos, float s = 1.0)
: itex(_itex), sprite_index(_sprite_index)
{
sprite.setTexture(_itex->texture);
sprite.setTextureRect(_itex->spriteCoordinates(_sprite_index));
sprite.setPosition(pos);
sprite.setScale(sf::Vector2f(s, s));
}
*/
UISprite::UISprite(std::shared_ptr<PyTexture> _ptex, int _sprite_index, sf::Vector2f _pos, float _scale)
: ptex(_ptex), sprite_index(_sprite_index)
{
sprite = ptex->sprite(sprite_index, _pos, sf::Vector2f(_scale, _scale));
}
//void UISprite::update()
//{
//auto& tex = Resources::game->textures[texture_index];
//sprite.setTexture(tex.texture);
//sprite.setScale(sf::Vector2f(scale, scale));
//sprite.setPosition(sf::Vector2f(x, y));
//std::cout << "Drawable position: " << x << ", " << y << " -> " << s.getPosition().x << ", " << s.getPosition().y << std::endl;
//sprite.setTextureRect(tex.spriteCoordinates(sprite_index));
//}
void UISprite::render(sf::Vector2f offset)
{
sprite.move(offset);
Resources::game->getWindow().draw(sprite);
sprite.move(-offset);
}
// 7DRL hack; needed to draw entities to UIGrid. TODO, apply this technique to all UIDrawables
void UISprite::render(sf::Vector2f offset, sf::RenderTexture& target)
{
sprite.move(offset);
target.draw(sprite);
sprite.move(-offset);
}
/*
void UISprite::setPosition(float x, float y)
{
setPosition(sf::Vector2f(x, y));
}
*/
void UISprite::setPosition(sf::Vector2f pos)
{
sprite.setPosition(pos);
}
void UISprite::setScale(sf::Vector2f s)
{
sprite.setScale(s);
}
void UISprite::setTexture(std::shared_ptr<PyTexture> _ptex, int _sprite_index)
{
ptex = _ptex;
if (_sprite_index != -1) // if you are changing textures, there's a good chance you need a new index too
sprite_index = _sprite_index;
sprite = ptex->sprite(sprite_index, sprite.getPosition(), sprite.getScale());
}
void UISprite::setSpriteIndex(int _sprite_index)
{
sprite_index = _sprite_index;
sprite = ptex->sprite(sprite_index, sprite.getPosition(), sprite.getScale());
}
sf::Vector2f UISprite::getScale()
{
return sprite.getScale();
}
sf::Vector2f UISprite::getPosition()
{
return sprite.getPosition();
}
std::shared_ptr<PyTexture> UISprite::getTexture()
{
return ptex;
}
int UISprite::getSpriteIndex()
{
return sprite_index;
}
PyObjectsEnum UICaption::derived_type()
{
return PyObjectsEnum::UICAPTION;
}
PyObjectsEnum UISprite::derived_type()
{
return PyObjectsEnum::UISPRITE;
}
// UIGrid support classes' methods
UIGridPoint::UIGridPoint()
:color(1.0f, 1.0f, 1.0f), color_overlay(0.0f, 0.0f, 0.0f), walkable(false), transparent(false),
tilesprite(-1), tile_overlay(-1), uisprite(-1)
{
}
UIEntity::UIEntity() {} // this will not work lol. TODO remove default constructor by finding the shared pointer inits that use it
UIEntity::UIEntity(UIGrid& grid)
: gridstate(grid.grid_x * grid.grid_y)
{
}
// UIGrid methods
UIGrid::UIGrid()
{
}
/*
UIGrid::UIGrid(int gx, int gy, std::shared_ptr<PyTexture> _ptex, float _x, float _y, float _w, float _h)
: grid_x(gx), grid_y(gy),
zoom(1.0f), center_x((gx/2) * _ptex->sheet_width), center_y((gy/2) * _ptex->sheet_height),
itex(_itex), points(gx * gy)
{
// set up blank list of entities
entities = std::make_shared<std::list<std::shared_ptr<UIEntity>>>();
box.setSize(sf::Vector2f(_w, _h));
box.setPosition(sf::Vector2f(_x, _y));
box.setFillColor(sf::Color(0,0,0,0));
renderTexture.create(_w, _h);
sprite.setTexture(_itex->texture);
output.setTextureRect(
sf::IntRect(0, 0,
box.getSize().x, box.getSize().y));
output.setPosition(box.getPosition());
// textures are upside-down inside renderTexture
output.setTexture(renderTexture.getTexture());
}
*/
UIGrid::UIGrid(int gx, int gy, std::shared_ptr<PyTexture> _ptex, sf::Vector2f _xy, sf::Vector2f _wh)
: grid_x(gx), grid_y(gy),
zoom(1.0f), center_x((gx/2) * _ptex->sprite_width), center_y((gy/2) * _ptex->sprite_height),
ptex(_ptex), points(gx * gy)
{
// set up blank list of entities
entities = std::make_shared<std::list<std::shared_ptr<UIEntity>>>();
box.setSize(_wh);
box.setPosition(_xy);
box.setFillColor(sf::Color(0,0,0,0));
//renderTexture.create(_wh.x, _wh.y);
// create renderTexture with maximum theoretical size; sprite can resize to show whatever amount needs to be rendered
renderTexture.create(1920, 1080); // TODO - renderTexture should be window size; above 1080p this will cause rendering errors
//sprite.setTexture(_itex->texture);
sprite = ptex->sprite(0);
output.setTextureRect(
sf::IntRect(0, 0,
box.getSize().x, box.getSize().y));
output.setPosition(box.getPosition());
// textures are upside-down inside renderTexture
output.setTexture(renderTexture.getTexture());
}
void UIGrid::update()
{
}
/*
void UIGrid::setSprite(int ti)
{
//int tx = ti % itex->grid_width, ty = ti / itex->grid_width;
// sprite.setTextureRect(sf::IntRect(tx * itex->grid_size, ty * itex->grid_size, itex->grid_size, itex->grid_size));
sprite = ptex->sprite(ti);
}
*/
void UIGrid::render(sf::Vector2f)
{
output.setPosition(box.getPosition()); // output sprite can move; update position when drawing
// output size can change; update size when drawing
output.setTextureRect(
sf::IntRect(0, 0,
box.getSize().x, box.getSize().y));
renderTexture.clear(sf::Color(8, 8, 8, 255)); // TODO - UIGrid needs a "background color" field
// sprites that are visible according to zoom, center_x, center_y, and box width
float center_x_sq = center_x / ptex->sprite_width;
float center_y_sq = center_y / ptex->sprite_height;
float width_sq = box.getSize().x / (ptex->sprite_width * zoom);
float height_sq = box.getSize().y / (ptex->sprite_height * zoom);
float left_edge = center_x_sq - (width_sq / 2.0);
float top_edge = center_y_sq - (height_sq / 2.0);
int left_spritepixels = center_x - (box.getSize().x / 2.0 / zoom);
int top_spritepixels = center_y - (box.getSize().y / 2.0 / zoom);
//sprite.setScale(sf::Vector2f(zoom, zoom));
sf::RectangleShape r; // for colors and overlays
r.setSize(sf::Vector2f(ptex->sprite_width * zoom, ptex->sprite_height * zoom));
r.setOutlineThickness(0);
int x_limit = left_edge + width_sq + 2;
if (x_limit > grid_x) x_limit = grid_x;
int y_limit = top_edge + height_sq + 2;
if (y_limit > grid_y) y_limit = grid_y;
// base layer - bottom color, tile sprite ("ground")
for (int x = (left_edge - 1 >= 0 ? left_edge - 1 : 0);
x < x_limit; //x < view_width;
x+=1)
{
//for (float y = (top_edge >= 0 ? top_edge : 0);
for (int y = (top_edge - 1 >= 0 ? top_edge - 1 : 0);
y < y_limit; //y < view_height;
y+=1)
{
auto pixel_pos = sf::Vector2f(
(x*ptex->sprite_width - left_spritepixels) * zoom,
(y*ptex->sprite_height - top_spritepixels) * zoom );
auto gridpoint = at(std::floor(x), std::floor(y));
//sprite.setPosition(pixel_pos);
r.setPosition(pixel_pos);
r.setFillColor(gridpoint.color);
renderTexture.draw(r);
// tilesprite
// if discovered but not visible, set opacity to 90%
// if not discovered... just don't draw it?
if (gridpoint.tilesprite != -1) {
sprite = ptex->sprite(gridpoint.tilesprite, pixel_pos, sf::Vector2f(zoom, zoom)); //setSprite(gridpoint.tilesprite);;
renderTexture.draw(sprite);
}
}
}
// middle layer - entities
// disabling entity rendering until I can render their UISprite inside the rendertexture (not directly to window)
for (auto e : *entities) {
// TODO skip out-of-bounds entities (grid square not visible at all, check for partially on visible grid squares / floating point grid position)
//auto drawent = e->cGrid->indexsprite.drawable();
auto& drawent = e->sprite;
//drawent.setScale(zoom, zoom);
drawent.setScale(sf::Vector2f(zoom, zoom));
auto pixel_pos = sf::Vector2f(
(e->position.x*ptex->sprite_width - left_spritepixels) * zoom,
(e->position.y*ptex->sprite_height - top_spritepixels) * zoom );
//drawent.setPosition(pixel_pos);
//renderTexture.draw(drawent);
drawent.render(pixel_pos, renderTexture);
}
// top layer - opacity for discovered / visible status (debug, basically)
/* // Disabled until I attach a "perspective"
for (int x = (left_edge - 1 >= 0 ? left_edge - 1 : 0);
x < x_limit; //x < view_width;
x+=1)
{
//for (float y = (top_edge >= 0 ? top_edge : 0);
for (int y = (top_edge - 1 >= 0 ? top_edge - 1 : 0);
y < y_limit; //y < view_height;
y+=1)
{
auto pixel_pos = sf::Vector2f(
(x*itex->grid_size - left_spritepixels) * zoom,
(y*itex->grid_size - top_spritepixels) * zoom );
auto gridpoint = at(std::floor(x), std::floor(y));
sprite.setPosition(pixel_pos);
r.setPosition(pixel_pos);
// visible & discovered layers for testing purposes
if (!gridpoint.discovered) {
r.setFillColor(sf::Color(16, 16, 20, 192)); // 255 opacity for actual blackout
renderTexture.draw(r);
} else if (!gridpoint.visible) {
r.setFillColor(sf::Color(32, 32, 40, 128));
renderTexture.draw(r);
}
// overlay
// uisprite
}
}
*/
// grid lines for testing & validation
/*
sf::Vertex line[] =
{
sf::Vertex(sf::Vector2f(0, 0), sf::Color::Red),
sf::Vertex(box.getSize(), sf::Color::Red),
};
renderTexture.draw(line, 2, sf::Lines);
sf::Vertex lineb[] =
{
sf::Vertex(sf::Vector2f(0, box.getSize().y), sf::Color::Blue),
sf::Vertex(sf::Vector2f(box.getSize().x, 0), sf::Color::Blue),
};
renderTexture.draw(lineb, 2, sf::Lines);
*/
// render to window
renderTexture.display();
Resources::game->getWindow().draw(output);
}
UIGridPoint& UIGrid::at(int x, int y)
{
return points[y * grid_x + x];
}
PyObjectsEnum UIGrid::derived_type()
{
return PyObjectsEnum::UIGRID;
}
std::shared_ptr<PyTexture> UIGrid::getTexture()
{
return ptex;
}

2495
src/UI.h

File diff suppressed because it is too large Load Diff

View File

@ -1,32 +0,0 @@
#pragma once
class UIEntity;
typedef struct {
PyObject_HEAD
std::shared_ptr<UIEntity> data;
} PyUIEntityObject;
class UIFrame;
typedef struct {
PyObject_HEAD
std::shared_ptr<UIFrame> data;
} PyUIFrameObject;
class UICaption;
typedef struct {
PyObject_HEAD
std::shared_ptr<UICaption> data;
PyObject* font;
} PyUICaptionObject;
class UIGrid;
typedef struct {
PyObject_HEAD
std::shared_ptr<UIGrid> data;
} PyUIGridObject;
class UISprite;
typedef struct {
PyObject_HEAD
std::shared_ptr<UISprite> data;
} PyUISpriteObject;

View File

@ -1,296 +0,0 @@
#include "UICaption.h"
#include "GameEngine.h"
#include "PyColor.h"
#include "PyVector.h"
#include "PyFont.h"
UIDrawable* UICaption::click_at(sf::Vector2f point)
{
if (click_callable)
{
if (text.getGlobalBounds().contains(point)) return this;
}
return NULL;
}
void UICaption::render(sf::Vector2f offset, sf::RenderTarget& target)
{
text.move(offset);
//Resources::game->getWindow().draw(text);
target.draw(text);
text.move(-offset);
}
PyObjectsEnum UICaption::derived_type()
{
return PyObjectsEnum::UICAPTION;
}
PyObject* UICaption::get_float_member(PyUICaptionObject* self, void* closure)
{
auto member_ptr = reinterpret_cast<long>(closure);
if (member_ptr == 0)
return PyFloat_FromDouble(self->data->text.getPosition().x);
else if (member_ptr == 1)
return PyFloat_FromDouble(self->data->text.getPosition().y);
else if (member_ptr == 4)
return PyFloat_FromDouble(self->data->text.getOutlineThickness());
else if (member_ptr == 5)
return PyLong_FromLong(self->data->text.getCharacterSize());
else
{
PyErr_SetString(PyExc_AttributeError, "Invalid attribute");
return nullptr;
}
}
int UICaption::set_float_member(PyUICaptionObject* self, PyObject* value, void* closure)
{
float val;
auto member_ptr = reinterpret_cast<long>(closure);
if (PyFloat_Check(value))
{
val = PyFloat_AsDouble(value);
}
else if (PyLong_Check(value))
{
val = PyLong_AsLong(value);
}
else
{
PyErr_SetString(PyExc_TypeError, "Value must be an integer.");
return -1;
}
if (member_ptr == 0) //x
self->data->text.setPosition(val, self->data->text.getPosition().y);
else if (member_ptr == 1) //y
self->data->text.setPosition(self->data->text.getPosition().x, val);
else if (member_ptr == 4) //outline
self->data->text.setOutlineThickness(val);
else if (member_ptr == 5) // character size
self->data->text.setCharacterSize(val);
return 0;
}
PyObject* UICaption::get_vec_member(PyUICaptionObject* self, void* closure)
{
return PyVector(self->data->text.getPosition()).pyObject();
}
int UICaption::set_vec_member(PyUICaptionObject* self, PyObject* value, void* closure)
{
self->data->text.setPosition(PyVector::fromPy(value));
return 0;
}
PyObject* UICaption::get_color_member(PyUICaptionObject* self, void* closure)
{
// TODO: migrate this code to a switch statement - validate closure & return values in one tighter, more extensible structure
// validate closure (should be impossible to be wrong, but it's thorough)
auto member_ptr = reinterpret_cast<long>(closure);
if (member_ptr != 0 && member_ptr != 1)
{
PyErr_SetString(PyExc_AttributeError, "Invalid attribute");
return nullptr;
}
// TODO: manually calling tp_alloc to create a PyColorObject seems like an antipattern
// fetch correct member data
sf::Color color;
if (member_ptr == 0)
{
color = self->data->text.getFillColor();
}
else if (member_ptr == 1)
{
color = self->data->text.getOutlineColor();
}
return PyColor(color).pyObject();
}
int UICaption::set_color_member(PyUICaptionObject* self, PyObject* value, void* closure)
{
auto member_ptr = reinterpret_cast<long>(closure);
//TODO: this logic of (PyColor instance OR tuple -> sf::color) should be encapsulated for reuse
int r, g, b, a;
if (PyObject_IsInstance(value, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Color") /*(PyObject*)&mcrfpydef::PyColorType)*/))
{
// get value from mcrfpy.Color instance
auto c = ((PyColorObject*)value)->data;
r = c.r; g = c.g; b = c.b; a = c.a;
std::cout << "got " << int(r) << ", " << int(g) << ", " << int(b) << ", " << int(a) << std::endl;
}
else if (!PyTuple_Check(value) || PyTuple_Size(value) < 3 || PyTuple_Size(value) > 4)
{
// reject non-Color, non-tuple value
PyErr_SetString(PyExc_TypeError, "Value must be a tuple of 3 or 4 integers or an mcrfpy.Color object.");
return -1;
}
else // get value from tuples
{
r = PyLong_AsLong(PyTuple_GetItem(value, 0));
g = PyLong_AsLong(PyTuple_GetItem(value, 1));
b = PyLong_AsLong(PyTuple_GetItem(value, 2));
a = 255;
if (PyTuple_Size(value) == 4)
{
a = PyLong_AsLong(PyTuple_GetItem(value, 3));
}
}
if (r < 0 || r > 255 || g < 0 || g > 255 || b < 0 || b > 255 || a < 0 || a > 255)
{
PyErr_SetString(PyExc_ValueError, "Color values must be between 0 and 255.");
return -1;
}
if (member_ptr == 0)
{
self->data->text.setFillColor(sf::Color(r, g, b, a));
}
else if (member_ptr == 1)
{
self->data->text.setOutlineColor(sf::Color(r, g, b, a));
}
else
{
PyErr_SetString(PyExc_AttributeError, "Invalid attribute");
return -1;
}
return 0;
}
//TODO: evaluate use of Resources::caption_buffer... can't I do this with a std::string?
PyObject* UICaption::get_text(PyUICaptionObject* self, void* closure)
{
Resources::caption_buffer = self->data->text.getString();
return PyUnicode_FromString(Resources::caption_buffer.c_str());
}
int UICaption::set_text(PyUICaptionObject* self, PyObject* value, void* closure)
{
PyObject* s = PyObject_Str(value);
PyObject * temp_bytes = PyUnicode_AsEncodedString(s, "UTF-8", "strict"); // Owned reference
if (temp_bytes != NULL) {
Resources::caption_buffer = PyBytes_AS_STRING(temp_bytes); // Borrowed pointer
Py_DECREF(temp_bytes);
}
self->data->text.setString(Resources::caption_buffer);
return 0;
}
PyGetSetDef UICaption::getsetters[] = {
{"x", (getter)UICaption::get_float_member, (setter)UICaption::set_float_member, "X coordinate of top-left corner", (void*)0},
{"y", (getter)UICaption::get_float_member, (setter)UICaption::set_float_member, "Y coordinate of top-left corner", (void*)1},
{"pos", (getter)UICaption::get_vec_member, (setter)UICaption::set_vec_member, "(x, y) vector", (void*)0},
//{"w", (getter)PyUIFrame_get_float_member, (setter)PyUIFrame_set_float_member, "width of the rectangle", (void*)2},
//{"h", (getter)PyUIFrame_get_float_member, (setter)PyUIFrame_set_float_member, "height of the rectangle", (void*)3},
{"outline", (getter)UICaption::get_float_member, (setter)UICaption::set_float_member, "Thickness of the border", (void*)4},
{"fill_color", (getter)UICaption::get_color_member, (setter)UICaption::set_color_member, "Fill color of the text", (void*)0},
{"outline_color", (getter)UICaption::get_color_member, (setter)UICaption::set_color_member, "Outline color of the text", (void*)1},
//{"children", (getter)PyUIFrame_get_children, NULL, "UICollection of objects on top of this one", NULL},
{"text", (getter)UICaption::get_text, (setter)UICaption::set_text, "The text displayed", NULL},
{"size", (getter)UICaption::get_float_member, (setter)UICaption::set_float_member, "Text size (integer) in points", (void*)5},
{"click", (getter)UIDrawable::get_click, (setter)UIDrawable::set_click, "Object called with (x, y, button) when clicked", (void*)PyObjectsEnum::UICAPTION},
{NULL}
};
PyObject* UICaption::repr(PyUICaptionObject* self)
{
std::ostringstream ss;
if (!self->data) ss << "<Caption (invalid internal object)>";
else {
auto text = self->data->text;
auto fc = text.getFillColor();
auto oc = text.getOutlineColor();
ss << "<Caption (x=" << text.getPosition().x << ", y=" << text.getPosition().y << ", " <<
"text='" << (std::string)text.getString() << "', " <<
"outline=" << text.getOutlineThickness() << ", " <<
"fill_color=(" << (int)fc.r << ", " << (int)fc.g << ", " << (int)fc.b << ", " << (int)fc.a <<"), " <<
"outline_color=(" << (int)oc.r << ", " << (int)oc.g << ", " << (int)oc.b << ", " << (int)oc.a <<"), " <<
")>";
}
std::string repr_str = ss.str();
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
}
int UICaption::init(PyUICaptionObject* self, PyObject* args, PyObject* kwds)
{
using namespace mcrfpydef;
// Constructor switch to Vector position
//static const char* keywords[] = { "x", "y", "text", "font", "fill_color", "outline_color", "outline", nullptr };
//float x = 0.0f, y = 0.0f, outline = 0.0f;
static const char* keywords[] = { "pos", "text", "font", "fill_color", "outline_color", "outline", nullptr };
PyObject* pos;
float outline = 0.0f;
char* text;
PyObject* font=NULL, *fill_color=NULL, *outline_color=NULL;
//if (!PyArg_ParseTupleAndKeywords(args, kwds, "|ffzOOOf",
// const_cast<char**>(keywords), &x, &y, &text, &font, &fill_color, &outline_color, &outline))
if (!PyArg_ParseTupleAndKeywords(args, kwds, "O|zOOOf",
const_cast<char**>(keywords), &pos, &text, &font, &fill_color, &outline_color, &outline))
{
return -1;
}
PyVectorObject* pos_result = PyVector::from_arg(pos);
if (!pos_result)
{
PyErr_SetString(PyExc_TypeError, "pos must be a mcrfpy.Vector instance or arguments to mcrfpy.Vector.__init__");
return -1;
}
self->data->text.setPosition(pos_result->data);
// check types for font, fill_color, outline_color
//std::cout << PyUnicode_AsUTF8(PyObject_Repr(font)) << std::endl;
if (font != NULL && !PyObject_IsInstance(font, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Font")/*(PyObject*)&PyFontType)*/)){
PyErr_SetString(PyExc_TypeError, "font must be a mcrfpy.Font instance");
return -1;
} else if (font != NULL)
{
auto font_obj = (PyFontObject*)font;
self->data->text.setFont(font_obj->data->font);
self->font = font;
Py_INCREF(font);
} else
{
// default font
//self->data->text.setFont(Resources::game->getFont());
}
self->data->text.setString((std::string)text);
self->data->text.setOutlineThickness(outline);
if (fill_color) {
auto fc = PyColor::from_arg(fill_color);
if (!fc) {
PyErr_SetString(PyExc_TypeError, "fill_color must be mcrfpy.Color or arguments to mcrfpy.Color.__init__");
return -1;
}
self->data->text.setFillColor(PyColor::fromPy(fc));
//Py_DECREF(fc);
} else {
self->data->text.setFillColor(sf::Color(0,0,0,255));
}
if (outline_color) {
auto oc = PyColor::from_arg(outline_color);
if (!oc) {
PyErr_SetString(PyExc_TypeError, "outline_color must be mcrfpy.Color or arguments to mcrfpy.Color.__init__");
return -1;
}
self->data->text.setOutlineColor(PyColor::fromPy(oc));
//Py_DECREF(oc);
} else {
self->data->text.setOutlineColor(sf::Color(128,128,128,255));
}
return 0;
}

View File

@ -1,62 +0,0 @@
#pragma once
#include "Common.h"
#include "Python.h"
#include "UIDrawable.h"
class UICaption: public UIDrawable
{
public:
sf::Text text;
void render(sf::Vector2f, sf::RenderTarget&) override final;
PyObjectsEnum derived_type() override final;
virtual UIDrawable* click_at(sf::Vector2f point) override final;
static PyObject* get_float_member(PyUICaptionObject* self, void* closure);
static int set_float_member(PyUICaptionObject* self, PyObject* value, void* closure);
static PyObject* get_vec_member(PyUICaptionObject* self, void* closure);
static int set_vec_member(PyUICaptionObject* self, PyObject* value, void* closure);
static PyObject* get_color_member(PyUICaptionObject* self, void* closure);
static int set_color_member(PyUICaptionObject* self, PyObject* value, void* closure);
static PyObject* get_text(PyUICaptionObject* self, void* closure);
static int set_text(PyUICaptionObject* self, PyObject* value, void* closure);
static PyGetSetDef getsetters[];
static PyObject* repr(PyUICaptionObject* self);
static int init(PyUICaptionObject* self, PyObject* args, PyObject* kwds);
};
namespace mcrfpydef {
static PyTypeObject PyUICaptionType = {
.tp_name = "mcrfpy.Caption",
.tp_basicsize = sizeof(PyUICaptionObject),
.tp_itemsize = 0,
// TODO - move tp_dealloc to .cpp file as static function (UICaption::dealloc)
.tp_dealloc = (destructor)[](PyObject* self)
{
PyUICaptionObject* obj = (PyUICaptionObject*)self;
// TODO - reevaluate with PyFont usage; UICaption does not own the font
// release reference to font object
if (obj->font) Py_DECREF(obj->font);
obj->data.reset();
Py_TYPE(self)->tp_free(self);
},
.tp_repr = (reprfunc)UICaption::repr,
//.tp_hash = NULL,
//.tp_iter
//.tp_iternext
.tp_flags = Py_TPFLAGS_DEFAULT,
.tp_doc = PyDoc_STR("docstring"),
//.tp_methods = PyUIFrame_methods,
//.tp_members = PyUIFrame_members,
.tp_getset = UICaption::getsetters,
//.tp_base = NULL,
.tp_init = (initproc)UICaption::init,
// TODO - move tp_new to .cpp file as a static function (UICaption::new)
.tp_new = [](PyTypeObject* type, PyObject* args, PyObject* kwds) -> PyObject*
{
PyUICaptionObject* self = (PyUICaptionObject*)type->tp_alloc(type, 0);
if (self) self->data = std::make_shared<UICaption>();
return (PyObject*)self;
}
};
}

View File

@ -1,203 +0,0 @@
#include "UICollection.h"
#include "UIFrame.h"
#include "UICaption.h"
#include "UISprite.h"
#include "UIGrid.h"
#include "McRFPy_API.h"
using namespace mcrfpydef;
int UICollectionIter::init(PyUICollectionIterObject* self, PyObject* args, PyObject* kwds)
{
PyErr_SetString(PyExc_TypeError, "UICollection cannot be instantiated: a C++ data source is required.");
return -1;
}
PyObject* UICollectionIter::next(PyUICollectionIterObject* self)
{
if (self->data->size() != self->start_size)
{
PyErr_SetString(PyExc_RuntimeError, "collection changed size during iteration");
return NULL;
}
if (self->index > self->start_size - 1)
{
PyErr_SetNone(PyExc_StopIteration);
return NULL;
}
self->index++;
auto vec = self->data.get();
if (!vec)
{
PyErr_SetString(PyExc_RuntimeError, "the collection store returned a null pointer");
return NULL;
}
auto target = (*vec)[self->index-1];
// TODO build PyObject* of the correct UIDrawable subclass to return
//return py_instance(target);
return NULL;
}
PyObject* UICollectionIter::repr(PyUICollectionIterObject* self)
{
std::ostringstream ss;
if (!self->data) ss << "<UICollectionIter (invalid internal object)>";
else {
ss << "<UICollectionIter (" << self->data->size() << " child objects, @ index " << self->index << ")>";
}
std::string repr_str = ss.str();
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
}
Py_ssize_t UICollection::len(PyUICollectionObject* self) {
return self->data->size();
}
PyObject* UICollection::getitem(PyUICollectionObject* self, Py_ssize_t index) {
// build a Python version of item at self->data[index]
// Copy pasted::
auto vec = self->data.get();
if (!vec)
{
PyErr_SetString(PyExc_RuntimeError, "the collection store returned a null pointer");
return NULL;
}
while (index < 0) index += self->data->size();
if (index > self->data->size() - 1)
{
PyErr_SetString(PyExc_IndexError, "UICollection index out of range");
return NULL;
}
auto target = (*vec)[index];
RET_PY_INSTANCE(target);
return NULL;
}
PySequenceMethods UICollection::sqmethods = {
.sq_length = (lenfunc)UICollection::len,
.sq_item = (ssizeargfunc)UICollection::getitem,
//.sq_item_by_index = PyUICollection_getitem
//.sq_slice - return a subset of the iterable
//.sq_ass_item - called when `o[x] = y` is executed (x is any object type)
//.sq_ass_slice - cool; no thanks, for now
//.sq_contains - called when `x in o` is executed
//.sq_ass_item_by_index - called when `o[x] = y` is executed (x is explictly an integer)
};
/* Idiomatic way to fetch complete types from the API rather than referencing their PyTypeObject struct
auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "Texture");
I never identified why `using namespace mcrfpydef;` doesn't solve the segfault issue.
The horrible macro in UIDrawable was originally a workaround for this, but as I interact with the types outside of the monster UI.h, a more general (and less icky) solution is required.
*/
PyObject* UICollection::append(PyUICollectionObject* self, PyObject* o)
{
// if not UIDrawable subclass, reject it
// self->data->push_back( c++ object inside o );
// this would be a great use case for .tp_base
if (!PyObject_IsInstance(o, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Frame")) &&
!PyObject_IsInstance(o, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Sprite")) &&
!PyObject_IsInstance(o, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Caption")) &&
!PyObject_IsInstance(o, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Grid"))
)
{
PyErr_SetString(PyExc_TypeError, "Only Frame, Caption, Sprite, and Grid objects can be added to UICollection");
return NULL;
}
if (PyObject_IsInstance(o, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Frame")))
{
PyUIFrameObject* frame = (PyUIFrameObject*)o;
self->data->push_back(frame->data);
}
if (PyObject_IsInstance(o, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Caption")))
{
PyUICaptionObject* caption = (PyUICaptionObject*)o;
self->data->push_back(caption->data);
}
if (PyObject_IsInstance(o, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Sprite")))
{
PyUISpriteObject* sprite = (PyUISpriteObject*)o;
self->data->push_back(sprite->data);
}
if (PyObject_IsInstance(o, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Grid")))
{
PyUIGridObject* grid = (PyUIGridObject*)o;
self->data->push_back(grid->data);
}
Py_INCREF(Py_None);
return Py_None;
}
PyObject* UICollection::remove(PyUICollectionObject* self, PyObject* o)
{
if (!PyLong_Check(o))
{
PyErr_SetString(PyExc_TypeError, "UICollection.remove requires an integer index to remove");
return NULL;
}
long index = PyLong_AsLong(o);
if (index >= self->data->size())
{
PyErr_SetString(PyExc_ValueError, "Index out of range");
return NULL;
}
else if (index < 0)
{
PyErr_SetString(PyExc_NotImplementedError, "reverse indexing is not implemented.");
return NULL;
}
// release the shared pointer at self->data[index];
self->data->erase(self->data->begin() + index);
Py_INCREF(Py_None);
return Py_None;
}
PyMethodDef UICollection::methods[] = {
{"append", (PyCFunction)UICollection::append, METH_O},
//{"extend", (PyCFunction)PyUICollection_extend, METH_O}, // TODO
{"remove", (PyCFunction)UICollection::remove, METH_O},
{NULL, NULL, 0, NULL}
};
PyObject* UICollection::repr(PyUICollectionObject* self)
{
std::ostringstream ss;
if (!self->data) ss << "<UICollection (invalid internal object)>";
else {
ss << "<UICollection (" << self->data->size() << " child objects)>";
}
std::string repr_str = ss.str();
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
}
int UICollection::init(PyUICollectionObject* self, PyObject* args, PyObject* kwds)
{
PyErr_SetString(PyExc_TypeError, "UICollection cannot be instantiated: a C++ data source is required.");
return -1;
}
PyObject* UICollection::iter(PyUICollectionObject* self)
{
PyUICollectionIterObject* iterObj;
iterObj = (PyUICollectionIterObject*)PyUICollectionIterType.tp_alloc(&PyUICollectionIterType, 0);
if (iterObj == NULL) {
return NULL; // Failed to allocate memory for the iterator object
}
iterObj->data = self->data;
iterObj->index = 0;
iterObj->start_size = self->data->size();
return (PyObject*)iterObj;
}

View File

@ -1,88 +0,0 @@
#pragma once
#include "Common.h"
#include "Python.h"
#include "UIDrawable.h"
class UICollectionIter
{
// really more of a namespace: all the members are public and static. But being consistent with other UI objects
public:
static int init(PyUICollectionIterObject* self, PyObject* args, PyObject* kwds);
static PyObject* next(PyUICollectionIterObject* self);
static PyObject* repr(PyUICollectionIterObject* self);
};
class UICollection
{
// really more of a namespace: all the members are public and static. But being consistent with other UI objects
public:
static Py_ssize_t len(PyUICollectionObject* self);
static PyObject* getitem(PyUICollectionObject* self, Py_ssize_t index);
static PySequenceMethods sqmethods;
static PyObject* append(PyUICollectionObject* self, PyObject* o);
static PyObject* remove(PyUICollectionObject* self, PyObject* o);
static PyMethodDef methods[];
static PyObject* repr(PyUICollectionObject* self);
static int init(PyUICollectionObject* self, PyObject* args, PyObject* kwds);
static PyObject* iter(PyUICollectionObject* self);
};
namespace mcrfpydef {
static PyTypeObject PyUICollectionIterType = {
//PyVarObject_HEAD_INIT(NULL, 0)
.tp_name = "mcrfpy.UICollectionIter",
.tp_basicsize = sizeof(PyUICollectionIterObject),
.tp_itemsize = 0,
//TODO - as static method, not inline lambda def, please
.tp_dealloc = (destructor)[](PyObject* self)
{
PyUICollectionIterObject* obj = (PyUICollectionIterObject*)self;
obj->data.reset();
Py_TYPE(self)->tp_free(self);
},
.tp_repr = (reprfunc)UICollectionIter::repr,
.tp_flags = Py_TPFLAGS_DEFAULT,
.tp_doc = PyDoc_STR("Iterator for a collection of UI objects"),
.tp_iternext = (iternextfunc)UICollectionIter::next,
//.tp_getset = PyUICollection_getset,
.tp_init = (initproc)UICollectionIter::init, // just raise an exception
//TODO - as static method, not inline lambda def, please
.tp_new = [](PyTypeObject* type, PyObject* args, PyObject* kwds) -> PyObject*
{
PyErr_SetString(PyExc_TypeError, "UICollection cannot be instantiated: a C++ data source is required.");
return NULL;
}
};
static PyTypeObject PyUICollectionType = {
//PyVarObject_/HEAD_INIT(NULL, 0)
.tp_name = "mcrfpy.UICollection",
.tp_basicsize = sizeof(PyUICollectionObject),
.tp_itemsize = 0,
//TODO - as static method, not inline lambda def, please
.tp_dealloc = (destructor)[](PyObject* self)
{
PyUICollectionObject* obj = (PyUICollectionObject*)self;
obj->data.reset();
Py_TYPE(self)->tp_free(self);
},
.tp_repr = (reprfunc)UICollection::repr,
.tp_as_sequence = &UICollection::sqmethods,
.tp_flags = Py_TPFLAGS_DEFAULT,
.tp_doc = PyDoc_STR("Iterable, indexable collection of UI objects"),
.tp_iter = (getiterfunc)UICollection::iter,
.tp_methods = UICollection::methods, // append, remove
//.tp_getset = PyUICollection_getset,
.tp_init = (initproc)UICollection::init, // just raise an exception
//TODO - as static method, not inline lambda def, please
.tp_new = [](PyTypeObject* type, PyObject* args, PyObject* kwds) -> PyObject*
{
// Does PyUICollectionType need __new__ if it's not supposed to be instantiable by the user?
// Should I just raise an exception? Or is the uninitialized shared_ptr enough of a blocker?
PyErr_SetString(PyExc_TypeError, "UICollection cannot be instantiated: a C++ data source is required.");
return NULL;
}
};
}

View File

@ -1,82 +0,0 @@
#include "UIDrawable.h"
#include "UIFrame.h"
#include "UICaption.h"
#include "UISprite.h"
#include "UIGrid.h"
#include "GameEngine.h"
UIDrawable::UIDrawable() { click_callable = NULL; }
void UIDrawable::click_unregister()
{
click_callable.reset();
}
void UIDrawable::render()
{
render(sf::Vector2f(), Resources::game->getWindow());
}
PyObject* UIDrawable::get_click(PyObject* self, void* closure) {
PyObjectsEnum objtype = static_cast<PyObjectsEnum>(reinterpret_cast<long>(closure)); // trust me bro, it's an Enum
PyObject* ptr;
switch (objtype)
{
case PyObjectsEnum::UIFRAME:
ptr = ((PyUIFrameObject*)self)->data->click_callable->borrow();
break;
case PyObjectsEnum::UICAPTION:
ptr = ((PyUICaptionObject*)self)->data->click_callable->borrow();
break;
case PyObjectsEnum::UISPRITE:
ptr = ((PyUISpriteObject*)self)->data->click_callable->borrow();
break;
case PyObjectsEnum::UIGRID:
ptr = ((PyUIGridObject*)self)->data->click_callable->borrow();
break;
default:
PyErr_SetString(PyExc_TypeError, "no idea how you did that; invalid UIDrawable derived instance for _get_click");
return NULL;
}
if (ptr && ptr != Py_None)
return ptr;
else
return Py_None;
}
int UIDrawable::set_click(PyObject* self, PyObject* value, void* closure) {
PyObjectsEnum objtype = static_cast<PyObjectsEnum>(reinterpret_cast<long>(closure)); // trust me bro, it's an Enum
UIDrawable* target;
switch (objtype)
{
case PyObjectsEnum::UIFRAME:
target = (((PyUIFrameObject*)self)->data.get());
break;
case PyObjectsEnum::UICAPTION:
target = (((PyUICaptionObject*)self)->data.get());
break;
case PyObjectsEnum::UISPRITE:
target = (((PyUISpriteObject*)self)->data.get());
break;
case PyObjectsEnum::UIGRID:
target = (((PyUIGridObject*)self)->data.get());
break;
default:
PyErr_SetString(PyExc_TypeError, "no idea how you did that; invalid UIDrawable derived instance for _set_click");
return -1;
}
if (value == Py_None)
{
target->click_unregister();
} else {
target->click_register(value);
}
return 0;
}
void UIDrawable::click_register(PyObject* callable)
{
click_callable = std::make_unique<PyClickCallable>(callable);
}

View File

@ -1,177 +0,0 @@
#pragma once
#include "Common.h"
#include "Python.h"
#include "structmember.h"
#include "IndexTexture.h"
#include "Resources.h"
#include <list>
#include "PyCallable.h"
#include "PyTexture.h"
#include "PyColor.h"
#include "PyVector.h"
#include "PyFont.h"
#include "Resources.h"
#include "UIBase.h"
class UIFrame; class UICaption; class UISprite; class UIEntity; class UIGrid;
enum PyObjectsEnum : int
{
UIFRAME = 1,
UICAPTION,
UISPRITE,
UIGRID
};
class UIDrawable
{
public:
void render();
//virtual void render(sf::Vector2f) = 0;
virtual void render(sf::Vector2f, sf::RenderTarget&) = 0;
virtual PyObjectsEnum derived_type() = 0;
// Mouse input handling - callable object, methods to find event's destination
std::unique_ptr<PyClickCallable> click_callable;
virtual UIDrawable* click_at(sf::Vector2f point) = 0;
void click_register(PyObject*);
void click_unregister();
UIDrawable();
static PyObject* get_click(PyObject* self, void* closure);
static int set_click(PyObject* self, PyObject* value, void* closure);
};
typedef struct {
PyObject_HEAD
std::shared_ptr<std::vector<std::shared_ptr<UIDrawable>>> data;
} PyUICollectionObject;
typedef struct {
PyObject_HEAD
std::shared_ptr<std::vector<std::shared_ptr<UIDrawable>>> data;
int index;
int start_size;
} PyUICollectionIterObject;
namespace mcrfpydef {
//PyObject* py_instance(std::shared_ptr<UIDrawable> source);
// This function segfaults on tp_alloc for an unknown reason, but works inline with mcrfpydef:: methods.
#define RET_PY_INSTANCE(target) { \
switch (target->derived_type()) \
{ \
case PyObjectsEnum::UIFRAME: \
{ \
PyUIFrameObject* o = (PyUIFrameObject*)((&PyUIFrameType)->tp_alloc(&PyUIFrameType, 0)); \
if (o) \
{ \
auto p = std::static_pointer_cast<UIFrame>(target); \
o->data = p; \
auto utarget = o->data; \
} \
return (PyObject*)o; \
} \
case PyObjectsEnum::UICAPTION: \
{ \
PyUICaptionObject* o = (PyUICaptionObject*)((&PyUICaptionType)->tp_alloc(&PyUICaptionType, 0)); \
if (o) \
{ \
auto p = std::static_pointer_cast<UICaption>(target); \
o->data = p; \
auto utarget = o->data; \
} \
return (PyObject*)o; \
} \
case PyObjectsEnum::UISPRITE: \
{ \
PyUISpriteObject* o = (PyUISpriteObject*)((&PyUISpriteType)->tp_alloc(&PyUISpriteType, 0)); \
if (o) \
{ \
auto p = std::static_pointer_cast<UISprite>(target); \
o->data = p; \
auto utarget = o->data; \
} \
return (PyObject*)o; \
} \
case PyObjectsEnum::UIGRID: \
{ \
PyUIGridObject* o = (PyUIGridObject*)((&PyUIGridType)->tp_alloc(&PyUIGridType, 0)); \
if (o) \
{ \
auto p = std::static_pointer_cast<UIGrid>(target); \
o->data = p; \
auto utarget = o->data; \
} \
return (PyObject*)o; \
} \
} \
}
// end macro definition
//TODO: add this method to class scope; move implementation to .cpp file
/*
static PyObject* PyUIDrawable_get_click(PyObject* self, void* closure) {
PyObjectsEnum objtype = static_cast<PyObjectsEnum>(reinterpret_cast<long>(closure)); // trust me bro, it's an Enum
PyObject* ptr;
switch (objtype)
{
case PyObjectsEnum::UIFRAME:
ptr = ((PyUIFrameObject*)self)->data->click_callable->borrow();
break;
case PyObjectsEnum::UICAPTION:
ptr = ((PyUICaptionObject*)self)->data->click_callable->borrow();
break;
case PyObjectsEnum::UISPRITE:
ptr = ((PyUISpriteObject*)self)->data->click_callable->borrow();
break;
case PyObjectsEnum::UIGRID:
ptr = ((PyUIGridObject*)self)->data->click_callable->borrow();
break;
default:
PyErr_SetString(PyExc_TypeError, "no idea how you did that; invalid UIDrawable derived instance for _get_click");
return NULL;
}
if (ptr && ptr != Py_None)
return ptr;
else
return Py_None;
}*/
//TODO: add this method to class scope; move implementation to .cpp file
/*
static int PyUIDrawable_set_click(PyObject* self, PyObject* value, void* closure) {
PyObjectsEnum objtype = static_cast<PyObjectsEnum>(reinterpret_cast<long>(closure)); // trust me bro, it's an Enum
UIDrawable* target;
switch (objtype)
{
case PyObjectsEnum::UIFRAME:
target = (((PyUIFrameObject*)self)->data.get());
break;
case PyObjectsEnum::UICAPTION:
target = (((PyUICaptionObject*)self)->data.get());
break;
case PyObjectsEnum::UISPRITE:
target = (((PyUISpriteObject*)self)->data.get());
break;
case PyObjectsEnum::UIGRID:
target = (((PyUIGridObject*)self)->data.get());
break;
default:
PyErr_SetString(PyExc_TypeError, "no idea how you did that; invalid UIDrawable derived instance for _set_click");
return -1;
}
if (value == Py_None)
{
target->click_unregister();
} else {
target->click_register(value);
}
return 0;
}
*/
}

View File

@ -1,210 +0,0 @@
#include "UIEntity.h"
#include "UIGrid.h"
#include "McRFPy_API.h"
UIEntity::UIEntity() {} // this will not work lol. TODO remove default constructor by finding the shared pointer inits that use it
UIEntity::UIEntity(UIGrid& grid)
: gridstate(grid.grid_x * grid.grid_y)
{
}
PyObject* UIEntity::at(PyUIEntityObject* self, PyObject* o) {
int x, y;
if (!PyArg_ParseTuple(o, "ii", &x, &y)) {
PyErr_SetString(PyExc_TypeError, "UIEntity.at requires two integer arguments: (x, y)");
return NULL;
}
if (self->data->grid == NULL) {
PyErr_SetString(PyExc_ValueError, "Entity cannot access surroundings because it is not associated with a grid");
return NULL;
}
/*
PyUIGridPointStateObject* obj = (PyUIGridPointStateObject*)((&mcrfpydef::PyUIGridPointStateType)->tp_alloc(&mcrfpydef::PyUIGridPointStateType, 0));
*/
auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "GridPointState");
auto obj = (PyUIGridPointStateObject*)type->tp_alloc(type, 0);
//auto target = std::static_pointer_cast<UIEntity>(target);
obj->data = &(self->data->gridstate[y + self->data->grid->grid_x * x]);
obj->grid = self->data->grid;
obj->entity = self->data;
return (PyObject*)obj;
}
int UIEntity::init(PyUIEntityObject* self, PyObject* args, PyObject* kwds) {
//static const char* keywords[] = { "x", "y", "texture", "sprite_index", "grid", nullptr };
//float x = 0.0f, y = 0.0f, scale = 1.0f;
static const char* keywords[] = { "pos", "texture", "sprite_index", "grid", nullptr };
PyObject* pos;
float scale = 1.0f;
int sprite_index = -1;
PyObject* texture = NULL;
PyObject* grid = NULL;
//if (!PyArg_ParseTupleAndKeywords(args, kwds, "ffOi|O",
// const_cast<char**>(keywords), &x, &y, &texture, &sprite_index, &grid))
if (!PyArg_ParseTupleAndKeywords(args, kwds, "OOi|O",
const_cast<char**>(keywords), &pos, &texture, &sprite_index, &grid))
{
return -1;
}
PyVectorObject* pos_result = PyVector::from_arg(pos);
if (!pos_result)
{
PyErr_SetString(PyExc_TypeError, "pos must be a mcrfpy.Vector instance or arguments to mcrfpy.Vector.__init__");
return -1;
}
// check types for texture
//
// Set Texture
//
if (texture != NULL && !PyObject_IsInstance(texture, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Texture"))){
PyErr_SetString(PyExc_TypeError, "texture must be a mcrfpy.Texture instance");
return -1;
} /*else if (texture != NULL) // this section needs to go; texture isn't optional and isn't managed by the UI objects anymore
{
self->texture = texture;
Py_INCREF(texture);
} else
{
// default tex?
}*/
if (grid != NULL && !PyObject_IsInstance(grid, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Grid"))) {
PyErr_SetString(PyExc_TypeError, "grid must be a mcrfpy.Grid instance");
return -1;
}
auto pytexture = (PyTextureObject*)texture;
if (grid == NULL)
self->data = std::make_shared<UIEntity>();
else
self->data = std::make_shared<UIEntity>(*((PyUIGridObject*)grid)->data);
// TODO - PyTextureObjects and IndexTextures are a little bit of a mess with shared/unshared pointers
self->data->sprite = UISprite(pytexture->data, sprite_index, sf::Vector2f(0,0), 1.0);
self->data->position = pos_result->data;
if (grid != NULL) {
PyUIGridObject* pygrid = (PyUIGridObject*)grid;
self->data->grid = pygrid->data;
// todone - on creation of Entity with Grid assignment, also append it to the entity list
pygrid->data->entities->push_back(self->data);
}
return 0;
}
PyObject* UIEntity::get_spritenumber(PyUIEntityObject* self, void* closure) {
return PyLong_FromDouble(self->data->sprite.getSpriteIndex());
}
PyObject* sfVector2f_to_PyObject(sf::Vector2f vector) {
return Py_BuildValue("(ff)", vector.x, vector.y);
}
PyObject* sfVector2i_to_PyObject(sf::Vector2i vector) {
return Py_BuildValue("(ii)", vector.x, vector.y);
}
sf::Vector2f PyObject_to_sfVector2f(PyObject* obj) {
float x, y;
if (!PyArg_ParseTuple(obj, "ff", &x, &y)) {
return sf::Vector2f(); // TODO / reconsider this default: Return default vector on parse error
}
return sf::Vector2f(x, y);
}
sf::Vector2i PyObject_to_sfVector2i(PyObject* obj) {
int x, y;
if (!PyArg_ParseTuple(obj, "ii", &x, &y)) {
return sf::Vector2i(); // TODO / reconsider this default: Return default vector on parse error
}
return sf::Vector2i(x, y);
}
// TODO - deprecate / remove this helper
PyObject* UIGridPointState_to_PyObject(const UIGridPointState& state) {
return PyObject_New(PyObject, (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "GridPointState"));
}
PyObject* UIGridPointStateVector_to_PyList(const std::vector<UIGridPointState>& vec) {
PyObject* list = PyList_New(vec.size());
if (!list) return PyErr_NoMemory();
for (size_t i = 0; i < vec.size(); ++i) {
PyObject* obj = UIGridPointState_to_PyObject(vec[i]);
if (!obj) { // Cleanup on failure
Py_DECREF(list);
return NULL;
}
PyList_SET_ITEM(list, i, obj); // This steals a reference to obj
}
return list;
}
PyObject* UIEntity::get_position(PyUIEntityObject* self, void* closure) {
if (reinterpret_cast<long>(closure) == 0) {
return sfVector2f_to_PyObject(self->data->position);
} else {
return sfVector2i_to_PyObject(self->data->collision_pos);
}
}
int UIEntity::set_position(PyUIEntityObject* self, PyObject* value, void* closure) {
if (reinterpret_cast<long>(closure) == 0) {
self->data->position = PyObject_to_sfVector2f(value);
} else {
self->data->collision_pos = PyObject_to_sfVector2i(value);
}
return 0;
}
PyObject* UIEntity::get_gridstate(PyUIEntityObject* self, void* closure) {
// Assuming a function to convert std::vector<UIGridPointState> to PyObject* list
return UIGridPointStateVector_to_PyList(self->data->gridstate);
}
int UIEntity::set_spritenumber(PyUIEntityObject* self, PyObject* value, void* closure) {
int val;
if (PyLong_Check(value))
val = PyLong_AsLong(value);
else
{
PyErr_SetString(PyExc_TypeError, "Value must be an integer.");
return -1;
}
//self->data->sprite.sprite_index = val;
self->data->sprite.setSpriteIndex(val); // todone - I don't like ".sprite.sprite" in this stack of UIEntity.UISprite.sf::Sprite
return 0;
}
PyMethodDef UIEntity::methods[] = {
{"at", (PyCFunction)UIEntity::at, METH_O},
{NULL, NULL, 0, NULL}
};
PyGetSetDef UIEntity::getsetters[] = {
{"draw_pos", (getter)UIEntity::get_position, (setter)UIEntity::set_position, "Entity position (graphically)", (void*)0},
{"pos", (getter)UIEntity::get_position, (setter)UIEntity::set_position, "Entity position (integer grid coordinates)", (void*)1},
{"gridstate", (getter)UIEntity::get_gridstate, NULL, "Grid point states for the entity", NULL},
{"sprite_number", (getter)UIEntity::get_spritenumber, (setter)UIEntity::set_spritenumber, "Sprite number (index) on the texture on the display", NULL},
{NULL} /* Sentinel */
};
PyObject* UIEntity::repr(PyUIEntityObject* self) {
std::ostringstream ss;
if (!self->data) ss << "<Entity (invalid internal object)>";
else {
auto ent = self->data;
ss << "<Entity (x=" << self->data->position.x << ", y=" << self->data->position.y << ", sprite_number=" << self->data->sprite.getSpriteIndex() <<
")>";
}
std::string repr_str = ss.str();
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
}

View File

@ -1,76 +0,0 @@
#pragma once
#include "Common.h"
#include "Python.h"
#include "structmember.h"
#include "IndexTexture.h"
#include "Resources.h"
#include <list>
#include "PyCallable.h"
#include "PyTexture.h"
#include "PyColor.h"
#include "PyVector.h"
#include "PyFont.h"
#include "UIGridPoint.h"
#include "UIDrawable.h"
#include "UIBase.h"
#include "UISprite.h"
class UIGrid;
//class UIEntity;
//typedef struct {
// PyObject_HEAD
// std::shared_ptr<UIEntity> data;
//} PyUIEntityObject;
// helper methods with no namespace requirement
static PyObject* sfVector2f_to_PyObject(sf::Vector2f vector);
static sf::Vector2f PyObject_to_sfVector2f(PyObject* obj);
static PyObject* UIGridPointState_to_PyObject(const UIGridPointState& state);
static PyObject* UIGridPointStateVector_to_PyList(const std::vector<UIGridPointState>& vec);
// TODO: make UIEntity a drawable
class UIEntity//: public UIDrawable
{
public:
//PyObject* self;
std::shared_ptr<UIGrid> grid;
std::vector<UIGridPointState> gridstate;
UISprite sprite;
sf::Vector2f position; //(x,y) in grid coordinates; float for animation
sf::Vector2i collision_pos; //(x, y) in grid coordinates: int for collision
//void render(sf::Vector2f); //override final;
UIEntity();
UIEntity(UIGrid&);
static PyObject* at(PyUIEntityObject* self, PyObject* o);
static int init(PyUIEntityObject* self, PyObject* args, PyObject* kwds);
static PyObject* get_position(PyUIEntityObject* self, void* closure);
static int set_position(PyUIEntityObject* self, PyObject* value, void* closure);
static PyObject* get_gridstate(PyUIEntityObject* self, void* closure);
static PyObject* get_spritenumber(PyUIEntityObject* self, void* closure);
static int set_spritenumber(PyUIEntityObject* self, PyObject* value, void* closure);
static PyMethodDef methods[];
static PyGetSetDef getsetters[];
static PyObject* repr(PyUIEntityObject* self);
};
namespace mcrfpydef {
static PyTypeObject PyUIEntityType = {
//PyVarObject_HEAD_INIT(NULL, 0)
.tp_name = "mcrfpy.Entity",
.tp_basicsize = sizeof(PyUIEntityObject),
.tp_itemsize = 0,
.tp_repr = (reprfunc)UIEntity::repr,
.tp_flags = Py_TPFLAGS_DEFAULT | Py_TPFLAGS_BASETYPE,
.tp_doc = "UIEntity objects",
.tp_methods = UIEntity::methods,
.tp_getset = UIEntity::getsetters,
.tp_init = (initproc)UIEntity::init,
.tp_new = PyType_GenericNew,
};
}

View File

@ -1,266 +0,0 @@
#include "UIFrame.h"
#include "UICollection.h"
#include "GameEngine.h"
UIDrawable* UIFrame::click_at(sf::Vector2f point)
{
for (auto e: *children)
{
auto p = e->click_at(point + box.getPosition());
if (p)
return p;
}
if (click_callable)
{
float x = box.getPosition().x, y = box.getPosition().y, w = box.getSize().x, h = box.getSize().y;
if (point.x > x && point.y > y && point.x < x+w && point.y < y+h) return this;
}
return NULL;
}
UIFrame::UIFrame()
: outline(0)
{
children = std::make_shared<std::vector<std::shared_ptr<UIDrawable>>>();
box.setPosition(0, 0);
box.setSize(sf::Vector2f(0, 0));
}
UIFrame::UIFrame(float _x, float _y, float _w, float _h)
: outline(0)
{
box.setPosition(_x, _y);
box.setSize(sf::Vector2f(_w, _h));
children = std::make_shared<std::vector<std::shared_ptr<UIDrawable>>>();
}
UIFrame::~UIFrame()
{
children.reset();
}
PyObjectsEnum UIFrame::derived_type()
{
return PyObjectsEnum::UIFRAME;
}
void UIFrame::render(sf::Vector2f offset, sf::RenderTarget& target)
{
box.move(offset);
//Resources::game->getWindow().draw(box);
target.draw(box);
box.move(-offset);
for (auto drawable : *children) {
drawable->render(offset + box.getPosition(), target);
}
}
PyObject* UIFrame::get_children(PyUIFrameObject* self, void* closure)
{
// create PyUICollection instance pointing to self->data->children
//PyUICollectionObject* o = (PyUICollectionObject*)mcrfpydef::PyUICollectionType.tp_alloc(&mcrfpydef::PyUICollectionType, 0);
auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "UICollection");
auto o = (PyUICollectionObject*)type->tp_alloc(type, 0);
if (o)
o->data = self->data->children;
return (PyObject*)o;
}
PyObject* UIFrame::get_float_member(PyUIFrameObject* self, void* closure)
{
auto member_ptr = reinterpret_cast<long>(closure);
if (member_ptr == 0)
return PyFloat_FromDouble(self->data->box.getPosition().x);
else if (member_ptr == 1)
return PyFloat_FromDouble(self->data->box.getPosition().y);
else if (member_ptr == 2)
return PyFloat_FromDouble(self->data->box.getSize().x);
else if (member_ptr == 3)
return PyFloat_FromDouble(self->data->box.getSize().y);
else if (member_ptr == 4)
return PyFloat_FromDouble(self->data->box.getOutlineThickness());
else
{
PyErr_SetString(PyExc_AttributeError, "Invalid attribute");
return nullptr;
}
}
int UIFrame::set_float_member(PyUIFrameObject* self, PyObject* value, void* closure)
{
float val;
auto member_ptr = reinterpret_cast<long>(closure);
if (PyFloat_Check(value))
{
val = PyFloat_AsDouble(value);
}
else if (PyLong_Check(value))
{
val = PyLong_AsLong(value);
}
else
{
PyErr_SetString(PyExc_TypeError, "Value must be an integer.");
return -1;
}
if (member_ptr == 0) //x
self->data->box.setPosition(val, self->data->box.getPosition().y);
else if (member_ptr == 1) //y
self->data->box.setPosition(self->data->box.getPosition().x, val);
else if (member_ptr == 2) //w
self->data->box.setSize(sf::Vector2f(val, self->data->box.getSize().y));
else if (member_ptr == 3) //h
self->data->box.setSize(sf::Vector2f(self->data->box.getSize().x, val));
else if (member_ptr == 4) //outline
self->data->box.setOutlineThickness(val);
return 0;
}
PyObject* UIFrame::get_color_member(PyUIFrameObject* self, void* closure)
{
// validate closure (should be impossible to be wrong, but it's thorough)
auto member_ptr = reinterpret_cast<long>(closure);
if (member_ptr != 0 && member_ptr != 1)
{
PyErr_SetString(PyExc_AttributeError, "Invalid attribute");
return nullptr;
}
//PyTypeObject* colorType = &PyColorType;
auto colorType = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "Color");
PyObject* pyColor = colorType->tp_alloc(colorType, 0);
if (pyColor == NULL)
{
std::cout << "failure to allocate mcrfpy.Color / PyColorType" << std::endl;
return NULL;
}
PyColorObject* pyColorObj = reinterpret_cast<PyColorObject*>(pyColor);
// fetch correct member data
sf::Color color;
if (member_ptr == 0)
{
color = self->data->box.getFillColor();
//return Py_BuildValue("(iii)", color.r, color.g, color.b);
}
else if (member_ptr == 1)
{
color = self->data->box.getOutlineColor();
//return Py_BuildValue("(iii)", color.r, color.g, color.b);
}
return PyColor(color).pyObject();
}
int UIFrame::set_color_member(PyUIFrameObject* self, PyObject* value, void* closure)
{
//TODO: this logic of (PyColor instance OR tuple -> sf::color) should be encapsulated for reuse
auto member_ptr = reinterpret_cast<long>(closure);
int r, g, b, a;
if (PyObject_IsInstance(value, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Color")))
{
sf::Color c = ((PyColorObject*)value)->data;
r = c.r; g = c.g; b = c.b; a = c.a;
}
else if (!PyTuple_Check(value) || PyTuple_Size(value) < 3 || PyTuple_Size(value) > 4)
{
// reject non-Color, non-tuple value
PyErr_SetString(PyExc_TypeError, "Value must be a tuple of 3 or 4 integers or an mcrfpy.Color object.");
return -1;
}
else // get value from tuples
{
r = PyLong_AsLong(PyTuple_GetItem(value, 0));
g = PyLong_AsLong(PyTuple_GetItem(value, 1));
b = PyLong_AsLong(PyTuple_GetItem(value, 2));
a = 255;
if (PyTuple_Size(value) == 4)
{
a = PyLong_AsLong(PyTuple_GetItem(value, 3));
}
}
if (r < 0 || r > 255 || g < 0 || g > 255 || b < 0 || b > 255 || a < 0 || a > 255)
{
PyErr_SetString(PyExc_ValueError, "Color values must be between 0 and 255.");
return -1;
}
if (member_ptr == 0)
{
self->data->box.setFillColor(sf::Color(r, g, b, a));
}
else if (member_ptr == 1)
{
self->data->box.setOutlineColor(sf::Color(r, g, b, a));
}
else
{
PyErr_SetString(PyExc_AttributeError, "Invalid attribute");
return -1;
}
return 0;
}
PyGetSetDef UIFrame::getsetters[] = {
{"x", (getter)UIFrame::get_float_member, (setter)UIFrame::set_float_member, "X coordinate of top-left corner", (void*)0},
{"y", (getter)UIFrame::get_float_member, (setter)UIFrame::set_float_member, "Y coordinate of top-left corner", (void*)1},
{"w", (getter)UIFrame::get_float_member, (setter)UIFrame::set_float_member, "width of the rectangle", (void*)2},
{"h", (getter)UIFrame::get_float_member, (setter)UIFrame::set_float_member, "height of the rectangle", (void*)3},
{"outline", (getter)UIFrame::get_float_member, (setter)UIFrame::set_float_member, "Thickness of the border", (void*)4},
{"fill_color", (getter)UIFrame::get_color_member, (setter)UIFrame::set_color_member, "Fill color of the rectangle", (void*)0},
{"outline_color", (getter)UIFrame::get_color_member, (setter)UIFrame::set_color_member, "Outline color of the rectangle", (void*)1},
{"children", (getter)UIFrame::get_children, NULL, "UICollection of objects on top of this one", NULL},
{"click", (getter)UIDrawable::get_click, (setter)UIDrawable::set_click, "Object called with (x, y, button) when clicked", (void*)PyObjectsEnum::UIFRAME},
{NULL}
};
PyObject* UIFrame::repr(PyUIFrameObject* self)
{
std::ostringstream ss;
if (!self->data) ss << "<Frame (invalid internal object)>";
else {
auto box = self->data->box;
auto fc = box.getFillColor();
auto oc = box.getOutlineColor();
ss << "<Frame (x=" << box.getPosition().x << ", y=" << box.getPosition().y << ", w=" <<
box.getSize().x << ", w=" << box.getSize().y << ", " <<
"outline=" << box.getOutlineThickness() << ", " <<
"fill_color=(" << (int)fc.r << ", " << (int)fc.g << ", " << (int)fc.b << ", " << (int)fc.a <<"), " <<
"outline_color=(" << (int)oc.r << ", " << (int)oc.g << ", " << (int)oc.b << ", " << (int)oc.a <<"), " <<
self->data->children->size() << " child objects" <<
")>";
}
std::string repr_str = ss.str();
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
}
int UIFrame::init(PyUIFrameObject* self, PyObject* args, PyObject* kwds)
{
//std::cout << "Init called\n";
const char* keywords[] = { "x", "y", "w", "h", "fill_color", "outline_color", "outline", nullptr };
float x = 0.0f, y = 0.0f, w = 0.0f, h=0.0f, outline=0.0f;
PyObject* fill_color = 0;
PyObject* outline_color = 0;
if (!PyArg_ParseTupleAndKeywords(args, kwds, "ffff|OOf", const_cast<char**>(keywords), &x, &y, &w, &h, &fill_color, &outline_color, &outline))
{
return -1;
}
self->data->box.setPosition(sf::Vector2f(x, y));
self->data->box.setSize(sf::Vector2f(w, h));
self->data->box.setOutlineThickness(outline);
// getsetter abuse because I haven't standardized Color object parsing (TODO)
int err_val = 0;
if (fill_color && fill_color != Py_None) err_val = UIFrame::set_color_member(self, fill_color, (void*)0);
else self->data->box.setFillColor(sf::Color(0,0,0,255));
if (err_val) return err_val;
if (outline_color && outline_color != Py_None) err_val = UIFrame::set_color_member(self, outline_color, (void*)1);
else self->data->box.setOutlineColor(sf::Color(128,128,128,255));
if (err_val) return err_val;
return 0;
}

View File

@ -1,77 +0,0 @@
#pragma once
#include "Common.h"
#include "Python.h"
#include "structmember.h"
#include "IndexTexture.h"
#include "Resources.h"
#include <list>
#include "PyCallable.h"
#include "PyColor.h"
#include "PyVector.h"
#include "UIDrawable.h"
#include "UIBase.h"
//class UIFrame;
//
//typedef struct {
// PyObject_HEAD
// std::shared_ptr<UIFrame> data;
//} PyUIFrameObject;
class UIFrame: public UIDrawable
{
public:
UIFrame(float, float, float, float);
UIFrame();
~UIFrame();
sf::RectangleShape box;
float outline;
std::shared_ptr<std::vector<std::shared_ptr<UIDrawable>>> children;
void render(sf::Vector2f, sf::RenderTarget&) override final;
void move(sf::Vector2f);
PyObjectsEnum derived_type() override final;
virtual UIDrawable* click_at(sf::Vector2f point) override final;
static PyObject* get_children(PyUIFrameObject* self, void* closure);
static PyObject* get_float_member(PyUIFrameObject* self, void* closure);
static int set_float_member(PyUIFrameObject* self, PyObject* value, void* closure);
static PyObject* get_color_member(PyUIFrameObject* self, void* closure);
static int set_color_member(PyUIFrameObject* self, PyObject* value, void* closure);
static PyGetSetDef getsetters[];
static PyObject* repr(PyUIFrameObject* self);
static int init(PyUIFrameObject* self, PyObject* args, PyObject* kwds);
};
namespace mcrfpydef {
static PyTypeObject PyUIFrameType = {
//PyVarObject_HEAD_INIT(NULL, 0)
.tp_name = "mcrfpy.Frame",
.tp_basicsize = sizeof(PyUIFrameObject),
.tp_itemsize = 0,
.tp_dealloc = (destructor)[](PyObject* self)
{
PyUIFrameObject* obj = (PyUIFrameObject*)self;
obj->data.reset();
Py_TYPE(self)->tp_free(self);
},
.tp_repr = (reprfunc)UIFrame::repr,
//.tp_hash = NULL,
//.tp_iter
//.tp_iternext
.tp_flags = Py_TPFLAGS_DEFAULT,
.tp_doc = PyDoc_STR("docstring"),
//.tp_methods = PyUIFrame_methods,
//.tp_members = PyUIFrame_members,
.tp_getset = UIFrame::getsetters,
//.tp_base = NULL,
.tp_init = (initproc)UIFrame::init,
.tp_new = [](PyTypeObject* type, PyObject* args, PyObject* kwds) -> PyObject*
{
PyUIFrameObject* self = (PyUIFrameObject*)type->tp_alloc(type, 0);
if (self) self->data = std::make_shared<UIFrame>();
return (PyObject*)self;
}
};
}

View File

@ -1,641 +0,0 @@
#include "UIGrid.h"
#include "GameEngine.h"
#include "McRFPy_API.h"
UIGrid::UIGrid() {}
UIGrid::UIGrid(int gx, int gy, std::shared_ptr<PyTexture> _ptex, sf::Vector2f _xy, sf::Vector2f _wh)
: grid_x(gx), grid_y(gy),
zoom(1.0f), center_x((gx/2) * _ptex->sprite_width), center_y((gy/2) * _ptex->sprite_height),
ptex(_ptex), points(gx * gy)
{
entities = std::make_shared<std::list<std::shared_ptr<UIEntity>>>();
box.setSize(_wh);
box.setPosition(_xy);
box.setFillColor(sf::Color(0,0,0,0));
// create renderTexture with maximum theoretical size; sprite can resize to show whatever amount needs to be rendered
renderTexture.create(1920, 1080); // TODO - renderTexture should be window size; above 1080p this will cause rendering errors
sprite = ptex->sprite(0);
output.setTextureRect(
sf::IntRect(0, 0,
box.getSize().x, box.getSize().y));
output.setPosition(box.getPosition());
// textures are upside-down inside renderTexture
output.setTexture(renderTexture.getTexture());
}
void UIGrid::update() {}
void UIGrid::render(sf::Vector2f offset, sf::RenderTarget& target)
{
output.setPosition(box.getPosition() + offset); // output sprite can move; update position when drawing
// output size can change; update size when drawing
output.setTextureRect(
sf::IntRect(0, 0,
box.getSize().x, box.getSize().y));
renderTexture.clear(sf::Color(8, 8, 8, 255)); // TODO - UIGrid needs a "background color" field
// sprites that are visible according to zoom, center_x, center_y, and box width
float center_x_sq = center_x / ptex->sprite_width;
float center_y_sq = center_y / ptex->sprite_height;
float width_sq = box.getSize().x / (ptex->sprite_width * zoom);
float height_sq = box.getSize().y / (ptex->sprite_height * zoom);
float left_edge = center_x_sq - (width_sq / 2.0);
float top_edge = center_y_sq - (height_sq / 2.0);
int left_spritepixels = center_x - (box.getSize().x / 2.0 / zoom);
int top_spritepixels = center_y - (box.getSize().y / 2.0 / zoom);
//sprite.setScale(sf::Vector2f(zoom, zoom));
sf::RectangleShape r; // for colors and overlays
r.setSize(sf::Vector2f(ptex->sprite_width * zoom, ptex->sprite_height * zoom));
r.setOutlineThickness(0);
int x_limit = left_edge + width_sq + 2;
if (x_limit > grid_x) x_limit = grid_x;
int y_limit = top_edge + height_sq + 2;
if (y_limit > grid_y) y_limit = grid_y;
// base layer - bottom color, tile sprite ("ground")
for (int x = (left_edge - 1 >= 0 ? left_edge - 1 : 0);
x < x_limit; //x < view_width;
x+=1)
{
//for (float y = (top_edge >= 0 ? top_edge : 0);
for (int y = (top_edge - 1 >= 0 ? top_edge - 1 : 0);
y < y_limit; //y < view_height;
y+=1)
{
auto pixel_pos = sf::Vector2f(
(x*ptex->sprite_width - left_spritepixels) * zoom,
(y*ptex->sprite_height - top_spritepixels) * zoom );
auto gridpoint = at(std::floor(x), std::floor(y));
//sprite.setPosition(pixel_pos);
r.setPosition(pixel_pos);
r.setFillColor(gridpoint.color);
renderTexture.draw(r);
// tilesprite
// if discovered but not visible, set opacity to 90%
// if not discovered... just don't draw it?
if (gridpoint.tilesprite != -1) {
sprite = ptex->sprite(gridpoint.tilesprite, pixel_pos, sf::Vector2f(zoom, zoom)); //setSprite(gridpoint.tilesprite);;
renderTexture.draw(sprite);
}
}
}
// middle layer - entities
// disabling entity rendering until I can render their UISprite inside the rendertexture (not directly to window)
for (auto e : *entities) {
// TODO skip out-of-bounds entities (grid square not visible at all, check for partially on visible grid squares / floating point grid position)
//auto drawent = e->cGrid->indexsprite.drawable();
auto& drawent = e->sprite;
//drawent.setScale(zoom, zoom);
drawent.setScale(sf::Vector2f(zoom, zoom));
auto pixel_pos = sf::Vector2f(
(e->position.x*ptex->sprite_width - left_spritepixels) * zoom,
(e->position.y*ptex->sprite_height - top_spritepixels) * zoom );
//drawent.setPosition(pixel_pos);
//renderTexture.draw(drawent);
drawent.render(pixel_pos, renderTexture);
}
// top layer - opacity for discovered / visible status (debug, basically)
/* // Disabled until I attach a "perspective"
for (int x = (left_edge - 1 >= 0 ? left_edge - 1 : 0);
x < x_limit; //x < view_width;
x+=1)
{
//for (float y = (top_edge >= 0 ? top_edge : 0);
for (int y = (top_edge - 1 >= 0 ? top_edge - 1 : 0);
y < y_limit; //y < view_height;
y+=1)
{
auto pixel_pos = sf::Vector2f(
(x*itex->grid_size - left_spritepixels) * zoom,
(y*itex->grid_size - top_spritepixels) * zoom );
auto gridpoint = at(std::floor(x), std::floor(y));
sprite.setPosition(pixel_pos);
r.setPosition(pixel_pos);
// visible & discovered layers for testing purposes
if (!gridpoint.discovered) {
r.setFillColor(sf::Color(16, 16, 20, 192)); // 255 opacity for actual blackout
renderTexture.draw(r);
} else if (!gridpoint.visible) {
r.setFillColor(sf::Color(32, 32, 40, 128));
renderTexture.draw(r);
}
// overlay
// uisprite
}
}
*/
// grid lines for testing & validation
/*
sf::Vertex line[] =
{
sf::Vertex(sf::Vector2f(0, 0), sf::Color::Red),
sf::Vertex(box.getSize(), sf::Color::Red),
};
renderTexture.draw(line, 2, sf::Lines);
sf::Vertex lineb[] =
{
sf::Vertex(sf::Vector2f(0, box.getSize().y), sf::Color::Blue),
sf::Vertex(sf::Vector2f(box.getSize().x, 0), sf::Color::Blue),
};
renderTexture.draw(lineb, 2, sf::Lines);
*/
// render to window
renderTexture.display();
//Resources::game->getWindow().draw(output);
target.draw(output);
}
UIGridPoint& UIGrid::at(int x, int y)
{
return points[y * grid_x + x];
}
PyObjectsEnum UIGrid::derived_type()
{
return PyObjectsEnum::UIGRID;
}
std::shared_ptr<PyTexture> UIGrid::getTexture()
{
return ptex;
}
UIDrawable* UIGrid::click_at(sf::Vector2f point)
{
if (click_callable)
{
if(box.getGlobalBounds().contains(point)) return this;
}
return NULL;
}
int UIGrid::init(PyUIGridObject* self, PyObject* args, PyObject* kwds) {
int grid_x, grid_y;
PyObject* textureObj;
//float box_x, box_y, box_w, box_h;
PyObject* pos, *size;
//if (!PyArg_ParseTuple(args, "iiOffff", &grid_x, &grid_y, &textureObj, &box_x, &box_y, &box_w, &box_h)) {
if (!PyArg_ParseTuple(args, "iiOOO", &grid_x, &grid_y, &textureObj, &pos, &size)) {
return -1; // If parsing fails, return an error
}
PyVectorObject* pos_result = PyVector::from_arg(pos);
if (!pos_result)
{
PyErr_SetString(PyExc_TypeError, "pos must be a mcrfpy.Vector instance or arguments to mcrfpy.Vector.__init__");
return -1;
}
PyVectorObject* size_result = PyVector::from_arg(size);
if (!size_result)
{
PyErr_SetString(PyExc_TypeError, "pos must be a mcrfpy.Vector instance or arguments to mcrfpy.Vector.__init__");
return -1;
}
// Convert PyObject texture to IndexTexture*
// This requires the texture object to have been initialized similar to UISprite's texture handling
//if (!PyObject_IsInstance(textureObj, (PyObject*)&PyTextureType)) {
if (!PyObject_IsInstance(textureObj, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Texture"))) {
PyErr_SetString(PyExc_TypeError, "texture must be a mcrfpy.Texture instance");
return -1;
}
PyTextureObject* pyTexture = reinterpret_cast<PyTextureObject*>(textureObj);
// TODO (7DRL day 2, item 4.) use shared_ptr / PyTextureObject on UIGrid
//IndexTexture* texture = pyTexture->data.get();
// Initialize UIGrid
//self->data = new UIGrid(grid_x, grid_y, texture, sf::Vector2f(box_x, box_y), sf::Vector2f(box_w, box_h));
//self->data = std::make_shared<UIGrid>(grid_x, grid_y, pyTexture->data,
// sf::Vector2f(box_x, box_y), sf::Vector2f(box_w, box_h));
self->data = std::make_shared<UIGrid>(grid_x, grid_y, pyTexture->data, pos_result->data, size_result->data);
return 0; // Success
}
PyObject* UIGrid::get_grid_size(PyUIGridObject* self, void* closure) {
return Py_BuildValue("(ii)", self->data->grid_x, self->data->grid_y);
}
PyObject* UIGrid::get_position(PyUIGridObject* self, void* closure) {
auto& box = self->data->box;
return Py_BuildValue("(ff)", box.getPosition().x, box.getPosition().y);
}
int UIGrid::set_position(PyUIGridObject* self, PyObject* value, void* closure) {
float x, y;
if (!PyArg_ParseTuple(value, "ff", &x, &y)) {
PyErr_SetString(PyExc_ValueError, "Position must be a tuple of two floats");
return -1;
}
self->data->box.setPosition(x, y);
return 0;
}
PyObject* UIGrid::get_size(PyUIGridObject* self, void* closure) {
auto& box = self->data->box;
return Py_BuildValue("(ff)", box.getSize().x, box.getSize().y);
}
int UIGrid::set_size(PyUIGridObject* self, PyObject* value, void* closure) {
float w, h;
if (!PyArg_ParseTuple(value, "ff", &w, &h)) {
PyErr_SetString(PyExc_ValueError, "Size must be a tuple of two floats");
return -1;
}
self->data->box.setSize(sf::Vector2f(w, h));
return 0;
}
PyObject* UIGrid::get_center(PyUIGridObject* self, void* closure) {
return Py_BuildValue("(ff)", self->data->center_x, self->data->center_y);
}
int UIGrid::set_center(PyUIGridObject* self, PyObject* value, void* closure) {
float x, y;
if (!PyArg_ParseTuple(value, "ff", &x, &y)) {
PyErr_SetString(PyExc_ValueError, "Size must be a tuple of two floats");
return -1;
}
self->data->center_x = x;
self->data->center_y = y;
return 0;
}
PyObject* UIGrid::get_float_member(PyUIGridObject* self, void* closure)
{
auto member_ptr = reinterpret_cast<long>(closure);
if (member_ptr == 0) // x
return PyFloat_FromDouble(self->data->box.getPosition().x);
else if (member_ptr == 1) // y
return PyFloat_FromDouble(self->data->box.getPosition().y);
else if (member_ptr == 2) // w
return PyFloat_FromDouble(self->data->box.getSize().x);
else if (member_ptr == 3) // h
return PyFloat_FromDouble(self->data->box.getSize().y);
else if (member_ptr == 4) // center_x
return PyFloat_FromDouble(self->data->center_x);
else if (member_ptr == 5) // center_y
return PyFloat_FromDouble(self->data->center_y);
else if (member_ptr == 6) // zoom
return PyFloat_FromDouble(self->data->zoom);
else
{
PyErr_SetString(PyExc_AttributeError, "Invalid attribute");
return nullptr;
}
}
int UIGrid::set_float_member(PyUIGridObject* self, PyObject* value, void* closure)
{
float val;
auto member_ptr = reinterpret_cast<long>(closure);
if (PyFloat_Check(value))
{
val = PyFloat_AsDouble(value);
}
else if (PyLong_Check(value))
{
val = PyLong_AsLong(value);
}
else
{
PyErr_SetString(PyExc_TypeError, "Value must be a floating point number.");
return -1;
}
if (member_ptr == 0) // x
self->data->box.setPosition(val, self->data->box.getPosition().y);
else if (member_ptr == 1) // y
self->data->box.setPosition(self->data->box.getPosition().x, val);
else if (member_ptr == 2) // w
self->data->box.setSize(sf::Vector2f(val, self->data->box.getSize().y));
else if (member_ptr == 3) // h
self->data->box.setSize(sf::Vector2f(self->data->box.getSize().x, val));
else if (member_ptr == 4) // center_x
self->data->center_x = val;
else if (member_ptr == 5) // center_y
self->data->center_y = val;
else if (member_ptr == 6) // zoom
self->data->zoom = val;
return 0;
}
// TODO (7DRL Day 2, item 5.) return Texture object
/*
PyObject* UIGrid::get_texture(PyUIGridObject* self, void* closure) {
Py_INCREF(self->texture);
return self->texture;
}
*/
PyObject* UIGrid::get_texture(PyUIGridObject* self, void* closure) {
//return self->data->getTexture()->pyObject();
// PyObject_GetAttrString(McRFPy_API::mcrf_module, "GridPointState")
//PyTextureObject* obj = (PyTextureObject*)((&PyTextureType)->tp_alloc(&PyTextureType, 0));
auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "Texture");
auto obj = (PyTextureObject*)type->tp_alloc(type, 0);
obj->data = self->data->getTexture();
return (PyObject*)obj;
}
PyObject* UIGrid::py_at(PyUIGridObject* self, PyObject* o)
{
int x, y;
if (!PyArg_ParseTuple(o, "ii", &x, &y)) {
PyErr_SetString(PyExc_TypeError, "UIGrid.at requires two integer arguments: (x, y)");
return NULL;
}
if (x < 0 || x >= self->data->grid_x) {
PyErr_SetString(PyExc_ValueError, "x value out of range (0, Grid.grid_y)");
return NULL;
}
if (y < 0 || y >= self->data->grid_y) {
PyErr_SetString(PyExc_ValueError, "y value out of range (0, Grid.grid_y)");
return NULL;
}
//PyUIGridPointObject* obj = (PyUIGridPointObject*)((&PyUIGridPointType)->tp_alloc(&PyUIGridPointType, 0));
auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "GridPoint");
auto obj = (PyUIGridPointObject*)type->tp_alloc(type, 0);
//auto target = std::static_pointer_cast<UIEntity>(target);
obj->data = &(self->data->points[x + self->data->grid_x * y]);
obj->grid = self->data;
return (PyObject*)obj;
}
PyMethodDef UIGrid::methods[] = {
{"at", (PyCFunction)UIGrid::py_at, METH_O},
{NULL, NULL, 0, NULL}
};
PyGetSetDef UIGrid::getsetters[] = {
// TODO - refactor into get_vector_member with field identifier values `(void*)n`
{"grid_size", (getter)UIGrid::get_grid_size, NULL, "Grid dimensions (grid_x, grid_y)", NULL},
{"position", (getter)UIGrid::get_position, (setter)UIGrid::set_position, "Position of the grid (x, y)", NULL},
{"size", (getter)UIGrid::get_size, (setter)UIGrid::set_size, "Size of the grid (width, height)", NULL},
{"center", (getter)UIGrid::get_center, (setter)UIGrid::set_center, "Grid coordinate at the center of the Grid's view (pan)", NULL},
{"entities", (getter)UIGrid::get_children, NULL, "EntityCollection of entities on this grid", NULL},
{"x", (getter)UIGrid::get_float_member, (setter)UIGrid::set_float_member, "top-left corner X-coordinate", (void*)0},
{"y", (getter)UIGrid::get_float_member, (setter)UIGrid::set_float_member, "top-left corner Y-coordinate", (void*)1},
{"w", (getter)UIGrid::get_float_member, (setter)UIGrid::set_float_member, "visible widget width", (void*)2},
{"h", (getter)UIGrid::get_float_member, (setter)UIGrid::set_float_member, "visible widget height", (void*)3},
{"center_x", (getter)UIGrid::get_float_member, (setter)UIGrid::set_float_member, "center of the view X-coordinate", (void*)4},
{"center_y", (getter)UIGrid::get_float_member, (setter)UIGrid::set_float_member, "center of the view Y-coordinate", (void*)5},
{"zoom", (getter)UIGrid::get_float_member, (setter)UIGrid::set_float_member, "zoom factor for displaying the Grid", (void*)6},
{"click", (getter)UIDrawable::get_click, (setter)UIDrawable::set_click, "Object called with (x, y, button) when clicked", (void*)PyObjectsEnum::UIGRID},
{"texture", (getter)UIGrid::get_texture, NULL, "Texture of the grid", NULL}, //TODO 7DRL-day2-item5
{NULL} /* Sentinel */
};
PyObject* UIGrid::get_children(PyUIGridObject* self, void* closure)
{
// create PyUICollection instance pointing to self->data->children
//PyUIEntityCollectionObject* o = (PyUIEntityCollectionObject*)PyUIEntityCollectionType.tp_alloc(&PyUIEntityCollectionType, 0);
auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "EntityCollection");
auto o = (PyUIEntityCollectionObject*)type->tp_alloc(type, 0);
if (o) {
o->data = self->data->entities; // todone. / BUGFIX - entities isn't a shared pointer on UIGrid, what to do? -- I made it a sp<list<sp<UIEntity>>>
o->grid = self->data;
}
return (PyObject*)o;
}
PyObject* UIGrid::repr(PyUIGridObject* self)
{
std::ostringstream ss;
if (!self->data) ss << "<Grid (invalid internal object)>";
else {
auto grid = self->data;
auto box = grid->box;
ss << "<Grid (x=" << box.getPosition().x << ", y=" << box.getPosition().y << ", w=" << box.getSize().x << ", h=" << box.getSize().y << ", " <<
"center=(" << grid->center_x << ", " << grid->center_y << "), zoom=" << grid->zoom <<
")>";
}
std::string repr_str = ss.str();
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
}
/* // TODO standard pointer would need deleted, but I opted for a shared pointer. tp_dealloc currently not even defined in the PyTypeObject
void PyUIGrid_dealloc(PyUIGridObject* self) {
delete self->data; // Clean up the allocated UIGrid object
Py_TYPE(self)->tp_free((PyObject*)self);
}
*/
int UIEntityCollectionIter::init(PyUIEntityCollectionIterObject* self, PyObject* args, PyObject* kwds)
{
PyErr_SetString(PyExc_TypeError, "UICollection cannot be instantiated: a C++ data source is required.");
return -1;
}
PyObject* UIEntityCollectionIter::next(PyUIEntityCollectionIterObject* self)
{
if (self->data->size() != self->start_size)
{
PyErr_SetString(PyExc_RuntimeError, "collection changed size during iteration");
return NULL;
}
if (self->index > self->start_size - 1)
{
PyErr_SetNone(PyExc_StopIteration);
return NULL;
}
self->index++;
auto vec = self->data.get();
if (!vec)
{
PyErr_SetString(PyExc_RuntimeError, "the collection store returned a null pointer");
return NULL;
}
// Advance list iterator since Entities are not stored in a vector (if this code even worked)
// vectors only: //auto target = (*vec)[self->index-1];
//auto l_front = (*vec).begin();
//std::advance(l_front, self->index-1);
// TODO build PyObject* of the correct UIDrawable subclass to return
//return py_instance(target);
return NULL;
}
PyObject* UIEntityCollectionIter::repr(PyUIEntityCollectionIterObject* self)
{
std::ostringstream ss;
if (!self->data) ss << "<UICollectionIter (invalid internal object)>";
else {
ss << "<UICollectionIter (" << self->data->size() << " child objects, @ index " << self->index << ")>";
}
std::string repr_str = ss.str();
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
}
Py_ssize_t UIEntityCollection::len(PyUIEntityCollectionObject* self) {
return self->data->size();
}
PyObject* UIEntityCollection::getitem(PyUIEntityCollectionObject* self, Py_ssize_t index) {
// build a Python version of item at self->data[index]
// Copy pasted::
auto vec = self->data.get();
if (!vec)
{
PyErr_SetString(PyExc_RuntimeError, "the collection store returned a null pointer");
return NULL;
}
while (index < 0) index += self->data->size();
if (index > self->data->size() - 1)
{
PyErr_SetString(PyExc_IndexError, "EntityCollection index out of range");
return NULL;
}
auto l_begin = (*vec).begin();
std::advance(l_begin, index);
auto target = *l_begin; //auto target = (*vec)[index];
//RET_PY_INSTANCE(target);
// construct and return an entity object that points directly into the UIGrid's entity vector
//PyUIEntityObject* o = (PyUIEntityObject*)((&PyUIEntityType)->tp_alloc(&PyUIEntityType, 0));
auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "Entity");
auto o = (PyUIEntityObject*)type->tp_alloc(type, 0);
auto p = std::static_pointer_cast<UIEntity>(target);
o->data = p;
return (PyObject*)o;
return NULL;
}
PySequenceMethods UIEntityCollection::sqmethods = {
.sq_length = (lenfunc)UIEntityCollection::len,
.sq_item = (ssizeargfunc)UIEntityCollection::getitem,
//.sq_item_by_index = UIEntityCollection::getitem
//.sq_slice - return a subset of the iterable
//.sq_ass_item - called when `o[x] = y` is executed (x is any object type)
//.sq_ass_slice - cool; no thanks, for now
//.sq_contains - called when `x in o` is executed
//.sq_ass_item_by_index - called when `o[x] = y` is executed (x is explictly an integer)
};
PyObject* UIEntityCollection::append(PyUIEntityCollectionObject* self, PyObject* o)
{
// if not UIDrawable subclass, reject it
// self->data->push_back( c++ object inside o );
// this would be a great use case for .tp_base
//if (!PyObject_IsInstance(o, (PyObject*)&PyUIEntityType))
if (!PyObject_IsInstance(o, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Entity")))
{
PyErr_SetString(PyExc_TypeError, "Only Entity objects can be added to EntityCollection");
return NULL;
}
PyUIEntityObject* entity = (PyUIEntityObject*)o;
self->data->push_back(entity->data);
entity->data->grid = self->grid;
Py_INCREF(Py_None);
return Py_None;
}
PyObject* UIEntityCollection::remove(PyUIEntityCollectionObject* self, PyObject* o)
{
if (!PyLong_Check(o))
{
PyErr_SetString(PyExc_TypeError, "UICollection.remove requires an integer index to remove");
return NULL;
}
long index = PyLong_AsLong(o);
if (index >= self->data->size())
{
PyErr_SetString(PyExc_ValueError, "Index out of range");
return NULL;
}
else if (index < 0)
{
PyErr_SetString(PyExc_NotImplementedError, "reverse indexing is not implemented.");
return NULL;
}
// release the shared pointer at correct part of the list
self->data->erase(std::next(self->data->begin(), index));
Py_INCREF(Py_None);
return Py_None;
}
PyMethodDef UIEntityCollection::methods[] = {
{"append", (PyCFunction)UIEntityCollection::append, METH_O},
//{"extend", (PyCFunction)UIEntityCollection::extend, METH_O}, // TODO
{"remove", (PyCFunction)UIEntityCollection::remove, METH_O},
{NULL, NULL, 0, NULL}
};
PyObject* UIEntityCollection::repr(PyUIEntityCollectionObject* self)
{
std::ostringstream ss;
if (!self->data) ss << "<UICollection (invalid internal object)>";
else {
ss << "<UICollection (" << self->data->size() << " child objects)>";
}
std::string repr_str = ss.str();
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
}
int UIEntityCollection::init(PyUIEntityCollectionObject* self, PyObject* args, PyObject* kwds)
{
PyErr_SetString(PyExc_TypeError, "EntityCollection cannot be instantiated: a C++ data source is required.");
return -1;
}
PyObject* UIEntityCollection::iter(PyUIEntityCollectionObject* self)
{
//PyUIEntityCollectionIterObject* iterObj;
//iterObj = (PyUIEntityCollectionIterObject*)PyUIEntityCollectionIterType.tp_alloc(&PyUIEntityCollectionIterType, 0);
auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "EntityCollectionIter");
auto iterObj = (PyUIEntityCollectionIterObject*)type->tp_alloc(type, 0);
if (iterObj == NULL) {
return NULL; // Failed to allocate memory for the iterator object
}
iterObj->data = self->data;
iterObj->index = 0;
iterObj->start_size = self->data->size();
return (PyObject*)iterObj;
}

View File

@ -1,184 +0,0 @@
#pragma once
#include "Common.h"
#include "Python.h"
#include "structmember.h"
#include "IndexTexture.h"
#include "Resources.h"
#include <list>
#include "PyCallable.h"
#include "PyTexture.h"
#include "PyColor.h"
#include "PyVector.h"
#include "PyFont.h"
#include "UIGridPoint.h"
#include "UIEntity.h"
#include "UIDrawable.h"
#include "UIBase.h"
class UIGrid: public UIDrawable
{
private:
std::shared_ptr<PyTexture> ptex;
public:
UIGrid();
//UIGrid(int, int, IndexTexture*, float, float, float, float);
UIGrid(int, int, std::shared_ptr<PyTexture>, sf::Vector2f, sf::Vector2f);
void update();
void render(sf::Vector2f, sf::RenderTarget&) override final;
UIGridPoint& at(int, int);
PyObjectsEnum derived_type() override final;
//void setSprite(int);
virtual UIDrawable* click_at(sf::Vector2f point) override final;
int grid_x, grid_y;
//int grid_size; // grid sizes are implied by IndexTexture now
sf::RectangleShape box;
float center_x, center_y, zoom;
//IndexTexture* itex;
std::shared_ptr<PyTexture> getTexture();
sf::Sprite sprite, output;
sf::RenderTexture renderTexture;
std::vector<UIGridPoint> points;
std::shared_ptr<std::list<std::shared_ptr<UIEntity>>> entities;
static int init(PyUIGridObject* self, PyObject* args, PyObject* kwds);
static PyObject* get_grid_size(PyUIGridObject* self, void* closure);
static PyObject* get_position(PyUIGridObject* self, void* closure);
static int set_position(PyUIGridObject* self, PyObject* value, void* closure);
static PyObject* get_size(PyUIGridObject* self, void* closure);
static int set_size(PyUIGridObject* self, PyObject* value, void* closure);
static PyObject* get_center(PyUIGridObject* self, void* closure);
static int set_center(PyUIGridObject* self, PyObject* value, void* closure);
static PyObject* get_float_member(PyUIGridObject* self, void* closure);
static int set_float_member(PyUIGridObject* self, PyObject* value, void* closure);
static PyObject* get_texture(PyUIGridObject* self, void* closure);
static PyObject* py_at(PyUIGridObject* self, PyObject* o);
static PyMethodDef methods[];
static PyGetSetDef getsetters[];
static PyObject* get_children(PyUIGridObject* self, void* closure);
static PyObject* repr(PyUIGridObject* self);
};
typedef struct {
PyObject_HEAD
std::shared_ptr<std::list<std::shared_ptr<UIEntity>>> data;
std::shared_ptr<UIGrid> grid;
} PyUIEntityCollectionObject;
class UIEntityCollection {
public:
static PySequenceMethods sqmethods;
static PyObject* append(PyUIEntityCollectionObject* self, PyObject* o);
static PyObject* remove(PyUIEntityCollectionObject* self, PyObject* o);
static PyMethodDef methods[];
static PyObject* repr(PyUIEntityCollectionObject* self);
static int init(PyUIEntityCollectionObject* self, PyObject* args, PyObject* kwds);
static PyObject* iter(PyUIEntityCollectionObject* self);
static Py_ssize_t len(PyUIEntityCollectionObject* self);
static PyObject* getitem(PyUIEntityCollectionObject* self, Py_ssize_t index);
};
typedef struct {
PyObject_HEAD
std::shared_ptr<std::list<std::shared_ptr<UIEntity>>> data;
int index;
int start_size;
} PyUIEntityCollectionIterObject;
class UIEntityCollectionIter {
public:
static int init(PyUIEntityCollectionIterObject* self, PyObject* args, PyObject* kwds);
static PyObject* next(PyUIEntityCollectionIterObject* self);
static PyObject* repr(PyUIEntityCollectionIterObject* self);
static PyObject* getitem(PyUIEntityCollectionObject* self, Py_ssize_t index);
};
namespace mcrfpydef {
static PyTypeObject PyUIGridType = {
//PyVarObject_HEAD_INIT(NULL, 0)
.tp_name = "mcrfpy.Grid",
.tp_basicsize = sizeof(PyUIGridObject),
.tp_itemsize = 0,
//.tp_dealloc = (destructor)[](PyObject* self)
//{
// PyUIGridObject* obj = (PyUIGridObject*)self;
// obj->data.reset();
// Py_TYPE(self)->tp_free(self);
//},
//TODO - PyUIGrid REPR def:
.tp_repr = (reprfunc)UIGrid::repr,
//.tp_hash = NULL,
//.tp_iter
//.tp_iternext
.tp_flags = Py_TPFLAGS_DEFAULT,
.tp_doc = PyDoc_STR("docstring"),
.tp_methods = UIGrid::methods,
//.tp_members = UIGrid::members,
.tp_getset = UIGrid::getsetters,
//.tp_base = NULL,
.tp_init = (initproc)UIGrid::init,
.tp_new = [](PyTypeObject* type, PyObject* args, PyObject* kwds) -> PyObject*
{
PyUIGridObject* self = (PyUIGridObject*)type->tp_alloc(type, 0);
if (self) self->data = std::make_shared<UIGrid>();
return (PyObject*)self;
}
};
static PyTypeObject PyUIEntityCollectionIterType = {
//PyVarObject_HEAD_INIT(NULL, 0)
.tp_name = "mcrfpy.UICollectionIter",
.tp_basicsize = sizeof(PyUIEntityCollectionIterObject),
.tp_itemsize = 0,
.tp_dealloc = (destructor)[](PyObject* self)
{
PyUIEntityCollectionIterObject* obj = (PyUIEntityCollectionIterObject*)self;
obj->data.reset();
Py_TYPE(self)->tp_free(self);
},
.tp_repr = (reprfunc)UIEntityCollectionIter::repr,
.tp_flags = Py_TPFLAGS_DEFAULT,
.tp_doc = PyDoc_STR("Iterator for a collection of UI objects"),
.tp_iternext = (iternextfunc)UIEntityCollectionIter::next,
//.tp_getset = UIEntityCollection::getset,
.tp_init = (initproc)UIEntityCollectionIter::init, // just raise an exception
.tp_new = [](PyTypeObject* type, PyObject* args, PyObject* kwds) -> PyObject*
{
PyErr_SetString(PyExc_TypeError, "UICollection cannot be instantiated: a C++ data source is required.");
return NULL;
}
};
static PyTypeObject PyUIEntityCollectionType = {
//PyVarObject_/HEAD_INIT(NULL, 0)
.tp_name = "mcrfpy.EntityCollection",
.tp_basicsize = sizeof(PyUIEntityCollectionObject),
.tp_itemsize = 0,
.tp_dealloc = (destructor)[](PyObject* self)
{
PyUIEntityCollectionObject* obj = (PyUIEntityCollectionObject*)self;
obj->data.reset();
Py_TYPE(self)->tp_free(self);
},
.tp_repr = (reprfunc)UIEntityCollection::repr,
.tp_as_sequence = &UIEntityCollection::sqmethods,
.tp_flags = Py_TPFLAGS_DEFAULT,
.tp_doc = PyDoc_STR("Iterable, indexable collection of Entities"),
.tp_iter = (getiterfunc)UIEntityCollection::iter,
.tp_methods = UIEntityCollection::methods, // append, remove
//.tp_getset = UIEntityCollection::getset,
.tp_init = (initproc)UIEntityCollection::init, // just raise an exception
.tp_new = [](PyTypeObject* type, PyObject* args, PyObject* kwds) -> PyObject*
{
// Does PyUIEntityCollectionType need __new__ if it's not supposed to be instantiable by the user?
// Should I just raise an exception? Or is the uninitialized shared_ptr enough of a blocker?
PyErr_SetString(PyExc_TypeError, "EntityCollection cannot be instantiated: a C++ data source is required.");
return NULL;
}
};
}

View File

@ -1,158 +0,0 @@
#include "UIGridPoint.h"
UIGridPoint::UIGridPoint()
: color(1.0f, 1.0f, 1.0f), color_overlay(0.0f, 0.0f, 0.0f), walkable(false), transparent(false),
tilesprite(-1), tile_overlay(-1), uisprite(-1)
{}
// Utility function to convert sf::Color to PyObject*
PyObject* sfColor_to_PyObject(sf::Color color) {
return Py_BuildValue("(iiii)", color.r, color.g, color.b, color.a);
}
// Utility function to convert PyObject* to sf::Color
sf::Color PyObject_to_sfColor(PyObject* obj) {
int r, g, b, a = 255; // Default alpha to fully opaque if not specified
if (!PyArg_ParseTuple(obj, "iii|i", &r, &g, &b, &a)) {
return sf::Color(); // Return default color on parse error
}
return sf::Color(r, g, b, a);
}
PyObject* UIGridPoint::get_color(PyUIGridPointObject* self, void* closure) {
if (reinterpret_cast<long>(closure) == 0) { // color
return sfColor_to_PyObject(self->data->color);
} else { // color_overlay
return sfColor_to_PyObject(self->data->color_overlay);
}
}
int UIGridPoint::set_color(PyUIGridPointObject* self, PyObject* value, void* closure) {
sf::Color color = PyObject_to_sfColor(value);
if (reinterpret_cast<long>(closure) == 0) { // color
self->data->color = color;
} else { // color_overlay
self->data->color_overlay = color;
}
return 0;
}
PyObject* UIGridPoint::get_bool_member(PyUIGridPointObject* self, void* closure) {
if (reinterpret_cast<long>(closure) == 0) { // walkable
return PyBool_FromLong(self->data->walkable);
} else { // transparent
return PyBool_FromLong(self->data->transparent);
}
}
int UIGridPoint::set_bool_member(PyUIGridPointObject* self, PyObject* value, void* closure) {
if (value == Py_True) {
if (reinterpret_cast<long>(closure) == 0) { // walkable
self->data->walkable = true;
} else { // transparent
self->data->transparent = true;
}
} else if (value == Py_False) {
if (reinterpret_cast<long>(closure) == 0) { // walkable
self->data->walkable = false;
} else { // transparent
self->data->transparent = false;
}
} else {
PyErr_SetString(PyExc_ValueError, "Expected a boolean value");
return -1;
}
return 0;
}
PyObject* UIGridPoint::get_int_member(PyUIGridPointObject* self, void* closure) {
switch(reinterpret_cast<long>(closure)) {
case 0: return PyLong_FromLong(self->data->tilesprite);
case 1: return PyLong_FromLong(self->data->tile_overlay);
case 2: return PyLong_FromLong(self->data->uisprite);
default: PyErr_SetString(PyExc_RuntimeError, "Invalid closure"); return nullptr;
}
}
int UIGridPoint::set_int_member(PyUIGridPointObject* self, PyObject* value, void* closure) {
long val = PyLong_AsLong(value);
if (PyErr_Occurred()) return -1;
switch(reinterpret_cast<long>(closure)) {
case 0: self->data->tilesprite = val; break;
case 1: self->data->tile_overlay = val; break;
case 2: self->data->uisprite = val; break;
default: PyErr_SetString(PyExc_RuntimeError, "Invalid closure"); return -1;
}
return 0;
}
PyGetSetDef UIGridPoint::getsetters[] = {
{"color", (getter)UIGridPoint::get_color, (setter)UIGridPoint::set_color, "GridPoint color", (void*)0},
{"color_overlay", (getter)UIGridPoint::get_color, (setter)UIGridPoint::set_color, "GridPoint color overlay", (void*)1},
{"walkable", (getter)UIGridPoint::get_bool_member, (setter)UIGridPoint::set_bool_member, "Is the GridPoint walkable", (void*)0},
{"transparent", (getter)UIGridPoint::get_bool_member, (setter)UIGridPoint::set_bool_member, "Is the GridPoint transparent", (void*)1},
{"tilesprite", (getter)UIGridPoint::get_int_member, (setter)UIGridPoint::set_int_member, "Tile sprite index", (void*)0},
{"tile_overlay", (getter)UIGridPoint::get_int_member, (setter)UIGridPoint::set_int_member, "Tile overlay sprite index", (void*)1},
{"uisprite", (getter)UIGridPoint::get_int_member, (setter)UIGridPoint::set_int_member, "UI sprite index", (void*)2},
{NULL} /* Sentinel */
};
PyObject* UIGridPoint::repr(PyUIGridPointObject* self) {
std::ostringstream ss;
if (!self->data) ss << "<GridPoint (invalid internal object)>";
else {
auto gp = self->data;
ss << "<GridPoint (walkable=" << (gp->walkable ? "True" : "False") << ", transparent=" << (gp->transparent ? "True" : "False") <<
", tilesprite=" << gp->tilesprite << ", tile_overlay=" << gp->tile_overlay << ", uisprite=" << gp->uisprite <<
")>";
}
std::string repr_str = ss.str();
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
}
PyObject* UIGridPointState::get_bool_member(PyUIGridPointStateObject* self, void* closure) {
if (reinterpret_cast<long>(closure) == 0) { // visible
return PyBool_FromLong(self->data->visible);
} else { // discovered
return PyBool_FromLong(self->data->discovered);
}
}
int UIGridPointState::set_bool_member(PyUIGridPointStateObject* self, PyObject* value, void* closure) {
if (!PyBool_Check(value)) {
PyErr_SetString(PyExc_TypeError, "Value must be a boolean");
return -1;
}
int truthValue = PyObject_IsTrue(value);
if (truthValue < 0) {
return -1; // PyObject_IsTrue returns -1 on error
}
if (reinterpret_cast<long>(closure) == 0) { // visible
self->data->visible = truthValue;
} else { // discovered
self->data->discovered = truthValue;
}
return 0;
}
PyGetSetDef UIGridPointState::getsetters[] = {
{"visible", (getter)UIGridPointState::get_bool_member, (setter)UIGridPointState::set_bool_member, "Is the GridPointState visible", (void*)0},
{"discovered", (getter)UIGridPointState::get_bool_member, (setter)UIGridPointState::set_bool_member, "Has the GridPointState been discovered", (void*)1},
{NULL} /* Sentinel */
};
PyObject* UIGridPointState::repr(PyUIGridPointStateObject* self) {
std::ostringstream ss;
if (!self->data) ss << "<GridPointState (invalid internal object)>";
else {
auto gps = self->data;
ss << "<GridPointState (visible=" << (gps->visible ? "True" : "False") << ", discovered=" << (gps->discovered ? "True" : "False") <<
")>";
}
std::string repr_str = ss.str();
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
}

View File

@ -1,92 +0,0 @@
#pragma once
#include "Common.h"
#include "Python.h"
#include "structmember.h"
#include "IndexTexture.h"
#include "Resources.h"
#include <list>
#include "PyCallable.h"
#include "PyTexture.h"
#include "PyColor.h"
#include "PyVector.h"
#include "PyFont.h"
static PyObject* sfColor_to_PyObject(sf::Color color);
static sf::Color PyObject_to_sfColor(PyObject* obj);
class UIGrid;
class UIEntity;
class UIGridPoint;
class UIGridPointState;
typedef struct {
PyObject_HEAD
UIGridPoint* data;
std::shared_ptr<UIGrid> grid;
} PyUIGridPointObject;
typedef struct {
PyObject_HEAD
UIGridPointState* data;
std::shared_ptr<UIGrid> grid;
std::shared_ptr<UIEntity> entity;
} PyUIGridPointStateObject;
// UIGridPoint - revised grid data for each point
class UIGridPoint
{
public:
sf::Color color, color_overlay;
bool walkable, transparent;
int tilesprite, tile_overlay, uisprite;
UIGridPoint();
static int set_int_member(PyUIGridPointObject* self, PyObject* value, void* closure);
static PyGetSetDef getsetters[];
static PyObject* get_color(PyUIGridPointObject* self, void* closure);
static PyObject* get_int_member(PyUIGridPointObject* self, void* closure);
static int set_bool_member(PyUIGridPointObject* self, PyObject* value, void* closure);
static PyObject* get_bool_member(PyUIGridPointObject* self, void* closure);
static int set_color(PyUIGridPointObject* self, PyObject* value, void* closure);
static PyObject* repr(PyUIGridPointObject* self);
};
// UIGridPointState - entity-specific info for each cell
class UIGridPointState
{
public:
bool visible, discovered;
static PyObject* get_bool_member(PyUIGridPointStateObject* self, void* closure);
static int set_bool_member(PyUIGridPointStateObject* self, PyObject* value, void* closure);
static PyGetSetDef getsetters[];
static PyObject* repr(PyUIGridPointStateObject* self);
};
namespace mcrfpydef {
static PyTypeObject PyUIGridPointType = {
//PyVarObject_HEAD_INIT(NULL, 0)
.tp_name = "mcrfpy.GridPoint",
.tp_basicsize = sizeof(PyUIGridPointObject),
.tp_itemsize = 0,
.tp_repr = (reprfunc)UIGridPoint::repr,
.tp_flags = Py_TPFLAGS_DEFAULT,
.tp_doc = "UIGridPoint object",
.tp_getset = UIGridPoint::getsetters,
//.tp_init = (initproc)PyUIGridPoint_init, // TODO Define the init function
.tp_new = PyType_GenericNew,
};
static PyTypeObject PyUIGridPointStateType = {
//PyVarObject_HEAD_INIT(NULL, 0)
.tp_name = "mcrfpy.GridPointState",
.tp_basicsize = sizeof(PyUIGridPointStateObject),
.tp_itemsize = 0,
.tp_repr = (reprfunc)UIGridPointState::repr,
.tp_flags = Py_TPFLAGS_DEFAULT,
.tp_doc = "UIGridPointState object", // TODO: Add PyUIGridPointState tp_init
.tp_getset = UIGridPointState::getsetters,
.tp_new = PyType_GenericNew,
};
}

View File

@ -1,217 +0,0 @@
#include "UISprite.h"
#include "GameEngine.h"
UIDrawable* UISprite::click_at(sf::Vector2f point)
{
if (click_callable)
{
if(sprite.getGlobalBounds().contains(point)) return this;
}
return NULL;
}
UISprite::UISprite() {}
UISprite::UISprite(std::shared_ptr<PyTexture> _ptex, int _sprite_index, sf::Vector2f _pos, float _scale)
: ptex(_ptex), sprite_index(_sprite_index)
{
sprite = ptex->sprite(sprite_index, _pos, sf::Vector2f(_scale, _scale));
}
/*
void UISprite::render(sf::Vector2f offset)
{
sprite.move(offset);
Resources::game->getWindow().draw(sprite);
sprite.move(-offset);
}
*/
void UISprite::render(sf::Vector2f offset, sf::RenderTarget& target)
{
sprite.move(offset);
target.draw(sprite);
sprite.move(-offset);
}
void UISprite::setPosition(sf::Vector2f pos)
{
sprite.setPosition(pos);
}
void UISprite::setScale(sf::Vector2f s)
{
sprite.setScale(s);
}
void UISprite::setTexture(std::shared_ptr<PyTexture> _ptex, int _sprite_index)
{
ptex = _ptex;
if (_sprite_index != -1) // if you are changing textures, there's a good chance you need a new index too
sprite_index = _sprite_index;
sprite = ptex->sprite(sprite_index, sprite.getPosition(), sprite.getScale());
}
void UISprite::setSpriteIndex(int _sprite_index)
{
sprite_index = _sprite_index;
sprite = ptex->sprite(sprite_index, sprite.getPosition(), sprite.getScale());
}
sf::Vector2f UISprite::getScale()
{
return sprite.getScale();
}
sf::Vector2f UISprite::getPosition()
{
return sprite.getPosition();
}
std::shared_ptr<PyTexture> UISprite::getTexture()
{
return ptex;
}
int UISprite::getSpriteIndex()
{
return sprite_index;
}
PyObjectsEnum UISprite::derived_type()
{
return PyObjectsEnum::UISPRITE;
}
PyObject* UISprite::get_float_member(PyUISpriteObject* self, void* closure)
{
auto member_ptr = reinterpret_cast<long>(closure);
if (member_ptr == 0)
return PyFloat_FromDouble(self->data->getPosition().x);
else if (member_ptr == 1)
return PyFloat_FromDouble(self->data->getPosition().y);
else if (member_ptr == 2)
return PyFloat_FromDouble(self->data->getScale().x); // scale X and Y are identical, presently
else
{
PyErr_SetString(PyExc_AttributeError, "Invalid attribute");
return nullptr;
}
}
int UISprite::set_float_member(PyUISpriteObject* self, PyObject* value, void* closure)
{
float val;
auto member_ptr = reinterpret_cast<long>(closure);
if (PyFloat_Check(value))
{
val = PyFloat_AsDouble(value);
}
else if (PyLong_Check(value))
{
val = PyLong_AsLong(value);
}
else
{
PyErr_SetString(PyExc_TypeError, "Value must be a floating point number.");
return -1;
}
if (member_ptr == 0) //x
self->data->setPosition(sf::Vector2f(val, self->data->getPosition().y));
else if (member_ptr == 1) //y
self->data->setPosition(sf::Vector2f(self->data->getPosition().x, val));
else if (member_ptr == 2) // scale
self->data->setScale(sf::Vector2f(val, val));
return 0;
}
PyObject* UISprite::get_int_member(PyUISpriteObject* self, void* closure)
{
auto member_ptr = reinterpret_cast<long>(closure);
if (true) {}
else
{
PyErr_SetString(PyExc_AttributeError, "Invalid attribute");
return nullptr;
}
return PyLong_FromDouble(self->data->getSpriteIndex());
}
int UISprite::set_int_member(PyUISpriteObject* self, PyObject* value, void* closure)
{
int val;
auto member_ptr = reinterpret_cast<long>(closure);
if (PyLong_Check(value))
{
val = PyLong_AsLong(value);
}
else
{
PyErr_SetString(PyExc_TypeError, "Value must be an integer.");
return -1;
}
self->data->setSpriteIndex(val);
return 0;
}
PyObject* UISprite::get_texture(PyUISpriteObject* self, void* closure)
{
return self->data->getTexture()->pyObject();
}
int UISprite::set_texture(PyUISpriteObject* self, PyObject* value, void* closure)
{
return -1;
}
PyGetSetDef UISprite::getsetters[] = {
{"x", (getter)UISprite::get_float_member, (setter)UISprite::set_float_member, "X coordinate of top-left corner", (void*)0},
{"y", (getter)UISprite::get_float_member, (setter)UISprite::set_float_member, "Y coordinate of top-left corner", (void*)1},
{"scale", (getter)UISprite::get_float_member, (setter)UISprite::set_float_member, "Size factor", (void*)2},
{"sprite_number", (getter)UISprite::get_int_member, (setter)UISprite::set_int_member, "Which sprite on the texture is shown", NULL},
{"texture", (getter)UISprite::get_texture, (setter)UISprite::set_texture, "Texture object", NULL},
{"click", (getter)UIDrawable::get_click, (setter)UIDrawable::set_click, "Object called with (x, y, button) when clicked", (void*)PyObjectsEnum::UISPRITE},
{NULL}
};
PyObject* UISprite::repr(PyUISpriteObject* self)
{
std::ostringstream ss;
if (!self->data) ss << "<Sprite (invalid internal object)>";
else {
//auto sprite = self->data->sprite;
ss << "<Sprite (x=" << self->data->getPosition().x << ", y=" << self->data->getPosition().y << ", " <<
"scale=" << self->data->getScale().x << ", " <<
"sprite_number=" << self->data->getSpriteIndex() << ")>";
}
std::string repr_str = ss.str();
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
}
int UISprite::init(PyUISpriteObject* self, PyObject* args, PyObject* kwds)
{
//std::cout << "Init called\n";
static const char* keywords[] = { "x", "y", "texture", "sprite_index", "scale", nullptr };
float x = 0.0f, y = 0.0f, scale = 1.0f;
int sprite_index;
PyObject* texture;
if (!PyArg_ParseTupleAndKeywords(args, kwds, "|ffOif",
const_cast<char**>(keywords), &x, &y, &texture, &sprite_index, &scale))
{
return -1;
}
// check types for texture
//if (texture != NULL && !PyObject_IsInstance(texture, (PyObject*)&PyTextureType)){
if (texture != NULL && !PyObject_IsInstance(texture, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Texture"))){
PyErr_SetString(PyExc_TypeError, "texture must be a mcrfpy.Texture instance");
return -1;
}
auto pytexture = (PyTextureObject*)texture;
self->data = std::make_shared<UISprite>(pytexture->data, sprite_index, sf::Vector2f(x, y), scale);
self->data->setPosition(sf::Vector2f(x, y));
return 0;
}

View File

@ -1,90 +0,0 @@
#pragma once
#include "Common.h"
#include "Python.h"
#include "structmember.h"
#include "IndexTexture.h"
#include "Resources.h"
#include <list>
#include "PyCallable.h"
#include "PyTexture.h"
#include "PyColor.h"
#include "PyVector.h"
#include "PyFont.h"
#include "UIDrawable.h"
#include "UIBase.h"
class UISprite: public UIDrawable
{
private:
int sprite_index;
sf::Sprite sprite;
protected:
std::shared_ptr<PyTexture> ptex;
public:
UISprite();
UISprite(std::shared_ptr<PyTexture>, int, sf::Vector2f, float);
void update();
void render(sf::Vector2f, sf::RenderTarget&) override final;
virtual UIDrawable* click_at(sf::Vector2f point) override final;
//void render(sf::Vector2f, sf::RenderTexture&);
void setPosition(sf::Vector2f);
sf::Vector2f getPosition();
void setScale(sf::Vector2f);
sf::Vector2f getScale();
void setSpriteIndex(int);
int getSpriteIndex();
void setTexture(std::shared_ptr<PyTexture> _ptex, int _sprite_index=-1);
std::shared_ptr<PyTexture> getTexture();
PyObjectsEnum derived_type() override final;
static PyObject* get_float_member(PyUISpriteObject* self, void* closure);
static int set_float_member(PyUISpriteObject* self, PyObject* value, void* closure);
static PyObject* get_int_member(PyUISpriteObject* self, void* closure);
static int set_int_member(PyUISpriteObject* self, PyObject* value, void* closure);
static PyObject* get_texture(PyUISpriteObject* self, void* closure);
static int set_texture(PyUISpriteObject* self, PyObject* value, void* closure);
static PyGetSetDef getsetters[];
static PyObject* repr(PyUISpriteObject* self);
static int init(PyUISpriteObject* self, PyObject* args, PyObject* kwds);
};
namespace mcrfpydef {
static PyTypeObject PyUISpriteType = {
//PyVarObject_HEAD_INIT(NULL, 0)
.tp_name = "mcrfpy.Sprite",
.tp_basicsize = sizeof(PyUISpriteObject),
.tp_itemsize = 0,
.tp_dealloc = (destructor)[](PyObject* self)
{
PyUISpriteObject* obj = (PyUISpriteObject*)self;
// release reference to font object
//if (obj->texture) Py_DECREF(obj->texture);
obj->data.reset();
Py_TYPE(self)->tp_free(self);
},
.tp_repr = (reprfunc)UISprite::repr,
//.tp_hash = NULL,
//.tp_iter
//.tp_iternext
.tp_flags = Py_TPFLAGS_DEFAULT,
.tp_doc = PyDoc_STR("docstring"),
//.tp_methods = PyUIFrame_methods,
//.tp_members = PyUIFrame_members,
.tp_getset = UISprite::getsetters,
//.tp_base = NULL,
.tp_init = (initproc)UISprite::init,
.tp_new = [](PyTypeObject* type, PyObject* args, PyObject* kwds) -> PyObject*
{
PyUISpriteObject* self = (PyUISpriteObject*)type->tp_alloc(type, 0);
//if (self) self->data = std::make_shared<UICaption>();
return (PyObject*)self;
}
};
}

View File

@ -154,7 +154,7 @@ void UITestScene::doAction(std::string name, std::string type)
*/
}
void UITestScene::render()
void UITestScene::sRender()
{
game->getWindow().clear();
game->getWindow().draw(text);

View File

@ -18,5 +18,5 @@ public:
UITestScene(GameEngine*);
void update() override final;
void doAction(std::string, std::string) override final;
void render() override final;
void sRender() override final;
};

View File

@ -1,393 +0,0 @@
import mcrfpy
import random
#t = mcrfpy.Texture("assets/kenney_tinydungeon.png", 16, 16)
t = mcrfpy.Texture("assets/kenney_TD_MR_IP.png", 16, 16)
#def iterable_entities(grid):
# """Workaround for UIEntityCollection bug; see issue #72"""
# entities = []
# for i in range(len(grid.entities)):
# entities.append(grid.entities[i])
# return entities
class COSEntity(): #mcrfpy.Entity): # Fake mcrfpy.Entity integration; engine bugs workarounds
def __init__(self, g:mcrfpy.Grid, x=0, y=0, sprite_num=86, *, game):
#self.e = mcrfpy.Entity((x, y), t, sprite_num)
#super().__init__((x, y), t, sprite_num)
self._entity = mcrfpy.Entity((x, y), t, sprite_num)
#grid.entities.append(self.e)
self.grid = g
#g.entities.append(self._entity)
self.game = game
self.game.add_entity(self)
## Wrapping mcfrpy.Entity properties to emulate derived class... see issue #76
@property
def draw_pos(self):
return self._entity.draw_pos
@draw_pos.setter
def draw_pos(self, value):
self._entity.draw_pos = value
@property
def sprite_number(self):
return self._entity.sprite_number
@sprite_number.setter
def sprite_number(self, value):
self._entity.sprite_number = value
def __repr__(self):
return f"<{self.__class__.__name__} ({self.draw_pos})>"
def die(self):
# ugly workaround! grid.entities isn't really iterable (segfaults)
for i in range(len(self.grid.entities)):
e = self.grid.entities[i]
if e == self._entity:
#if e == self:
self.grid.entities.remove(i)
break
else:
print(f"!!! {self!r} wasn't removed from grid on call to die()")
def bump(self, other, dx, dy, test=False):
raise NotImplementedError
def do_move(self, tx, ty):
"""Base class method to move this entity
Assumes try_move succeeded, for everyone!
from: self._entity.draw_pos
to: (tx, ty)
calls ev_exit for every entity at (draw_pos)
calls ev_enter for every entity at (tx, ty)
"""
old_pos = self.draw_pos
self.draw_pos = (tx, ty)
for e in self.game.entities:
if e is self: continue
if e.draw_pos == old_pos: e.ev_exit(self)
for e in self.game.entities:
if e is self: continue
if e.draw_pos == (tx, ty): e.ev_enter(self)
def act(self):
pass
def ev_enter(self, other):
pass
def ev_exit(self, other):
pass
def try_move(self, dx, dy, test=False):
x_max, y_max = self.grid.grid_size
tx, ty = int(self.draw_pos[0] + dx), int(self.draw_pos[1] + dy)
#for e in iterable_entities(self.grid):
# sorting entities to test against the boulder instead of the button when they overlap.
for e in sorted(self.game.entities, key = lambda i: i.draw_order, reverse = True):
if e.draw_pos == (tx, ty):
#print(f"bumping {e}")
return e.bump(self, dx, dy)
if tx < 0 or tx >= x_max:
return False
if ty < 0 or ty >= y_max:
return False
if self.grid.at((tx, ty)).walkable == True:
if not test:
#self.draw_pos = (tx, ty)
self.do_move(tx, ty)
return True
else:
#print("Bonk")
return False
def _relative_move(self, dx, dy):
tx, ty = int(self.draw_pos[0] + dx), int(self.draw_pos[1] + dy)
#self.draw_pos = (tx, ty)
self.do_move(tx, ty)
class Equippable:
def __init__(self, hands = 0, hp_healing = 0, damage = 0, defense = 0, zap_damage = 1, zap_cooldown = 10, sprite = 129):
self.hands = hands
self.hp_healing = hp_healing
self.damage = damage
self.defense = defense
self.zap_damage = zap_damage
self.zap_cooldown = zap_cooldown
self.zap_cooldown_remaining = 0
self.sprite = self.sprite
self.quality = 0
def tick(self):
if self.zap_cooldown_remaining:
self.zap_cooldown_remaining -= 1
if self.zap_cooldown_remaining < 0: self.zap_cooldown_remaining = 0
def __repr__(self):
cooldown_str = f'({self.zap_cooldown_remaining} rounds until ready)'
return f"<Equippable hands={self.hands}, hp_healing={self.hp_healing}, damage={self.damage}, defense={self.defense}, zap_damage={self.zap_damage}, zap_cooldown={self.zap_cooldown}{cooldown_str if self.zap_cooldown_remaining else ''}, sprite={self.sprite}>"
def classify(self):
categories = []
if self.hands==0:
categories.append("consumable")
elif self.damage > 0:
categories.append(f"{self.hands}-handed weapon")
elif self.defense > 0:
categories.append(f"defense")
elif self.zap_damage > 0:
categories.append("{self.hands}-handed magic weapon")
if len(categories) == 0:
return "unclassifiable"
elif len(categories) == 1:
return categories[0]
else:
return "Erratic: " + ', '.join(categories)
#def compare(self, other):
# my_class = self.classify()
# o_class = other.classify()
# if my_class == "unclassifiable" or o_class == "unclassifiable":
# return None
# if my_class == "consumable":
# return other.hp_healing - self.hp_healing
class PlayerEntity(COSEntity):
def __init__(self, *, game):
#print(f"spawn at origin")
self.draw_order = 10
super().__init__(game.grid, 0, 0, sprite_num=84, game=game)
self.hp = 10
self.max_hp = 10
self.base_damage = 1
self.base_defense = 0
self.luck = 0
self.archetype = None
self.equipped = []
self.inventory = []
def tick(self):
for i in self.equipped:
i.tick()
def calc_damage(self):
dmg = self.base_damage
for i in self.equipped:
dmg += i.damage
return dmg
def calc_defense(self):
defense = self.base_defense
for i in self.equipped:
defense += i.damage
return defense
def do_zap(self):
pass
def bump(self, other, dx, dy, test=False):
if type(other) == BoulderEntity:
print("Boulder hit w/ knockback!")
return self.game.pull_boulder_move((-dx, -dy), other)
print(f"oof, ouch, {other} bumped the player - {other.base_damage} damage from {other}")
self.hp = max(self.hp - max(other.base_damage - self.calc_defense(), 0), 0)
def respawn(self, avoid=None):
# find spawn point
x_max, y_max = g.size
spawn_points = []
for x in range(x_max):
for y in range(y_max):
if g.at((x, y)).walkable:
spawn_points.append((x, y))
random.shuffle(spawn_points)
## TODO - find other entities to avoid spawning on top of
for spawn in spawn_points:
for e in avoid or []:
if e.draw_pos == spawn: break
else:
break
self.draw_pos = spawn
def __repr__(self):
return f"<PlayerEntity {self.draw_pos}, {self.grid}>"
class BoulderEntity(COSEntity):
def __init__(self, x, y, *, game):
self.draw_order = 8
super().__init__(game.grid, x, y, 66, game=game)
def bump(self, other, dx, dy, test=False):
if type(other) == BoulderEntity:
#print("Boulders can't push boulders")
return False
elif type(other) == EnemyEntity:
if not other.can_push: return False
#tx, ty = int(self.e.position[0] + dx), int(self.e.position[1] + dy)
tx, ty = int(self.draw_pos[0] + dx), int(self.draw_pos[1] + dy)
# Is the boulder blocked the same direction as the bumper? If not, let's both move
old_pos = int(self.draw_pos[0]), int(self.draw_pos[1])
if self.try_move(dx, dy, test=test):
if not test:
other.do_move(*old_pos)
#other.draw_pos = old_pos
return True
class ButtonEntity(COSEntity):
def __init__(self, x, y, exit_entity, *, game):
self.draw_order = 1
super().__init__(game.grid, x, y, 250, game=game)
self.exit = exit_entity
def ev_enter(self, other):
print("Button makes a satisfying click!")
self.exit.unlock()
def ev_exit(self, other):
print("Button makes a disappointing click.")
self.exit.lock()
def bump(self, other, dx, dy, test=False):
#if type(other) == BoulderEntity:
# self.exit.unlock()
# TODO: unlock, and then lock again, when player steps on/off
if not test:
pos = int(self.draw_pos[0]), int(self.draw_pos[1])
other.do_move(*pos)
return True
class ExitEntity(COSEntity):
def __init__(self, x, y, bx, by, *, game):
self.draw_order = 2
super().__init__(game.grid, x, y, 45, game=game)
self.my_button = ButtonEntity(bx, by, self, game=game)
self.unlocked = False
#global cos_entities
#cos_entities.append(self.my_button)
def unlock(self):
self.sprite_number = 21
self.unlocked = True
def lock(self):
self.sprite_number = 45
self.unlocked = False
def bump(self, other, dx, dy, test=False):
if type(other) == BoulderEntity:
return False
if self.unlocked:
if not test:
other._relative_move(dx, dy)
#TODO - player go down a level logic
if type(other) == PlayerEntity:
self.game.depth += 1
print(f"welcome to level {self.game.depth}")
self.game.create_level(self.game.depth)
self.game.swap_level(self.game.level, self.game.spawn_point)
class EnemyEntity(COSEntity):
def __init__(self, x, y, hp=2, base_damage=1, base_defense=0, sprite=123, can_push=False, crushable=True, sight=8, move_cooldown=1, *, game):
self.draw_order = 7
super().__init__(game.grid, x, y, sprite, game=game)
self.hp = hp
self.base_damage = base_damage
self.base_defense = base_defense
self.base_sprite = sprite
self.can_push = can_push
self.crushable = crushable
self.sight = sight
self.move_cooldown = move_cooldown
self.moved_last = 0
def bump(self, other, dx, dy, test=False):
if self.hp == 0:
if not test:
old_pos = int(self.draw_pos[0]), int(self.draw_pos[1])
other.do_move(*old_pos)
return True
if type(other) == PlayerEntity:
# TODO - get damage from player, take damage, decide to die or not
d = other.calc_damage()
self.hp -= d
self.hp = max(self.hp, 0)
if self.hp == 0:
self._entity.sprite_number = self.base_sprite + 246
self.draw_order = 1
print(f"Player hit for {d}. HP = {self.hp}")
#self.hp = 0
return False
elif type(other) == BoulderEntity:
if not self.crushable and self.hp > 0:
print("Uncrushable!")
return False
if self.hp > 0:
print("Ouch, my entire body!!")
self._entity.sprite_number = self.base_sprite + 246
self.hp = 0
old_pos = int(self.draw_pos[0]), int(self.draw_pos[1])
if not test:
other.do_move(*old_pos)
return True
def act(self):
if self.hp > 0:
# if player nearby: attack
x, y = self.draw_pos
px, py = self.game.player.draw_pos
for d in ((1, 0), (0, 1), (-1, 0), (1, 0)):
if int(x + d[0]) == int(px) and int(y + d[1]) == int(py):
self.try_move(*d)
return
# slow movement (doesn't affect ability to attack)
if self.moved_last < 0:
self.moved_last -= 1
return
else:
self.moved_last = self.move_cooldown
# if player is not nearby, wander
if abs(x - px) + abs(y - py) > self.sight:
d = random.choice(((1, 0), (0, 1), (-1, 0), (1, 0)))
self.try_move(*d)
# if can_push and player in a line: KICK
if self.can_push:
if int(x) == int(px):
pass # vertical kick
elif int(y) == int(py):
pass # horizontal kick
# else, nearby pursue
towards = []
dist = lambda dx, dy: abs(px - (x + dx)) + abs(py - (y + dy))
current_dist = dist(0, 0)
for d in ((1, 0), (0, 1), (-1, 0), (1, 0)):
if dist(*d) <= current_dist + 0.75: towards.append(d)
print(current_dist, towards)
target_dir = random.choice(towards)
self.try_move(*target_dir)
class TreasureEntity(COSEntity):
def __init__(self, x, y, treasure_table=None, *, game):
self.draw_order = 6
super().__init__(game.grid, x, y, 89, game=game)
self.popped = False
def bump(self, other, dx, dy, test=False):
if type(other) != PlayerEntity:
return False
if self.popped:
print("It's already open.")
return
print("Take me, I'm yours!")
self._entity.sprite_number = 91
self.popped = True

View File

@ -1,285 +0,0 @@
import random
import mcrfpy
import cos_tiles as ct
t = mcrfpy.Texture("assets/kenney_TD_MR_IP.png", 16, 16)
def binary_space_partition(x, y, w, h):
d = random.choices(["vert", "horiz"], weights=[w/(w+h), h/(w+h)])[0]
split = random.randint(30, 70) / 100.0
if d == "vert":
coord = int(w * split)
return (x, y, coord, h), (x+coord, y, w-coord, h)
else: # horizontal
coord = int(h * split)
return (x, y, w, coord), (x, y+coord, w, h-coord)
room_area = lambda x, y, w, h: w * h
class BinaryRoomNode:
def __init__(self, xywh):
self.data = xywh
self.left = None
self.right = None
def __repr__(self):
return f"<RoomNode {self.data}>"
def center(self):
x, y, w, h = self.data
return (x + w // 2, y + h // 2)
def split(self):
new_data = binary_space_partition(*self.data)
self.left = BinaryRoomNode(new_data[0])
self.right = BinaryRoomNode(new_data[1])
def walk(self):
if self.left and self.right:
return self.left.walk() + self.right.walk()
return [self]
def contains(self, pt):
x, y, w, h = self.data
tx, ty = pt
return x <= tx <= x + w and y <= ty <= y + h
class RoomGraph:
def __init__(self, xywh):
self.root = BinaryRoomNode(xywh)
def __repr__(self):
return f"<RoomGraph, root={self.root}, {len(self.walk())} rooms>"
def walk(self):
w = self.root.walk() if self.root else []
#print(w)
return w
def room_coord(room, margin=0):
x, y, w, h = room.data
#print(x,y,w,h, f'{margin=}', end=';')
w -= 1
h -= 1
margin += 1
x += margin
y += margin
w -= margin
h -= margin
if w < 0: w = 0
if h < 0: h = 0
#print(x,y,w,h, end=' -> ')
tx = x if w==0 else random.randint(x, x+w)
ty = y if h==0 else random.randint(y, y+h)
#print((tx, ty))
return (tx, ty)
def adjacent_rooms(r, rooms):
x, y, w, h = r.data
adjacents = {}
for i, other_r in enumerate(rooms):
rx, ry, rw, rh = other_r.data
if (rx, ry, rw, rh) == r:
continue # Skip self
# Check vertical adjacency (above or below)
if rx < x + w and x < rx + rw: # Overlapping width
if ry + rh == y: # Above
adjacents[i] = (x + w // 2, y - 1)
elif y + h == ry: # Below
adjacents[i] = (x + w // 2, y + h + 1)
# Check horizontal adjacency (left or right)
if ry < y + h and y < ry + rh: # Overlapping height
if rx + rw == x: # Left
adjacents[i] = (x - 1, y + h // 2)
elif x + w == rx: # Right
adjacents[i] = (x + w + 1, y + h // 2)
return adjacents
class Level:
def __init__(self, width, height):
self.width = width
self.height = height
#self.graph = [(0, 0, width, height)]
self.graph = RoomGraph( (0, 0, width, height) )
self.grid = mcrfpy.Grid(width, height, t, (10, 10), (1014, 758))
self.highlighted = -1 #debug view feature
self.walled_rooms = [] # for tracking "hallway rooms" vs "walled rooms"
def fill(self, xywh, highlight = False):
if highlight:
ts = 0
else:
ts = room_area(*xywh) % 131
X, Y, W, H = xywh
for x in range(X, X+W):
for y in range(Y, Y+H):
self.grid.at((x, y)).tilesprite = ts
def highlight(self, delta):
rooms = self.graph.walk()
if self.highlighted < len(rooms):
#print(f"reset {self.highlighted}")
self.fill(rooms[self.highlighted].data) # reset
self.highlighted += delta
print(f"highlight {self.highlighted}")
self.highlighted = self.highlighted % len(rooms)
self.fill(rooms[self.highlighted].data, highlight = True)
def reset(self):
self.graph = RoomGraph( (0, 0, self.width, self.height) )
for x in range(self.width):
for y in range(self.height):
self.grid.at((x, y)).walkable = True
self.grid.at((x, y)).transparent = True
self.grid.at((x, y)).tilesprite = 0 #random.choice([40, 28])
def split(self, single=False):
if single:
areas = {g.data: room_area(*g.data) for g in self.graph.walk()}
largest = sorted(self.graph.walk(), key=lambda g: areas[g.data])[-1]
largest.split()
else:
for room in self.graph.walk(): room.split()
self.fill_rooms()
def fill_rooms(self, features=None):
rooms = self.graph.walk()
#print(f"rooms: {len(rooms)}")
for i, g in enumerate(rooms):
X, Y, W, H = g.data
#c = [random.randint(0, 255) for _ in range(3)]
ts = room_area(*g.data) % 131 + i # modulo - consistent tile pick
for x in range(X, X+W):
for y in range(Y, Y+H):
self.grid.at((x, y)).tilesprite = ts
def wall_rooms(self):
self.walled_rooms = []
rooms = self.graph.walk()
for i, g in enumerate(rooms):
# unwalled / hallways: not selected for small dungeons, first, last, and 65% of all other rooms
if len(rooms) > 3 and i > 1 and i < len(rooms) - 2 and random.random() < 0.35:
self.walled_rooms.append(False)
continue
self.walled_rooms.append(True)
X, Y, W, H = g.data
for x in range(X, X+W):
self.grid.at((x, Y)).walkable = False
#self.grid.at((x, Y+H-1)).walkable = False
for y in range(Y, Y+H):
self.grid.at((X, y)).walkable = False
#self.grid.at((X+W-1, y)).walkable = False
# boundary of entire level
for x in range(0, self.width):
# self.grid.at((x, 0)).walkable = False
self.grid.at((x, self.height-1)).walkable = False
for y in range(0, self.height):
# self.grid.at((0, y)).walkable = False
self.grid.at((self.width-1, y)).walkable = False
def dig_path(self, start:"Tuple[int, int]", end:"Tuple[int, int]", walkable=True, color=None, sprite=None):
print(f"Digging: {start} -> {end}")
# get x1,y1 and x2,y2 coordinates: top left and bottom right points on the rect formed by two random points, one from each of the 2 rooms
x1 = min([start[0], end[0]])
x2 = max([start[0], end[0]])
dw = x2 - x1
y1 = min([start[1], end[1]])
y2 = max([start[1], end[1]])
dh = y2 - y1
# random: top left or bottom right as the corner between the paths
tx, ty = (x1, y1) if random.random() >= 0.5 else (x2, y2)
for x in range(x1, x1+dw):
try:
if walkable:
self.grid.at((x, ty)).walkable = walkable
if color:
self.grid.at((x, ty)).color = color
if sprite is not None:
self.grid.at((x, ty)).tilesprite = sprite
except:
pass
for y in range(y1, y1+dh):
try:
if walkable:
self.grid.at((tx, y)).walkable = True
if color:
self.grid.at((tx, y)).color = color
if sprite is not None:
self.grid.at((tx, y)).tilesprite = sprite
except:
pass
def generate(self, level_plan): #target_rooms = 5, features=None):
self.reset()
target_rooms = len(level_plan)
if type(level_plan) is set:
level_plan = random.choice(list(level_plan))
while len(self.graph.walk()) < target_rooms:
self.split(single=len(self.graph.walk()) > target_rooms * .5)
# Player path planning
#self.fill_rooms()
self.wall_rooms()
rooms = self.graph.walk()
feature_coords = []
prev_room = None
print(level_plan)
for room_num, room in enumerate(rooms):
room_plan = level_plan[room_num]
if type(room_plan) == str: room_plan = [room_plan] # single item plans became single-character plans...
for f in room_plan:
#feature_coords.append((f, room_coord(room, margin=4 if f in ("boulder",) else 1)))
# boulders are breaking my brain. If I can't get boulders away from walls with margin, I'm just going to dig them out.
if f == "boulder":
x, y = room_coord(room, margin=0)
if x < 2: x += 1
if y < 2: y += 1
if x > self.grid.grid_size[0] - 2: x -= 1
if y > self.grid.grid_size[1] - 2: y -= 1
for _x in (1, 0, -1):
for _y in (1, 0, -1):
self.grid.at((x + _x, y + _y)).walkable = True
feature_coords.append((f, (x, y)))
else:
feature_coords.append((f, room_coord(room, margin=0)))
print(feature_coords[-1])
## Hallway generation
# plow an inelegant path
if prev_room:
start = room_coord(prev_room, margin=2)
end = room_coord(room, margin=2)
self.dig_path(start, end, color=(0, 64, 0))
prev_room = room
# Tile painting
possibilities = None
while possibilities or possibilities is None:
possibilities = ct.wfc_pass(self.grid, possibilities)
## "hallway room" repainting
#for i, hall_room in enumerate(rooms):
# if self.walled_rooms[i]:
# print(f"walled room: {hall_room}")
# continue
# print(f"hall room: {hall_room}")
# x, y, w, h = hall_room.data
# for _x in range(x+1, x+w-1):
# for _y in range(y+1, y+h-1):
# self.grid.at((_x, _y)).walkable = False
# self.grid.at((_x, _y)).tilesprite = -1
# self.grid.at((_x, _y)).color = (0, 0, 0) # pit!
# targets = adjacent_rooms(hall_room, rooms)
# print(targets)
# for k, v in targets.items():
# self.dig_path(hall_room.center(), v, color=(64, 32, 32))
# for _, p in feature_coords:
# if hall_room.contains(p): self.dig_path(hall_room.center(), p, color=(92, 48, 48))
return feature_coords

300
src/scripts/cos_play.py Normal file
View File

@ -0,0 +1,300 @@
import mcrfpy
mcrfpy.createScene("play")
ui = mcrfpy.sceneUI("play")
t = mcrfpy.Texture("assets/kenney_tinydungeon.png", 16, 16) # 12, 11)
font = mcrfpy.Font("assets/JetbrainsMono.ttf")
frame_color = (64, 64, 128)
grid = mcrfpy.Grid(20, 15, t, 10, 10, 800, 595)
grid.zoom = 2.0
entity_frame = mcrfpy.Frame(815, 10, 194, 595, fill_color = frame_color)
inventory_frame = mcrfpy.Frame(10, 610, 800, 143, fill_color = frame_color)
stats_frame = mcrfpy.Frame(815, 610, 194, 143, fill_color = frame_color)
begin_btn = mcrfpy.Frame(350,250,100,100, fill_color = (255,0,0))
begin_btn.children.append(mcrfpy.Caption(5, 5, "Begin", font))
def cos_keys(key, state):
if key == 'M' and state == 'start':
mapgen()
elif state == "end": return
elif key == "W":
player.move("N")
elif key == "A":
player.move("W")
elif key == "S":
player.move("S")
elif key == "D":
player.move("E")
def cos_init(*args):
if args[3] != "start": return
mcrfpy.keypressScene(cos_keys)
ui.remove(4)
begin_btn.click = cos_init
[ui.append(e) for e in (grid, entity_frame, inventory_frame, stats_frame, begin_btn)]
import random
def rcolor():
return tuple([random.randint(0, 255) for i in range(3)]) # TODO list won't work with GridPoint.color, so had to cast to tuple
x_max, y_max = grid.grid_size
for x in range(x_max):
for y in range(y_max):
grid.at((x,y)).color = rcolor()
from math import pi, cos, sin
def mapgen(room_size_max = 7, room_size_min = 3, room_count = 4):
# reset map
for x in range(x_max):
for y in range(y_max):
grid.at((x, y)).walkable = False
grid.at((x, y)).transparent= False
grid.at((x,y)).tilesprite = random.choices([40, 28], weights=[.8, .2])[0]
global cos_entities
for e in cos_entities:
e.e.position = (999,999) # TODO
e.die()
cos_entities = []
#Dungeon generation
centers = []
attempts = 0
while len(centers) < room_count:
# Leaving this attempt here for later comparison. These rooms sucked.
# overlapping, uninteresting hallways, crowded into the corners sometimes, etc.
attempts += 1
if attempts > room_count * 15: break
# room_left = random.randint(1, x_max)
# room_top = random.randint(1, y_max)
# Take 2 - circular distribution of rooms
angle_mid = (len(centers) / room_count) * 2 * pi + 0.785
angle = random.uniform(angle_mid - 0.25, angle_mid + 0.25)
radius = random.uniform(3, 14)
room_left = int(radius * cos(angle)) + int(x_max/2)
if room_left <= 1: room_left = 1
if room_left > x_max - 1: room_left = x_max - 2
room_top = int(radius * sin(angle)) + int(y_max/2)
if room_top <= 1: room_top = 1
if room_top > y_max - 1: room_top = y_max - 2
room_w = random.randint(room_size_min, room_size_max)
if room_w + room_left >= x_max: room_w = x_max - room_left - 2
room_h = random.randint(room_size_min, room_size_max)
if room_h + room_top >= y_max: room_h = y_max - room_top - 2
#print(room_left, room_top, room_left + room_w, room_top + room_h)
if any( # centers contained in this randomly generated room
[c[0] >= room_left and c[0] <= room_left + room_w and c[1] >= room_top and c[1] <= room_top + room_h for c in centers]
):
continue # re-randomize the room position
centers.append(
(int(room_left + (room_w/2)), int(room_top + (room_h/2)))
)
for x in range(room_w):
for y in range(room_h):
grid.at((room_left+x, room_top+y)).walkable=True
grid.at((room_left+x, room_top+y)).transparent=True
grid.at((room_left+x, room_top+y)).tilesprite = random.choice([48, 49, 50, 51, 52, 53])
# generate a boulder
if (room_w > 2 and room_h > 2):
room_boulder_x, room_boulder_y = random.randint(room_left+1, room_left+room_w-1), random.randint(room_top+1, room_top+room_h-1)
cos_entities.append(BoulderEntity(room_boulder_x, room_boulder_y))
print(f"{room_count} rooms generated after {attempts} attempts.")
#print(centers)
# hallways
pairs = []
for c1 in centers:
for c2 in centers:
if c1 == c2: continue
if (c2, c1) in pairs or (c1, c2) in pairs: continue
left = min(c1[0], c2[0])
right = max(c1[0], c2[0])
top = min(c1[1], c2[1])
bottom = max(c1[1], c2[1])
corners = [(left, top), (left, bottom), (right, top), (right, bottom)]
corners.remove(c1)
corners.remove(c2)
random.shuffle(corners)
target, other = corners
for x in range(target[0], other[0], -1 if target[0] > other[0] else 1):
was_walkable = grid.at((x, target[1])).walkable
grid.at((x, target[1])).walkable=True
grid.at((x, target[1])).transparent=True
if not was_walkable:
grid.at((x, target[1])).tilesprite = random.choices([0, 12, 24], weights=[.6, .3, .1])[0]
for y in range(target[1], other[1], -1 if target[1] > other[1] else 1):
was_walkable = grid.at((target[0], y)).walkable
grid.at((target[0], y)).walkable=True
grid.at((target[0], y)).transparent=True
if not was_walkable:
grid.at((target[0], y)).tilesprite = random.choices([0, 12, 24], weights=[0.4, 0.3, 0.3])[0]
pairs.append((c1, c2))
# spawn exit and button
spawn_points = []
for x in range(x_max):
for y in range(y_max):
if grid.at((x, y)).walkable:
spawn_points.append((x, y))
random.shuffle(spawn_points)
door_spawn, button_spawn = spawn_points[:2]
cos_entities.append(ExitEntity(*door_spawn, *button_spawn))
# respawn player
global player
if player:
player.position = (999,999) # TODO - die() is broken and I don't know why
player = PlayerEntity()
#for x in range(x_max):
# for y in range(y_max):
# if grid.at((x, y)).walkable:
# #grid.at((x,y)).tilesprite = random.choice([48, 49, 50, 51, 52, 53])
# pass
# else:
# #grid.at((x,y)).tilesprite = random.choices([40, 28], weights=[.8, .2])[0]
#131 - last sprite
#123, 124 - brown, grey rats
#121 - ghost
#114, 115, 116 - green, red, blue potion
#102 - shield
#98 - low armor guy, #97 - high armor guy
#89 - chest, #91 - empty chest
#84 - wizard
#82 - barrel
#66 - boulder
#64, 65 - graves
#48 - 53: ground (not going to figure out how they fit together tonight)
#42 - button-looking ground
#40 - basic solid wall
#36, 37, 38 - wall (left, middle, right)
#28 solid wall but with a grate
#21 - wide open door, 33 medium open, 45 closed door
#0 - basic dirt
class MyEntity:
def __init__(self, x=0, y=0, sprite_num=86):
self.e = mcrfpy.Entity(x, y, t, sprite_num)
grid.entities.append(self.e)
def die(self):
for i in range(len(grid.entities)):
e = grid.entities[i]
if e == self.e:
grid.entities.remove(i)
break
def bump(self, other, dx, dy):
raise NotImplementedError
def try_move(self, dx, dy):
tx, ty = int(self.e.position[0] + dx), int(self.e.position[1] + dy)
for e in cos_entities:
if e.e.position == (tx, ty):
#print(f"bumping {e}")
return e.bump(self, dx, dy)
if tx < 0 or tx >= x_max:
#print("out of bounds horizontally")
return False
if ty < 0 or ty >= y_max:
#print("out of bounds vertically")
return False
if grid.at((tx, ty)).walkable == True:
#print("Motion!")
self.e.position = (tx, ty)
return True
else:
#print("Bonk")
return False
def _relative_move(self, dx, dy):
tx, ty = int(self.e.position[0] + dx), int(self.e.position[1] + dy)
self.e.position = (tx, ty)
def move(self, direction):
if direction == "N":
self.try_move(0, -1)
elif direction == "E":
self.try_move(1, 0)
elif direction == "S":
self.try_move(0, 1)
elif direction == "W":
self.try_move(-1, 0)
cos_entities = []
class PlayerEntity(MyEntity):
def __init__(self):
# find spawn point
spawn_points = []
for x in range(x_max):
for y in range(y_max):
if grid.at((x, y)).walkable:
spawn_points.append((x, y))
random.shuffle(spawn_points)
for spawn in spawn_points:
for e in cos_entities:
if e.e.position == spawn: break
else:
break
#print(f"spawn at {spawn}")
super().__init__(spawn[0], spawn[1], sprite_num=84)
class BoulderEntity(MyEntity):
def __init__(self, x, y):
super().__init__(x, y, 66)
def bump(self, other, dx, dy):
if type(other) == BoulderEntity:
#print("Boulders can't push boulders")
return False
tx, ty = int(self.e.position[0] + dx), int(self.e.position[1] + dy)
# Is the boulder blocked the same direction as the bumper? If not, let's both move
old_pos = int(self.e.position[0]), int(self.e.position[1])
if self.try_move(dx, dy):
other.e.position = old_pos
return True
class ButtonEntity(MyEntity):
def __init__(self, x, y, exit):
super().__init__(x, y, 42)
self.exit = exit
def bump(self, other, dx, dy):
if type(other) == BoulderEntity:
self.exit.unlock()
other._relative_move(dx, dy)
return True
class ExitEntity(MyEntity):
def __init__(self, x, y, bx, by):
super().__init__(x, y, 45)
self.my_button = ButtonEntity(bx, by, self)
self.unlocked = False
global cos_entities
cos_entities.append(self.my_button)
def unlock(self):
self.e.sprite_number = 21
self.unlocked = True
def lock(self):
self.e.sprite_number = 45
self.unlocked = True
def bump(self, other, dx, dy):
if type(other) == BoulderEntity:
return False
if self.unlocked:
other._relative_move(dx, dy)
player = None

View File

@ -1,223 +0,0 @@
tiles = {}
deltas = [
(-1, -1), ( 0, -1), (+1, -1),
(-1, 0), ( 0, 0), (+1, 0),
(-1, +1), ( 0, +1), (+1, +1)
]
class TileInfo:
GROUND, WALL, DONTCARE = True, False, None
chars = {
"X": WALL,
"_": GROUND,
"?": DONTCARE
}
symbols = {v: k for k, v in chars.items()}
def __init__(self, values:dict):
self._values = values
self.rules = []
self.chance = 1.0
@staticmethod
def from_grid(grid, xy:tuple):
values = {}
for d in deltas:
tx, ty = d[0] + xy[0], d[1] + xy[1]
try:
values[d] = grid.at((tx, ty)).walkable
except ValueError:
values[d] = True
return TileInfo(values)
@staticmethod
def from_string(s):
values = {}
for d, c in zip(deltas, s):
values[d] = TileInfo.chars[c]
return TileInfo(values)
def __hash__(self):
"""for use as a dictionary key"""
return hash(tuple(self._values.items()))
def match(self, other:"TileInfo"):
for d, rule in self._values.items():
if rule is TileInfo.DONTCARE: continue
if other._values[d] is TileInfo.DONTCARE: continue
if rule != other._values[d]: return False
return True
def show(self):
nine = ['', '', '\n'] * 3
for k, end in zip(deltas, nine):
c = TileInfo.symbols[self._values[k]]
print(c, end=end)
def __repr__(self):
return f"<TileInfo {self._values}>"
cardinal_directions = {
"N": ( 0, -1),
"S": ( 0, +1),
"E": (-1, 0),
"W": (+1, 0)
}
def special_rule_verify(rule, grid, xy, unverified_tiles, pass_unverified=False):
cardinal, allowed_tile = rule
dxy = cardinal_directions[cardinal.upper()]
tx, ty = xy[0] + dxy[0], xy[1] + dxy[1]
#print(f"Special rule: {cardinal} {allowed_tile} {type(allowed_tile)} -> ({tx}, {ty}) [{grid.at((tx, ty)).tilesprite}]{'*' if (tx, ty) in unverified_tiles else ''}")
if (tx, ty) in unverified_tiles and cardinal in "nsew": return pass_unverified
try:
return grid.at((tx, ty)).tilesprite == allowed_tile
except ValueError:
return False
import random
tile_of_last_resort = 431
def find_possible_tiles(grid, x, y, unverified_tiles=None, pass_unverified=False):
ti = TileInfo.from_grid(grid, (x, y))
if unverified_tiles is None: unverified_tiles = []
matches = [(k, v) for k, v in tiles.items() if k.match(ti)]
if not matches:
return []
possible = []
if not any([tileinfo.rules for tileinfo, _ in matches]):
# make weighted choice, as the tile does not depend on verification
wts = [k.chance for k, v in matches]
tileinfo, tile = random.choices(matches, weights=wts)[0]
return [tile]
for tileinfo, tile in matches:
if not tileinfo.rules:
possible.append(tile)
continue
for r in tileinfo.rules: #for r in ...: if ... continue == more readable than an "any" 1-liner
p = special_rule_verify(r, grid, (x,y),
unverified_tiles=unverified_tiles,
pass_unverified = pass_unverified
)
if p:
possible.append(tile)
continue
return list(set(list(possible)))
def wfc_first_pass(grid):
w, h = grid.grid_size
possibilities = {}
for x in range(0, w):
for y in range(0, h):
matches = find_possible_tiles(grid, x, y, pass_unverified=True)
if len(matches) == 0:
grid.at((x, y)).tilesprite = tile_of_last_resort
possibilities[(x,y)] = matches
elif len(matches) == 1:
grid.at((x, y)).tilesprite = matches[0]
else:
possibilities[(x,y)] = matches
return possibilities
def wfc_pass(grid, possibilities=None):
w, h = grid.grid_size
if possibilities is None:
#print("first pass results:")
possibilities = wfc_first_pass(grid)
counts = {}
for v in possibilities.values():
if len(v) in counts: counts[len(v)] += 1
else: counts[len(v)] = 1
#print(counts)
return possibilities
elif len(possibilities) == 0:
print("We're done!")
return
old_possibilities = possibilities
possibilities = {}
for (x, y) in old_possibilities.keys():
matches = find_possible_tiles(grid, x, y, unverified_tiles=old_possibilities.keys(), pass_unverified = True)
if len(matches) == 0:
print((x,y), matches)
grid.at((x, y)).tilesprite = tile_of_last_resort
possibilities[(x,y)] = matches
elif len(matches) == 1:
grid.at((x, y)).tilesprite = matches[0]
else:
grid.at((x, y)).tilesprite = -1
grid.at((x, y)).color = (32 * len(matches), 32 * len(matches), 32 * len(matches))
possibilities[(x,y)] = matches
if len(possibilities) == len(old_possibilities):
#print("No more tiles could be solved without collapse")
counts = {}
for v in possibilities.values():
if len(v) in counts: counts[len(v)] += 1
else: counts[len(v)] = 1
#print(counts)
if 0 in counts: del counts[0]
if len(counts) == 0:
print("Contrats! You broke it! (insufficient tile defs to solve remaining tiles)")
return []
target = min(list(counts.keys()))
while possibilities:
for (x, y) in possibilities.keys():
if len(possibilities[(x, y)]) != target:
continue
ti = TileInfo.from_grid(grid, (x, y))
matches = [(k, v) for k, v in tiles.items() if k.match(ti)]
verifiable_matches = find_possible_tiles(grid, x, y, unverified_tiles=possibilities.keys())
if not verifiable_matches: continue
#print(f"collapsing {(x, y)} ({target} choices)")
matches = [(k, v) for k, v in matches if v in verifiable_matches]
wts = [k.chance for k, v in matches]
tileinfo, tile = random.choices(matches, weights=wts)[0]
grid.at((x, y)).tilesprite = tile
del possibilities[(x, y)]
break
else:
selected = random.choice(list(possibilities.keys()))
#print(f"No tiles have verifable solutions: QUANTUM -> {selected}")
# sprinkle some quantumness on it
ti = TileInfo.from_grid(grid, (x, y))
matches = [(k, v) for k, v in tiles.items() if k.match(ti)]
wts = [k.chance for k, v in matches]
if not wts:
print(f"This one: {(x,y)} {matches}\n{wts}")
del possibilities[(x, y)]
return possibilities
tileinfo, tile = random.choices(matches, weights=wts)[0]
grid.at((x, y)).tilesprite = tile
del possibilities[(x, y)]
return possibilities
#with open("scripts/tile_def.txt", "r") as f:
with open("scripts/simple_tiles.txt", "r") as f:
for block in f.read().split('\n\n'):
info, constraints = block.split('\n', 1)
if '#' in info:
info, comment = info.split('#', 1)
rules = []
if '@' in info:
info, *block_rules = info.split('@')
#print(block_rules)
for r in block_rules:
rules.append((r[0], int(r[1:])))
#cardinal_dir = block_rules[0]
#partner
if ':' not in info:
tile_id = int(info)
chance = 1.0
else:
tile_id, chance = info.split(':')
tile_id = int(tile_id)
chance = float(chance.strip())
constraints = constraints.replace('\n', '')
k = TileInfo.from_string(constraints)
k.rules = rules
k.chance = chance
tiles[k] = tile_id

View File

@ -1,606 +1,51 @@
import mcrfpy
#t = mcrfpy.Texture("assets/kenney_tinydungeon.png", 16, 16) # 12, 11)
t = mcrfpy.Texture("assets/kenney_TD_MR_IP.png", 16, 16) # 12, 11)
btn_tex = mcrfpy.Texture("assets/48px_ui_icons-KenneyNL.png", 48, 48)
font = mcrfpy.Font("assets/JetbrainsMono.ttf")
texture = mcrfpy.Texture("assets/kenney_tinydungeon.png", 16, 16)
# build test widgets
mcrfpy.createScene("pytest")
mcrfpy.setScene("pytest")
ui = mcrfpy.sceneUI("pytest")
# Frame
f = mcrfpy.Frame(25, 19, 462, 346, fill_color=(255, 92, 92))
# fill (LinkedColor / Color): f.fill_color
# outline (LinkedColor / Color): f.outline_color
# pos (LinkedVector / Vector): f.pos
# size (LinkedVector / Vector): f.size
# Caption
c = mcrfpy.Caption(512+25, 19, "Hi.", font)
# fill (LinkedColor / Color): c.fill_color
#color_val = c.fill_color
print(c.fill_color)
print("Set a fill color")
c.fill_color = (255, 255, 255)
print("Lol, did it segfault?")
# outline (LinkedColor / Color): c.outline_color
# font (Font): c.font
# pos (LinkedVector / Vector): c.pos
# Sprite
s = mcrfpy.Sprite(25, 384+19, texture, 86, 9.0)
# pos (LinkedVector / Vector): s.pos
# texture (Texture): s.texture
# Grid
g = mcrfpy.Grid(10, 10, texture, 512+25, 384+19, 462, 346)
# texture (Texture): g.texture
# pos (LinkedVector / Vector): g.pos
# size (LinkedVector / Vector): g.size
for _x in range(10):
for _y in range(10):
g.at((_x, _y)).color = (255 - _x*25, 255 - _y*25, 255)
g.zoom = 2.0
[ui.append(d) for d in (f, c, s, g)]
print("built!")
# tests
frame_color = (64, 64, 128)
import random
import cos_entities as ce
import cos_level as cl
#import cos_tiles as ct
class Resources:
def __init__(self):
self.music_enabled = True
self.music_volume = 40
self.sfx_enabled = True
self.sfx_volume = 100
self.master_volume = 100
# load the music/sfx files here
self.splats = []
for i in range(1, 10):
mcrfpy.createSoundBuffer(f"assets/sfx/splat{i}.ogg")
def play_sfx(self, sfx_id):
if self.sfx_enabled and self.sfx_volume and self.master_volume:
mcrfpy.setSoundVolume(self.master_volume/100 * self.sfx_volume)
mcrfpy.playSound(sfx_id)
def play_music(self, track_id):
if self.music_enabled and self.music_volume and self.master_volume:
mcrfpy.setMusicVolume(self.master_volume/100 * self.music_volume)
mcrfpy.playMusic(...)
resources = Resources()
class Crypt:
def __init__(self):
mcrfpy.createScene("play")
self.ui = mcrfpy.sceneUI("play")
entity_frame = mcrfpy.Frame(815, 10, 194, 595, fill_color = frame_color)
inventory_frame = mcrfpy.Frame(10, 610, 800, 143, fill_color = frame_color)
stats_frame = mcrfpy.Frame(815, 610, 194, 143, fill_color = frame_color)
#self.level = cl.Level(30, 23)
self.entities = []
self.depth=1
self.stuck_btn = SweetButton(self.ui, (810, 700), "Stuck", icon=19, box_width=150, box_height = 60, click=self.stuck)
self.level_plan = {
1: [("spawn", "button", "boulder"), ("exit")],
2: [("spawn", "button", "boulder"), ("rat"), ("exit")],
3: [("spawn", "button", "boulder"), ("rat"), ("exit")],
4: [("spawn", "button", "rat"), ("boulder", "rat", "treasure"), ("exit")],
5: [("spawn", "button", "rat"), ("boulder", "rat"), ("exit")],
6: {(("spawn", "button"), ("boulder", "treasure", "exit")),
(("spawn", "boulder"), ("button", "treasure", "exit"))},
7: {(("spawn", "button"), ("boulder", "treasure", "exit")),
(("spawn", "boulder"), ("button", "treasure", "exit"))},
8: {(("spawn", "treasure", "button"), ("boulder", "treasure", "exit")),
(("spawn", "treasure", "boulder"), ("button", "treasure", "exit"))}
#9: self.lv_planner
}
# empty void for the player to initialize into
self.headsup = mcrfpy.Frame(10, 684, 320, 64, fill_color = (0, 0, 0, 0))
self.sidebar = mcrfpy.Frame(860, 4, 160, 600, fill_color = (96, 96, 160))
# Heads Up (health bar, armor bar) config
self.health_bar = [mcrfpy.Sprite(32*i, 2, t, 659, 2) for i in range(10)]
[self.headsup.children.append(i) for i in self.health_bar]
self.armor_bar = [mcrfpy.Sprite(32*i, 42, t, 659, 2) for i in range(10)]
[self.headsup.children.append(i) for i in self.armor_bar]
# (40, 3), caption, font, fill_color=font_color
self.stat_captions = mcrfpy.Caption((325,0), "HP:10\nDef:0(+0)", font, fill_color=(255, 255, 255))
self.stat_captions.outline = 3
self.stat_captions.outline_color = (0, 0, 0)
self.headsup.children.append(self.stat_captions)
# Side Bar (inventory, level info) config
self.level_caption = mcrfpy.Caption((5,5), "Level: 1", font, fill_color=(255, 255, 255))
self.level_caption.size = 26
self.level_caption.outline = 3
self.level_caption.outline_color = (0, 0, 0)
self.sidebar.children.append(self.level_caption)
self.inv_sprites = [mcrfpy.Sprite(15, 70 + 95*i, t, 659, 6.0) for i in range(5)]
for i in self.inv_sprites:
self.sidebar.children.append(i)
self.key_captions = [
mcrfpy.Sprite(75, 130 + (95*2) + 95 * i, t, 384 + i, 3.0) for i in range(3)
]
for i in self.key_captions:
self.sidebar.children.append(i)
self.inv_captions = [
mcrfpy.Caption((25, 130 + 95 * i), "x", font, fill_color=(255, 255, 255)) for i in range(5)
]
for i in self.inv_captions:
self.sidebar.children.append(i)
liminal_void = mcrfpy.Grid(1, 1, t, (0, 0), (16, 16))
self.grid = liminal_void
self.player = ce.PlayerEntity(game=self)
self.spawn_point = (0, 0)
# level creation moves player to the game level at the generated spawn point
self.create_level(self.depth)
#self.grid = mcrfpy.Grid(20, 15, t, (10, 10), (1014, 758))
self.swap_level(self.level, self.spawn_point)
# Test Entities
#ce.BoulderEntity(9, 7, game=self)
#ce.BoulderEntity(9, 8, game=self)
#ce.ExitEntity(12, 6, 14, 4, game=self)
# scene setup
## might be done by self.swap_level
#[self.ui.append(e) for e in (self.grid, self.stuck_btn.base_frame)] # entity_frame, inventory_frame, stats_frame)]
self.possibilities = None # track WFC possibilities between rounds
self.enemies = []
#mcrfpy.setTimer("enemy_test", self.enemy_movement, 750)
#mcrfpy.Frame(x, y, box_width+shadow_offset, box_height, fill_color = (0, 0, 0, 255))
#Sprite(0, 3, btn_tex, icon, icon_scale)
#def enemy_movement(self, *args):
# for e in self.enemies: e.act()
#def spawn_test_rat(self):
# success = False
# while not success:
# x, y = [random.randint(0, i-1) for i in self.grid.grid_size]
# success = self.grid.at((x,y)).walkable
# self.enemies.append(ce.EnemyEntity(x, y, game=self))
def gui_update(self):
self.stat_captions.text = f"HP:{self.player.hp}\nDef:{self.player.calc_defense()}(+{self.player.calc_defense() - self.player.base_defense})"
for i, hs in enumerate(self.health_bar):
full_hearts = self.player.hp - (i*2)
empty_hearts = self.player.max_hp - (i*2)
hs.sprite_number = 659
if empty_hearts >= 2:
hs.sprite_number = 208
if full_hearts >= 2:
hs.sprite_number = 210
elif full_hearts == 1:
hs.sprite_number = 209
for i, arm_s in enumerate(self.armor_bar):
full_hearts = self.player.calc_defense() - (i*2)
arm_s.sprite_number = 659
if full_hearts >= 2:
arm_s.sprite_number = 211
elif full_hearts == 1:
arm_s.sprite_number = 212
#items = self.player.equipped[:] + self.player.inventory[:]
for i in range(5):
if i == 0:
item = self.player.equipped[0] if len(self.player.equipped) > 0 else None
elif i == 1:
item = self.player.equipped[1] if len(self.player.equipped) > 1 else None
elif i == 2:
item = self.player.inventory[0] if len(self.player.inventory) > 0 else None
elif i == 3:
item = self.player.inventory[1] if len(self.player.inventory) > 1 else None
elif i == 4:
item = self.player.inventory[2] if len(self.player.inventory) > 2 else None
if item is None:
self.inv_sprites[i].sprite_number = 659
if i > 1: self.key_captions[i - 2].sprite_number = 659
self.inv_captions[i].text = ""
continue
self.inv_sprites[i].sprite_number = item.sprite
if i > 1:
self.key_captions[i - 2].sprite_number = 384 + (i - 2)
self.inv_captions[i].text = "Blah"
def lv_planner(self, target_level):
"""Plan room sequence in levels > 9"""
monsters = (target_level - 6) // 2
target_rooms = min(int(target_level // 2), 6)
target_treasure = min(int(target_level // 3), 4)
rooms = []
for i in range(target_rooms):
rooms.append([])
for o in ("spawn", "boulder", "button", "exit"):
r = random.randint(0, target_rooms-1)
rooms[r].append(o)
monster_table = {
"rat": int(monsters * 0.8) + 2,
"big rat": max(int(monsters * 0.2) - 2, 0),
"cyclops": max(int(monsters * 0.1) - 3, 0)
}
monster_table = {k: v for k, v in monster_table.items() if v > 0}
monster_names = list(monster_table.keys())
monster_weights = [monster_table[k] for k in monster_names]
for m in range(monsters):
r = random.randint(0, target_rooms - 1)
rooms[r].append(random.choices(monster_names, weights = monster_weights)[0])
for t in range(target_treasure):
r = random.randint(0, target_rooms - 1)
rooms[r].append("treasure")
return rooms
def treasure_planner(self, treasure_level):
"""Plan treasure contents at all levels"""
item_minlv = {
"buckler": 1,
"shield": 2,
"sword": 1,
"sword2": 2,
"sword3": 5,
"axe": 1,
"axe2": 2,
"axe3": 5,
"wand": 1,
"staff": 2,
"staff2": 5,
"red_pot": 3,
"blue_pot": 6,
"green_pot": 6,
"grey_pot": 6,
"sm_grey_pot": 1
}
base_wts = {
("buckler", "shield"): 0.25, # defensive items
("sword", "sword2", "axe", "axe2"): 0.4, #1h weapons
("sword3", "axe3"): 0.25, #2h weapons
("wand", "staff", "staff2"): 0.15, #magic weapons
("red_pot",): 0.25, #health
("blue_pot", "green_pot", "grey_pot", "sm_grey_pot"): 0.2 #stat upgrade potions
}
# find item name in base_wts key (base weight of the category)
base_weight = lambda s: base_wts[list([t for t in base_wts.keys() if s in t])[0]]
weights = {d[0]: base_weight(d[0]) for d in item_minlv.items() if treasure_level > d[1]}
if self.player.archetype is None:
prefs = []
elif self.player.archetype == "viking":
prefs = ["axe2", "axe3", "green_pot"]
elif self.player.archetype == "knight":
prefs = ["sword2", "shield", "grey_pot"]
elif self.player.archetype == "wizard":
prefs = ["staff", "staff2", "blue_pot"]
for i in prefs:
if i in weights: weights[i] *= 3
return weights
def start(self):
resources.play_sfx(1)
mcrfpy.setScene("play")
mcrfpy.keypressScene(self.cos_keys)
def add_entity(self, e:ce.COSEntity):
self.entities.append(e)
self.entities.sort(key = lambda e: e.draw_order, reverse=False)
# hack / workaround for grid.entities not interable
while len(self.grid.entities): # while there are entities on the grid,
self.grid.entities.remove(0) # remove the 1st ("0th")
for e in self.entities:
self.grid.entities.append(e._entity)
def create_level(self, depth, _luck = 0):
#if depth < 3:
# features = None
self.level = cl.Level(20, 20)
self.grid = self.level.grid
if depth in self.level_plan:
plan = self.level_plan[depth]
else:
plan = self.lv_planner(depth)
coords = self.level.generate(plan)
self.entities = []
if self.player:
luck = self.player.luck
else:
luck = 0
buttons = []
for k, v in sorted(coords, key=lambda i: i[0]): # "button" before "exit"; "button", "button", "door", "exit" -> alphabetical is correct sequence
if k == "spawn":
if self.player:
self.add_entity(self.player)
#self.player.draw_pos = v
self.spawn_point = v
elif k == "boulder":
ce.BoulderEntity(v[0], v[1], game=self)
elif k == "treasure":
ce.TreasureEntity(v[0], v[1], treasure_table = self.treasure_planner(depth + luck), game=self)
elif k == "button":
buttons.append(v)
elif k == "exit":
btn = buttons.pop(0)
ce.ExitEntity(v[0], v[1], btn[0], btn[1], game=self)
elif k == "rat":
ce.EnemyEntity(*v, game=self)
elif k == "big rat":
ce.EnemyEntity(*v, game=self, base_damage=2, hp=4, sprite=130)
elif k == "cyclops":
ce.EnemyEntity(*v, game=self, base_damage=3, hp=8, sprite=109, base_defense=2)
#if self.depth > 2:
#for i in range(10):
# self.spawn_test_rat()
def stuck(self, sweet_btn, args):
if args[3] == "end": return
self.create_level(self.depth)
self.swap_level(self.level, self.spawn_point)
def cos_keys(self, key, state):
d = None
if state == "end": return
elif key == "W": d = (0, -1)
elif key == "A": d = (-1, 0)
elif key == "S": d = (0, 1)
elif key == "D": d = (1, 0)
#elif key == "M": self.level.generate()
#elif key == "R":
# self.level.reset()
# self.possibilities = None
#elif key == "T":
# self.level.split()
# self.possibilities = None
#elif key == "Y": self.level.split(single=True)
#elif key == "U": self.level.highlight(+1)
#elif key == "I": self.level.highlight(-1)
#elif key == "O":
# self.level.wall_rooms()
# self.possibilities = None
#elif key == "P": ct.format_tiles(self.grid)
#elif key == "P":
#self.possibilities = ct.wfc_pass(self.grid, self.possibilities)
elif key == "P":
self.depth += 1
print(f"Descending: lv {self.depth}")
self.stuck(None, [1,2,3,4])
elif key == "Period":
self.enemy_turn()
elif key == "X":
self.pull_boulder_search()
#else:
# print(key)
if d:
self.entities.sort(key = lambda e: e.draw_order, reverse=False)
self.player.try_move(*d)
self.enemy_turn()
def enemy_turn(self):
self.entities.sort(key = lambda e: e.draw_order, reverse=False)
for e in self.entities:
e.act()
self.gui_update()
def pull_boulder_search(self):
for dx, dy in ( (0, -1), (-1, 0), (1, 0), (0, 1) ):
for e in self.entities:
if e.draw_pos != (self.player.draw_pos[0] + dx, self.player.draw_pos[1] + dy): continue
if type(e) == ce.BoulderEntity:
self.pull_boulder_move((dx, dy), e)
return self.enemy_turn()
else:
print("No boulder found to pull.")
def pull_boulder_move(self, p, target_boulder):
print(p, target_boulder)
self.entities.sort(key = lambda e: e.draw_order, reverse=False)
if self.player.try_move(-p[0], -p[1], test=True):
old_pos = self.player.draw_pos
self.player.try_move(-p[0], -p[1])
target_boulder.do_move(*old_pos)
def swap_level(self, new_level, spawn_point):
self.level = new_level
self.grid = self.level.grid
self.grid.zoom = 2.0
# TODO, make an entity mover function
#self.add_entity(self.player)
self.player.grid = self.grid
self.player.draw_pos = spawn_point
#self.grid.entities.append(self.player._entity)
# reform UI (workaround to ui collection iterators crashing)
while len(self.ui) > 0:
try:
self.ui.remove(0)
except:
pass
self.ui.append(self.grid)
self.ui.append(self.stuck_btn.base_frame)
self.ui.append(self.headsup)
self.level_caption.text = f"Level: {self.depth}"
self.ui.append(self.sidebar)
self.gui_update()
class SweetButton:
def __init__(self, ui:mcrfpy.UICollection,
pos:"Tuple[int, int]",
caption:str, font=font, font_size=24, font_color=(255,255,255), font_outline_color=(0, 0, 0), font_outline_width=2,
shadow_offset = 8, box_width=200, box_height = 80, shadow_color=(64, 64, 86), box_color=(96, 96, 160),
icon=4, icon_scale=1.75, click=lambda *args: None):
self.ui = ui
self.shadow_box = mcrfpy.Frame
x, y = pos
# box w/ drop shadow
self.shadow_offset = shadow_offset
self.base_frame = mcrfpy.Frame(x, y, box_width+shadow_offset, box_height, fill_color = (0, 0, 0, 255))
self.base_frame.click = self.do_click
# drop shadow won't need configured, append directly
self.base_frame.children.append(mcrfpy.Frame(0, 0, box_width, box_height, fill_color = shadow_color))
# main button is where the content lives
self.main_button = mcrfpy.Frame(shadow_offset, shadow_offset, box_width, box_height, fill_color = box_color)
self.click = click
self.base_frame.children.append(self.main_button)
# main button icon
self.icon = mcrfpy.Sprite(0, 3, btn_tex, icon, icon_scale)
self.main_button.children.append(self.icon)
# main button caption
self.caption = mcrfpy.Caption((40, 3), caption, font, fill_color=font_color)
self.caption.size = font_size
self.caption.outline_color=font_outline_color
self.caption.outline=font_outline_width
self.main_button.children.append(self.caption)
def unpress(self):
"""Helper func for when graphics changes or glitches make the button stuck down"""
self.main_button.x, self.main_button.y = (self.shadow_offset, self.shadow_offset)
def do_click(self, x, y, mousebtn, event):
if event == "start":
self.main_button.x, self.main_button.y = (0, 0)
elif event == "end":
self.main_button.x, self.main_button.y = (self.shadow_offset, self.shadow_offset)
result = self.click(self, (x, y, mousebtn, event))
if result: # return True from event function to instantly un-pop
self.main_button.x, self.main_button.y = (self.shadow_offset, self.shadow_offset)
@property
def text(self):
return self.caption.text
@text.setter
def text(self, value):
self.caption.text = value
@property
def sprite_number(self):
return self.icon.sprite_number
@sprite_number.setter
def sprite_number(self, value):
self.icon.sprite_number = value
class MainMenu:
def __init__(self):
mcrfpy.createScene("menu")
self.ui = mcrfpy.sceneUI("menu")
mcrfpy.setScene("menu")
self.crypt = None
components = []
# demo grid
#components.append(
# )
# title text
drop_shadow = mcrfpy.Caption((150, 10), "Crypt Of Sokoban", font, fill_color=(96, 96, 96), outline_color=(192, 0, 0))
drop_shadow.outline = 3
drop_shadow.size = 64
components.append(
drop_shadow
)
title_txt = mcrfpy.Caption((158, 18), "Crypt Of Sokoban", font, fill_color=(255, 255, 255))
title_txt.size = 64
components.append(
title_txt
)
# toast: text over the demo grid that fades out on a timer
self.toast = mcrfpy.Caption((150, 400), "", font, fill_color=(0, 0, 0))
self.toast.size = 28
self.toast.outline = 2
self.toast.outline_color = (255, 255, 255)
self.toast_event = None
components.append(self.toast)
# button - PLAY
#playbtn = mcrfpy.Frame(284, 548, 456, 120, fill_color =
play_btn = SweetButton(self.ui, (284, 548), "PLAY", box_width=456, box_height=110, icon=1, icon_scale=2.0, click=self.play)
components.append(play_btn.base_frame)
# button - config menu pane
#self.config = lambda self, sweet_btn, *args: print(f"boop, sweet button {sweet_btn} config {args}")
config_btn = SweetButton(self.ui, (10, 678), "Settings", icon=2, click=self.show_config)
components.append(config_btn.base_frame)
# button - insta-1080p scaling
scale_btn = SweetButton(self.ui, (10+256, 678), "Scale up\nto 1080p", icon=15, click=self.scale)
self.scaled = False
components.append(scale_btn.base_frame)
# button - music toggle
music_btn = SweetButton(self.ui, (10+256*2, 678), "Music\nON", icon=12, click=self.music_toggle)
self.music_enabled = True
self.music_volume = 40
components.append(music_btn.base_frame)
# button - sfx toggle
sfx_btn = SweetButton(self.ui, (10+256*3, 678), "SFX\nON", icon=0, click=self.sfx_toggle)
self.sfx_enabled = True
self.sfx_volume = 40
components.append(sfx_btn.base_frame)
[self.ui.append(e) for e in components]
def toast_say(self, txt, delay=10):
"kick off a toast event"
if self.toast_event is not None:
mcrfpy.delTimer("toast_timer")
self.toast.text = txt
self.toast_event = 350
self.toast.fill_color = (255, 255, 255, 255)
self.toast.outline = 2
self.toast.outline_color = (0, 0, 0, 255)
mcrfpy.setTimer("toast_timer", self.toast_callback, 100)
def toast_callback(self, *args):
"fade out the toast text"
self.toast_event -= 5
if self.toast_event < 0:
self.toast_event = None
mcrfpy.delTimer("toast_timer")
mcrfpy.text = ""
return
a = min(self.toast_event, 255)
self.toast.fill_color = (255, 255, 255, a)
self.toast.outline_color = (0, 0, 0, a)
def show_config(self, sweet_btn, args):
self.toast_say("Beep, Boop! Configurations will go here.")
def play(self, sweet_btn, args):
#if args[3] == "start": return # DRAMATIC on release action!
if args[3] == "end": return
self.crypt = Crypt()
#mcrfpy.setScene("play")
self.crypt.start()
def scale(self, sweet_btn, args, window_scale=None):
if args[3] == "end": return
if not window_scale:
self.scaled = not self.scaled
window_scale = 1.3
else:
self.scaled = True
sweet_btn.unpress()
if self.scaled:
self.toast_say("Windowed mode only, sorry!\nCheck Settings for for fine-tuned controls.")
mcrfpy.setScale(window_scale)
sweet_btn.text = "Scale down\n to 1.0x"
else:
mcrfpy.setScale(1.0)
sweet_btn.text = "Scale up\nto 1080p"
def music_toggle(self, sweet_btn, args):
if args[3] == "end": return
self.music_enabled = not self.music_enabled
print(f"music: {self.music_enabled}")
if self.music_enabled:
mcrfpy.setMusicVolume(self.music_volume)
sweet_btn.text = "Music is ON"
sweet_btn.sprite_number = 12
else:
self.toast_say("Use your volume keys or\nlook in Settings for a volume meter.")
mcrfpy.setMusicVolume(0)
sweet_btn.text = "Music is OFF"
sweet_btn.sprite_number = 17
def sfx_toggle(self, sweet_btn, args):
if args[3] == "end": return
self.sfx_enabled = not self.sfx_enabled
print(f"sfx: {self.sfx_enabled}")
if self.sfx_enabled:
mcrfpy.setSoundVolume(self.sfx_volume)
sweet_btn.text = "SFX are ON"
sweet_btn.sprite_number = 0
else:
self.toast_say("Use your volume keys or\nlook in Settings for a volume meter.")
mcrfpy.setSoundVolume(0)
sweet_btn.text = "SFX are OFF"
sweet_btn.sprite_number = 17
mainmenu = MainMenu()

221
src/scripts/game_old.py Normal file
View File

@ -0,0 +1,221 @@
#print("Hello mcrogueface")
import mcrfpy
import cos_play
# Universal stuff
font = mcrfpy.Font("assets/JetbrainsMono.ttf")
texture = mcrfpy.Texture("assets/kenney_tinydungeon.png", 16, 16) #12, 11)
texture_cold = mcrfpy.Texture("assets/kenney_ice.png", 16, 16) #12, 11)
texture_hot = mcrfpy.Texture("assets/kenney_lava.png", 16, 16) #12, 11)
# Test stuff
mcrfpy.createScene("boom")
mcrfpy.setScene("boom")
ui = mcrfpy.sceneUI("boom")
box = mcrfpy.Frame(40, 60, 200, 300, fill_color=(255,128,0), outline=4.0, outline_color=(64,64,255,96))
ui.append(box)
#caption = mcrfpy.Caption(10, 10, "Clicky", font, (255, 255, 255, 255), (0, 0, 0, 255))
#box.click = lambda x, y, btn, type: print("Hello callback: ", x, y, btn, type)
#box.children.append(caption)
test_sprite_number = 86
sprite = mcrfpy.Sprite(20, 60, texture, test_sprite_number, 4.0)
spritecap = mcrfpy.Caption(5, 5, "60", font)
def click_sprite(x, y, btn, action):
global test_sprite_number
if action != "start": return
if btn in ("left", "wheel_up"):
test_sprite_number -= 1
elif btn in ("right", "wheel_down"):
test_sprite_number += 1
sprite.sprite_number = test_sprite_number # TODO - inconsistent naming for __init__, __repr__ and getsetter: sprite_number vs sprite_index
spritecap.text = test_sprite_number
sprite.click = click_sprite # TODO - sprites don't seem to correct for screen position or scale when clicking
box.children.append(sprite)
box.children.append(spritecap)
box.click = click_sprite
f_a = mcrfpy.Frame(250, 60, 80, 80, fill_color=(255, 92, 92))
f_a_txt = mcrfpy.Caption(5, 5, "0", font)
f_b = mcrfpy.Frame(340, 60, 80, 80, fill_color=(92, 255, 92))
f_b_txt = mcrfpy.Caption(5, 5, "0", font)
f_c = mcrfpy.Frame(430, 60, 80, 80, fill_color=(92, 92, 255))
f_c_txt = mcrfpy.Caption(5, 5, "0", font)
ui.append(f_a)
f_a.children.append(f_a_txt)
ui.append(f_b)
f_b.children.append(f_b_txt)
ui.append(f_c)
f_c.children.append(f_c_txt)
import sys
def ding(*args):
f_a_txt.text = str(sys.getrefcount(ding)) + " refs"
f_b_txt.text = sys.getrefcount(dong)
f_c_txt.text = sys.getrefcount(stress_test)
def dong(*args):
f_a_txt.text = str(sys.getrefcount(ding)) + " refs"
f_b_txt.text = sys.getrefcount(dong)
f_c_txt.text = sys.getrefcount(stress_test)
running = False
timers = []
def add_ding():
global timers
n = len(timers)
mcrfpy.setTimer(f"timer{n}", ding, 100)
print("+1 ding:", timers)
def add_dong():
global timers
n = len(timers)
mcrfpy.setTimer(f"timer{n}", dong, 100)
print("+1 dong:", timers)
def remove_random():
global timers
target = random.choice(timers)
print("-1 timer:", target)
print("remove from list")
timers.remove(target)
print("delTimer")
mcrfpy.delTimer(target)
print("done")
import random
import time
def stress_test(*args):
global running
global timers
if not running:
print("stress test initial")
running = True
timers.append("recurse")
add_ding()
add_dong()
mcrfpy.setTimer("recurse", stress_test, 1000)
mcrfpy.setTimer("terminate", lambda *args: mcrfpy.delTimer("recurse"), 30000)
ding(); dong()
else:
#print("stress test random activity")
#random.choice([
# add_ding,
# add_dong,
# remove_random
# ])()
#print(timers)
print("Segfaultin' time")
mcrfpy.delTimer("recurse")
print("Does this still work?")
time.sleep(0.5)
print("How about now?")
stress_test()
# Loading Screen
mcrfpy.createScene("loading")
ui = mcrfpy.sceneUI("loading")
#mcrfpy.setScene("loading")
logo_texture = mcrfpy.Texture("assets/temp_logo.png", 1024, 1024)#1, 1)
logo_sprite = mcrfpy.Sprite(50, 50, logo_texture, 0, 0.5)
ui.append(logo_sprite)
logo_sprite.click = lambda *args: mcrfpy.setScene("menu")
logo_caption = mcrfpy.Caption(70, 600, "Click to Proceed", font, (255, 0, 0, 255), (0, 0, 0, 255))
#logo_caption.fill_color =(255, 0, 0, 255)
ui.append(logo_caption)
# menu screen
mcrfpy.createScene("menu")
for e in [
mcrfpy.Caption(10, 10, "Crypt of Sokoban", font, (255, 255, 255), (0, 0, 0)),
mcrfpy.Caption(20, 55, "a McRogueFace demo project", font, (192, 192, 192), (0, 0, 0)),
mcrfpy.Frame(15, 70, 150, 60, fill_color=(64, 64, 128)),
mcrfpy.Frame(15, 145, 150, 60, fill_color=(64, 64, 128)),
mcrfpy.Frame(15, 220, 150, 60, fill_color=(64, 64, 128)),
mcrfpy.Frame(15, 295, 150, 60, fill_color=(64, 64, 128)),
#mcrfpy.Frame(900, 10, 100, 100, fill_color=(255, 0, 0)),
]:
mcrfpy.sceneUI("menu").append(e)
def click_once(fn):
def wraps(*args, **kwargs):
#print(args)
action = args[3]
if action != "start": return
return fn(*args, **kwargs)
return wraps
@click_once
def asdf(x, y, btn, action):
print(f"clicky @({x},{y}) {action}->{btn}")
@click_once
def clicked_exit(*args):
mcrfpy.exit()
menu_btns = [
("Boom", lambda *args: 1 / 0),
("Exit", clicked_exit),
("About", lambda *args: mcrfpy.setScene("about")),
("Settings", lambda *args: mcrfpy.setScene("settings")),
("Start", lambda *args: mcrfpy.setScene("play"))
]
for i in range(len(mcrfpy.sceneUI("menu"))):
e = mcrfpy.sceneUI("menu")[i] # TODO - fix iterator
#print(e, type(e))
if type(e) is not mcrfpy.Frame: continue
label, fn = menu_btns.pop()
#print(label)
e.children.append(mcrfpy.Caption(5, 5, label, font, (192, 192, 255), (0,0,0)))
e.click = fn
# settings screen
mcrfpy.createScene("settings")
window_scaling = 1.0
scale_caption = mcrfpy.Caption(180, 70, "1.0x", font, (255, 255, 255), (0, 0, 0))
#scale_caption.fill_color = (255, 255, 255) # TODO - mcrfpy.Caption.__init__ is not setting colors
for e in [
mcrfpy.Caption(10, 10, "Settings", font, (255, 255, 255), (0, 0, 0)),
mcrfpy.Frame(15, 70, 150, 60, fill_color=(64, 64, 128)), # +
mcrfpy.Frame(300, 70, 150, 60, fill_color=(64, 64, 128)), # -
mcrfpy.Frame(15, 295, 150, 60, fill_color=(64, 64, 128)),
scale_caption,
]:
mcrfpy.sceneUI("settings").append(e)
@click_once
def game_scale(x, y, btn, action, delta):
global window_scaling
print(f"WIP - scale the window from {window_scaling:.1f} to {window_scaling+delta:.1f}")
window_scaling += delta
scale_caption.text = f"{window_scaling:.1f}x"
mcrfpy.setScale(window_scaling)
#mcrfpy.setScale(2)
settings_btns = [
("back", lambda *args: mcrfpy.setScene("menu")),
("-", lambda x, y, btn, action: game_scale(x, y, btn, action, -0.1)),
("+", lambda x, y, btn, action: game_scale(x, y, btn, action, +0.1))
]
for i in range(len(mcrfpy.sceneUI("settings"))):
e = mcrfpy.sceneUI("settings")[i] # TODO - fix iterator
#print(e, type(e))
if type(e) is not mcrfpy.Frame: continue
label, fn = settings_btns.pop()
#print(label, fn)
e.children.append(mcrfpy.Caption(5, 5, label, font, (192, 192, 255), (0,0,0)))
e.click = fn

View File

@ -1,144 +0,0 @@
145# open space
???
?_?
???
184:0.03# open space variant
???
?_?
???
146# lone wall / pillar
___
_X_
___
132# top left corner
?_?
_XX
?X?
133# plain horizontal wall
???
XXX
?_?
182:0.04# plain horizontal wall variant
???
XXX
?_?
183:0.04# plain horizontal wall variant
???
XXX
?_?
157:0.01# plain horizontal wall variant
???
XXX
?_?
135# top right corner
?_?
XX_
?X?
144@N132@s144@n144@n192@s192@S156@n171@s169@n180# Left side wall. Space on both sides rule may make the dungeon less robust (no double-walls allowed)
?X?
?X_
?X?
147@N135@s147@n147@n193@s193@S159@n170@s168@n181# Right side wall
?X?
_X?
?X?
156# bottom left corner
?X?
_XX
?_?
159# bottom right corner
?X?
XX_
?_?
192@n144@s144@s169# vertical T, left wall
?X?
?XX
?X?
193@n147@s147@s168# vertical T, right wall
?X?
XX?
?X?
180@s144@s144@s169# horizontal T, left wall
???
XXX
?X?
181@s147@s147@s168# horizontal T, right wall
???
XXX
?X?
195@W133@W182@W183@W157# wall for edge of a gap
??_
XX_
?__
195
?__
XX_
?__
194@E133@E182@E183@E157# wall for edge of a gap (R)
_??
_XX
__?
194
__?
_XX
__?
195@W133@W182@W183@W157# wall for edge of a gap
?__
XX_
??_
194@E133@E182@E183@E157# wall for edge of a gap (R)
__?
_XX
_??
195@W133@W182@W183@W157# wall for edge of a gap
??_
XX_
?__
194@E133@E182@E183@E157# wall for edge of a gap (R)
_??
_XX
__?
168@n147@n170@n135@n181@n193# right vertical wall, gap below
?X?
_X_
?_?
169@n144@n171@n132@n192@n180# left vertical wall, gap below
?X?
_X_
?_?
170@s147@s168@s133@s182@s183@s157@s193@s181# right vertical wall, gap above
?_?
_X_
?X?
171@s144@s169@s133@s182@s183@s157@s171@s180# left vertical wall, gap above
?_?
_X_
?X?