Compare commits
3 Commits
master
...
standardiz
Author | SHA1 | Date |
---|---|---|
|
5009fa0fb9 | |
|
a19781b56a | |
|
159658521c |
|
@ -46,7 +46,7 @@ endif()
|
|||
|
||||
# Add the directory where the linker should look for the libraries
|
||||
#link_directories(${CMAKE_SOURCE_DIR}/deps_linux)
|
||||
link_directories(${CMAKE_SOURCE_DIR}/__lib)
|
||||
link_directories(${CMAKE_SOURCE_DIR}/lib)
|
||||
|
||||
# Define the executable target before linking libraries
|
||||
add_executable(mcrogueface ${SOURCES})
|
||||
|
@ -67,9 +67,9 @@ add_custom_command(TARGET mcrogueface POST_BUILD
|
|||
# Copy Python standard library to build directory
|
||||
add_custom_command(TARGET mcrogueface POST_BUILD
|
||||
COMMAND ${CMAKE_COMMAND} -E copy_directory
|
||||
${CMAKE_SOURCE_DIR}/__lib $<TARGET_FILE_DIR:mcrogueface>/lib)
|
||||
${CMAKE_SOURCE_DIR}/lib $<TARGET_FILE_DIR:mcrogueface>/lib)
|
||||
|
||||
# rpath for including shared libraries
|
||||
set_target_properties(mcrogueface PROPERTIES
|
||||
INSTALL_RPATH "$ORIGIN/./lib")
|
||||
INSTALL_RPATH "./lib")
|
||||
|
||||
|
|
Binary file not shown.
Before Width: | Height: | Size: 181 KiB |
Binary file not shown.
Before Width: | Height: | Size: 674 KiB |
Binary file not shown.
Binary file not shown.
Binary file not shown.
Binary file not shown.
Binary file not shown.
Binary file not shown.
Binary file not shown.
Binary file not shown.
Binary file not shown.
|
@ -9,10 +9,10 @@ GameEngine::GameEngine()
|
|||
{
|
||||
Resources::font.loadFromFile("./assets/JetbrainsMono.ttf");
|
||||
Resources::game = this;
|
||||
window_title = "Crypt of Sokoban - 7DRL 2025, McRogueface Engine";
|
||||
window_title = "McRogueFace - 7DRL 2024 Engine Demo";
|
||||
window.create(sf::VideoMode(1024, 768), window_title, sf::Style::Titlebar | sf::Style::Close);
|
||||
visible = window.getDefaultView();
|
||||
window.setFramerateLimit(60);
|
||||
window.setFramerateLimit(30);
|
||||
scene = "uitest";
|
||||
scenes["uitest"] = new UITestScene(this);
|
||||
|
||||
|
@ -59,14 +59,11 @@ void GameEngine::run()
|
|||
if (!paused)
|
||||
{
|
||||
}
|
||||
currentScene()->render();
|
||||
currentScene()->sRender();
|
||||
currentFrame++;
|
||||
frameTime = clock.restart().asSeconds();
|
||||
fps = 1 / frameTime;
|
||||
int whole_fps = (int)fps;
|
||||
int tenth_fps = int(fps * 100) % 10;
|
||||
//window.setTitle(window_title + " " + std::to_string(fps) + " FPS");
|
||||
window.setTitle(window_title + " " + std::to_string(whole_fps) + "." + std::to_string(tenth_fps) + " FPS");
|
||||
window.setTitle(window_title + " " + std::to_string(fps) + " FPS");
|
||||
}
|
||||
}
|
||||
|
||||
|
|
|
@ -84,15 +84,9 @@ PyObject* PyInit_mcrfpy()
|
|||
auto t = pytypes[i];
|
||||
while (t != nullptr)
|
||||
{
|
||||
std::cout << "Registering type: " << t->tp_name << std::endl;
|
||||
if (PyType_Ready(t) < 0) {
|
||||
std::cout << "ERROR: PyType_Ready failed for " << t->tp_name << std::endl;
|
||||
return NULL;
|
||||
}
|
||||
std::cout << " tp_alloc after PyType_Ready: " << (void*)t->tp_alloc << std::endl;
|
||||
/*std::cout << */ PyType_Ready(t); /*<< std::endl; */
|
||||
PyModule_AddType(m, t);
|
||||
i++;
|
||||
t = pytypes[i];
|
||||
t = pytypes[i++];
|
||||
}
|
||||
|
||||
// Add default_font and default_texture to module
|
||||
|
|
|
@ -1,7 +1,4 @@
|
|||
#include "PyColor.h"
|
||||
#include "McRFPy_API.h"
|
||||
#include "PyObjectUtils.h"
|
||||
#include "PyRAII.h"
|
||||
|
||||
PyGetSetDef PyColor::getsetters[] = {
|
||||
{"r", (getter)PyColor::get_member, (setter)PyColor::set_member, "Red component", (void*)0},
|
||||
|
@ -16,16 +13,11 @@ PyColor::PyColor(sf::Color target)
|
|||
|
||||
PyObject* PyColor::pyObject()
|
||||
{
|
||||
PyTypeObject* type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "Color");
|
||||
if (!type) return nullptr;
|
||||
|
||||
PyColorObject* obj = (PyColorObject*)type->tp_alloc(type, 0);
|
||||
Py_DECREF(type);
|
||||
|
||||
if (obj) {
|
||||
obj->data = data;
|
||||
}
|
||||
return (PyObject*)obj;
|
||||
PyObject* obj = PyType_GenericAlloc(&mcrfpydef::PyColorType, 0);
|
||||
Py_INCREF(obj);
|
||||
PyColorObject* self = (PyColorObject*)obj;
|
||||
self->data = data;
|
||||
return obj;
|
||||
}
|
||||
|
||||
sf::Color PyColor::fromPy(PyObject* obj)
|
||||
|
@ -142,33 +134,3 @@ int PyColor::set_member(PyObject* obj, PyObject* value, void* closure)
|
|||
// TODO
|
||||
return 0;
|
||||
}
|
||||
|
||||
PyColorObject* PyColor::from_arg(PyObject* args)
|
||||
{
|
||||
// Use RAII for type reference management
|
||||
PyRAII::PyTypeRef type("Color", McRFPy_API::mcrf_module);
|
||||
if (!type) {
|
||||
return NULL;
|
||||
}
|
||||
|
||||
// Check if args is already a Color instance
|
||||
if (PyObject_IsInstance(args, (PyObject*)type.get())) {
|
||||
return (PyColorObject*)args;
|
||||
}
|
||||
|
||||
// Create new Color object using RAII
|
||||
PyRAII::PyObjectRef obj(type->tp_alloc(type.get(), 0), true);
|
||||
if (!obj) {
|
||||
return NULL;
|
||||
}
|
||||
|
||||
// Initialize the object
|
||||
int err = init((PyColorObject*)obj.get(), args, NULL);
|
||||
if (err) {
|
||||
// obj will be automatically cleaned up when it goes out of scope
|
||||
return NULL;
|
||||
}
|
||||
|
||||
// Release ownership and return
|
||||
return (PyColorObject*)obj.release();
|
||||
}
|
||||
|
|
|
@ -29,12 +29,10 @@ public:
|
|||
static int set_member(PyObject*, PyObject*, void*);
|
||||
|
||||
static PyGetSetDef getsetters[];
|
||||
static PyColorObject* from_arg(PyObject*);
|
||||
};
|
||||
|
||||
namespace mcrfpydef {
|
||||
static PyTypeObject PyColorType = {
|
||||
.ob_base = {.ob_base = {.ob_refcnt = 1, .ob_type = NULL}, .ob_size = 0},
|
||||
.tp_name = "mcrfpy.Color",
|
||||
.tp_basicsize = sizeof(PyColorObject),
|
||||
.tp_itemsize = 0,
|
||||
|
|
|
@ -25,7 +25,6 @@ public:
|
|||
|
||||
namespace mcrfpydef {
|
||||
static PyTypeObject PyFontType = {
|
||||
.ob_base = {.ob_base = {.ob_refcnt = 1, .ob_type = NULL}, .ob_size = 0},
|
||||
.tp_name = "mcrfpy.Font",
|
||||
.tp_basicsize = sizeof(PyFontObject),
|
||||
.tp_itemsize = 0,
|
||||
|
|
|
@ -1,76 +0,0 @@
|
|||
#pragma once
|
||||
#include "Common.h"
|
||||
#include "Python.h"
|
||||
#include "McRFPy_API.h"
|
||||
#include "PyRAII.h"
|
||||
|
||||
namespace PyObjectUtils {
|
||||
|
||||
// Template for getting Python type object from module
|
||||
template<typename T>
|
||||
PyTypeObject* getPythonType(const char* typeName) {
|
||||
PyTypeObject* type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, typeName);
|
||||
if (!type) {
|
||||
PyErr_Format(PyExc_RuntimeError, "Could not find %s type in module", typeName);
|
||||
}
|
||||
return type;
|
||||
}
|
||||
|
||||
// Generic function to create a Python object of given type
|
||||
inline PyObject* createPyObjectGeneric(const char* typeName) {
|
||||
PyTypeObject* type = getPythonType<void>(typeName);
|
||||
if (!type) return nullptr;
|
||||
|
||||
PyObject* obj = type->tp_alloc(type, 0);
|
||||
Py_DECREF(type);
|
||||
|
||||
return obj;
|
||||
}
|
||||
|
||||
// Helper function to allocate and initialize a Python object with data
|
||||
template<typename PyObjType, typename DataType>
|
||||
PyObject* createPyObjectWithData(const char* typeName, DataType data) {
|
||||
PyTypeObject* type = getPythonType<void>(typeName);
|
||||
if (!type) return nullptr;
|
||||
|
||||
PyObjType* obj = (PyObjType*)type->tp_alloc(type, 0);
|
||||
Py_DECREF(type);
|
||||
|
||||
if (obj) {
|
||||
obj->data = data;
|
||||
}
|
||||
return (PyObject*)obj;
|
||||
}
|
||||
|
||||
// Function to convert UIDrawable to appropriate Python object
|
||||
// This is moved to UICollection.cpp to avoid circular dependencies
|
||||
|
||||
// RAII-based object creation example
|
||||
inline PyObject* createPyObjectGenericRAII(const char* typeName) {
|
||||
PyRAII::PyTypeRef type(typeName, McRFPy_API::mcrf_module);
|
||||
if (!type) {
|
||||
PyErr_Format(PyExc_RuntimeError, "Could not find %s type in module", typeName);
|
||||
return nullptr;
|
||||
}
|
||||
|
||||
PyObject* obj = type->tp_alloc(type.get(), 0);
|
||||
// Return the new reference (caller owns it)
|
||||
return obj;
|
||||
}
|
||||
|
||||
// Example of using PyObjectRef for safer reference management
|
||||
template<typename PyObjType, typename DataType>
|
||||
PyObject* createPyObjectWithDataRAII(const char* typeName, DataType data) {
|
||||
PyRAII::PyObjectRef obj = PyRAII::createObject<PyObjType>(typeName, McRFPy_API::mcrf_module);
|
||||
if (!obj) {
|
||||
PyErr_Format(PyExc_RuntimeError, "Could not create %s object", typeName);
|
||||
return nullptr;
|
||||
}
|
||||
|
||||
// Access the object through the RAII wrapper
|
||||
((PyObjType*)obj.get())->data = data;
|
||||
|
||||
// Release ownership to return to Python
|
||||
return obj.release();
|
||||
}
|
||||
}
|
138
src/PyRAII.h
138
src/PyRAII.h
|
@ -1,138 +0,0 @@
|
|||
#pragma once
|
||||
#include "Python.h"
|
||||
#include <utility>
|
||||
|
||||
namespace PyRAII {
|
||||
|
||||
// RAII wrapper for PyObject* that automatically manages reference counting
|
||||
class PyObjectRef {
|
||||
private:
|
||||
PyObject* ptr;
|
||||
|
||||
public:
|
||||
// Constructors
|
||||
PyObjectRef() : ptr(nullptr) {}
|
||||
|
||||
explicit PyObjectRef(PyObject* p, bool steal_ref = false) : ptr(p) {
|
||||
if (ptr && !steal_ref) {
|
||||
Py_INCREF(ptr);
|
||||
}
|
||||
}
|
||||
|
||||
// Copy constructor
|
||||
PyObjectRef(const PyObjectRef& other) : ptr(other.ptr) {
|
||||
if (ptr) {
|
||||
Py_INCREF(ptr);
|
||||
}
|
||||
}
|
||||
|
||||
// Move constructor
|
||||
PyObjectRef(PyObjectRef&& other) noexcept : ptr(other.ptr) {
|
||||
other.ptr = nullptr;
|
||||
}
|
||||
|
||||
// Destructor
|
||||
~PyObjectRef() {
|
||||
Py_XDECREF(ptr);
|
||||
}
|
||||
|
||||
// Copy assignment
|
||||
PyObjectRef& operator=(const PyObjectRef& other) {
|
||||
if (this != &other) {
|
||||
Py_XDECREF(ptr);
|
||||
ptr = other.ptr;
|
||||
if (ptr) {
|
||||
Py_INCREF(ptr);
|
||||
}
|
||||
}
|
||||
return *this;
|
||||
}
|
||||
|
||||
// Move assignment
|
||||
PyObjectRef& operator=(PyObjectRef&& other) noexcept {
|
||||
if (this != &other) {
|
||||
Py_XDECREF(ptr);
|
||||
ptr = other.ptr;
|
||||
other.ptr = nullptr;
|
||||
}
|
||||
return *this;
|
||||
}
|
||||
|
||||
// Access operators
|
||||
PyObject* get() const { return ptr; }
|
||||
PyObject* operator->() const { return ptr; }
|
||||
PyObject& operator*() const { return *ptr; }
|
||||
operator bool() const { return ptr != nullptr; }
|
||||
|
||||
// Release ownership (for returning to Python)
|
||||
PyObject* release() {
|
||||
PyObject* temp = ptr;
|
||||
ptr = nullptr;
|
||||
return temp;
|
||||
}
|
||||
|
||||
// Reset with new pointer
|
||||
void reset(PyObject* p = nullptr, bool steal_ref = false) {
|
||||
if (p != ptr) {
|
||||
Py_XDECREF(ptr);
|
||||
ptr = p;
|
||||
if (ptr && !steal_ref) {
|
||||
Py_INCREF(ptr);
|
||||
}
|
||||
}
|
||||
}
|
||||
};
|
||||
|
||||
// Helper class for managing PyTypeObject* references from module lookups
|
||||
class PyTypeRef {
|
||||
private:
|
||||
PyTypeObject* type;
|
||||
|
||||
public:
|
||||
PyTypeRef() : type(nullptr) {}
|
||||
|
||||
explicit PyTypeRef(const char* typeName, PyObject* module) {
|
||||
type = (PyTypeObject*)PyObject_GetAttrString(module, typeName);
|
||||
// GetAttrString returns a new reference, so we own it
|
||||
}
|
||||
|
||||
~PyTypeRef() {
|
||||
Py_XDECREF((PyObject*)type);
|
||||
}
|
||||
|
||||
// Delete copy operations to prevent accidental reference issues
|
||||
PyTypeRef(const PyTypeRef&) = delete;
|
||||
PyTypeRef& operator=(const PyTypeRef&) = delete;
|
||||
|
||||
// Allow move operations
|
||||
PyTypeRef(PyTypeRef&& other) noexcept : type(other.type) {
|
||||
other.type = nullptr;
|
||||
}
|
||||
|
||||
PyTypeRef& operator=(PyTypeRef&& other) noexcept {
|
||||
if (this != &other) {
|
||||
Py_XDECREF((PyObject*)type);
|
||||
type = other.type;
|
||||
other.type = nullptr;
|
||||
}
|
||||
return *this;
|
||||
}
|
||||
|
||||
PyTypeObject* get() const { return type; }
|
||||
PyTypeObject* operator->() const { return type; }
|
||||
operator bool() const { return type != nullptr; }
|
||||
};
|
||||
|
||||
// Convenience function to create a new object with RAII
|
||||
template<typename PyObjType>
|
||||
PyObjectRef createObject(const char* typeName, PyObject* module) {
|
||||
PyTypeRef type(typeName, module);
|
||||
if (!type) {
|
||||
return PyObjectRef();
|
||||
}
|
||||
|
||||
PyObject* obj = type->tp_alloc(type.get(), 0);
|
||||
// tp_alloc returns a new reference, so we steal it
|
||||
return PyObjectRef(obj, true);
|
||||
}
|
||||
}
|
|
@ -11,8 +11,7 @@ PyScene::PyScene(GameEngine* g) : Scene(g)
|
|||
registerAction(ActionCode::MOUSEWHEEL + ActionCode::WHEEL_DEL, "wheel_up");
|
||||
registerAction(ActionCode::MOUSEWHEEL + ActionCode::WHEEL_NEG + ActionCode::WHEEL_DEL, "wheel_down");
|
||||
|
||||
// console (` / ~ key) - don't hard code.
|
||||
//registerAction(ActionCode::KEY + sf::Keyboard::Grave, "debug_menu");
|
||||
registerAction(ActionCode::KEY + sf::Keyboard::Grave, "debug_menu");
|
||||
}
|
||||
|
||||
void PyScene::update()
|
||||
|
@ -60,7 +59,7 @@ void PyScene::doAction(std::string name, std::string type)
|
|||
}
|
||||
}
|
||||
|
||||
void PyScene::render()
|
||||
void PyScene::sRender()
|
||||
{
|
||||
game->getWindow().clear();
|
||||
|
||||
|
|
|
@ -11,7 +11,7 @@ public:
|
|||
PyScene(GameEngine*);
|
||||
void update() override final;
|
||||
void doAction(std::string, std::string) override final;
|
||||
void render() override final;
|
||||
void sRender() override final;
|
||||
|
||||
void do_mouse_input(std::string, std::string);
|
||||
};
|
||||
|
|
|
@ -28,11 +28,36 @@ sf::Sprite PyTexture::sprite(int index, sf::Vector2f pos, sf::Vector2f s)
|
|||
|
||||
PyObject* PyTexture::pyObject()
|
||||
{
|
||||
auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "Texture");
|
||||
PyObject* obj = PyTexture::pynew(type, Py_None, Py_None);
|
||||
// method 1: works but with type weirdness
|
||||
//PyObject* obj = PyType_GenericAlloc(&mcrfpydef::PyTextureType, 0);
|
||||
//Py_SET_TYPE(obj, &mcrfpydef::PyTextureType);
|
||||
|
||||
// method 2: does not work (segfault on use of the mcrfpy.Texture object)
|
||||
//PyObject* obj = PyTexture::pynew(&mcrfpydef::PyTextureType, Py_None, Py_None);
|
||||
|
||||
// method 3: does not work (segfault on use of the mcrfpy.Texture object)
|
||||
std::cout << "Find type" << std::endl;
|
||||
auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "Texture");
|
||||
//auto type = obj->ob_type;
|
||||
//auto type = &mcrfpydef::PyTextureType;
|
||||
//std::cout << "assigned value 0x" << std::hex << reinterpret_cast<long>(type) << std::endl;
|
||||
//std::cout << "Found PyTextureType: " << PyUnicode_AsUTF8(PyObject_Repr((PyObject*)type)) << std::endl;
|
||||
//std::cout << "PyTextureType metatype: " << PyUnicode_AsUTF8(PyObject_Repr((PyObject_Type((PyObject*)type)))) << std::endl;
|
||||
//std::cout << "tp_alloc: 0x" << std::hex << reinterpret_cast <long>(type->tp_alloc) << std::endl <<
|
||||
// "tp_new: 0x" << std::hex << reinterpret_cast<long>(type->tp_new) << std::endl;
|
||||
//PyObject* obj = ((PyTypeObject*)type)->tp_new((PyTypeObject*)type, Py_None, Py_None);
|
||||
PyObject* obj = PyTexture::pynew(type, Py_None, Py_None);
|
||||
//Py_SET_TYPE(obj, type);
|
||||
|
||||
// method 4: call the type object?
|
||||
|
||||
std::cout << "Instantiated" << std::endl;
|
||||
//Py_SET_TYPE(obj, &mcrfpydef::PyTextureType);
|
||||
|
||||
//PyObject_CallFunction(&mcrfpydef::PyTextureType,
|
||||
try {
|
||||
((PyTextureObject*)obj)->data = shared_from_this();
|
||||
std::cout << "Sideloaded texture: " << PyUnicode_AsUTF8(PyObject_Repr(obj)) << std::endl;
|
||||
}
|
||||
catch (std::bad_weak_ptr& e)
|
||||
{
|
||||
|
|
|
@ -29,7 +29,6 @@ public:
|
|||
|
||||
namespace mcrfpydef {
|
||||
static PyTypeObject PyTextureType = {
|
||||
.ob_base = {.ob_base = {.ob_refcnt = 1, .ob_type = NULL}, .ob_size = 0},
|
||||
.tp_name = "mcrfpy.Texture",
|
||||
.tp_basicsize = sizeof(PyTextureObject),
|
||||
.tp_itemsize = 0,
|
||||
|
|
|
@ -1,5 +1,4 @@
|
|||
#include "PyVector.h"
|
||||
#include "PyObjectUtils.h"
|
||||
|
||||
PyGetSetDef PyVector::getsetters[] = {
|
||||
{"x", (getter)PyVector::get_member, (setter)PyVector::set_member, "X/horizontal component", (void*)0},
|
||||
|
@ -12,16 +11,11 @@ PyVector::PyVector(sf::Vector2f target)
|
|||
|
||||
PyObject* PyVector::pyObject()
|
||||
{
|
||||
PyTypeObject* type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "Vector");
|
||||
if (!type) return nullptr;
|
||||
|
||||
PyVectorObject* obj = (PyVectorObject*)type->tp_alloc(type, 0);
|
||||
Py_DECREF(type);
|
||||
|
||||
if (obj) {
|
||||
obj->data = data;
|
||||
}
|
||||
return (PyObject*)obj;
|
||||
PyObject* obj = PyType_GenericAlloc(&mcrfpydef::PyVectorType, 0);
|
||||
Py_INCREF(obj);
|
||||
PyVectorObject* self = (PyVectorObject*)obj;
|
||||
self->data = data;
|
||||
return obj;
|
||||
}
|
||||
|
||||
sf::Vector2f PyVector::fromPy(PyObject* obj)
|
||||
|
@ -115,16 +109,3 @@ int PyVector::set_member(PyObject* obj, PyObject* value, void* closure)
|
|||
// TODO
|
||||
return 0;
|
||||
}
|
||||
|
||||
PyVectorObject* PyVector::from_arg(PyObject* args)
|
||||
{
|
||||
auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "Vector");
|
||||
if (PyObject_IsInstance(args, (PyObject*)type)) return (PyVectorObject*)args;
|
||||
auto obj = (PyVectorObject*)type->tp_alloc(type, 0);
|
||||
int err = init(obj, args, NULL);
|
||||
if (err) {
|
||||
Py_DECREF(obj);
|
||||
return NULL;
|
||||
}
|
||||
return obj;
|
||||
}
|
||||
|
|
|
@ -1,7 +1,6 @@
|
|||
#pragma once
|
||||
#include "Common.h"
|
||||
#include "Python.h"
|
||||
#include "McRFPy_API.h"
|
||||
|
||||
typedef struct {
|
||||
PyObject_HEAD
|
||||
|
@ -23,14 +22,12 @@ public:
|
|||
static PyObject* pynew(PyTypeObject* type, PyObject* args=NULL, PyObject* kwds=NULL);
|
||||
static PyObject* get_member(PyObject*, void*);
|
||||
static int set_member(PyObject*, PyObject*, void*);
|
||||
static PyVectorObject* from_arg(PyObject*);
|
||||
|
||||
static PyGetSetDef getsetters[];
|
||||
};
|
||||
|
||||
namespace mcrfpydef {
|
||||
static PyTypeObject PyVectorType = {
|
||||
.ob_base = {.ob_base = {.ob_refcnt = 1, .ob_type = NULL}, .ob_size = 0},
|
||||
.tp_name = "mcrfpy.Vector",
|
||||
.tp_basicsize = sizeof(PyVectorObject),
|
||||
.tp_itemsize = 0,
|
||||
|
|
|
@ -31,7 +31,7 @@ public:
|
|||
//Scene();
|
||||
Scene(GameEngine*);
|
||||
virtual void update() = 0;
|
||||
virtual void render() = 0;
|
||||
virtual void sRender() = 0;
|
||||
virtual void doAction(std::string, std::string) = 0;
|
||||
bool hasAction(std::string);
|
||||
bool hasAction(int);
|
||||
|
|
|
@ -0,0 +1,527 @@
|
|||
#include "UI.h"
|
||||
#include "Resources.h"
|
||||
#include "GameEngine.h"
|
||||
|
||||
/* //callability fields & methods
|
||||
PyObject* click_callable;
|
||||
virtual UIDrawable* click_at(sf::Vector2f point);
|
||||
void click_register(PyObject*);
|
||||
void click_unregister();
|
||||
*/
|
||||
|
||||
UIDrawable::UIDrawable() { click_callable = NULL; }
|
||||
|
||||
UIDrawable* UIFrame::click_at(sf::Vector2f point)
|
||||
{
|
||||
for (auto e: *children)
|
||||
{
|
||||
auto p = e->click_at(point + box.getPosition());
|
||||
if (p)
|
||||
return p;
|
||||
}
|
||||
if (click_callable)
|
||||
{
|
||||
float x = box.getPosition().x, y = box.getPosition().y, w = box.getSize().x, h = box.getSize().y;
|
||||
if (point.x > x && point.y > y && point.x < x+w && point.y < y+h) return this;
|
||||
}
|
||||
return NULL;
|
||||
}
|
||||
|
||||
UIDrawable* UICaption::click_at(sf::Vector2f point)
|
||||
{
|
||||
if (click_callable)
|
||||
{
|
||||
if (text.getGlobalBounds().contains(point)) return this;
|
||||
}
|
||||
return NULL;
|
||||
}
|
||||
|
||||
UIDrawable* UISprite::click_at(sf::Vector2f point)
|
||||
{
|
||||
if (click_callable)
|
||||
{
|
||||
if(sprite.getGlobalBounds().contains(point)) return this;
|
||||
}
|
||||
return NULL;
|
||||
}
|
||||
|
||||
UIDrawable* UIGrid::click_at(sf::Vector2f point)
|
||||
{
|
||||
if (click_callable)
|
||||
{
|
||||
if(box.getGlobalBounds().contains(point)) return this;
|
||||
}
|
||||
return NULL;
|
||||
}
|
||||
|
||||
void UIDrawable::click_register(PyObject* callable)
|
||||
{
|
||||
/*
|
||||
if (click_callable)
|
||||
{
|
||||
// decrement reference before overwriting
|
||||
Py_DECREF(click_callable);
|
||||
}
|
||||
click_callable = callable;
|
||||
Py_INCREF(click_callable);
|
||||
*/
|
||||
click_callable = std::make_unique<PyClickCallable>(callable);
|
||||
}
|
||||
|
||||
void UIDrawable::click_unregister()
|
||||
{
|
||||
/*
|
||||
if (click_callable == NULL) return;
|
||||
Py_DECREF(click_callable);
|
||||
click_callable = NULL;
|
||||
*/
|
||||
click_callable.reset();
|
||||
}
|
||||
|
||||
void UIDrawable::render()
|
||||
{
|
||||
//std::cout << "Rendering base UIDrawable\n";
|
||||
render(sf::Vector2f());
|
||||
}
|
||||
UIFrame::UIFrame():
|
||||
//x(0), y(0), w(0), h(0),
|
||||
outline(0)
|
||||
{
|
||||
children = std::make_shared<std::vector<std::shared_ptr<UIDrawable>>>();
|
||||
box.setPosition(0, 0);
|
||||
box.setSize(sf::Vector2f(0, 0));
|
||||
/*
|
||||
pyOutlineColor = NULL;
|
||||
pyFillColor = NULL;
|
||||
_outlineColor = NULL;
|
||||
_fillColor = NULL;
|
||||
*/
|
||||
}
|
||||
|
||||
UIFrame::UIFrame(float _x, float _y, float _w, float _h):
|
||||
//x(_x), y(_y), w(_w), h(_h),
|
||||
outline(0)
|
||||
{
|
||||
box.setPosition(_x, _y);
|
||||
box.setSize(sf::Vector2f(_w, _h));
|
||||
children = std::make_shared<std::vector<std::shared_ptr<UIDrawable>>>();
|
||||
/*
|
||||
pyOutlineColor = NULL;
|
||||
pyFillColor = NULL;
|
||||
_outlineColor = NULL;
|
||||
_fillColor = NULL;
|
||||
*/
|
||||
}
|
||||
|
||||
UIFrame::~UIFrame()
|
||||
{
|
||||
children.reset();
|
||||
/*
|
||||
if (pyOutlineColor) Py_DECREF(pyOutlineColor);
|
||||
else if (_outlineColor) delete _outlineColor;
|
||||
if (pyFillColor) Py_DECREF(pyFillColor);
|
||||
else if (_fillColor) delete _fillColor;
|
||||
*/
|
||||
}
|
||||
|
||||
/*
|
||||
sf::Color& fillColor(); // getter
|
||||
void fillColor(sf::Color c); // C++ setter
|
||||
void fillColor(PyObject* pyColor); // Python setter
|
||||
|
||||
sf::Color& outlineColor(); // getter
|
||||
void outlineColor(sf::Color c); // C++ setter
|
||||
void outlineColor(PyObject* pyColor); // Python setter
|
||||
*/
|
||||
|
||||
|
||||
PyObjectsEnum UIFrame::derived_type()
|
||||
{
|
||||
return PyObjectsEnum::UIFRAME;
|
||||
}
|
||||
|
||||
void UIFrame::render(sf::Vector2f offset)
|
||||
{
|
||||
//std::cout << "Rendering UIFrame w/ offset " << offset.x << ", " << offset.y << "\n";
|
||||
//std::cout << "position = " << x << ", " << y << "\n";
|
||||
box.move(offset);
|
||||
Resources::game->getWindow().draw(box);
|
||||
box.move(-offset);
|
||||
//sf::RectangleShape box = sf::RectangleShape(sf::Vector2f(w,h));
|
||||
//sf::Vector2f pos = sf::Vector2f(x, y);
|
||||
//box.setPosition(offset + pos);
|
||||
//if (_fillColor) { box.setFillColor(fillColor()); }
|
||||
//if (_outlineColor) { box.setOutlineColor(outlineColor()); }
|
||||
//box.setOutlineThickness(outline);
|
||||
//Resources::game->getWindow().draw(box);
|
||||
for (auto drawable : *children) {
|
||||
drawable->render(offset + box.getPosition());
|
||||
}
|
||||
}
|
||||
|
||||
void UICaption::render(sf::Vector2f offset)
|
||||
{
|
||||
//std::cout << "Rendering Caption with offset\n";
|
||||
text.move(offset);
|
||||
Resources::game->getWindow().draw(text);
|
||||
text.move(-offset);
|
||||
}
|
||||
|
||||
UISprite::UISprite() {}
|
||||
/*
|
||||
// * tearing down the old IndexTexture way of life
|
||||
UISprite::UISprite(IndexTexture* _itex, int _sprite_index, float x = 0.0, float y = 0.0, float s = 1.0)
|
||||
: itex(_itex), sprite_index(_sprite_index)
|
||||
{
|
||||
sprite.setTexture(_itex->texture);
|
||||
sprite.setTextureRect(_itex->spriteCoordinates(_sprite_index));
|
||||
sprite.setPosition(sf::Vector2f(x, y));
|
||||
sprite.setScale(sf::Vector2f(s, s));
|
||||
}
|
||||
|
||||
UISprite::UISprite(IndexTexture* _itex, int _sprite_index, sf::Vector2f pos, float s = 1.0)
|
||||
: itex(_itex), sprite_index(_sprite_index)
|
||||
{
|
||||
sprite.setTexture(_itex->texture);
|
||||
sprite.setTextureRect(_itex->spriteCoordinates(_sprite_index));
|
||||
sprite.setPosition(pos);
|
||||
sprite.setScale(sf::Vector2f(s, s));
|
||||
}
|
||||
*/
|
||||
|
||||
UISprite::UISprite(std::shared_ptr<PyTexture> _ptex, int _sprite_index, sf::Vector2f _pos, float _scale)
|
||||
: ptex(_ptex), sprite_index(_sprite_index)
|
||||
{
|
||||
sprite = ptex->sprite(sprite_index, _pos, sf::Vector2f(_scale, _scale));
|
||||
}
|
||||
|
||||
//void UISprite::update()
|
||||
//{
|
||||
//auto& tex = Resources::game->textures[texture_index];
|
||||
//sprite.setTexture(tex.texture);
|
||||
//sprite.setScale(sf::Vector2f(scale, scale));
|
||||
//sprite.setPosition(sf::Vector2f(x, y));
|
||||
//std::cout << "Drawable position: " << x << ", " << y << " -> " << s.getPosition().x << ", " << s.getPosition().y << std::endl;
|
||||
//sprite.setTextureRect(tex.spriteCoordinates(sprite_index));
|
||||
//}
|
||||
|
||||
void UISprite::render(sf::Vector2f offset)
|
||||
{
|
||||
sprite.move(offset);
|
||||
Resources::game->getWindow().draw(sprite);
|
||||
sprite.move(-offset);
|
||||
}
|
||||
|
||||
// 7DRL hack; needed to draw entities to UIGrid. TODO, apply this technique to all UIDrawables
|
||||
void UISprite::render(sf::Vector2f offset, sf::RenderTexture& target)
|
||||
{
|
||||
sprite.move(offset);
|
||||
target.draw(sprite);
|
||||
sprite.move(-offset);
|
||||
}
|
||||
|
||||
/*
|
||||
void UISprite::setPosition(float x, float y)
|
||||
{
|
||||
setPosition(sf::Vector2f(x, y));
|
||||
}
|
||||
*/
|
||||
|
||||
void UISprite::setPosition(sf::Vector2f pos)
|
||||
{
|
||||
sprite.setPosition(pos);
|
||||
}
|
||||
|
||||
void UISprite::setScale(sf::Vector2f s)
|
||||
{
|
||||
sprite.setScale(s);
|
||||
}
|
||||
|
||||
void UISprite::setTexture(std::shared_ptr<PyTexture> _ptex, int _sprite_index)
|
||||
{
|
||||
ptex = _ptex;
|
||||
if (_sprite_index != -1) // if you are changing textures, there's a good chance you need a new index too
|
||||
sprite_index = _sprite_index;
|
||||
sprite = ptex->sprite(sprite_index, sprite.getPosition(), sprite.getScale());
|
||||
}
|
||||
|
||||
void UISprite::setSpriteIndex(int _sprite_index)
|
||||
{
|
||||
sprite_index = _sprite_index;
|
||||
sprite = ptex->sprite(sprite_index, sprite.getPosition(), sprite.getScale());
|
||||
}
|
||||
|
||||
sf::Vector2f UISprite::getScale()
|
||||
{
|
||||
return sprite.getScale();
|
||||
}
|
||||
|
||||
sf::Vector2f UISprite::getPosition()
|
||||
{
|
||||
return sprite.getPosition();
|
||||
}
|
||||
|
||||
std::shared_ptr<PyTexture> UISprite::getTexture()
|
||||
{
|
||||
return ptex;
|
||||
}
|
||||
|
||||
int UISprite::getSpriteIndex()
|
||||
{
|
||||
return sprite_index;
|
||||
}
|
||||
|
||||
PyObjectsEnum UICaption::derived_type()
|
||||
{
|
||||
return PyObjectsEnum::UICAPTION;
|
||||
}
|
||||
|
||||
PyObjectsEnum UISprite::derived_type()
|
||||
{
|
||||
return PyObjectsEnum::UISPRITE;
|
||||
}
|
||||
|
||||
// UIGrid support classes' methods
|
||||
|
||||
UIGridPoint::UIGridPoint()
|
||||
:color(1.0f, 1.0f, 1.0f), color_overlay(0.0f, 0.0f, 0.0f), walkable(false), transparent(false),
|
||||
tilesprite(-1), tile_overlay(-1), uisprite(-1)
|
||||
{
|
||||
}
|
||||
|
||||
UIEntity::UIEntity() {} // this will not work lol. TODO remove default constructor by finding the shared pointer inits that use it
|
||||
|
||||
UIEntity::UIEntity(UIGrid& grid)
|
||||
: gridstate(grid.grid_x * grid.grid_y)
|
||||
{
|
||||
}
|
||||
|
||||
// UIGrid methods
|
||||
|
||||
UIGrid::UIGrid()
|
||||
{
|
||||
}
|
||||
|
||||
/*
|
||||
UIGrid::UIGrid(int gx, int gy, std::shared_ptr<PyTexture> _ptex, float _x, float _y, float _w, float _h)
|
||||
: grid_x(gx), grid_y(gy),
|
||||
zoom(1.0f), center_x((gx/2) * _ptex->sheet_width), center_y((gy/2) * _ptex->sheet_height),
|
||||
itex(_itex), points(gx * gy)
|
||||
{
|
||||
// set up blank list of entities
|
||||
entities = std::make_shared<std::list<std::shared_ptr<UIEntity>>>();
|
||||
|
||||
box.setSize(sf::Vector2f(_w, _h));
|
||||
box.setPosition(sf::Vector2f(_x, _y));
|
||||
|
||||
box.setFillColor(sf::Color(0,0,0,0));
|
||||
renderTexture.create(_w, _h);
|
||||
sprite.setTexture(_itex->texture);
|
||||
output.setTextureRect(
|
||||
sf::IntRect(0, 0,
|
||||
box.getSize().x, box.getSize().y));
|
||||
output.setPosition(box.getPosition());
|
||||
// textures are upside-down inside renderTexture
|
||||
output.setTexture(renderTexture.getTexture());
|
||||
}
|
||||
*/
|
||||
|
||||
UIGrid::UIGrid(int gx, int gy, std::shared_ptr<PyTexture> _ptex, sf::Vector2f _xy, sf::Vector2f _wh)
|
||||
: grid_x(gx), grid_y(gy),
|
||||
zoom(1.0f), center_x((gx/2) * _ptex->sprite_width), center_y((gy/2) * _ptex->sprite_height),
|
||||
ptex(_ptex), points(gx * gy)
|
||||
{
|
||||
// set up blank list of entities
|
||||
entities = std::make_shared<std::list<std::shared_ptr<UIEntity>>>();
|
||||
|
||||
box.setSize(_wh);
|
||||
box.setPosition(_xy);
|
||||
|
||||
box.setFillColor(sf::Color(0,0,0,0));
|
||||
//renderTexture.create(_wh.x, _wh.y);
|
||||
// create renderTexture with maximum theoretical size; sprite can resize to show whatever amount needs to be rendered
|
||||
renderTexture.create(1920, 1080); // TODO - renderTexture should be window size; above 1080p this will cause rendering errors
|
||||
|
||||
//sprite.setTexture(_itex->texture);
|
||||
sprite = ptex->sprite(0);
|
||||
|
||||
output.setTextureRect(
|
||||
sf::IntRect(0, 0,
|
||||
box.getSize().x, box.getSize().y));
|
||||
output.setPosition(box.getPosition());
|
||||
// textures are upside-down inside renderTexture
|
||||
output.setTexture(renderTexture.getTexture());
|
||||
|
||||
}
|
||||
|
||||
void UIGrid::update()
|
||||
{
|
||||
}
|
||||
|
||||
/*
|
||||
void UIGrid::setSprite(int ti)
|
||||
{
|
||||
//int tx = ti % itex->grid_width, ty = ti / itex->grid_width;
|
||||
// sprite.setTextureRect(sf::IntRect(tx * itex->grid_size, ty * itex->grid_size, itex->grid_size, itex->grid_size));
|
||||
sprite = ptex->sprite(ti);
|
||||
}
|
||||
*/
|
||||
|
||||
void UIGrid::render(sf::Vector2f)
|
||||
{
|
||||
output.setPosition(box.getPosition()); // output sprite can move; update position when drawing
|
||||
// output size can change; update size when drawing
|
||||
output.setTextureRect(
|
||||
sf::IntRect(0, 0,
|
||||
box.getSize().x, box.getSize().y));
|
||||
renderTexture.clear(sf::Color(8, 8, 8, 255)); // TODO - UIGrid needs a "background color" field
|
||||
// sprites that are visible according to zoom, center_x, center_y, and box width
|
||||
float center_x_sq = center_x / ptex->sprite_width;
|
||||
float center_y_sq = center_y / ptex->sprite_height;
|
||||
|
||||
float width_sq = box.getSize().x / (ptex->sprite_width * zoom);
|
||||
float height_sq = box.getSize().y / (ptex->sprite_height * zoom);
|
||||
float left_edge = center_x_sq - (width_sq / 2.0);
|
||||
float top_edge = center_y_sq - (height_sq / 2.0);
|
||||
|
||||
int left_spritepixels = center_x - (box.getSize().x / 2.0 / zoom);
|
||||
int top_spritepixels = center_y - (box.getSize().y / 2.0 / zoom);
|
||||
|
||||
//sprite.setScale(sf::Vector2f(zoom, zoom));
|
||||
sf::RectangleShape r; // for colors and overlays
|
||||
r.setSize(sf::Vector2f(ptex->sprite_width * zoom, ptex->sprite_height * zoom));
|
||||
r.setOutlineThickness(0);
|
||||
|
||||
int x_limit = left_edge + width_sq + 2;
|
||||
if (x_limit > grid_x) x_limit = grid_x;
|
||||
|
||||
int y_limit = top_edge + height_sq + 2;
|
||||
if (y_limit > grid_y) y_limit = grid_y;
|
||||
|
||||
// base layer - bottom color, tile sprite ("ground")
|
||||
for (int x = (left_edge - 1 >= 0 ? left_edge - 1 : 0);
|
||||
x < x_limit; //x < view_width;
|
||||
x+=1)
|
||||
{
|
||||
//for (float y = (top_edge >= 0 ? top_edge : 0);
|
||||
for (int y = (top_edge - 1 >= 0 ? top_edge - 1 : 0);
|
||||
y < y_limit; //y < view_height;
|
||||
y+=1)
|
||||
{
|
||||
auto pixel_pos = sf::Vector2f(
|
||||
(x*ptex->sprite_width - left_spritepixels) * zoom,
|
||||
(y*ptex->sprite_height - top_spritepixels) * zoom );
|
||||
|
||||
auto gridpoint = at(std::floor(x), std::floor(y));
|
||||
|
||||
//sprite.setPosition(pixel_pos);
|
||||
|
||||
r.setPosition(pixel_pos);
|
||||
r.setFillColor(gridpoint.color);
|
||||
renderTexture.draw(r);
|
||||
|
||||
// tilesprite
|
||||
// if discovered but not visible, set opacity to 90%
|
||||
// if not discovered... just don't draw it?
|
||||
if (gridpoint.tilesprite != -1) {
|
||||
sprite = ptex->sprite(gridpoint.tilesprite, pixel_pos, sf::Vector2f(zoom, zoom)); //setSprite(gridpoint.tilesprite);;
|
||||
renderTexture.draw(sprite);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// middle layer - entities
|
||||
// disabling entity rendering until I can render their UISprite inside the rendertexture (not directly to window)
|
||||
for (auto e : *entities) {
|
||||
// TODO skip out-of-bounds entities (grid square not visible at all, check for partially on visible grid squares / floating point grid position)
|
||||
//auto drawent = e->cGrid->indexsprite.drawable();
|
||||
auto& drawent = e->sprite;
|
||||
//drawent.setScale(zoom, zoom);
|
||||
drawent.setScale(sf::Vector2f(zoom, zoom));
|
||||
auto pixel_pos = sf::Vector2f(
|
||||
(e->position.x*ptex->sprite_width - left_spritepixels) * zoom,
|
||||
(e->position.y*ptex->sprite_height - top_spritepixels) * zoom );
|
||||
//drawent.setPosition(pixel_pos);
|
||||
//renderTexture.draw(drawent);
|
||||
drawent.render(pixel_pos, renderTexture);
|
||||
}
|
||||
|
||||
|
||||
// top layer - opacity for discovered / visible status (debug, basically)
|
||||
/* // Disabled until I attach a "perspective"
|
||||
for (int x = (left_edge - 1 >= 0 ? left_edge - 1 : 0);
|
||||
x < x_limit; //x < view_width;
|
||||
x+=1)
|
||||
{
|
||||
//for (float y = (top_edge >= 0 ? top_edge : 0);
|
||||
for (int y = (top_edge - 1 >= 0 ? top_edge - 1 : 0);
|
||||
y < y_limit; //y < view_height;
|
||||
y+=1)
|
||||
{
|
||||
|
||||
auto pixel_pos = sf::Vector2f(
|
||||
(x*itex->grid_size - left_spritepixels) * zoom,
|
||||
(y*itex->grid_size - top_spritepixels) * zoom );
|
||||
|
||||
auto gridpoint = at(std::floor(x), std::floor(y));
|
||||
|
||||
sprite.setPosition(pixel_pos);
|
||||
|
||||
r.setPosition(pixel_pos);
|
||||
|
||||
// visible & discovered layers for testing purposes
|
||||
if (!gridpoint.discovered) {
|
||||
r.setFillColor(sf::Color(16, 16, 20, 192)); // 255 opacity for actual blackout
|
||||
renderTexture.draw(r);
|
||||
} else if (!gridpoint.visible) {
|
||||
r.setFillColor(sf::Color(32, 32, 40, 128));
|
||||
renderTexture.draw(r);
|
||||
}
|
||||
|
||||
// overlay
|
||||
|
||||
// uisprite
|
||||
}
|
||||
}
|
||||
*/
|
||||
|
||||
// grid lines for testing & validation
|
||||
/*
|
||||
sf::Vertex line[] =
|
||||
{
|
||||
sf::Vertex(sf::Vector2f(0, 0), sf::Color::Red),
|
||||
sf::Vertex(box.getSize(), sf::Color::Red),
|
||||
|
||||
};
|
||||
|
||||
renderTexture.draw(line, 2, sf::Lines);
|
||||
sf::Vertex lineb[] =
|
||||
{
|
||||
sf::Vertex(sf::Vector2f(0, box.getSize().y), sf::Color::Blue),
|
||||
sf::Vertex(sf::Vector2f(box.getSize().x, 0), sf::Color::Blue),
|
||||
|
||||
};
|
||||
|
||||
renderTexture.draw(lineb, 2, sf::Lines);
|
||||
*/
|
||||
|
||||
// render to window
|
||||
renderTexture.display();
|
||||
Resources::game->getWindow().draw(output);
|
||||
|
||||
}
|
||||
|
||||
UIGridPoint& UIGrid::at(int x, int y)
|
||||
{
|
||||
return points[y * grid_x + x];
|
||||
}
|
||||
|
||||
PyObjectsEnum UIGrid::derived_type()
|
||||
{
|
||||
return PyObjectsEnum::UIGRID;
|
||||
}
|
||||
|
||||
std::shared_ptr<PyTexture> UIGrid::getTexture()
|
||||
{
|
||||
return ptex;
|
||||
}
|
32
src/UIBase.h
32
src/UIBase.h
|
@ -1,32 +0,0 @@
|
|||
#pragma once
|
||||
|
||||
class UIEntity;
|
||||
typedef struct {
|
||||
PyObject_HEAD
|
||||
std::shared_ptr<UIEntity> data;
|
||||
} PyUIEntityObject;
|
||||
|
||||
class UIFrame;
|
||||
typedef struct {
|
||||
PyObject_HEAD
|
||||
std::shared_ptr<UIFrame> data;
|
||||
} PyUIFrameObject;
|
||||
|
||||
class UICaption;
|
||||
typedef struct {
|
||||
PyObject_HEAD
|
||||
std::shared_ptr<UICaption> data;
|
||||
PyObject* font;
|
||||
} PyUICaptionObject;
|
||||
|
||||
class UIGrid;
|
||||
typedef struct {
|
||||
PyObject_HEAD
|
||||
std::shared_ptr<UIGrid> data;
|
||||
} PyUIGridObject;
|
||||
|
||||
class UISprite;
|
||||
typedef struct {
|
||||
PyObject_HEAD
|
||||
std::shared_ptr<UISprite> data;
|
||||
} PyUISpriteObject;
|
|
@ -1,296 +0,0 @@
|
|||
#include "UICaption.h"
|
||||
#include "GameEngine.h"
|
||||
#include "PyColor.h"
|
||||
#include "PyVector.h"
|
||||
#include "PyFont.h"
|
||||
|
||||
UIDrawable* UICaption::click_at(sf::Vector2f point)
|
||||
{
|
||||
if (click_callable)
|
||||
{
|
||||
if (text.getGlobalBounds().contains(point)) return this;
|
||||
}
|
||||
return NULL;
|
||||
}
|
||||
|
||||
void UICaption::render(sf::Vector2f offset, sf::RenderTarget& target)
|
||||
{
|
||||
text.move(offset);
|
||||
//Resources::game->getWindow().draw(text);
|
||||
target.draw(text);
|
||||
text.move(-offset);
|
||||
}
|
||||
|
||||
PyObjectsEnum UICaption::derived_type()
|
||||
{
|
||||
return PyObjectsEnum::UICAPTION;
|
||||
}
|
||||
|
||||
PyObject* UICaption::get_float_member(PyUICaptionObject* self, void* closure)
|
||||
{
|
||||
auto member_ptr = reinterpret_cast<long>(closure);
|
||||
if (member_ptr == 0)
|
||||
return PyFloat_FromDouble(self->data->text.getPosition().x);
|
||||
else if (member_ptr == 1)
|
||||
return PyFloat_FromDouble(self->data->text.getPosition().y);
|
||||
else if (member_ptr == 4)
|
||||
return PyFloat_FromDouble(self->data->text.getOutlineThickness());
|
||||
else if (member_ptr == 5)
|
||||
return PyLong_FromLong(self->data->text.getCharacterSize());
|
||||
else
|
||||
{
|
||||
PyErr_SetString(PyExc_AttributeError, "Invalid attribute");
|
||||
return nullptr;
|
||||
}
|
||||
}
|
||||
|
||||
int UICaption::set_float_member(PyUICaptionObject* self, PyObject* value, void* closure)
|
||||
{
|
||||
float val;
|
||||
auto member_ptr = reinterpret_cast<long>(closure);
|
||||
if (PyFloat_Check(value))
|
||||
{
|
||||
val = PyFloat_AsDouble(value);
|
||||
}
|
||||
else if (PyLong_Check(value))
|
||||
{
|
||||
val = PyLong_AsLong(value);
|
||||
}
|
||||
else
|
||||
{
|
||||
PyErr_SetString(PyExc_TypeError, "Value must be an integer.");
|
||||
return -1;
|
||||
}
|
||||
if (member_ptr == 0) //x
|
||||
self->data->text.setPosition(val, self->data->text.getPosition().y);
|
||||
else if (member_ptr == 1) //y
|
||||
self->data->text.setPosition(self->data->text.getPosition().x, val);
|
||||
else if (member_ptr == 4) //outline
|
||||
self->data->text.setOutlineThickness(val);
|
||||
else if (member_ptr == 5) // character size
|
||||
self->data->text.setCharacterSize(val);
|
||||
return 0;
|
||||
}
|
||||
|
||||
PyObject* UICaption::get_vec_member(PyUICaptionObject* self, void* closure)
|
||||
{
|
||||
return PyVector(self->data->text.getPosition()).pyObject();
|
||||
}
|
||||
|
||||
int UICaption::set_vec_member(PyUICaptionObject* self, PyObject* value, void* closure)
|
||||
{
|
||||
self->data->text.setPosition(PyVector::fromPy(value));
|
||||
return 0;
|
||||
}
|
||||
|
||||
PyObject* UICaption::get_color_member(PyUICaptionObject* self, void* closure)
|
||||
{
|
||||
// TODO: migrate this code to a switch statement - validate closure & return values in one tighter, more extensible structure
|
||||
|
||||
// validate closure (should be impossible to be wrong, but it's thorough)
|
||||
auto member_ptr = reinterpret_cast<long>(closure);
|
||||
if (member_ptr != 0 && member_ptr != 1)
|
||||
{
|
||||
PyErr_SetString(PyExc_AttributeError, "Invalid attribute");
|
||||
return nullptr;
|
||||
}
|
||||
|
||||
// TODO: manually calling tp_alloc to create a PyColorObject seems like an antipattern
|
||||
// fetch correct member data
|
||||
sf::Color color;
|
||||
|
||||
if (member_ptr == 0)
|
||||
{
|
||||
color = self->data->text.getFillColor();
|
||||
}
|
||||
else if (member_ptr == 1)
|
||||
{
|
||||
color = self->data->text.getOutlineColor();
|
||||
}
|
||||
|
||||
return PyColor(color).pyObject();
|
||||
}
|
||||
|
||||
int UICaption::set_color_member(PyUICaptionObject* self, PyObject* value, void* closure)
|
||||
{
|
||||
auto member_ptr = reinterpret_cast<long>(closure);
|
||||
//TODO: this logic of (PyColor instance OR tuple -> sf::color) should be encapsulated for reuse
|
||||
int r, g, b, a;
|
||||
if (PyObject_IsInstance(value, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Color") /*(PyObject*)&mcrfpydef::PyColorType)*/))
|
||||
{
|
||||
// get value from mcrfpy.Color instance
|
||||
auto c = ((PyColorObject*)value)->data;
|
||||
r = c.r; g = c.g; b = c.b; a = c.a;
|
||||
std::cout << "got " << int(r) << ", " << int(g) << ", " << int(b) << ", " << int(a) << std::endl;
|
||||
}
|
||||
else if (!PyTuple_Check(value) || PyTuple_Size(value) < 3 || PyTuple_Size(value) > 4)
|
||||
{
|
||||
// reject non-Color, non-tuple value
|
||||
PyErr_SetString(PyExc_TypeError, "Value must be a tuple of 3 or 4 integers or an mcrfpy.Color object.");
|
||||
return -1;
|
||||
}
|
||||
else // get value from tuples
|
||||
{
|
||||
r = PyLong_AsLong(PyTuple_GetItem(value, 0));
|
||||
g = PyLong_AsLong(PyTuple_GetItem(value, 1));
|
||||
b = PyLong_AsLong(PyTuple_GetItem(value, 2));
|
||||
a = 255;
|
||||
|
||||
if (PyTuple_Size(value) == 4)
|
||||
{
|
||||
a = PyLong_AsLong(PyTuple_GetItem(value, 3));
|
||||
}
|
||||
}
|
||||
|
||||
if (r < 0 || r > 255 || g < 0 || g > 255 || b < 0 || b > 255 || a < 0 || a > 255)
|
||||
{
|
||||
PyErr_SetString(PyExc_ValueError, "Color values must be between 0 and 255.");
|
||||
return -1;
|
||||
}
|
||||
|
||||
if (member_ptr == 0)
|
||||
{
|
||||
self->data->text.setFillColor(sf::Color(r, g, b, a));
|
||||
}
|
||||
else if (member_ptr == 1)
|
||||
{
|
||||
self->data->text.setOutlineColor(sf::Color(r, g, b, a));
|
||||
}
|
||||
else
|
||||
{
|
||||
PyErr_SetString(PyExc_AttributeError, "Invalid attribute");
|
||||
return -1;
|
||||
}
|
||||
|
||||
return 0;
|
||||
}
|
||||
|
||||
|
||||
//TODO: evaluate use of Resources::caption_buffer... can't I do this with a std::string?
|
||||
PyObject* UICaption::get_text(PyUICaptionObject* self, void* closure)
|
||||
{
|
||||
Resources::caption_buffer = self->data->text.getString();
|
||||
return PyUnicode_FromString(Resources::caption_buffer.c_str());
|
||||
}
|
||||
|
||||
int UICaption::set_text(PyUICaptionObject* self, PyObject* value, void* closure)
|
||||
{
|
||||
PyObject* s = PyObject_Str(value);
|
||||
PyObject * temp_bytes = PyUnicode_AsEncodedString(s, "UTF-8", "strict"); // Owned reference
|
||||
if (temp_bytes != NULL) {
|
||||
Resources::caption_buffer = PyBytes_AS_STRING(temp_bytes); // Borrowed pointer
|
||||
Py_DECREF(temp_bytes);
|
||||
}
|
||||
self->data->text.setString(Resources::caption_buffer);
|
||||
return 0;
|
||||
}
|
||||
|
||||
PyGetSetDef UICaption::getsetters[] = {
|
||||
{"x", (getter)UICaption::get_float_member, (setter)UICaption::set_float_member, "X coordinate of top-left corner", (void*)0},
|
||||
{"y", (getter)UICaption::get_float_member, (setter)UICaption::set_float_member, "Y coordinate of top-left corner", (void*)1},
|
||||
{"pos", (getter)UICaption::get_vec_member, (setter)UICaption::set_vec_member, "(x, y) vector", (void*)0},
|
||||
//{"w", (getter)PyUIFrame_get_float_member, (setter)PyUIFrame_set_float_member, "width of the rectangle", (void*)2},
|
||||
//{"h", (getter)PyUIFrame_get_float_member, (setter)PyUIFrame_set_float_member, "height of the rectangle", (void*)3},
|
||||
{"outline", (getter)UICaption::get_float_member, (setter)UICaption::set_float_member, "Thickness of the border", (void*)4},
|
||||
{"fill_color", (getter)UICaption::get_color_member, (setter)UICaption::set_color_member, "Fill color of the text", (void*)0},
|
||||
{"outline_color", (getter)UICaption::get_color_member, (setter)UICaption::set_color_member, "Outline color of the text", (void*)1},
|
||||
//{"children", (getter)PyUIFrame_get_children, NULL, "UICollection of objects on top of this one", NULL},
|
||||
{"text", (getter)UICaption::get_text, (setter)UICaption::set_text, "The text displayed", NULL},
|
||||
{"size", (getter)UICaption::get_float_member, (setter)UICaption::set_float_member, "Text size (integer) in points", (void*)5},
|
||||
{"click", (getter)UIDrawable::get_click, (setter)UIDrawable::set_click, "Object called with (x, y, button) when clicked", (void*)PyObjectsEnum::UICAPTION},
|
||||
{NULL}
|
||||
};
|
||||
|
||||
PyObject* UICaption::repr(PyUICaptionObject* self)
|
||||
{
|
||||
std::ostringstream ss;
|
||||
if (!self->data) ss << "<Caption (invalid internal object)>";
|
||||
else {
|
||||
auto text = self->data->text;
|
||||
auto fc = text.getFillColor();
|
||||
auto oc = text.getOutlineColor();
|
||||
ss << "<Caption (x=" << text.getPosition().x << ", y=" << text.getPosition().y << ", " <<
|
||||
"text='" << (std::string)text.getString() << "', " <<
|
||||
"outline=" << text.getOutlineThickness() << ", " <<
|
||||
"fill_color=(" << (int)fc.r << ", " << (int)fc.g << ", " << (int)fc.b << ", " << (int)fc.a <<"), " <<
|
||||
"outline_color=(" << (int)oc.r << ", " << (int)oc.g << ", " << (int)oc.b << ", " << (int)oc.a <<"), " <<
|
||||
")>";
|
||||
}
|
||||
std::string repr_str = ss.str();
|
||||
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
|
||||
}
|
||||
|
||||
int UICaption::init(PyUICaptionObject* self, PyObject* args, PyObject* kwds)
|
||||
{
|
||||
using namespace mcrfpydef;
|
||||
// Constructor switch to Vector position
|
||||
//static const char* keywords[] = { "x", "y", "text", "font", "fill_color", "outline_color", "outline", nullptr };
|
||||
//float x = 0.0f, y = 0.0f, outline = 0.0f;
|
||||
static const char* keywords[] = { "pos", "text", "font", "fill_color", "outline_color", "outline", nullptr };
|
||||
PyObject* pos;
|
||||
float outline = 0.0f;
|
||||
char* text;
|
||||
PyObject* font=NULL, *fill_color=NULL, *outline_color=NULL;
|
||||
|
||||
//if (!PyArg_ParseTupleAndKeywords(args, kwds, "|ffzOOOf",
|
||||
// const_cast<char**>(keywords), &x, &y, &text, &font, &fill_color, &outline_color, &outline))
|
||||
if (!PyArg_ParseTupleAndKeywords(args, kwds, "O|zOOOf",
|
||||
const_cast<char**>(keywords), &pos, &text, &font, &fill_color, &outline_color, &outline))
|
||||
{
|
||||
return -1;
|
||||
}
|
||||
|
||||
PyVectorObject* pos_result = PyVector::from_arg(pos);
|
||||
if (!pos_result)
|
||||
{
|
||||
PyErr_SetString(PyExc_TypeError, "pos must be a mcrfpy.Vector instance or arguments to mcrfpy.Vector.__init__");
|
||||
return -1;
|
||||
}
|
||||
self->data->text.setPosition(pos_result->data);
|
||||
// check types for font, fill_color, outline_color
|
||||
|
||||
//std::cout << PyUnicode_AsUTF8(PyObject_Repr(font)) << std::endl;
|
||||
if (font != NULL && !PyObject_IsInstance(font, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Font")/*(PyObject*)&PyFontType)*/)){
|
||||
PyErr_SetString(PyExc_TypeError, "font must be a mcrfpy.Font instance");
|
||||
return -1;
|
||||
} else if (font != NULL)
|
||||
{
|
||||
auto font_obj = (PyFontObject*)font;
|
||||
self->data->text.setFont(font_obj->data->font);
|
||||
self->font = font;
|
||||
Py_INCREF(font);
|
||||
} else
|
||||
{
|
||||
// default font
|
||||
//self->data->text.setFont(Resources::game->getFont());
|
||||
}
|
||||
|
||||
self->data->text.setString((std::string)text);
|
||||
self->data->text.setOutlineThickness(outline);
|
||||
if (fill_color) {
|
||||
auto fc = PyColor::from_arg(fill_color);
|
||||
if (!fc) {
|
||||
PyErr_SetString(PyExc_TypeError, "fill_color must be mcrfpy.Color or arguments to mcrfpy.Color.__init__");
|
||||
return -1;
|
||||
}
|
||||
self->data->text.setFillColor(PyColor::fromPy(fc));
|
||||
//Py_DECREF(fc);
|
||||
} else {
|
||||
self->data->text.setFillColor(sf::Color(0,0,0,255));
|
||||
}
|
||||
|
||||
if (outline_color) {
|
||||
auto oc = PyColor::from_arg(outline_color);
|
||||
if (!oc) {
|
||||
PyErr_SetString(PyExc_TypeError, "outline_color must be mcrfpy.Color or arguments to mcrfpy.Color.__init__");
|
||||
return -1;
|
||||
}
|
||||
self->data->text.setOutlineColor(PyColor::fromPy(oc));
|
||||
//Py_DECREF(oc);
|
||||
} else {
|
||||
self->data->text.setOutlineColor(sf::Color(128,128,128,255));
|
||||
}
|
||||
|
||||
return 0;
|
||||
}
|
||||
|
|
@ -1,63 +0,0 @@
|
|||
#pragma once
|
||||
#include "Common.h"
|
||||
#include "Python.h"
|
||||
#include "UIDrawable.h"
|
||||
|
||||
class UICaption: public UIDrawable
|
||||
{
|
||||
public:
|
||||
sf::Text text;
|
||||
void render(sf::Vector2f, sf::RenderTarget&) override final;
|
||||
PyObjectsEnum derived_type() override final;
|
||||
virtual UIDrawable* click_at(sf::Vector2f point) override final;
|
||||
|
||||
static PyObject* get_float_member(PyUICaptionObject* self, void* closure);
|
||||
static int set_float_member(PyUICaptionObject* self, PyObject* value, void* closure);
|
||||
static PyObject* get_vec_member(PyUICaptionObject* self, void* closure);
|
||||
static int set_vec_member(PyUICaptionObject* self, PyObject* value, void* closure);
|
||||
static PyObject* get_color_member(PyUICaptionObject* self, void* closure);
|
||||
static int set_color_member(PyUICaptionObject* self, PyObject* value, void* closure);
|
||||
static PyObject* get_text(PyUICaptionObject* self, void* closure);
|
||||
static int set_text(PyUICaptionObject* self, PyObject* value, void* closure);
|
||||
static PyGetSetDef getsetters[];
|
||||
static PyObject* repr(PyUICaptionObject* self);
|
||||
static int init(PyUICaptionObject* self, PyObject* args, PyObject* kwds);
|
||||
|
||||
};
|
||||
|
||||
namespace mcrfpydef {
|
||||
static PyTypeObject PyUICaptionType = {
|
||||
.ob_base = {.ob_base = {.ob_refcnt = 1, .ob_type = NULL}, .ob_size = 0},
|
||||
.tp_name = "mcrfpy.Caption",
|
||||
.tp_basicsize = sizeof(PyUICaptionObject),
|
||||
.tp_itemsize = 0,
|
||||
// TODO - move tp_dealloc to .cpp file as static function (UICaption::dealloc)
|
||||
.tp_dealloc = (destructor)[](PyObject* self)
|
||||
{
|
||||
PyUICaptionObject* obj = (PyUICaptionObject*)self;
|
||||
// TODO - reevaluate with PyFont usage; UICaption does not own the font
|
||||
// release reference to font object
|
||||
if (obj->font) Py_DECREF(obj->font);
|
||||
obj->data.reset();
|
||||
Py_TYPE(self)->tp_free(self);
|
||||
},
|
||||
.tp_repr = (reprfunc)UICaption::repr,
|
||||
//.tp_hash = NULL,
|
||||
//.tp_iter
|
||||
//.tp_iternext
|
||||
.tp_flags = Py_TPFLAGS_DEFAULT,
|
||||
.tp_doc = PyDoc_STR("docstring"),
|
||||
//.tp_methods = PyUIFrame_methods,
|
||||
//.tp_members = PyUIFrame_members,
|
||||
.tp_getset = UICaption::getsetters,
|
||||
//.tp_base = NULL,
|
||||
.tp_init = (initproc)UICaption::init,
|
||||
// TODO - move tp_new to .cpp file as a static function (UICaption::new)
|
||||
.tp_new = [](PyTypeObject* type, PyObject* args, PyObject* kwds) -> PyObject*
|
||||
{
|
||||
PyUICaptionObject* self = (PyUICaptionObject*)type->tp_alloc(type, 0);
|
||||
if (self) self->data = std::make_shared<UICaption>();
|
||||
return (PyObject*)self;
|
||||
}
|
||||
};
|
||||
}
|
|
@ -1,284 +0,0 @@
|
|||
#include "UICollection.h"
|
||||
|
||||
#include "UIFrame.h"
|
||||
#include "UICaption.h"
|
||||
#include "UISprite.h"
|
||||
#include "UIGrid.h"
|
||||
#include "McRFPy_API.h"
|
||||
#include "PyObjectUtils.h"
|
||||
|
||||
using namespace mcrfpydef;
|
||||
|
||||
// Local helper function to convert UIDrawable to appropriate Python object
|
||||
static PyObject* convertDrawableToPython(std::shared_ptr<UIDrawable> drawable) {
|
||||
if (!drawable) {
|
||||
Py_RETURN_NONE;
|
||||
}
|
||||
|
||||
PyTypeObject* type = nullptr;
|
||||
PyObject* obj = nullptr;
|
||||
|
||||
switch (drawable->derived_type()) {
|
||||
case PyObjectsEnum::UIFRAME:
|
||||
{
|
||||
type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "Frame");
|
||||
if (!type) return nullptr;
|
||||
auto pyObj = (PyUIFrameObject*)type->tp_alloc(type, 0);
|
||||
if (pyObj) {
|
||||
pyObj->data = std::static_pointer_cast<UIFrame>(drawable);
|
||||
}
|
||||
obj = (PyObject*)pyObj;
|
||||
break;
|
||||
}
|
||||
case PyObjectsEnum::UICAPTION:
|
||||
{
|
||||
type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "Caption");
|
||||
if (!type) return nullptr;
|
||||
auto pyObj = (PyUICaptionObject*)type->tp_alloc(type, 0);
|
||||
if (pyObj) {
|
||||
pyObj->data = std::static_pointer_cast<UICaption>(drawable);
|
||||
pyObj->font = nullptr;
|
||||
}
|
||||
obj = (PyObject*)pyObj;
|
||||
break;
|
||||
}
|
||||
case PyObjectsEnum::UISPRITE:
|
||||
{
|
||||
type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "Sprite");
|
||||
if (!type) return nullptr;
|
||||
auto pyObj = (PyUISpriteObject*)type->tp_alloc(type, 0);
|
||||
if (pyObj) {
|
||||
pyObj->data = std::static_pointer_cast<UISprite>(drawable);
|
||||
}
|
||||
obj = (PyObject*)pyObj;
|
||||
break;
|
||||
}
|
||||
case PyObjectsEnum::UIGRID:
|
||||
{
|
||||
type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "Grid");
|
||||
if (!type) return nullptr;
|
||||
auto pyObj = (PyUIGridObject*)type->tp_alloc(type, 0);
|
||||
if (pyObj) {
|
||||
pyObj->data = std::static_pointer_cast<UIGrid>(drawable);
|
||||
}
|
||||
obj = (PyObject*)pyObj;
|
||||
break;
|
||||
}
|
||||
default:
|
||||
PyErr_SetString(PyExc_TypeError, "Unknown UIDrawable derived type");
|
||||
return nullptr;
|
||||
}
|
||||
|
||||
if (type) {
|
||||
Py_DECREF(type);
|
||||
}
|
||||
return obj;
|
||||
}
|
||||
|
||||
int UICollectionIter::init(PyUICollectionIterObject* self, PyObject* args, PyObject* kwds)
|
||||
{
|
||||
PyErr_SetString(PyExc_TypeError, "UICollection cannot be instantiated: a C++ data source is required.");
|
||||
return -1;
|
||||
}
|
||||
|
||||
PyObject* UICollectionIter::next(PyUICollectionIterObject* self)
|
||||
{
|
||||
// Check if self and self->data are valid
|
||||
if (!self || !self->data) {
|
||||
PyErr_SetString(PyExc_RuntimeError, "Iterator object or data is null");
|
||||
return NULL;
|
||||
}
|
||||
|
||||
if (self->data->size() != self->start_size)
|
||||
{
|
||||
PyErr_SetString(PyExc_RuntimeError, "collection changed size during iteration");
|
||||
return NULL;
|
||||
}
|
||||
|
||||
if (self->index > self->start_size - 1)
|
||||
{
|
||||
PyErr_SetNone(PyExc_StopIteration);
|
||||
return NULL;
|
||||
}
|
||||
self->index++;
|
||||
auto vec = self->data.get();
|
||||
if (!vec)
|
||||
{
|
||||
PyErr_SetString(PyExc_RuntimeError, "the collection store returned a null pointer");
|
||||
return NULL;
|
||||
}
|
||||
auto target = (*vec)[self->index-1];
|
||||
// Return the proper Python object for this UIDrawable
|
||||
return convertDrawableToPython(target);
|
||||
}
|
||||
|
||||
PyObject* UICollectionIter::repr(PyUICollectionIterObject* self)
|
||||
{
|
||||
std::ostringstream ss;
|
||||
if (!self->data) ss << "<UICollectionIter (invalid internal object)>";
|
||||
else {
|
||||
ss << "<UICollectionIter (" << self->data->size() << " child objects, @ index " << self->index << ")>";
|
||||
}
|
||||
std::string repr_str = ss.str();
|
||||
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
|
||||
}
|
||||
|
||||
Py_ssize_t UICollection::len(PyUICollectionObject* self) {
|
||||
return self->data->size();
|
||||
}
|
||||
|
||||
PyObject* UICollection::getitem(PyUICollectionObject* self, Py_ssize_t index) {
|
||||
// build a Python version of item at self->data[index]
|
||||
// Copy pasted::
|
||||
auto vec = self->data.get();
|
||||
if (!vec)
|
||||
{
|
||||
PyErr_SetString(PyExc_RuntimeError, "the collection store returned a null pointer");
|
||||
return NULL;
|
||||
}
|
||||
while (index < 0) index += self->data->size();
|
||||
if (index > self->data->size() - 1)
|
||||
{
|
||||
PyErr_SetString(PyExc_IndexError, "UICollection index out of range");
|
||||
return NULL;
|
||||
}
|
||||
auto target = (*vec)[index];
|
||||
return convertDrawableToPython(target);
|
||||
|
||||
|
||||
}
|
||||
|
||||
PySequenceMethods UICollection::sqmethods = {
|
||||
.sq_length = (lenfunc)UICollection::len,
|
||||
.sq_item = (ssizeargfunc)UICollection::getitem,
|
||||
//.sq_item_by_index = PyUICollection_getitem
|
||||
//.sq_slice - return a subset of the iterable
|
||||
//.sq_ass_item - called when `o[x] = y` is executed (x is any object type)
|
||||
//.sq_ass_slice - cool; no thanks, for now
|
||||
//.sq_contains - called when `x in o` is executed
|
||||
//.sq_ass_item_by_index - called when `o[x] = y` is executed (x is explictly an integer)
|
||||
};
|
||||
|
||||
/* Idiomatic way to fetch complete types from the API rather than referencing their PyTypeObject struct
|
||||
|
||||
auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "Texture");
|
||||
|
||||
I never identified why `using namespace mcrfpydef;` doesn't solve the segfault issue.
|
||||
The horrible macro in UIDrawable was originally a workaround for this, but as I interact with the types outside of the monster UI.h, a more general (and less icky) solution is required.
|
||||
|
||||
*/
|
||||
|
||||
PyObject* UICollection::append(PyUICollectionObject* self, PyObject* o)
|
||||
{
|
||||
// if not UIDrawable subclass, reject it
|
||||
// self->data->push_back( c++ object inside o );
|
||||
|
||||
// this would be a great use case for .tp_base
|
||||
if (!PyObject_IsInstance(o, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Frame")) &&
|
||||
!PyObject_IsInstance(o, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Sprite")) &&
|
||||
!PyObject_IsInstance(o, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Caption")) &&
|
||||
!PyObject_IsInstance(o, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Grid"))
|
||||
)
|
||||
{
|
||||
PyErr_SetString(PyExc_TypeError, "Only Frame, Caption, Sprite, and Grid objects can be added to UICollection");
|
||||
return NULL;
|
||||
}
|
||||
|
||||
if (PyObject_IsInstance(o, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Frame")))
|
||||
{
|
||||
PyUIFrameObject* frame = (PyUIFrameObject*)o;
|
||||
self->data->push_back(frame->data);
|
||||
}
|
||||
if (PyObject_IsInstance(o, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Caption")))
|
||||
{
|
||||
PyUICaptionObject* caption = (PyUICaptionObject*)o;
|
||||
self->data->push_back(caption->data);
|
||||
}
|
||||
if (PyObject_IsInstance(o, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Sprite")))
|
||||
{
|
||||
PyUISpriteObject* sprite = (PyUISpriteObject*)o;
|
||||
self->data->push_back(sprite->data);
|
||||
}
|
||||
if (PyObject_IsInstance(o, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Grid")))
|
||||
{
|
||||
PyUIGridObject* grid = (PyUIGridObject*)o;
|
||||
self->data->push_back(grid->data);
|
||||
}
|
||||
|
||||
Py_INCREF(Py_None);
|
||||
return Py_None;
|
||||
}
|
||||
|
||||
PyObject* UICollection::remove(PyUICollectionObject* self, PyObject* o)
|
||||
{
|
||||
if (!PyLong_Check(o))
|
||||
{
|
||||
PyErr_SetString(PyExc_TypeError, "UICollection.remove requires an integer index to remove");
|
||||
return NULL;
|
||||
}
|
||||
long index = PyLong_AsLong(o);
|
||||
if (index >= self->data->size())
|
||||
{
|
||||
PyErr_SetString(PyExc_ValueError, "Index out of range");
|
||||
return NULL;
|
||||
}
|
||||
else if (index < 0)
|
||||
{
|
||||
PyErr_SetString(PyExc_NotImplementedError, "reverse indexing is not implemented.");
|
||||
return NULL;
|
||||
}
|
||||
|
||||
// release the shared pointer at self->data[index];
|
||||
self->data->erase(self->data->begin() + index);
|
||||
Py_INCREF(Py_None);
|
||||
return Py_None;
|
||||
}
|
||||
|
||||
PyMethodDef UICollection::methods[] = {
|
||||
{"append", (PyCFunction)UICollection::append, METH_O},
|
||||
//{"extend", (PyCFunction)PyUICollection_extend, METH_O}, // TODO
|
||||
{"remove", (PyCFunction)UICollection::remove, METH_O},
|
||||
{NULL, NULL, 0, NULL}
|
||||
};
|
||||
|
||||
PyObject* UICollection::repr(PyUICollectionObject* self)
|
||||
{
|
||||
std::ostringstream ss;
|
||||
if (!self->data) ss << "<UICollection (invalid internal object)>";
|
||||
else {
|
||||
ss << "<UICollection (" << self->data->size() << " child objects)>";
|
||||
}
|
||||
std::string repr_str = ss.str();
|
||||
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
|
||||
}
|
||||
|
||||
int UICollection::init(PyUICollectionObject* self, PyObject* args, PyObject* kwds)
|
||||
{
|
||||
PyErr_SetString(PyExc_TypeError, "UICollection cannot be instantiated: a C++ data source is required.");
|
||||
return -1;
|
||||
}
|
||||
|
||||
PyObject* UICollection::iter(PyUICollectionObject* self)
|
||||
{
|
||||
// Get the iterator type from the module to ensure we have the registered version
|
||||
PyTypeObject* iterType = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "UICollectionIter");
|
||||
if (!iterType) {
|
||||
PyErr_SetString(PyExc_RuntimeError, "Could not find UICollectionIter type in module");
|
||||
return NULL;
|
||||
}
|
||||
|
||||
// Allocate new iterator instance
|
||||
PyUICollectionIterObject* iterObj = (PyUICollectionIterObject*)iterType->tp_alloc(iterType, 0);
|
||||
|
||||
if (iterObj == NULL) {
|
||||
Py_DECREF(iterType);
|
||||
return NULL; // Failed to allocate memory for the iterator object
|
||||
}
|
||||
|
||||
iterObj->data = self->data;
|
||||
iterObj->index = 0;
|
||||
iterObj->start_size = self->data->size();
|
||||
|
||||
Py_DECREF(iterType);
|
||||
return (PyObject*)iterObj;
|
||||
}
|
|
@ -1,90 +0,0 @@
|
|||
#pragma once
|
||||
#include "Common.h"
|
||||
#include "Python.h"
|
||||
|
||||
#include "UIDrawable.h"
|
||||
|
||||
class UICollectionIter
|
||||
{
|
||||
// really more of a namespace: all the members are public and static. But being consistent with other UI objects
|
||||
public:
|
||||
static int init(PyUICollectionIterObject* self, PyObject* args, PyObject* kwds);
|
||||
static PyObject* next(PyUICollectionIterObject* self);
|
||||
static PyObject* repr(PyUICollectionIterObject* self);
|
||||
};
|
||||
|
||||
class UICollection
|
||||
{
|
||||
// really more of a namespace: all the members are public and static. But being consistent with other UI objects
|
||||
public:
|
||||
static Py_ssize_t len(PyUICollectionObject* self);
|
||||
static PyObject* getitem(PyUICollectionObject* self, Py_ssize_t index);
|
||||
static PySequenceMethods sqmethods;
|
||||
static PyObject* append(PyUICollectionObject* self, PyObject* o);
|
||||
static PyObject* remove(PyUICollectionObject* self, PyObject* o);
|
||||
static PyMethodDef methods[];
|
||||
static PyObject* repr(PyUICollectionObject* self);
|
||||
static int init(PyUICollectionObject* self, PyObject* args, PyObject* kwds);
|
||||
static PyObject* iter(PyUICollectionObject* self);
|
||||
};
|
||||
|
||||
namespace mcrfpydef {
|
||||
static PyTypeObject PyUICollectionIterType = {
|
||||
.ob_base = {.ob_base = {.ob_refcnt = 1, .ob_type = NULL}, .ob_size = 0},
|
||||
.tp_name = "mcrfpy.UICollectionIter",
|
||||
.tp_basicsize = sizeof(PyUICollectionIterObject),
|
||||
.tp_itemsize = 0,
|
||||
//TODO - as static method, not inline lambda def, please
|
||||
.tp_dealloc = (destructor)[](PyObject* self)
|
||||
{
|
||||
PyUICollectionIterObject* obj = (PyUICollectionIterObject*)self;
|
||||
obj->data.reset();
|
||||
Py_TYPE(self)->tp_free(self);
|
||||
},
|
||||
.tp_repr = (reprfunc)UICollectionIter::repr,
|
||||
.tp_flags = Py_TPFLAGS_DEFAULT,
|
||||
.tp_doc = PyDoc_STR("Iterator for a collection of UI objects"),
|
||||
.tp_iter = PyObject_SelfIter,
|
||||
.tp_iternext = (iternextfunc)UICollectionIter::next,
|
||||
//.tp_getset = PyUICollection_getset,
|
||||
.tp_init = (initproc)UICollectionIter::init, // just raise an exception
|
||||
.tp_alloc = PyType_GenericAlloc,
|
||||
//TODO - as static method, not inline lambda def, please
|
||||
.tp_new = [](PyTypeObject* type, PyObject* args, PyObject* kwds) -> PyObject*
|
||||
{
|
||||
PyErr_SetString(PyExc_TypeError, "UICollection cannot be instantiated: a C++ data source is required.");
|
||||
return NULL;
|
||||
}
|
||||
};
|
||||
|
||||
static PyTypeObject PyUICollectionType = {
|
||||
.ob_base = {.ob_base = {.ob_refcnt = 1, .ob_type = NULL}, .ob_size = 0},
|
||||
.tp_name = "mcrfpy.UICollection",
|
||||
.tp_basicsize = sizeof(PyUICollectionObject),
|
||||
.tp_itemsize = 0,
|
||||
//TODO - as static method, not inline lambda def, please
|
||||
.tp_dealloc = (destructor)[](PyObject* self)
|
||||
{
|
||||
PyUICollectionObject* obj = (PyUICollectionObject*)self;
|
||||
obj->data.reset();
|
||||
Py_TYPE(self)->tp_free(self);
|
||||
},
|
||||
.tp_repr = (reprfunc)UICollection::repr,
|
||||
.tp_as_sequence = &UICollection::sqmethods,
|
||||
.tp_flags = Py_TPFLAGS_DEFAULT,
|
||||
.tp_doc = PyDoc_STR("Iterable, indexable collection of UI objects"),
|
||||
.tp_iter = (getiterfunc)UICollection::iter,
|
||||
.tp_methods = UICollection::methods, // append, remove
|
||||
//.tp_getset = PyUICollection_getset,
|
||||
.tp_init = (initproc)UICollection::init, // just raise an exception
|
||||
//TODO - as static method, not inline lambda def, please
|
||||
.tp_new = [](PyTypeObject* type, PyObject* args, PyObject* kwds) -> PyObject*
|
||||
{
|
||||
// Does PyUICollectionType need __new__ if it's not supposed to be instantiable by the user?
|
||||
// Should I just raise an exception? Or is the uninitialized shared_ptr enough of a blocker?
|
||||
PyErr_SetString(PyExc_TypeError, "UICollection cannot be instantiated: a C++ data source is required.");
|
||||
return NULL;
|
||||
}
|
||||
};
|
||||
|
||||
}
|
|
@ -1,82 +0,0 @@
|
|||
#include "UIDrawable.h"
|
||||
#include "UIFrame.h"
|
||||
#include "UICaption.h"
|
||||
#include "UISprite.h"
|
||||
#include "UIGrid.h"
|
||||
#include "GameEngine.h"
|
||||
|
||||
UIDrawable::UIDrawable() { click_callable = NULL; }
|
||||
|
||||
void UIDrawable::click_unregister()
|
||||
{
|
||||
click_callable.reset();
|
||||
}
|
||||
|
||||
void UIDrawable::render()
|
||||
{
|
||||
render(sf::Vector2f(), Resources::game->getWindow());
|
||||
}
|
||||
|
||||
PyObject* UIDrawable::get_click(PyObject* self, void* closure) {
|
||||
PyObjectsEnum objtype = static_cast<PyObjectsEnum>(reinterpret_cast<long>(closure)); // trust me bro, it's an Enum
|
||||
PyObject* ptr;
|
||||
|
||||
switch (objtype)
|
||||
{
|
||||
case PyObjectsEnum::UIFRAME:
|
||||
ptr = ((PyUIFrameObject*)self)->data->click_callable->borrow();
|
||||
break;
|
||||
case PyObjectsEnum::UICAPTION:
|
||||
ptr = ((PyUICaptionObject*)self)->data->click_callable->borrow();
|
||||
break;
|
||||
case PyObjectsEnum::UISPRITE:
|
||||
ptr = ((PyUISpriteObject*)self)->data->click_callable->borrow();
|
||||
break;
|
||||
case PyObjectsEnum::UIGRID:
|
||||
ptr = ((PyUIGridObject*)self)->data->click_callable->borrow();
|
||||
break;
|
||||
default:
|
||||
PyErr_SetString(PyExc_TypeError, "no idea how you did that; invalid UIDrawable derived instance for _get_click");
|
||||
return NULL;
|
||||
}
|
||||
if (ptr && ptr != Py_None)
|
||||
return ptr;
|
||||
else
|
||||
return Py_None;
|
||||
}
|
||||
|
||||
int UIDrawable::set_click(PyObject* self, PyObject* value, void* closure) {
|
||||
PyObjectsEnum objtype = static_cast<PyObjectsEnum>(reinterpret_cast<long>(closure)); // trust me bro, it's an Enum
|
||||
UIDrawable* target;
|
||||
switch (objtype)
|
||||
{
|
||||
case PyObjectsEnum::UIFRAME:
|
||||
target = (((PyUIFrameObject*)self)->data.get());
|
||||
break;
|
||||
case PyObjectsEnum::UICAPTION:
|
||||
target = (((PyUICaptionObject*)self)->data.get());
|
||||
break;
|
||||
case PyObjectsEnum::UISPRITE:
|
||||
target = (((PyUISpriteObject*)self)->data.get());
|
||||
break;
|
||||
case PyObjectsEnum::UIGRID:
|
||||
target = (((PyUIGridObject*)self)->data.get());
|
||||
break;
|
||||
default:
|
||||
PyErr_SetString(PyExc_TypeError, "no idea how you did that; invalid UIDrawable derived instance for _set_click");
|
||||
return -1;
|
||||
}
|
||||
|
||||
if (value == Py_None)
|
||||
{
|
||||
target->click_unregister();
|
||||
} else {
|
||||
target->click_register(value);
|
||||
}
|
||||
return 0;
|
||||
}
|
||||
|
||||
void UIDrawable::click_register(PyObject* callable)
|
||||
{
|
||||
click_callable = std::make_unique<PyClickCallable>(callable);
|
||||
}
|
127
src/UIDrawable.h
127
src/UIDrawable.h
|
@ -1,127 +0,0 @@
|
|||
#pragma once
|
||||
#include "Common.h"
|
||||
#include "Python.h"
|
||||
#include "structmember.h"
|
||||
#include "IndexTexture.h"
|
||||
#include "Resources.h"
|
||||
#include <list>
|
||||
|
||||
#include "PyCallable.h"
|
||||
#include "PyTexture.h"
|
||||
#include "PyColor.h"
|
||||
#include "PyVector.h"
|
||||
#include "PyFont.h"
|
||||
|
||||
#include "Resources.h"
|
||||
#include "UIBase.h"
|
||||
class UIFrame; class UICaption; class UISprite; class UIEntity; class UIGrid;
|
||||
|
||||
enum PyObjectsEnum : int
|
||||
{
|
||||
UIFRAME = 1,
|
||||
UICAPTION,
|
||||
UISPRITE,
|
||||
UIGRID
|
||||
};
|
||||
|
||||
class UIDrawable
|
||||
{
|
||||
public:
|
||||
void render();
|
||||
//virtual void render(sf::Vector2f) = 0;
|
||||
virtual void render(sf::Vector2f, sf::RenderTarget&) = 0;
|
||||
virtual PyObjectsEnum derived_type() = 0;
|
||||
|
||||
// Mouse input handling - callable object, methods to find event's destination
|
||||
std::unique_ptr<PyClickCallable> click_callable;
|
||||
virtual UIDrawable* click_at(sf::Vector2f point) = 0;
|
||||
void click_register(PyObject*);
|
||||
void click_unregister();
|
||||
|
||||
UIDrawable();
|
||||
|
||||
static PyObject* get_click(PyObject* self, void* closure);
|
||||
static int set_click(PyObject* self, PyObject* value, void* closure);
|
||||
};
|
||||
|
||||
typedef struct {
|
||||
PyObject_HEAD
|
||||
std::shared_ptr<std::vector<std::shared_ptr<UIDrawable>>> data;
|
||||
} PyUICollectionObject;
|
||||
|
||||
typedef struct {
|
||||
PyObject_HEAD
|
||||
std::shared_ptr<std::vector<std::shared_ptr<UIDrawable>>> data;
|
||||
int index;
|
||||
int start_size;
|
||||
} PyUICollectionIterObject;
|
||||
|
||||
namespace mcrfpydef {
|
||||
// DEPRECATED: RET_PY_INSTANCE macro has been replaced with template functions in PyObjectUtils.h
|
||||
// The macro was difficult to debug and used static type references that could cause initialization order issues.
|
||||
// Use PyObjectUtils::convertDrawableToPython() or PyObjectUtils::createPyObject<T>() instead.
|
||||
|
||||
//TODO: add this method to class scope; move implementation to .cpp file
|
||||
/*
|
||||
static PyObject* PyUIDrawable_get_click(PyObject* self, void* closure) {
|
||||
PyObjectsEnum objtype = static_cast<PyObjectsEnum>(reinterpret_cast<long>(closure)); // trust me bro, it's an Enum
|
||||
PyObject* ptr;
|
||||
|
||||
switch (objtype)
|
||||
{
|
||||
case PyObjectsEnum::UIFRAME:
|
||||
ptr = ((PyUIFrameObject*)self)->data->click_callable->borrow();
|
||||
break;
|
||||
case PyObjectsEnum::UICAPTION:
|
||||
ptr = ((PyUICaptionObject*)self)->data->click_callable->borrow();
|
||||
break;
|
||||
case PyObjectsEnum::UISPRITE:
|
||||
ptr = ((PyUISpriteObject*)self)->data->click_callable->borrow();
|
||||
break;
|
||||
case PyObjectsEnum::UIGRID:
|
||||
ptr = ((PyUIGridObject*)self)->data->click_callable->borrow();
|
||||
break;
|
||||
default:
|
||||
PyErr_SetString(PyExc_TypeError, "no idea how you did that; invalid UIDrawable derived instance for _get_click");
|
||||
return NULL;
|
||||
}
|
||||
if (ptr && ptr != Py_None)
|
||||
return ptr;
|
||||
else
|
||||
return Py_None;
|
||||
}*/
|
||||
|
||||
//TODO: add this method to class scope; move implementation to .cpp file
|
||||
/*
|
||||
static int PyUIDrawable_set_click(PyObject* self, PyObject* value, void* closure) {
|
||||
PyObjectsEnum objtype = static_cast<PyObjectsEnum>(reinterpret_cast<long>(closure)); // trust me bro, it's an Enum
|
||||
UIDrawable* target;
|
||||
switch (objtype)
|
||||
{
|
||||
case PyObjectsEnum::UIFRAME:
|
||||
target = (((PyUIFrameObject*)self)->data.get());
|
||||
break;
|
||||
case PyObjectsEnum::UICAPTION:
|
||||
target = (((PyUICaptionObject*)self)->data.get());
|
||||
break;
|
||||
case PyObjectsEnum::UISPRITE:
|
||||
target = (((PyUISpriteObject*)self)->data.get());
|
||||
break;
|
||||
case PyObjectsEnum::UIGRID:
|
||||
target = (((PyUIGridObject*)self)->data.get());
|
||||
break;
|
||||
default:
|
||||
PyErr_SetString(PyExc_TypeError, "no idea how you did that; invalid UIDrawable derived instance for _set_click");
|
||||
return -1;
|
||||
}
|
||||
|
||||
if (value == Py_None)
|
||||
{
|
||||
target->click_unregister();
|
||||
} else {
|
||||
target->click_register(value);
|
||||
}
|
||||
return 0;
|
||||
}
|
||||
*/
|
||||
}
|
213
src/UIEntity.cpp
213
src/UIEntity.cpp
|
@ -1,213 +0,0 @@
|
|||
#include "UIEntity.h"
|
||||
#include "UIGrid.h"
|
||||
#include "McRFPy_API.h"
|
||||
#include "PyObjectUtils.h"
|
||||
|
||||
UIEntity::UIEntity() {} // this will not work lol. TODO remove default constructor by finding the shared pointer inits that use it
|
||||
|
||||
UIEntity::UIEntity(UIGrid& grid)
|
||||
: gridstate(grid.grid_x * grid.grid_y)
|
||||
{
|
||||
}
|
||||
|
||||
PyObject* UIEntity::at(PyUIEntityObject* self, PyObject* o) {
|
||||
int x, y;
|
||||
if (!PyArg_ParseTuple(o, "ii", &x, &y)) {
|
||||
PyErr_SetString(PyExc_TypeError, "UIEntity.at requires two integer arguments: (x, y)");
|
||||
return NULL;
|
||||
}
|
||||
|
||||
if (self->data->grid == NULL) {
|
||||
PyErr_SetString(PyExc_ValueError, "Entity cannot access surroundings because it is not associated with a grid");
|
||||
return NULL;
|
||||
}
|
||||
/*
|
||||
PyUIGridPointStateObject* obj = (PyUIGridPointStateObject*)((&mcrfpydef::PyUIGridPointStateType)->tp_alloc(&mcrfpydef::PyUIGridPointStateType, 0));
|
||||
*/
|
||||
auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "GridPointState");
|
||||
auto obj = (PyUIGridPointStateObject*)type->tp_alloc(type, 0);
|
||||
//auto target = std::static_pointer_cast<UIEntity>(target);
|
||||
obj->data = &(self->data->gridstate[y + self->data->grid->grid_x * x]);
|
||||
obj->grid = self->data->grid;
|
||||
obj->entity = self->data;
|
||||
return (PyObject*)obj;
|
||||
|
||||
}
|
||||
|
||||
int UIEntity::init(PyUIEntityObject* self, PyObject* args, PyObject* kwds) {
|
||||
//static const char* keywords[] = { "x", "y", "texture", "sprite_index", "grid", nullptr };
|
||||
//float x = 0.0f, y = 0.0f, scale = 1.0f;
|
||||
static const char* keywords[] = { "pos", "texture", "sprite_index", "grid", nullptr };
|
||||
PyObject* pos;
|
||||
float scale = 1.0f;
|
||||
int sprite_index = -1;
|
||||
PyObject* texture = NULL;
|
||||
PyObject* grid = NULL;
|
||||
|
||||
//if (!PyArg_ParseTupleAndKeywords(args, kwds, "ffOi|O",
|
||||
// const_cast<char**>(keywords), &x, &y, &texture, &sprite_index, &grid))
|
||||
if (!PyArg_ParseTupleAndKeywords(args, kwds, "OOi|O",
|
||||
const_cast<char**>(keywords), &pos, &texture, &sprite_index, &grid))
|
||||
{
|
||||
return -1;
|
||||
}
|
||||
|
||||
PyVectorObject* pos_result = PyVector::from_arg(pos);
|
||||
if (!pos_result)
|
||||
{
|
||||
PyErr_SetString(PyExc_TypeError, "pos must be a mcrfpy.Vector instance or arguments to mcrfpy.Vector.__init__");
|
||||
return -1;
|
||||
}
|
||||
|
||||
// check types for texture
|
||||
//
|
||||
// Set Texture
|
||||
//
|
||||
if (texture != NULL && !PyObject_IsInstance(texture, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Texture"))){
|
||||
PyErr_SetString(PyExc_TypeError, "texture must be a mcrfpy.Texture instance");
|
||||
return -1;
|
||||
} /*else if (texture != NULL) // this section needs to go; texture isn't optional and isn't managed by the UI objects anymore
|
||||
{
|
||||
self->texture = texture;
|
||||
Py_INCREF(texture);
|
||||
} else
|
||||
{
|
||||
// default tex?
|
||||
}*/
|
||||
|
||||
if (grid != NULL && !PyObject_IsInstance(grid, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Grid"))) {
|
||||
PyErr_SetString(PyExc_TypeError, "grid must be a mcrfpy.Grid instance");
|
||||
return -1;
|
||||
}
|
||||
|
||||
auto pytexture = (PyTextureObject*)texture;
|
||||
if (grid == NULL)
|
||||
self->data = std::make_shared<UIEntity>();
|
||||
else
|
||||
self->data = std::make_shared<UIEntity>(*((PyUIGridObject*)grid)->data);
|
||||
|
||||
// TODO - PyTextureObjects and IndexTextures are a little bit of a mess with shared/unshared pointers
|
||||
self->data->sprite = UISprite(pytexture->data, sprite_index, sf::Vector2f(0,0), 1.0);
|
||||
self->data->position = pos_result->data;
|
||||
if (grid != NULL) {
|
||||
PyUIGridObject* pygrid = (PyUIGridObject*)grid;
|
||||
self->data->grid = pygrid->data;
|
||||
// todone - on creation of Entity with Grid assignment, also append it to the entity list
|
||||
pygrid->data->entities->push_back(self->data);
|
||||
}
|
||||
return 0;
|
||||
}
|
||||
|
||||
|
||||
|
||||
PyObject* UIEntity::get_spritenumber(PyUIEntityObject* self, void* closure) {
|
||||
return PyLong_FromDouble(self->data->sprite.getSpriteIndex());
|
||||
}
|
||||
|
||||
PyObject* sfVector2f_to_PyObject(sf::Vector2f vector) {
|
||||
return Py_BuildValue("(ff)", vector.x, vector.y);
|
||||
}
|
||||
|
||||
PyObject* sfVector2i_to_PyObject(sf::Vector2i vector) {
|
||||
return Py_BuildValue("(ii)", vector.x, vector.y);
|
||||
}
|
||||
|
||||
sf::Vector2f PyObject_to_sfVector2f(PyObject* obj) {
|
||||
float x, y;
|
||||
if (!PyArg_ParseTuple(obj, "ff", &x, &y)) {
|
||||
return sf::Vector2f(); // TODO / reconsider this default: Return default vector on parse error
|
||||
}
|
||||
return sf::Vector2f(x, y);
|
||||
}
|
||||
|
||||
sf::Vector2i PyObject_to_sfVector2i(PyObject* obj) {
|
||||
int x, y;
|
||||
if (!PyArg_ParseTuple(obj, "ii", &x, &y)) {
|
||||
return sf::Vector2i(); // TODO / reconsider this default: Return default vector on parse error
|
||||
}
|
||||
return sf::Vector2i(x, y);
|
||||
}
|
||||
|
||||
// TODO - deprecate / remove this helper
|
||||
PyObject* UIGridPointState_to_PyObject(const UIGridPointState& state) {
|
||||
// This function is incomplete - it creates an empty object without setting state data
|
||||
// Should use PyObjectUtils::createGridPointState() instead
|
||||
return PyObjectUtils::createPyObjectGeneric("GridPointState");
|
||||
}
|
||||
|
||||
PyObject* UIGridPointStateVector_to_PyList(const std::vector<UIGridPointState>& vec) {
|
||||
PyObject* list = PyList_New(vec.size());
|
||||
if (!list) return PyErr_NoMemory();
|
||||
|
||||
for (size_t i = 0; i < vec.size(); ++i) {
|
||||
PyObject* obj = UIGridPointState_to_PyObject(vec[i]);
|
||||
if (!obj) { // Cleanup on failure
|
||||
Py_DECREF(list);
|
||||
return NULL;
|
||||
}
|
||||
PyList_SET_ITEM(list, i, obj); // This steals a reference to obj
|
||||
}
|
||||
|
||||
return list;
|
||||
}
|
||||
|
||||
PyObject* UIEntity::get_position(PyUIEntityObject* self, void* closure) {
|
||||
if (reinterpret_cast<long>(closure) == 0) {
|
||||
return sfVector2f_to_PyObject(self->data->position);
|
||||
} else {
|
||||
return sfVector2i_to_PyObject(self->data->collision_pos);
|
||||
}
|
||||
}
|
||||
|
||||
int UIEntity::set_position(PyUIEntityObject* self, PyObject* value, void* closure) {
|
||||
if (reinterpret_cast<long>(closure) == 0) {
|
||||
self->data->position = PyObject_to_sfVector2f(value);
|
||||
} else {
|
||||
self->data->collision_pos = PyObject_to_sfVector2i(value);
|
||||
}
|
||||
return 0;
|
||||
}
|
||||
|
||||
PyObject* UIEntity::get_gridstate(PyUIEntityObject* self, void* closure) {
|
||||
// Assuming a function to convert std::vector<UIGridPointState> to PyObject* list
|
||||
return UIGridPointStateVector_to_PyList(self->data->gridstate);
|
||||
}
|
||||
|
||||
int UIEntity::set_spritenumber(PyUIEntityObject* self, PyObject* value, void* closure) {
|
||||
int val;
|
||||
if (PyLong_Check(value))
|
||||
val = PyLong_AsLong(value);
|
||||
else
|
||||
{
|
||||
PyErr_SetString(PyExc_TypeError, "Value must be an integer.");
|
||||
return -1;
|
||||
}
|
||||
//self->data->sprite.sprite_index = val;
|
||||
self->data->sprite.setSpriteIndex(val); // todone - I don't like ".sprite.sprite" in this stack of UIEntity.UISprite.sf::Sprite
|
||||
return 0;
|
||||
}
|
||||
|
||||
PyMethodDef UIEntity::methods[] = {
|
||||
{"at", (PyCFunction)UIEntity::at, METH_O},
|
||||
{NULL, NULL, 0, NULL}
|
||||
};
|
||||
|
||||
PyGetSetDef UIEntity::getsetters[] = {
|
||||
{"draw_pos", (getter)UIEntity::get_position, (setter)UIEntity::set_position, "Entity position (graphically)", (void*)0},
|
||||
{"pos", (getter)UIEntity::get_position, (setter)UIEntity::set_position, "Entity position (integer grid coordinates)", (void*)1},
|
||||
{"gridstate", (getter)UIEntity::get_gridstate, NULL, "Grid point states for the entity", NULL},
|
||||
{"sprite_number", (getter)UIEntity::get_spritenumber, (setter)UIEntity::set_spritenumber, "Sprite number (index) on the texture on the display", NULL},
|
||||
{NULL} /* Sentinel */
|
||||
};
|
||||
|
||||
PyObject* UIEntity::repr(PyUIEntityObject* self) {
|
||||
std::ostringstream ss;
|
||||
if (!self->data) ss << "<Entity (invalid internal object)>";
|
||||
else {
|
||||
auto ent = self->data;
|
||||
ss << "<Entity (x=" << self->data->position.x << ", y=" << self->data->position.y << ", sprite_number=" << self->data->sprite.getSpriteIndex() <<
|
||||
")>";
|
||||
}
|
||||
std::string repr_str = ss.str();
|
||||
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
|
||||
}
|
|
@ -1,76 +0,0 @@
|
|||
#pragma once
|
||||
#include "Common.h"
|
||||
#include "Python.h"
|
||||
#include "structmember.h"
|
||||
#include "IndexTexture.h"
|
||||
#include "Resources.h"
|
||||
#include <list>
|
||||
|
||||
#include "PyCallable.h"
|
||||
#include "PyTexture.h"
|
||||
#include "PyColor.h"
|
||||
#include "PyVector.h"
|
||||
#include "PyFont.h"
|
||||
|
||||
#include "UIGridPoint.h"
|
||||
#include "UIDrawable.h"
|
||||
#include "UIBase.h"
|
||||
#include "UISprite.h"
|
||||
|
||||
class UIGrid;
|
||||
|
||||
//class UIEntity;
|
||||
//typedef struct {
|
||||
// PyObject_HEAD
|
||||
// std::shared_ptr<UIEntity> data;
|
||||
//} PyUIEntityObject;
|
||||
|
||||
// helper methods with no namespace requirement
|
||||
static PyObject* sfVector2f_to_PyObject(sf::Vector2f vector);
|
||||
static sf::Vector2f PyObject_to_sfVector2f(PyObject* obj);
|
||||
static PyObject* UIGridPointState_to_PyObject(const UIGridPointState& state);
|
||||
static PyObject* UIGridPointStateVector_to_PyList(const std::vector<UIGridPointState>& vec);
|
||||
|
||||
// TODO: make UIEntity a drawable
|
||||
class UIEntity//: public UIDrawable
|
||||
{
|
||||
public:
|
||||
//PyObject* self;
|
||||
std::shared_ptr<UIGrid> grid;
|
||||
std::vector<UIGridPointState> gridstate;
|
||||
UISprite sprite;
|
||||
sf::Vector2f position; //(x,y) in grid coordinates; float for animation
|
||||
sf::Vector2i collision_pos; //(x, y) in grid coordinates: int for collision
|
||||
//void render(sf::Vector2f); //override final;
|
||||
|
||||
UIEntity();
|
||||
UIEntity(UIGrid&);
|
||||
|
||||
static PyObject* at(PyUIEntityObject* self, PyObject* o);
|
||||
static int init(PyUIEntityObject* self, PyObject* args, PyObject* kwds);
|
||||
|
||||
static PyObject* get_position(PyUIEntityObject* self, void* closure);
|
||||
static int set_position(PyUIEntityObject* self, PyObject* value, void* closure);
|
||||
static PyObject* get_gridstate(PyUIEntityObject* self, void* closure);
|
||||
static PyObject* get_spritenumber(PyUIEntityObject* self, void* closure);
|
||||
static int set_spritenumber(PyUIEntityObject* self, PyObject* value, void* closure);
|
||||
static PyMethodDef methods[];
|
||||
static PyGetSetDef getsetters[];
|
||||
static PyObject* repr(PyUIEntityObject* self);
|
||||
};
|
||||
|
||||
namespace mcrfpydef {
|
||||
static PyTypeObject PyUIEntityType = {
|
||||
.ob_base = {.ob_base = {.ob_refcnt = 1, .ob_type = NULL}, .ob_size = 0},
|
||||
.tp_name = "mcrfpy.Entity",
|
||||
.tp_basicsize = sizeof(PyUIEntityObject),
|
||||
.tp_itemsize = 0,
|
||||
.tp_repr = (reprfunc)UIEntity::repr,
|
||||
.tp_flags = Py_TPFLAGS_DEFAULT | Py_TPFLAGS_BASETYPE,
|
||||
.tp_doc = "UIEntity objects",
|
||||
.tp_methods = UIEntity::methods,
|
||||
.tp_getset = UIEntity::getsetters,
|
||||
.tp_init = (initproc)UIEntity::init,
|
||||
.tp_new = PyType_GenericNew,
|
||||
};
|
||||
}
|
266
src/UIFrame.cpp
266
src/UIFrame.cpp
|
@ -1,266 +0,0 @@
|
|||
#include "UIFrame.h"
|
||||
#include "UICollection.h"
|
||||
#include "GameEngine.h"
|
||||
|
||||
UIDrawable* UIFrame::click_at(sf::Vector2f point)
|
||||
{
|
||||
for (auto e: *children)
|
||||
{
|
||||
auto p = e->click_at(point + box.getPosition());
|
||||
if (p)
|
||||
return p;
|
||||
}
|
||||
if (click_callable)
|
||||
{
|
||||
float x = box.getPosition().x, y = box.getPosition().y, w = box.getSize().x, h = box.getSize().y;
|
||||
if (point.x > x && point.y > y && point.x < x+w && point.y < y+h) return this;
|
||||
}
|
||||
return NULL;
|
||||
}
|
||||
|
||||
UIFrame::UIFrame()
|
||||
: outline(0)
|
||||
{
|
||||
children = std::make_shared<std::vector<std::shared_ptr<UIDrawable>>>();
|
||||
box.setPosition(0, 0);
|
||||
box.setSize(sf::Vector2f(0, 0));
|
||||
}
|
||||
|
||||
UIFrame::UIFrame(float _x, float _y, float _w, float _h)
|
||||
: outline(0)
|
||||
{
|
||||
box.setPosition(_x, _y);
|
||||
box.setSize(sf::Vector2f(_w, _h));
|
||||
children = std::make_shared<std::vector<std::shared_ptr<UIDrawable>>>();
|
||||
}
|
||||
|
||||
UIFrame::~UIFrame()
|
||||
{
|
||||
children.reset();
|
||||
}
|
||||
|
||||
PyObjectsEnum UIFrame::derived_type()
|
||||
{
|
||||
return PyObjectsEnum::UIFRAME;
|
||||
}
|
||||
|
||||
void UIFrame::render(sf::Vector2f offset, sf::RenderTarget& target)
|
||||
{
|
||||
box.move(offset);
|
||||
//Resources::game->getWindow().draw(box);
|
||||
target.draw(box);
|
||||
box.move(-offset);
|
||||
|
||||
for (auto drawable : *children) {
|
||||
drawable->render(offset + box.getPosition(), target);
|
||||
}
|
||||
}
|
||||
|
||||
PyObject* UIFrame::get_children(PyUIFrameObject* self, void* closure)
|
||||
{
|
||||
// create PyUICollection instance pointing to self->data->children
|
||||
//PyUICollectionObject* o = (PyUICollectionObject*)mcrfpydef::PyUICollectionType.tp_alloc(&mcrfpydef::PyUICollectionType, 0);
|
||||
auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "UICollection");
|
||||
auto o = (PyUICollectionObject*)type->tp_alloc(type, 0);
|
||||
if (o)
|
||||
o->data = self->data->children;
|
||||
return (PyObject*)o;
|
||||
}
|
||||
|
||||
|
||||
PyObject* UIFrame::get_float_member(PyUIFrameObject* self, void* closure)
|
||||
{
|
||||
auto member_ptr = reinterpret_cast<long>(closure);
|
||||
if (member_ptr == 0)
|
||||
return PyFloat_FromDouble(self->data->box.getPosition().x);
|
||||
else if (member_ptr == 1)
|
||||
return PyFloat_FromDouble(self->data->box.getPosition().y);
|
||||
else if (member_ptr == 2)
|
||||
return PyFloat_FromDouble(self->data->box.getSize().x);
|
||||
else if (member_ptr == 3)
|
||||
return PyFloat_FromDouble(self->data->box.getSize().y);
|
||||
else if (member_ptr == 4)
|
||||
return PyFloat_FromDouble(self->data->box.getOutlineThickness());
|
||||
else
|
||||
{
|
||||
PyErr_SetString(PyExc_AttributeError, "Invalid attribute");
|
||||
return nullptr;
|
||||
}
|
||||
}
|
||||
|
||||
int UIFrame::set_float_member(PyUIFrameObject* self, PyObject* value, void* closure)
|
||||
{
|
||||
float val;
|
||||
auto member_ptr = reinterpret_cast<long>(closure);
|
||||
if (PyFloat_Check(value))
|
||||
{
|
||||
val = PyFloat_AsDouble(value);
|
||||
}
|
||||
else if (PyLong_Check(value))
|
||||
{
|
||||
val = PyLong_AsLong(value);
|
||||
}
|
||||
else
|
||||
{
|
||||
PyErr_SetString(PyExc_TypeError, "Value must be an integer.");
|
||||
return -1;
|
||||
}
|
||||
if (member_ptr == 0) //x
|
||||
self->data->box.setPosition(val, self->data->box.getPosition().y);
|
||||
else if (member_ptr == 1) //y
|
||||
self->data->box.setPosition(self->data->box.getPosition().x, val);
|
||||
else if (member_ptr == 2) //w
|
||||
self->data->box.setSize(sf::Vector2f(val, self->data->box.getSize().y));
|
||||
else if (member_ptr == 3) //h
|
||||
self->data->box.setSize(sf::Vector2f(self->data->box.getSize().x, val));
|
||||
else if (member_ptr == 4) //outline
|
||||
self->data->box.setOutlineThickness(val);
|
||||
return 0;
|
||||
}
|
||||
|
||||
PyObject* UIFrame::get_color_member(PyUIFrameObject* self, void* closure)
|
||||
{
|
||||
// validate closure (should be impossible to be wrong, but it's thorough)
|
||||
auto member_ptr = reinterpret_cast<long>(closure);
|
||||
if (member_ptr != 0 && member_ptr != 1)
|
||||
{
|
||||
PyErr_SetString(PyExc_AttributeError, "Invalid attribute");
|
||||
return nullptr;
|
||||
}
|
||||
//PyTypeObject* colorType = &PyColorType;
|
||||
auto colorType = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "Color");
|
||||
PyObject* pyColor = colorType->tp_alloc(colorType, 0);
|
||||
if (pyColor == NULL)
|
||||
{
|
||||
std::cout << "failure to allocate mcrfpy.Color / PyColorType" << std::endl;
|
||||
return NULL;
|
||||
}
|
||||
PyColorObject* pyColorObj = reinterpret_cast<PyColorObject*>(pyColor);
|
||||
|
||||
// fetch correct member data
|
||||
sf::Color color;
|
||||
if (member_ptr == 0)
|
||||
{
|
||||
color = self->data->box.getFillColor();
|
||||
//return Py_BuildValue("(iii)", color.r, color.g, color.b);
|
||||
}
|
||||
else if (member_ptr == 1)
|
||||
{
|
||||
color = self->data->box.getOutlineColor();
|
||||
//return Py_BuildValue("(iii)", color.r, color.g, color.b);
|
||||
}
|
||||
|
||||
return PyColor(color).pyObject();
|
||||
}
|
||||
|
||||
int UIFrame::set_color_member(PyUIFrameObject* self, PyObject* value, void* closure)
|
||||
{
|
||||
//TODO: this logic of (PyColor instance OR tuple -> sf::color) should be encapsulated for reuse
|
||||
auto member_ptr = reinterpret_cast<long>(closure);
|
||||
int r, g, b, a;
|
||||
if (PyObject_IsInstance(value, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Color")))
|
||||
{
|
||||
sf::Color c = ((PyColorObject*)value)->data;
|
||||
r = c.r; g = c.g; b = c.b; a = c.a;
|
||||
}
|
||||
else if (!PyTuple_Check(value) || PyTuple_Size(value) < 3 || PyTuple_Size(value) > 4)
|
||||
{
|
||||
// reject non-Color, non-tuple value
|
||||
PyErr_SetString(PyExc_TypeError, "Value must be a tuple of 3 or 4 integers or an mcrfpy.Color object.");
|
||||
return -1;
|
||||
}
|
||||
else // get value from tuples
|
||||
{
|
||||
r = PyLong_AsLong(PyTuple_GetItem(value, 0));
|
||||
g = PyLong_AsLong(PyTuple_GetItem(value, 1));
|
||||
b = PyLong_AsLong(PyTuple_GetItem(value, 2));
|
||||
a = 255;
|
||||
|
||||
if (PyTuple_Size(value) == 4)
|
||||
{
|
||||
a = PyLong_AsLong(PyTuple_GetItem(value, 3));
|
||||
}
|
||||
}
|
||||
|
||||
if (r < 0 || r > 255 || g < 0 || g > 255 || b < 0 || b > 255 || a < 0 || a > 255)
|
||||
{
|
||||
PyErr_SetString(PyExc_ValueError, "Color values must be between 0 and 255.");
|
||||
return -1;
|
||||
}
|
||||
|
||||
if (member_ptr == 0)
|
||||
{
|
||||
self->data->box.setFillColor(sf::Color(r, g, b, a));
|
||||
}
|
||||
else if (member_ptr == 1)
|
||||
{
|
||||
self->data->box.setOutlineColor(sf::Color(r, g, b, a));
|
||||
}
|
||||
else
|
||||
{
|
||||
PyErr_SetString(PyExc_AttributeError, "Invalid attribute");
|
||||
return -1;
|
||||
}
|
||||
|
||||
return 0;
|
||||
}
|
||||
|
||||
PyGetSetDef UIFrame::getsetters[] = {
|
||||
{"x", (getter)UIFrame::get_float_member, (setter)UIFrame::set_float_member, "X coordinate of top-left corner", (void*)0},
|
||||
{"y", (getter)UIFrame::get_float_member, (setter)UIFrame::set_float_member, "Y coordinate of top-left corner", (void*)1},
|
||||
{"w", (getter)UIFrame::get_float_member, (setter)UIFrame::set_float_member, "width of the rectangle", (void*)2},
|
||||
{"h", (getter)UIFrame::get_float_member, (setter)UIFrame::set_float_member, "height of the rectangle", (void*)3},
|
||||
{"outline", (getter)UIFrame::get_float_member, (setter)UIFrame::set_float_member, "Thickness of the border", (void*)4},
|
||||
{"fill_color", (getter)UIFrame::get_color_member, (setter)UIFrame::set_color_member, "Fill color of the rectangle", (void*)0},
|
||||
{"outline_color", (getter)UIFrame::get_color_member, (setter)UIFrame::set_color_member, "Outline color of the rectangle", (void*)1},
|
||||
{"children", (getter)UIFrame::get_children, NULL, "UICollection of objects on top of this one", NULL},
|
||||
{"click", (getter)UIDrawable::get_click, (setter)UIDrawable::set_click, "Object called with (x, y, button) when clicked", (void*)PyObjectsEnum::UIFRAME},
|
||||
{NULL}
|
||||
};
|
||||
|
||||
PyObject* UIFrame::repr(PyUIFrameObject* self)
|
||||
{
|
||||
std::ostringstream ss;
|
||||
if (!self->data) ss << "<Frame (invalid internal object)>";
|
||||
else {
|
||||
auto box = self->data->box;
|
||||
auto fc = box.getFillColor();
|
||||
auto oc = box.getOutlineColor();
|
||||
ss << "<Frame (x=" << box.getPosition().x << ", y=" << box.getPosition().y << ", w=" <<
|
||||
box.getSize().x << ", w=" << box.getSize().y << ", " <<
|
||||
"outline=" << box.getOutlineThickness() << ", " <<
|
||||
"fill_color=(" << (int)fc.r << ", " << (int)fc.g << ", " << (int)fc.b << ", " << (int)fc.a <<"), " <<
|
||||
"outline_color=(" << (int)oc.r << ", " << (int)oc.g << ", " << (int)oc.b << ", " << (int)oc.a <<"), " <<
|
||||
self->data->children->size() << " child objects" <<
|
||||
")>";
|
||||
}
|
||||
std::string repr_str = ss.str();
|
||||
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
|
||||
}
|
||||
|
||||
int UIFrame::init(PyUIFrameObject* self, PyObject* args, PyObject* kwds)
|
||||
{
|
||||
//std::cout << "Init called\n";
|
||||
const char* keywords[] = { "x", "y", "w", "h", "fill_color", "outline_color", "outline", nullptr };
|
||||
float x = 0.0f, y = 0.0f, w = 0.0f, h=0.0f, outline=0.0f;
|
||||
PyObject* fill_color = 0;
|
||||
PyObject* outline_color = 0;
|
||||
|
||||
if (!PyArg_ParseTupleAndKeywords(args, kwds, "ffff|OOf", const_cast<char**>(keywords), &x, &y, &w, &h, &fill_color, &outline_color, &outline))
|
||||
{
|
||||
return -1;
|
||||
}
|
||||
|
||||
self->data->box.setPosition(sf::Vector2f(x, y));
|
||||
self->data->box.setSize(sf::Vector2f(w, h));
|
||||
self->data->box.setOutlineThickness(outline);
|
||||
// getsetter abuse because I haven't standardized Color object parsing (TODO)
|
||||
int err_val = 0;
|
||||
if (fill_color && fill_color != Py_None) err_val = UIFrame::set_color_member(self, fill_color, (void*)0);
|
||||
else self->data->box.setFillColor(sf::Color(0,0,0,255));
|
||||
if (err_val) return err_val;
|
||||
if (outline_color && outline_color != Py_None) err_val = UIFrame::set_color_member(self, outline_color, (void*)1);
|
||||
else self->data->box.setOutlineColor(sf::Color(128,128,128,255));
|
||||
if (err_val) return err_val;
|
||||
return 0;
|
||||
}
|
|
@ -1,77 +0,0 @@
|
|||
#pragma once
|
||||
#include "Common.h"
|
||||
#include "Python.h"
|
||||
#include "structmember.h"
|
||||
#include "IndexTexture.h"
|
||||
#include "Resources.h"
|
||||
#include <list>
|
||||
|
||||
#include "PyCallable.h"
|
||||
#include "PyColor.h"
|
||||
#include "PyVector.h"
|
||||
#include "UIDrawable.h"
|
||||
#include "UIBase.h"
|
||||
|
||||
//class UIFrame;
|
||||
//
|
||||
//typedef struct {
|
||||
// PyObject_HEAD
|
||||
// std::shared_ptr<UIFrame> data;
|
||||
//} PyUIFrameObject;
|
||||
|
||||
class UIFrame: public UIDrawable
|
||||
{
|
||||
public:
|
||||
UIFrame(float, float, float, float);
|
||||
UIFrame();
|
||||
~UIFrame();
|
||||
sf::RectangleShape box;
|
||||
float outline;
|
||||
std::shared_ptr<std::vector<std::shared_ptr<UIDrawable>>> children;
|
||||
void render(sf::Vector2f, sf::RenderTarget&) override final;
|
||||
void move(sf::Vector2f);
|
||||
PyObjectsEnum derived_type() override final;
|
||||
virtual UIDrawable* click_at(sf::Vector2f point) override final;
|
||||
|
||||
static PyObject* get_children(PyUIFrameObject* self, void* closure);
|
||||
|
||||
static PyObject* get_float_member(PyUIFrameObject* self, void* closure);
|
||||
static int set_float_member(PyUIFrameObject* self, PyObject* value, void* closure);
|
||||
static PyObject* get_color_member(PyUIFrameObject* self, void* closure);
|
||||
static int set_color_member(PyUIFrameObject* self, PyObject* value, void* closure);
|
||||
static PyGetSetDef getsetters[];
|
||||
static PyObject* repr(PyUIFrameObject* self);
|
||||
static int init(PyUIFrameObject* self, PyObject* args, PyObject* kwds);
|
||||
};
|
||||
|
||||
namespace mcrfpydef {
|
||||
static PyTypeObject PyUIFrameType = {
|
||||
.ob_base = {.ob_base = {.ob_refcnt = 1, .ob_type = NULL}, .ob_size = 0},
|
||||
.tp_name = "mcrfpy.Frame",
|
||||
.tp_basicsize = sizeof(PyUIFrameObject),
|
||||
.tp_itemsize = 0,
|
||||
.tp_dealloc = (destructor)[](PyObject* self)
|
||||
{
|
||||
PyUIFrameObject* obj = (PyUIFrameObject*)self;
|
||||
obj->data.reset();
|
||||
Py_TYPE(self)->tp_free(self);
|
||||
},
|
||||
.tp_repr = (reprfunc)UIFrame::repr,
|
||||
//.tp_hash = NULL,
|
||||
//.tp_iter
|
||||
//.tp_iternext
|
||||
.tp_flags = Py_TPFLAGS_DEFAULT,
|
||||
.tp_doc = PyDoc_STR("docstring"),
|
||||
//.tp_methods = PyUIFrame_methods,
|
||||
//.tp_members = PyUIFrame_members,
|
||||
.tp_getset = UIFrame::getsetters,
|
||||
//.tp_base = NULL,
|
||||
.tp_init = (initproc)UIFrame::init,
|
||||
.tp_new = [](PyTypeObject* type, PyObject* args, PyObject* kwds) -> PyObject*
|
||||
{
|
||||
PyUIFrameObject* self = (PyUIFrameObject*)type->tp_alloc(type, 0);
|
||||
if (self) self->data = std::make_shared<UIFrame>();
|
||||
return (PyObject*)self;
|
||||
}
|
||||
};
|
||||
}
|
652
src/UIGrid.cpp
652
src/UIGrid.cpp
|
@ -1,652 +0,0 @@
|
|||
#include "UIGrid.h"
|
||||
#include "GameEngine.h"
|
||||
#include "McRFPy_API.h"
|
||||
|
||||
UIGrid::UIGrid() {}
|
||||
|
||||
UIGrid::UIGrid(int gx, int gy, std::shared_ptr<PyTexture> _ptex, sf::Vector2f _xy, sf::Vector2f _wh)
|
||||
: grid_x(gx), grid_y(gy),
|
||||
zoom(1.0f), center_x((gx/2) * _ptex->sprite_width), center_y((gy/2) * _ptex->sprite_height),
|
||||
ptex(_ptex), points(gx * gy)
|
||||
{
|
||||
entities = std::make_shared<std::list<std::shared_ptr<UIEntity>>>();
|
||||
|
||||
box.setSize(_wh);
|
||||
box.setPosition(_xy);
|
||||
|
||||
box.setFillColor(sf::Color(0,0,0,0));
|
||||
// create renderTexture with maximum theoretical size; sprite can resize to show whatever amount needs to be rendered
|
||||
renderTexture.create(1920, 1080); // TODO - renderTexture should be window size; above 1080p this will cause rendering errors
|
||||
|
||||
sprite = ptex->sprite(0);
|
||||
|
||||
output.setTextureRect(
|
||||
sf::IntRect(0, 0,
|
||||
box.getSize().x, box.getSize().y));
|
||||
output.setPosition(box.getPosition());
|
||||
// textures are upside-down inside renderTexture
|
||||
output.setTexture(renderTexture.getTexture());
|
||||
|
||||
}
|
||||
|
||||
void UIGrid::update() {}
|
||||
|
||||
|
||||
void UIGrid::render(sf::Vector2f offset, sf::RenderTarget& target)
|
||||
{
|
||||
output.setPosition(box.getPosition() + offset); // output sprite can move; update position when drawing
|
||||
// output size can change; update size when drawing
|
||||
output.setTextureRect(
|
||||
sf::IntRect(0, 0,
|
||||
box.getSize().x, box.getSize().y));
|
||||
renderTexture.clear(sf::Color(8, 8, 8, 255)); // TODO - UIGrid needs a "background color" field
|
||||
// sprites that are visible according to zoom, center_x, center_y, and box width
|
||||
float center_x_sq = center_x / ptex->sprite_width;
|
||||
float center_y_sq = center_y / ptex->sprite_height;
|
||||
|
||||
float width_sq = box.getSize().x / (ptex->sprite_width * zoom);
|
||||
float height_sq = box.getSize().y / (ptex->sprite_height * zoom);
|
||||
float left_edge = center_x_sq - (width_sq / 2.0);
|
||||
float top_edge = center_y_sq - (height_sq / 2.0);
|
||||
|
||||
int left_spritepixels = center_x - (box.getSize().x / 2.0 / zoom);
|
||||
int top_spritepixels = center_y - (box.getSize().y / 2.0 / zoom);
|
||||
|
||||
//sprite.setScale(sf::Vector2f(zoom, zoom));
|
||||
sf::RectangleShape r; // for colors and overlays
|
||||
r.setSize(sf::Vector2f(ptex->sprite_width * zoom, ptex->sprite_height * zoom));
|
||||
r.setOutlineThickness(0);
|
||||
|
||||
int x_limit = left_edge + width_sq + 2;
|
||||
if (x_limit > grid_x) x_limit = grid_x;
|
||||
|
||||
int y_limit = top_edge + height_sq + 2;
|
||||
if (y_limit > grid_y) y_limit = grid_y;
|
||||
|
||||
// base layer - bottom color, tile sprite ("ground")
|
||||
for (int x = (left_edge - 1 >= 0 ? left_edge - 1 : 0);
|
||||
x < x_limit; //x < view_width;
|
||||
x+=1)
|
||||
{
|
||||
//for (float y = (top_edge >= 0 ? top_edge : 0);
|
||||
for (int y = (top_edge - 1 >= 0 ? top_edge - 1 : 0);
|
||||
y < y_limit; //y < view_height;
|
||||
y+=1)
|
||||
{
|
||||
auto pixel_pos = sf::Vector2f(
|
||||
(x*ptex->sprite_width - left_spritepixels) * zoom,
|
||||
(y*ptex->sprite_height - top_spritepixels) * zoom );
|
||||
|
||||
auto gridpoint = at(std::floor(x), std::floor(y));
|
||||
|
||||
//sprite.setPosition(pixel_pos);
|
||||
|
||||
r.setPosition(pixel_pos);
|
||||
r.setFillColor(gridpoint.color);
|
||||
renderTexture.draw(r);
|
||||
|
||||
// tilesprite
|
||||
// if discovered but not visible, set opacity to 90%
|
||||
// if not discovered... just don't draw it?
|
||||
if (gridpoint.tilesprite != -1) {
|
||||
sprite = ptex->sprite(gridpoint.tilesprite, pixel_pos, sf::Vector2f(zoom, zoom)); //setSprite(gridpoint.tilesprite);;
|
||||
renderTexture.draw(sprite);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// middle layer - entities
|
||||
// disabling entity rendering until I can render their UISprite inside the rendertexture (not directly to window)
|
||||
for (auto e : *entities) {
|
||||
// TODO skip out-of-bounds entities (grid square not visible at all, check for partially on visible grid squares / floating point grid position)
|
||||
//auto drawent = e->cGrid->indexsprite.drawable();
|
||||
auto& drawent = e->sprite;
|
||||
//drawent.setScale(zoom, zoom);
|
||||
drawent.setScale(sf::Vector2f(zoom, zoom));
|
||||
auto pixel_pos = sf::Vector2f(
|
||||
(e->position.x*ptex->sprite_width - left_spritepixels) * zoom,
|
||||
(e->position.y*ptex->sprite_height - top_spritepixels) * zoom );
|
||||
//drawent.setPosition(pixel_pos);
|
||||
//renderTexture.draw(drawent);
|
||||
drawent.render(pixel_pos, renderTexture);
|
||||
}
|
||||
|
||||
|
||||
// top layer - opacity for discovered / visible status (debug, basically)
|
||||
/* // Disabled until I attach a "perspective"
|
||||
for (int x = (left_edge - 1 >= 0 ? left_edge - 1 : 0);
|
||||
x < x_limit; //x < view_width;
|
||||
x+=1)
|
||||
{
|
||||
//for (float y = (top_edge >= 0 ? top_edge : 0);
|
||||
for (int y = (top_edge - 1 >= 0 ? top_edge - 1 : 0);
|
||||
y < y_limit; //y < view_height;
|
||||
y+=1)
|
||||
{
|
||||
|
||||
auto pixel_pos = sf::Vector2f(
|
||||
(x*itex->grid_size - left_spritepixels) * zoom,
|
||||
(y*itex->grid_size - top_spritepixels) * zoom );
|
||||
|
||||
auto gridpoint = at(std::floor(x), std::floor(y));
|
||||
|
||||
sprite.setPosition(pixel_pos);
|
||||
|
||||
r.setPosition(pixel_pos);
|
||||
|
||||
// visible & discovered layers for testing purposes
|
||||
if (!gridpoint.discovered) {
|
||||
r.setFillColor(sf::Color(16, 16, 20, 192)); // 255 opacity for actual blackout
|
||||
renderTexture.draw(r);
|
||||
} else if (!gridpoint.visible) {
|
||||
r.setFillColor(sf::Color(32, 32, 40, 128));
|
||||
renderTexture.draw(r);
|
||||
}
|
||||
|
||||
// overlay
|
||||
|
||||
// uisprite
|
||||
}
|
||||
}
|
||||
*/
|
||||
|
||||
// grid lines for testing & validation
|
||||
/*
|
||||
sf::Vertex line[] =
|
||||
{
|
||||
sf::Vertex(sf::Vector2f(0, 0), sf::Color::Red),
|
||||
sf::Vertex(box.getSize(), sf::Color::Red),
|
||||
|
||||
};
|
||||
|
||||
renderTexture.draw(line, 2, sf::Lines);
|
||||
sf::Vertex lineb[] =
|
||||
{
|
||||
sf::Vertex(sf::Vector2f(0, box.getSize().y), sf::Color::Blue),
|
||||
sf::Vertex(sf::Vector2f(box.getSize().x, 0), sf::Color::Blue),
|
||||
|
||||
};
|
||||
|
||||
renderTexture.draw(lineb, 2, sf::Lines);
|
||||
*/
|
||||
|
||||
// render to window
|
||||
renderTexture.display();
|
||||
//Resources::game->getWindow().draw(output);
|
||||
target.draw(output);
|
||||
|
||||
}
|
||||
|
||||
UIGridPoint& UIGrid::at(int x, int y)
|
||||
{
|
||||
return points[y * grid_x + x];
|
||||
}
|
||||
|
||||
PyObjectsEnum UIGrid::derived_type()
|
||||
{
|
||||
return PyObjectsEnum::UIGRID;
|
||||
}
|
||||
|
||||
std::shared_ptr<PyTexture> UIGrid::getTexture()
|
||||
{
|
||||
return ptex;
|
||||
}
|
||||
|
||||
UIDrawable* UIGrid::click_at(sf::Vector2f point)
|
||||
{
|
||||
if (click_callable)
|
||||
{
|
||||
if(box.getGlobalBounds().contains(point)) return this;
|
||||
}
|
||||
return NULL;
|
||||
}
|
||||
|
||||
|
||||
int UIGrid::init(PyUIGridObject* self, PyObject* args, PyObject* kwds) {
|
||||
int grid_x, grid_y;
|
||||
PyObject* textureObj;
|
||||
//float box_x, box_y, box_w, box_h;
|
||||
PyObject* pos, *size;
|
||||
|
||||
//if (!PyArg_ParseTuple(args, "iiOffff", &grid_x, &grid_y, &textureObj, &box_x, &box_y, &box_w, &box_h)) {
|
||||
if (!PyArg_ParseTuple(args, "iiOOO", &grid_x, &grid_y, &textureObj, &pos, &size)) {
|
||||
return -1; // If parsing fails, return an error
|
||||
}
|
||||
|
||||
PyVectorObject* pos_result = PyVector::from_arg(pos);
|
||||
if (!pos_result)
|
||||
{
|
||||
PyErr_SetString(PyExc_TypeError, "pos must be a mcrfpy.Vector instance or arguments to mcrfpy.Vector.__init__");
|
||||
return -1;
|
||||
}
|
||||
|
||||
PyVectorObject* size_result = PyVector::from_arg(size);
|
||||
if (!size_result)
|
||||
{
|
||||
PyErr_SetString(PyExc_TypeError, "pos must be a mcrfpy.Vector instance or arguments to mcrfpy.Vector.__init__");
|
||||
return -1;
|
||||
}
|
||||
|
||||
// Convert PyObject texture to IndexTexture*
|
||||
// This requires the texture object to have been initialized similar to UISprite's texture handling
|
||||
|
||||
//if (!PyObject_IsInstance(textureObj, (PyObject*)&PyTextureType)) {
|
||||
if (!PyObject_IsInstance(textureObj, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Texture"))) {
|
||||
PyErr_SetString(PyExc_TypeError, "texture must be a mcrfpy.Texture instance");
|
||||
return -1;
|
||||
}
|
||||
PyTextureObject* pyTexture = reinterpret_cast<PyTextureObject*>(textureObj);
|
||||
// TODO (7DRL day 2, item 4.) use shared_ptr / PyTextureObject on UIGrid
|
||||
//IndexTexture* texture = pyTexture->data.get();
|
||||
|
||||
// Initialize UIGrid
|
||||
//self->data = new UIGrid(grid_x, grid_y, texture, sf::Vector2f(box_x, box_y), sf::Vector2f(box_w, box_h));
|
||||
//self->data = std::make_shared<UIGrid>(grid_x, grid_y, pyTexture->data,
|
||||
// sf::Vector2f(box_x, box_y), sf::Vector2f(box_w, box_h));
|
||||
self->data = std::make_shared<UIGrid>(grid_x, grid_y, pyTexture->data, pos_result->data, size_result->data);
|
||||
return 0; // Success
|
||||
}
|
||||
|
||||
PyObject* UIGrid::get_grid_size(PyUIGridObject* self, void* closure) {
|
||||
return Py_BuildValue("(ii)", self->data->grid_x, self->data->grid_y);
|
||||
}
|
||||
|
||||
PyObject* UIGrid::get_position(PyUIGridObject* self, void* closure) {
|
||||
auto& box = self->data->box;
|
||||
return Py_BuildValue("(ff)", box.getPosition().x, box.getPosition().y);
|
||||
}
|
||||
|
||||
int UIGrid::set_position(PyUIGridObject* self, PyObject* value, void* closure) {
|
||||
float x, y;
|
||||
if (!PyArg_ParseTuple(value, "ff", &x, &y)) {
|
||||
PyErr_SetString(PyExc_ValueError, "Position must be a tuple of two floats");
|
||||
return -1;
|
||||
}
|
||||
self->data->box.setPosition(x, y);
|
||||
return 0;
|
||||
}
|
||||
|
||||
PyObject* UIGrid::get_size(PyUIGridObject* self, void* closure) {
|
||||
auto& box = self->data->box;
|
||||
return Py_BuildValue("(ff)", box.getSize().x, box.getSize().y);
|
||||
}
|
||||
|
||||
int UIGrid::set_size(PyUIGridObject* self, PyObject* value, void* closure) {
|
||||
float w, h;
|
||||
if (!PyArg_ParseTuple(value, "ff", &w, &h)) {
|
||||
PyErr_SetString(PyExc_ValueError, "Size must be a tuple of two floats");
|
||||
return -1;
|
||||
}
|
||||
self->data->box.setSize(sf::Vector2f(w, h));
|
||||
return 0;
|
||||
}
|
||||
|
||||
PyObject* UIGrid::get_center(PyUIGridObject* self, void* closure) {
|
||||
return Py_BuildValue("(ff)", self->data->center_x, self->data->center_y);
|
||||
}
|
||||
|
||||
int UIGrid::set_center(PyUIGridObject* self, PyObject* value, void* closure) {
|
||||
float x, y;
|
||||
if (!PyArg_ParseTuple(value, "ff", &x, &y)) {
|
||||
PyErr_SetString(PyExc_ValueError, "Size must be a tuple of two floats");
|
||||
return -1;
|
||||
}
|
||||
self->data->center_x = x;
|
||||
self->data->center_y = y;
|
||||
return 0;
|
||||
}
|
||||
|
||||
PyObject* UIGrid::get_float_member(PyUIGridObject* self, void* closure)
|
||||
{
|
||||
auto member_ptr = reinterpret_cast<long>(closure);
|
||||
if (member_ptr == 0) // x
|
||||
return PyFloat_FromDouble(self->data->box.getPosition().x);
|
||||
else if (member_ptr == 1) // y
|
||||
return PyFloat_FromDouble(self->data->box.getPosition().y);
|
||||
else if (member_ptr == 2) // w
|
||||
return PyFloat_FromDouble(self->data->box.getSize().x);
|
||||
else if (member_ptr == 3) // h
|
||||
return PyFloat_FromDouble(self->data->box.getSize().y);
|
||||
else if (member_ptr == 4) // center_x
|
||||
return PyFloat_FromDouble(self->data->center_x);
|
||||
else if (member_ptr == 5) // center_y
|
||||
return PyFloat_FromDouble(self->data->center_y);
|
||||
else if (member_ptr == 6) // zoom
|
||||
return PyFloat_FromDouble(self->data->zoom);
|
||||
else
|
||||
{
|
||||
PyErr_SetString(PyExc_AttributeError, "Invalid attribute");
|
||||
return nullptr;
|
||||
}
|
||||
}
|
||||
|
||||
int UIGrid::set_float_member(PyUIGridObject* self, PyObject* value, void* closure)
|
||||
{
|
||||
float val;
|
||||
auto member_ptr = reinterpret_cast<long>(closure);
|
||||
if (PyFloat_Check(value))
|
||||
{
|
||||
val = PyFloat_AsDouble(value);
|
||||
}
|
||||
else if (PyLong_Check(value))
|
||||
{
|
||||
val = PyLong_AsLong(value);
|
||||
}
|
||||
else
|
||||
{
|
||||
PyErr_SetString(PyExc_TypeError, "Value must be a floating point number.");
|
||||
return -1;
|
||||
}
|
||||
if (member_ptr == 0) // x
|
||||
self->data->box.setPosition(val, self->data->box.getPosition().y);
|
||||
else if (member_ptr == 1) // y
|
||||
self->data->box.setPosition(self->data->box.getPosition().x, val);
|
||||
else if (member_ptr == 2) // w
|
||||
self->data->box.setSize(sf::Vector2f(val, self->data->box.getSize().y));
|
||||
else if (member_ptr == 3) // h
|
||||
self->data->box.setSize(sf::Vector2f(self->data->box.getSize().x, val));
|
||||
else if (member_ptr == 4) // center_x
|
||||
self->data->center_x = val;
|
||||
else if (member_ptr == 5) // center_y
|
||||
self->data->center_y = val;
|
||||
else if (member_ptr == 6) // zoom
|
||||
self->data->zoom = val;
|
||||
return 0;
|
||||
}
|
||||
// TODO (7DRL Day 2, item 5.) return Texture object
|
||||
/*
|
||||
PyObject* UIGrid::get_texture(PyUIGridObject* self, void* closure) {
|
||||
Py_INCREF(self->texture);
|
||||
return self->texture;
|
||||
}
|
||||
*/
|
||||
|
||||
PyObject* UIGrid::get_texture(PyUIGridObject* self, void* closure) {
|
||||
//return self->data->getTexture()->pyObject();
|
||||
// PyObject_GetAttrString(McRFPy_API::mcrf_module, "GridPointState")
|
||||
//PyTextureObject* obj = (PyTextureObject*)((&PyTextureType)->tp_alloc(&PyTextureType, 0));
|
||||
auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "Texture");
|
||||
auto obj = (PyTextureObject*)type->tp_alloc(type, 0);
|
||||
obj->data = self->data->getTexture();
|
||||
return (PyObject*)obj;
|
||||
}
|
||||
|
||||
PyObject* UIGrid::py_at(PyUIGridObject* self, PyObject* o)
|
||||
{
|
||||
int x, y;
|
||||
if (!PyArg_ParseTuple(o, "ii", &x, &y)) {
|
||||
PyErr_SetString(PyExc_TypeError, "UIGrid.at requires two integer arguments: (x, y)");
|
||||
return NULL;
|
||||
}
|
||||
if (x < 0 || x >= self->data->grid_x) {
|
||||
PyErr_SetString(PyExc_ValueError, "x value out of range (0, Grid.grid_y)");
|
||||
return NULL;
|
||||
}
|
||||
if (y < 0 || y >= self->data->grid_y) {
|
||||
PyErr_SetString(PyExc_ValueError, "y value out of range (0, Grid.grid_y)");
|
||||
return NULL;
|
||||
}
|
||||
|
||||
//PyUIGridPointObject* obj = (PyUIGridPointObject*)((&PyUIGridPointType)->tp_alloc(&PyUIGridPointType, 0));
|
||||
auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "GridPoint");
|
||||
auto obj = (PyUIGridPointObject*)type->tp_alloc(type, 0);
|
||||
//auto target = std::static_pointer_cast<UIEntity>(target);
|
||||
obj->data = &(self->data->points[x + self->data->grid_x * y]);
|
||||
obj->grid = self->data;
|
||||
return (PyObject*)obj;
|
||||
}
|
||||
|
||||
PyMethodDef UIGrid::methods[] = {
|
||||
{"at", (PyCFunction)UIGrid::py_at, METH_O},
|
||||
{NULL, NULL, 0, NULL}
|
||||
};
|
||||
|
||||
|
||||
PyGetSetDef UIGrid::getsetters[] = {
|
||||
|
||||
// TODO - refactor into get_vector_member with field identifier values `(void*)n`
|
||||
{"grid_size", (getter)UIGrid::get_grid_size, NULL, "Grid dimensions (grid_x, grid_y)", NULL},
|
||||
{"position", (getter)UIGrid::get_position, (setter)UIGrid::set_position, "Position of the grid (x, y)", NULL},
|
||||
{"size", (getter)UIGrid::get_size, (setter)UIGrid::set_size, "Size of the grid (width, height)", NULL},
|
||||
{"center", (getter)UIGrid::get_center, (setter)UIGrid::set_center, "Grid coordinate at the center of the Grid's view (pan)", NULL},
|
||||
|
||||
{"entities", (getter)UIGrid::get_children, NULL, "EntityCollection of entities on this grid", NULL},
|
||||
|
||||
{"x", (getter)UIGrid::get_float_member, (setter)UIGrid::set_float_member, "top-left corner X-coordinate", (void*)0},
|
||||
{"y", (getter)UIGrid::get_float_member, (setter)UIGrid::set_float_member, "top-left corner Y-coordinate", (void*)1},
|
||||
{"w", (getter)UIGrid::get_float_member, (setter)UIGrid::set_float_member, "visible widget width", (void*)2},
|
||||
{"h", (getter)UIGrid::get_float_member, (setter)UIGrid::set_float_member, "visible widget height", (void*)3},
|
||||
{"center_x", (getter)UIGrid::get_float_member, (setter)UIGrid::set_float_member, "center of the view X-coordinate", (void*)4},
|
||||
{"center_y", (getter)UIGrid::get_float_member, (setter)UIGrid::set_float_member, "center of the view Y-coordinate", (void*)5},
|
||||
{"zoom", (getter)UIGrid::get_float_member, (setter)UIGrid::set_float_member, "zoom factor for displaying the Grid", (void*)6},
|
||||
|
||||
{"click", (getter)UIDrawable::get_click, (setter)UIDrawable::set_click, "Object called with (x, y, button) when clicked", (void*)PyObjectsEnum::UIGRID},
|
||||
|
||||
{"texture", (getter)UIGrid::get_texture, NULL, "Texture of the grid", NULL}, //TODO 7DRL-day2-item5
|
||||
{NULL} /* Sentinel */
|
||||
};
|
||||
|
||||
PyObject* UIGrid::get_children(PyUIGridObject* self, void* closure)
|
||||
{
|
||||
// create PyUICollection instance pointing to self->data->children
|
||||
//PyUIEntityCollectionObject* o = (PyUIEntityCollectionObject*)PyUIEntityCollectionType.tp_alloc(&PyUIEntityCollectionType, 0);
|
||||
auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "EntityCollection");
|
||||
auto o = (PyUIEntityCollectionObject*)type->tp_alloc(type, 0);
|
||||
if (o) {
|
||||
o->data = self->data->entities; // todone. / BUGFIX - entities isn't a shared pointer on UIGrid, what to do? -- I made it a sp<list<sp<UIEntity>>>
|
||||
o->grid = self->data;
|
||||
}
|
||||
return (PyObject*)o;
|
||||
}
|
||||
|
||||
PyObject* UIGrid::repr(PyUIGridObject* self)
|
||||
{
|
||||
std::ostringstream ss;
|
||||
if (!self->data) ss << "<Grid (invalid internal object)>";
|
||||
else {
|
||||
auto grid = self->data;
|
||||
auto box = grid->box;
|
||||
ss << "<Grid (x=" << box.getPosition().x << ", y=" << box.getPosition().y << ", w=" << box.getSize().x << ", h=" << box.getSize().y << ", " <<
|
||||
"center=(" << grid->center_x << ", " << grid->center_y << "), zoom=" << grid->zoom <<
|
||||
")>";
|
||||
}
|
||||
std::string repr_str = ss.str();
|
||||
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
|
||||
}
|
||||
|
||||
/* // TODO standard pointer would need deleted, but I opted for a shared pointer. tp_dealloc currently not even defined in the PyTypeObject
|
||||
void PyUIGrid_dealloc(PyUIGridObject* self) {
|
||||
delete self->data; // Clean up the allocated UIGrid object
|
||||
Py_TYPE(self)->tp_free((PyObject*)self);
|
||||
}
|
||||
*/
|
||||
|
||||
int UIEntityCollectionIter::init(PyUIEntityCollectionIterObject* self, PyObject* args, PyObject* kwds)
|
||||
{
|
||||
PyErr_SetString(PyExc_TypeError, "UICollection cannot be instantiated: a C++ data source is required.");
|
||||
return -1;
|
||||
}
|
||||
|
||||
PyObject* UIEntityCollectionIter::next(PyUIEntityCollectionIterObject* self)
|
||||
{
|
||||
if (self->data->size() != self->start_size)
|
||||
{
|
||||
PyErr_SetString(PyExc_RuntimeError, "collection changed size during iteration");
|
||||
return NULL;
|
||||
}
|
||||
|
||||
if (self->index > self->start_size - 1)
|
||||
{
|
||||
PyErr_SetNone(PyExc_StopIteration);
|
||||
return NULL;
|
||||
}
|
||||
self->index++;
|
||||
auto vec = self->data.get();
|
||||
if (!vec)
|
||||
{
|
||||
PyErr_SetString(PyExc_RuntimeError, "the collection store returned a null pointer");
|
||||
return NULL;
|
||||
}
|
||||
// Advance list iterator since Entities are stored in a list, not a vector
|
||||
auto l_begin = (*vec).begin();
|
||||
std::advance(l_begin, self->index-1);
|
||||
auto target = *l_begin;
|
||||
|
||||
// Create and return a Python Entity object
|
||||
auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "Entity");
|
||||
auto o = (PyUIEntityObject*)type->tp_alloc(type, 0);
|
||||
auto p = std::static_pointer_cast<UIEntity>(target);
|
||||
o->data = p;
|
||||
return (PyObject*)o;
|
||||
}
|
||||
|
||||
PyObject* UIEntityCollectionIter::repr(PyUIEntityCollectionIterObject* self)
|
||||
{
|
||||
std::ostringstream ss;
|
||||
if (!self->data) ss << "<UICollectionIter (invalid internal object)>";
|
||||
else {
|
||||
ss << "<UICollectionIter (" << self->data->size() << " child objects, @ index " << self->index << ")>";
|
||||
}
|
||||
std::string repr_str = ss.str();
|
||||
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
|
||||
}
|
||||
|
||||
Py_ssize_t UIEntityCollection::len(PyUIEntityCollectionObject* self) {
|
||||
return self->data->size();
|
||||
}
|
||||
|
||||
PyObject* UIEntityCollection::getitem(PyUIEntityCollectionObject* self, Py_ssize_t index) {
|
||||
// build a Python version of item at self->data[index]
|
||||
// Copy pasted::
|
||||
auto vec = self->data.get();
|
||||
if (!vec)
|
||||
{
|
||||
PyErr_SetString(PyExc_RuntimeError, "the collection store returned a null pointer");
|
||||
return NULL;
|
||||
}
|
||||
while (index < 0) index += self->data->size();
|
||||
if (index > self->data->size() - 1)
|
||||
{
|
||||
PyErr_SetString(PyExc_IndexError, "EntityCollection index out of range");
|
||||
return NULL;
|
||||
}
|
||||
auto l_begin = (*vec).begin();
|
||||
std::advance(l_begin, index);
|
||||
auto target = *l_begin; //auto target = (*vec)[index];
|
||||
//RET_PY_INSTANCE(target);
|
||||
// construct and return an entity object that points directly into the UIGrid's entity vector
|
||||
//PyUIEntityObject* o = (PyUIEntityObject*)((&PyUIEntityType)->tp_alloc(&PyUIEntityType, 0));
|
||||
auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "Entity");
|
||||
auto o = (PyUIEntityObject*)type->tp_alloc(type, 0);
|
||||
auto p = std::static_pointer_cast<UIEntity>(target);
|
||||
o->data = p;
|
||||
return (PyObject*)o;
|
||||
return NULL;
|
||||
|
||||
|
||||
}
|
||||
|
||||
PySequenceMethods UIEntityCollection::sqmethods = {
|
||||
.sq_length = (lenfunc)UIEntityCollection::len,
|
||||
.sq_item = (ssizeargfunc)UIEntityCollection::getitem,
|
||||
//.sq_item_by_index = UIEntityCollection::getitem
|
||||
//.sq_slice - return a subset of the iterable
|
||||
//.sq_ass_item - called when `o[x] = y` is executed (x is any object type)
|
||||
//.sq_ass_slice - cool; no thanks, for now
|
||||
//.sq_contains - called when `x in o` is executed
|
||||
//.sq_ass_item_by_index - called when `o[x] = y` is executed (x is explictly an integer)
|
||||
};
|
||||
|
||||
PyObject* UIEntityCollection::append(PyUIEntityCollectionObject* self, PyObject* o)
|
||||
{
|
||||
// if not UIDrawable subclass, reject it
|
||||
// self->data->push_back( c++ object inside o );
|
||||
|
||||
// this would be a great use case for .tp_base
|
||||
//if (!PyObject_IsInstance(o, (PyObject*)&PyUIEntityType))
|
||||
if (!PyObject_IsInstance(o, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Entity")))
|
||||
{
|
||||
PyErr_SetString(PyExc_TypeError, "Only Entity objects can be added to EntityCollection");
|
||||
return NULL;
|
||||
}
|
||||
PyUIEntityObject* entity = (PyUIEntityObject*)o;
|
||||
self->data->push_back(entity->data);
|
||||
entity->data->grid = self->grid;
|
||||
|
||||
Py_INCREF(Py_None);
|
||||
return Py_None;
|
||||
}
|
||||
|
||||
PyObject* UIEntityCollection::remove(PyUIEntityCollectionObject* self, PyObject* o)
|
||||
{
|
||||
if (!PyLong_Check(o))
|
||||
{
|
||||
PyErr_SetString(PyExc_TypeError, "UICollection.remove requires an integer index to remove");
|
||||
return NULL;
|
||||
}
|
||||
long index = PyLong_AsLong(o);
|
||||
if (index >= self->data->size())
|
||||
{
|
||||
PyErr_SetString(PyExc_ValueError, "Index out of range");
|
||||
return NULL;
|
||||
}
|
||||
else if (index < 0)
|
||||
{
|
||||
PyErr_SetString(PyExc_NotImplementedError, "reverse indexing is not implemented.");
|
||||
return NULL;
|
||||
}
|
||||
|
||||
// release the shared pointer at correct part of the list
|
||||
self->data->erase(std::next(self->data->begin(), index));
|
||||
Py_INCREF(Py_None);
|
||||
return Py_None;
|
||||
}
|
||||
|
||||
PyMethodDef UIEntityCollection::methods[] = {
|
||||
{"append", (PyCFunction)UIEntityCollection::append, METH_O},
|
||||
//{"extend", (PyCFunction)UIEntityCollection::extend, METH_O}, // TODO
|
||||
{"remove", (PyCFunction)UIEntityCollection::remove, METH_O},
|
||||
{NULL, NULL, 0, NULL}
|
||||
};
|
||||
|
||||
PyObject* UIEntityCollection::repr(PyUIEntityCollectionObject* self)
|
||||
{
|
||||
std::ostringstream ss;
|
||||
if (!self->data) ss << "<UICollection (invalid internal object)>";
|
||||
else {
|
||||
ss << "<UICollection (" << self->data->size() << " child objects)>";
|
||||
}
|
||||
std::string repr_str = ss.str();
|
||||
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
|
||||
}
|
||||
|
||||
int UIEntityCollection::init(PyUIEntityCollectionObject* self, PyObject* args, PyObject* kwds)
|
||||
{
|
||||
PyErr_SetString(PyExc_TypeError, "EntityCollection cannot be instantiated: a C++ data source is required.");
|
||||
return -1;
|
||||
}
|
||||
|
||||
PyObject* UIEntityCollection::iter(PyUIEntityCollectionObject* self)
|
||||
{
|
||||
// Get the iterator type from the module to ensure we have the registered version
|
||||
PyTypeObject* iterType = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "UIEntityCollectionIter");
|
||||
if (!iterType) {
|
||||
PyErr_SetString(PyExc_RuntimeError, "Could not find UIEntityCollectionIter type in module");
|
||||
return NULL;
|
||||
}
|
||||
|
||||
// Allocate new iterator instance
|
||||
PyUIEntityCollectionIterObject* iterObj = (PyUIEntityCollectionIterObject*)iterType->tp_alloc(iterType, 0);
|
||||
|
||||
if (iterObj == NULL) {
|
||||
Py_DECREF(iterType);
|
||||
return NULL; // Failed to allocate memory for the iterator object
|
||||
}
|
||||
|
||||
iterObj->data = self->data;
|
||||
iterObj->index = 0;
|
||||
iterObj->start_size = self->data->size();
|
||||
|
||||
Py_DECREF(iterType);
|
||||
return (PyObject*)iterObj;
|
||||
}
|
186
src/UIGrid.h
186
src/UIGrid.h
|
@ -1,186 +0,0 @@
|
|||
#pragma once
|
||||
#include "Common.h"
|
||||
#include "Python.h"
|
||||
#include "structmember.h"
|
||||
#include "IndexTexture.h"
|
||||
#include "Resources.h"
|
||||
#include <list>
|
||||
|
||||
#include "PyCallable.h"
|
||||
#include "PyTexture.h"
|
||||
#include "PyColor.h"
|
||||
#include "PyVector.h"
|
||||
#include "PyFont.h"
|
||||
|
||||
#include "UIGridPoint.h"
|
||||
#include "UIEntity.h"
|
||||
#include "UIDrawable.h"
|
||||
#include "UIBase.h"
|
||||
|
||||
class UIGrid: public UIDrawable
|
||||
{
|
||||
private:
|
||||
std::shared_ptr<PyTexture> ptex;
|
||||
public:
|
||||
UIGrid();
|
||||
//UIGrid(int, int, IndexTexture*, float, float, float, float);
|
||||
UIGrid(int, int, std::shared_ptr<PyTexture>, sf::Vector2f, sf::Vector2f);
|
||||
void update();
|
||||
void render(sf::Vector2f, sf::RenderTarget&) override final;
|
||||
UIGridPoint& at(int, int);
|
||||
PyObjectsEnum derived_type() override final;
|
||||
//void setSprite(int);
|
||||
virtual UIDrawable* click_at(sf::Vector2f point) override final;
|
||||
|
||||
int grid_x, grid_y;
|
||||
//int grid_size; // grid sizes are implied by IndexTexture now
|
||||
sf::RectangleShape box;
|
||||
float center_x, center_y, zoom;
|
||||
//IndexTexture* itex;
|
||||
std::shared_ptr<PyTexture> getTexture();
|
||||
sf::Sprite sprite, output;
|
||||
sf::RenderTexture renderTexture;
|
||||
std::vector<UIGridPoint> points;
|
||||
std::shared_ptr<std::list<std::shared_ptr<UIEntity>>> entities;
|
||||
|
||||
static int init(PyUIGridObject* self, PyObject* args, PyObject* kwds);
|
||||
static PyObject* get_grid_size(PyUIGridObject* self, void* closure);
|
||||
static PyObject* get_position(PyUIGridObject* self, void* closure);
|
||||
static int set_position(PyUIGridObject* self, PyObject* value, void* closure);
|
||||
static PyObject* get_size(PyUIGridObject* self, void* closure);
|
||||
static int set_size(PyUIGridObject* self, PyObject* value, void* closure);
|
||||
static PyObject* get_center(PyUIGridObject* self, void* closure);
|
||||
static int set_center(PyUIGridObject* self, PyObject* value, void* closure);
|
||||
static PyObject* get_float_member(PyUIGridObject* self, void* closure);
|
||||
static int set_float_member(PyUIGridObject* self, PyObject* value, void* closure);
|
||||
static PyObject* get_texture(PyUIGridObject* self, void* closure);
|
||||
static PyObject* py_at(PyUIGridObject* self, PyObject* o);
|
||||
static PyMethodDef methods[];
|
||||
static PyGetSetDef getsetters[];
|
||||
static PyObject* get_children(PyUIGridObject* self, void* closure);
|
||||
static PyObject* repr(PyUIGridObject* self);
|
||||
|
||||
};
|
||||
|
||||
typedef struct {
|
||||
PyObject_HEAD
|
||||
std::shared_ptr<std::list<std::shared_ptr<UIEntity>>> data;
|
||||
std::shared_ptr<UIGrid> grid;
|
||||
} PyUIEntityCollectionObject;
|
||||
|
||||
class UIEntityCollection {
|
||||
public:
|
||||
static PySequenceMethods sqmethods;
|
||||
static PyObject* append(PyUIEntityCollectionObject* self, PyObject* o);
|
||||
static PyObject* remove(PyUIEntityCollectionObject* self, PyObject* o);
|
||||
static PyMethodDef methods[];
|
||||
static PyObject* repr(PyUIEntityCollectionObject* self);
|
||||
static int init(PyUIEntityCollectionObject* self, PyObject* args, PyObject* kwds);
|
||||
static PyObject* iter(PyUIEntityCollectionObject* self);
|
||||
static Py_ssize_t len(PyUIEntityCollectionObject* self);
|
||||
static PyObject* getitem(PyUIEntityCollectionObject* self, Py_ssize_t index);
|
||||
};
|
||||
|
||||
typedef struct {
|
||||
PyObject_HEAD
|
||||
std::shared_ptr<std::list<std::shared_ptr<UIEntity>>> data;
|
||||
int index;
|
||||
int start_size;
|
||||
} PyUIEntityCollectionIterObject;
|
||||
|
||||
class UIEntityCollectionIter {
|
||||
public:
|
||||
static int init(PyUIEntityCollectionIterObject* self, PyObject* args, PyObject* kwds);
|
||||
static PyObject* next(PyUIEntityCollectionIterObject* self);
|
||||
static PyObject* repr(PyUIEntityCollectionIterObject* self);
|
||||
static PyObject* getitem(PyUIEntityCollectionObject* self, Py_ssize_t index);
|
||||
|
||||
};
|
||||
|
||||
namespace mcrfpydef {
|
||||
static PyTypeObject PyUIGridType = {
|
||||
.ob_base = {.ob_base = {.ob_refcnt = 1, .ob_type = NULL}, .ob_size = 0},
|
||||
.tp_name = "mcrfpy.Grid",
|
||||
.tp_basicsize = sizeof(PyUIGridObject),
|
||||
.tp_itemsize = 0,
|
||||
//.tp_dealloc = (destructor)[](PyObject* self)
|
||||
//{
|
||||
// PyUIGridObject* obj = (PyUIGridObject*)self;
|
||||
// obj->data.reset();
|
||||
// Py_TYPE(self)->tp_free(self);
|
||||
//},
|
||||
//TODO - PyUIGrid REPR def:
|
||||
.tp_repr = (reprfunc)UIGrid::repr,
|
||||
//.tp_hash = NULL,
|
||||
//.tp_iter
|
||||
//.tp_iternext
|
||||
.tp_flags = Py_TPFLAGS_DEFAULT,
|
||||
.tp_doc = PyDoc_STR("docstring"),
|
||||
.tp_methods = UIGrid::methods,
|
||||
//.tp_members = UIGrid::members,
|
||||
.tp_getset = UIGrid::getsetters,
|
||||
//.tp_base = NULL,
|
||||
.tp_init = (initproc)UIGrid::init,
|
||||
.tp_new = [](PyTypeObject* type, PyObject* args, PyObject* kwds) -> PyObject*
|
||||
{
|
||||
PyUIGridObject* self = (PyUIGridObject*)type->tp_alloc(type, 0);
|
||||
if (self) self->data = std::make_shared<UIGrid>();
|
||||
return (PyObject*)self;
|
||||
}
|
||||
};
|
||||
|
||||
static PyTypeObject PyUIEntityCollectionIterType = {
|
||||
.ob_base = {.ob_base = {.ob_refcnt = 1, .ob_type = NULL}, .ob_size = 0},
|
||||
.tp_name = "mcrfpy.UIEntityCollectionIter",
|
||||
.tp_basicsize = sizeof(PyUIEntityCollectionIterObject),
|
||||
.tp_itemsize = 0,
|
||||
.tp_dealloc = (destructor)[](PyObject* self)
|
||||
{
|
||||
PyUIEntityCollectionIterObject* obj = (PyUIEntityCollectionIterObject*)self;
|
||||
obj->data.reset();
|
||||
Py_TYPE(self)->tp_free(self);
|
||||
},
|
||||
.tp_repr = (reprfunc)UIEntityCollectionIter::repr,
|
||||
.tp_flags = Py_TPFLAGS_DEFAULT,
|
||||
.tp_doc = PyDoc_STR("Iterator for a collection of UI objects"),
|
||||
.tp_iter = PyObject_SelfIter,
|
||||
.tp_iternext = (iternextfunc)UIEntityCollectionIter::next,
|
||||
//.tp_getset = UIEntityCollection::getset,
|
||||
.tp_init = (initproc)UIEntityCollectionIter::init, // just raise an exception
|
||||
.tp_alloc = PyType_GenericAlloc,
|
||||
.tp_new = [](PyTypeObject* type, PyObject* args, PyObject* kwds) -> PyObject*
|
||||
{
|
||||
PyErr_SetString(PyExc_TypeError, "UICollection cannot be instantiated: a C++ data source is required.");
|
||||
return NULL;
|
||||
}
|
||||
};
|
||||
|
||||
static PyTypeObject PyUIEntityCollectionType = {
|
||||
.ob_base = {.ob_base = {.ob_refcnt = 1, .ob_type = NULL}, .ob_size = 0},
|
||||
.tp_name = "mcrfpy.EntityCollection",
|
||||
.tp_basicsize = sizeof(PyUIEntityCollectionObject),
|
||||
.tp_itemsize = 0,
|
||||
.tp_dealloc = (destructor)[](PyObject* self)
|
||||
{
|
||||
PyUIEntityCollectionObject* obj = (PyUIEntityCollectionObject*)self;
|
||||
obj->data.reset();
|
||||
Py_TYPE(self)->tp_free(self);
|
||||
},
|
||||
.tp_repr = (reprfunc)UIEntityCollection::repr,
|
||||
.tp_as_sequence = &UIEntityCollection::sqmethods,
|
||||
.tp_flags = Py_TPFLAGS_DEFAULT,
|
||||
.tp_doc = PyDoc_STR("Iterable, indexable collection of Entities"),
|
||||
.tp_iter = (getiterfunc)UIEntityCollection::iter,
|
||||
.tp_methods = UIEntityCollection::methods, // append, remove
|
||||
//.tp_getset = UIEntityCollection::getset,
|
||||
.tp_init = (initproc)UIEntityCollection::init, // just raise an exception
|
||||
.tp_new = [](PyTypeObject* type, PyObject* args, PyObject* kwds) -> PyObject*
|
||||
{
|
||||
// Does PyUIEntityCollectionType need __new__ if it's not supposed to be instantiable by the user?
|
||||
// Should I just raise an exception? Or is the uninitialized shared_ptr enough of a blocker?
|
||||
PyErr_SetString(PyExc_TypeError, "EntityCollection cannot be instantiated: a C++ data source is required.");
|
||||
return NULL;
|
||||
}
|
||||
};
|
||||
|
||||
}
|
|
@ -1,158 +0,0 @@
|
|||
#include "UIGridPoint.h"
|
||||
|
||||
UIGridPoint::UIGridPoint()
|
||||
: color(1.0f, 1.0f, 1.0f), color_overlay(0.0f, 0.0f, 0.0f), walkable(false), transparent(false),
|
||||
tilesprite(-1), tile_overlay(-1), uisprite(-1)
|
||||
{}
|
||||
|
||||
// Utility function to convert sf::Color to PyObject*
|
||||
PyObject* sfColor_to_PyObject(sf::Color color) {
|
||||
return Py_BuildValue("(iiii)", color.r, color.g, color.b, color.a);
|
||||
}
|
||||
|
||||
// Utility function to convert PyObject* to sf::Color
|
||||
sf::Color PyObject_to_sfColor(PyObject* obj) {
|
||||
int r, g, b, a = 255; // Default alpha to fully opaque if not specified
|
||||
if (!PyArg_ParseTuple(obj, "iii|i", &r, &g, &b, &a)) {
|
||||
return sf::Color(); // Return default color on parse error
|
||||
}
|
||||
return sf::Color(r, g, b, a);
|
||||
}
|
||||
|
||||
PyObject* UIGridPoint::get_color(PyUIGridPointObject* self, void* closure) {
|
||||
if (reinterpret_cast<long>(closure) == 0) { // color
|
||||
return sfColor_to_PyObject(self->data->color);
|
||||
} else { // color_overlay
|
||||
return sfColor_to_PyObject(self->data->color_overlay);
|
||||
}
|
||||
}
|
||||
|
||||
int UIGridPoint::set_color(PyUIGridPointObject* self, PyObject* value, void* closure) {
|
||||
sf::Color color = PyObject_to_sfColor(value);
|
||||
if (reinterpret_cast<long>(closure) == 0) { // color
|
||||
self->data->color = color;
|
||||
} else { // color_overlay
|
||||
self->data->color_overlay = color;
|
||||
}
|
||||
return 0;
|
||||
}
|
||||
|
||||
PyObject* UIGridPoint::get_bool_member(PyUIGridPointObject* self, void* closure) {
|
||||
if (reinterpret_cast<long>(closure) == 0) { // walkable
|
||||
return PyBool_FromLong(self->data->walkable);
|
||||
} else { // transparent
|
||||
return PyBool_FromLong(self->data->transparent);
|
||||
}
|
||||
}
|
||||
|
||||
int UIGridPoint::set_bool_member(PyUIGridPointObject* self, PyObject* value, void* closure) {
|
||||
if (value == Py_True) {
|
||||
if (reinterpret_cast<long>(closure) == 0) { // walkable
|
||||
self->data->walkable = true;
|
||||
} else { // transparent
|
||||
self->data->transparent = true;
|
||||
}
|
||||
} else if (value == Py_False) {
|
||||
if (reinterpret_cast<long>(closure) == 0) { // walkable
|
||||
self->data->walkable = false;
|
||||
} else { // transparent
|
||||
self->data->transparent = false;
|
||||
}
|
||||
} else {
|
||||
PyErr_SetString(PyExc_ValueError, "Expected a boolean value");
|
||||
return -1;
|
||||
}
|
||||
return 0;
|
||||
}
|
||||
|
||||
PyObject* UIGridPoint::get_int_member(PyUIGridPointObject* self, void* closure) {
|
||||
switch(reinterpret_cast<long>(closure)) {
|
||||
case 0: return PyLong_FromLong(self->data->tilesprite);
|
||||
case 1: return PyLong_FromLong(self->data->tile_overlay);
|
||||
case 2: return PyLong_FromLong(self->data->uisprite);
|
||||
default: PyErr_SetString(PyExc_RuntimeError, "Invalid closure"); return nullptr;
|
||||
}
|
||||
}
|
||||
|
||||
int UIGridPoint::set_int_member(PyUIGridPointObject* self, PyObject* value, void* closure) {
|
||||
long val = PyLong_AsLong(value);
|
||||
if (PyErr_Occurred()) return -1;
|
||||
|
||||
switch(reinterpret_cast<long>(closure)) {
|
||||
case 0: self->data->tilesprite = val; break;
|
||||
case 1: self->data->tile_overlay = val; break;
|
||||
case 2: self->data->uisprite = val; break;
|
||||
default: PyErr_SetString(PyExc_RuntimeError, "Invalid closure"); return -1;
|
||||
}
|
||||
return 0;
|
||||
}
|
||||
|
||||
PyGetSetDef UIGridPoint::getsetters[] = {
|
||||
{"color", (getter)UIGridPoint::get_color, (setter)UIGridPoint::set_color, "GridPoint color", (void*)0},
|
||||
{"color_overlay", (getter)UIGridPoint::get_color, (setter)UIGridPoint::set_color, "GridPoint color overlay", (void*)1},
|
||||
{"walkable", (getter)UIGridPoint::get_bool_member, (setter)UIGridPoint::set_bool_member, "Is the GridPoint walkable", (void*)0},
|
||||
{"transparent", (getter)UIGridPoint::get_bool_member, (setter)UIGridPoint::set_bool_member, "Is the GridPoint transparent", (void*)1},
|
||||
{"tilesprite", (getter)UIGridPoint::get_int_member, (setter)UIGridPoint::set_int_member, "Tile sprite index", (void*)0},
|
||||
{"tile_overlay", (getter)UIGridPoint::get_int_member, (setter)UIGridPoint::set_int_member, "Tile overlay sprite index", (void*)1},
|
||||
{"uisprite", (getter)UIGridPoint::get_int_member, (setter)UIGridPoint::set_int_member, "UI sprite index", (void*)2},
|
||||
{NULL} /* Sentinel */
|
||||
};
|
||||
|
||||
PyObject* UIGridPoint::repr(PyUIGridPointObject* self) {
|
||||
std::ostringstream ss;
|
||||
if (!self->data) ss << "<GridPoint (invalid internal object)>";
|
||||
else {
|
||||
auto gp = self->data;
|
||||
ss << "<GridPoint (walkable=" << (gp->walkable ? "True" : "False") << ", transparent=" << (gp->transparent ? "True" : "False") <<
|
||||
", tilesprite=" << gp->tilesprite << ", tile_overlay=" << gp->tile_overlay << ", uisprite=" << gp->uisprite <<
|
||||
")>";
|
||||
}
|
||||
std::string repr_str = ss.str();
|
||||
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
|
||||
}
|
||||
|
||||
PyObject* UIGridPointState::get_bool_member(PyUIGridPointStateObject* self, void* closure) {
|
||||
if (reinterpret_cast<long>(closure) == 0) { // visible
|
||||
return PyBool_FromLong(self->data->visible);
|
||||
} else { // discovered
|
||||
return PyBool_FromLong(self->data->discovered);
|
||||
}
|
||||
}
|
||||
|
||||
int UIGridPointState::set_bool_member(PyUIGridPointStateObject* self, PyObject* value, void* closure) {
|
||||
if (!PyBool_Check(value)) {
|
||||
PyErr_SetString(PyExc_TypeError, "Value must be a boolean");
|
||||
return -1;
|
||||
}
|
||||
|
||||
int truthValue = PyObject_IsTrue(value);
|
||||
if (truthValue < 0) {
|
||||
return -1; // PyObject_IsTrue returns -1 on error
|
||||
}
|
||||
|
||||
if (reinterpret_cast<long>(closure) == 0) { // visible
|
||||
self->data->visible = truthValue;
|
||||
} else { // discovered
|
||||
self->data->discovered = truthValue;
|
||||
}
|
||||
|
||||
return 0;
|
||||
}
|
||||
|
||||
PyGetSetDef UIGridPointState::getsetters[] = {
|
||||
{"visible", (getter)UIGridPointState::get_bool_member, (setter)UIGridPointState::set_bool_member, "Is the GridPointState visible", (void*)0},
|
||||
{"discovered", (getter)UIGridPointState::get_bool_member, (setter)UIGridPointState::set_bool_member, "Has the GridPointState been discovered", (void*)1},
|
||||
{NULL} /* Sentinel */
|
||||
};
|
||||
|
||||
PyObject* UIGridPointState::repr(PyUIGridPointStateObject* self) {
|
||||
std::ostringstream ss;
|
||||
if (!self->data) ss << "<GridPointState (invalid internal object)>";
|
||||
else {
|
||||
auto gps = self->data;
|
||||
ss << "<GridPointState (visible=" << (gps->visible ? "True" : "False") << ", discovered=" << (gps->discovered ? "True" : "False") <<
|
||||
")>";
|
||||
}
|
||||
std::string repr_str = ss.str();
|
||||
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
|
||||
}
|
|
@ -1,92 +0,0 @@
|
|||
#pragma once
|
||||
#include "Common.h"
|
||||
#include "Python.h"
|
||||
#include "structmember.h"
|
||||
#include "IndexTexture.h"
|
||||
#include "Resources.h"
|
||||
#include <list>
|
||||
|
||||
#include "PyCallable.h"
|
||||
#include "PyTexture.h"
|
||||
#include "PyColor.h"
|
||||
#include "PyVector.h"
|
||||
#include "PyFont.h"
|
||||
|
||||
static PyObject* sfColor_to_PyObject(sf::Color color);
|
||||
static sf::Color PyObject_to_sfColor(PyObject* obj);
|
||||
|
||||
class UIGrid;
|
||||
class UIEntity;
|
||||
class UIGridPoint;
|
||||
class UIGridPointState;
|
||||
|
||||
typedef struct {
|
||||
PyObject_HEAD
|
||||
UIGridPoint* data;
|
||||
std::shared_ptr<UIGrid> grid;
|
||||
} PyUIGridPointObject;
|
||||
|
||||
typedef struct {
|
||||
PyObject_HEAD
|
||||
UIGridPointState* data;
|
||||
std::shared_ptr<UIGrid> grid;
|
||||
std::shared_ptr<UIEntity> entity;
|
||||
} PyUIGridPointStateObject;
|
||||
|
||||
// UIGridPoint - revised grid data for each point
|
||||
class UIGridPoint
|
||||
{
|
||||
public:
|
||||
sf::Color color, color_overlay;
|
||||
bool walkable, transparent;
|
||||
int tilesprite, tile_overlay, uisprite;
|
||||
UIGridPoint();
|
||||
|
||||
static int set_int_member(PyUIGridPointObject* self, PyObject* value, void* closure);
|
||||
static PyGetSetDef getsetters[];
|
||||
static PyObject* get_color(PyUIGridPointObject* self, void* closure);
|
||||
static PyObject* get_int_member(PyUIGridPointObject* self, void* closure);
|
||||
static int set_bool_member(PyUIGridPointObject* self, PyObject* value, void* closure);
|
||||
static PyObject* get_bool_member(PyUIGridPointObject* self, void* closure);
|
||||
static int set_color(PyUIGridPointObject* self, PyObject* value, void* closure);
|
||||
static PyObject* repr(PyUIGridPointObject* self);
|
||||
};
|
||||
|
||||
// UIGridPointState - entity-specific info for each cell
|
||||
class UIGridPointState
|
||||
{
|
||||
public:
|
||||
bool visible, discovered;
|
||||
|
||||
static PyObject* get_bool_member(PyUIGridPointStateObject* self, void* closure);
|
||||
static int set_bool_member(PyUIGridPointStateObject* self, PyObject* value, void* closure);
|
||||
static PyGetSetDef getsetters[];
|
||||
static PyObject* repr(PyUIGridPointStateObject* self);
|
||||
};
|
||||
|
||||
namespace mcrfpydef {
|
||||
static PyTypeObject PyUIGridPointType = {
|
||||
.ob_base = {.ob_base = {.ob_refcnt = 1, .ob_type = NULL}, .ob_size = 0},
|
||||
.tp_name = "mcrfpy.GridPoint",
|
||||
.tp_basicsize = sizeof(PyUIGridPointObject),
|
||||
.tp_itemsize = 0,
|
||||
.tp_repr = (reprfunc)UIGridPoint::repr,
|
||||
.tp_flags = Py_TPFLAGS_DEFAULT,
|
||||
.tp_doc = "UIGridPoint object",
|
||||
.tp_getset = UIGridPoint::getsetters,
|
||||
//.tp_init = (initproc)PyUIGridPoint_init, // TODO Define the init function
|
||||
.tp_new = PyType_GenericNew,
|
||||
};
|
||||
|
||||
static PyTypeObject PyUIGridPointStateType = {
|
||||
.ob_base = {.ob_base = {.ob_refcnt = 1, .ob_type = NULL}, .ob_size = 0},
|
||||
.tp_name = "mcrfpy.GridPointState",
|
||||
.tp_basicsize = sizeof(PyUIGridPointStateObject),
|
||||
.tp_itemsize = 0,
|
||||
.tp_repr = (reprfunc)UIGridPointState::repr,
|
||||
.tp_flags = Py_TPFLAGS_DEFAULT,
|
||||
.tp_doc = "UIGridPointState object", // TODO: Add PyUIGridPointState tp_init
|
||||
.tp_getset = UIGridPointState::getsetters,
|
||||
.tp_new = PyType_GenericNew,
|
||||
};
|
||||
}
|
217
src/UISprite.cpp
217
src/UISprite.cpp
|
@ -1,217 +0,0 @@
|
|||
#include "UISprite.h"
|
||||
#include "GameEngine.h"
|
||||
|
||||
UIDrawable* UISprite::click_at(sf::Vector2f point)
|
||||
{
|
||||
if (click_callable)
|
||||
{
|
||||
if(sprite.getGlobalBounds().contains(point)) return this;
|
||||
}
|
||||
return NULL;
|
||||
}
|
||||
|
||||
UISprite::UISprite() {}
|
||||
|
||||
UISprite::UISprite(std::shared_ptr<PyTexture> _ptex, int _sprite_index, sf::Vector2f _pos, float _scale)
|
||||
: ptex(_ptex), sprite_index(_sprite_index)
|
||||
{
|
||||
sprite = ptex->sprite(sprite_index, _pos, sf::Vector2f(_scale, _scale));
|
||||
}
|
||||
|
||||
/*
|
||||
void UISprite::render(sf::Vector2f offset)
|
||||
{
|
||||
sprite.move(offset);
|
||||
Resources::game->getWindow().draw(sprite);
|
||||
sprite.move(-offset);
|
||||
}
|
||||
*/
|
||||
|
||||
void UISprite::render(sf::Vector2f offset, sf::RenderTarget& target)
|
||||
{
|
||||
sprite.move(offset);
|
||||
target.draw(sprite);
|
||||
sprite.move(-offset);
|
||||
}
|
||||
|
||||
void UISprite::setPosition(sf::Vector2f pos)
|
||||
{
|
||||
sprite.setPosition(pos);
|
||||
}
|
||||
|
||||
void UISprite::setScale(sf::Vector2f s)
|
||||
{
|
||||
sprite.setScale(s);
|
||||
}
|
||||
|
||||
void UISprite::setTexture(std::shared_ptr<PyTexture> _ptex, int _sprite_index)
|
||||
{
|
||||
ptex = _ptex;
|
||||
if (_sprite_index != -1) // if you are changing textures, there's a good chance you need a new index too
|
||||
sprite_index = _sprite_index;
|
||||
sprite = ptex->sprite(sprite_index, sprite.getPosition(), sprite.getScale());
|
||||
}
|
||||
|
||||
void UISprite::setSpriteIndex(int _sprite_index)
|
||||
{
|
||||
sprite_index = _sprite_index;
|
||||
sprite = ptex->sprite(sprite_index, sprite.getPosition(), sprite.getScale());
|
||||
}
|
||||
|
||||
sf::Vector2f UISprite::getScale()
|
||||
{
|
||||
return sprite.getScale();
|
||||
}
|
||||
|
||||
sf::Vector2f UISprite::getPosition()
|
||||
{
|
||||
return sprite.getPosition();
|
||||
}
|
||||
|
||||
std::shared_ptr<PyTexture> UISprite::getTexture()
|
||||
{
|
||||
return ptex;
|
||||
}
|
||||
|
||||
int UISprite::getSpriteIndex()
|
||||
{
|
||||
return sprite_index;
|
||||
}
|
||||
|
||||
PyObjectsEnum UISprite::derived_type()
|
||||
{
|
||||
return PyObjectsEnum::UISPRITE;
|
||||
}
|
||||
|
||||
PyObject* UISprite::get_float_member(PyUISpriteObject* self, void* closure)
|
||||
{
|
||||
auto member_ptr = reinterpret_cast<long>(closure);
|
||||
if (member_ptr == 0)
|
||||
return PyFloat_FromDouble(self->data->getPosition().x);
|
||||
else if (member_ptr == 1)
|
||||
return PyFloat_FromDouble(self->data->getPosition().y);
|
||||
else if (member_ptr == 2)
|
||||
return PyFloat_FromDouble(self->data->getScale().x); // scale X and Y are identical, presently
|
||||
else
|
||||
{
|
||||
PyErr_SetString(PyExc_AttributeError, "Invalid attribute");
|
||||
return nullptr;
|
||||
}
|
||||
}
|
||||
|
||||
int UISprite::set_float_member(PyUISpriteObject* self, PyObject* value, void* closure)
|
||||
{
|
||||
float val;
|
||||
auto member_ptr = reinterpret_cast<long>(closure);
|
||||
if (PyFloat_Check(value))
|
||||
{
|
||||
val = PyFloat_AsDouble(value);
|
||||
}
|
||||
else if (PyLong_Check(value))
|
||||
{
|
||||
val = PyLong_AsLong(value);
|
||||
}
|
||||
else
|
||||
{
|
||||
PyErr_SetString(PyExc_TypeError, "Value must be a floating point number.");
|
||||
return -1;
|
||||
}
|
||||
if (member_ptr == 0) //x
|
||||
self->data->setPosition(sf::Vector2f(val, self->data->getPosition().y));
|
||||
else if (member_ptr == 1) //y
|
||||
self->data->setPosition(sf::Vector2f(self->data->getPosition().x, val));
|
||||
else if (member_ptr == 2) // scale
|
||||
self->data->setScale(sf::Vector2f(val, val));
|
||||
return 0;
|
||||
}
|
||||
|
||||
PyObject* UISprite::get_int_member(PyUISpriteObject* self, void* closure)
|
||||
{
|
||||
auto member_ptr = reinterpret_cast<long>(closure);
|
||||
if (true) {}
|
||||
else
|
||||
{
|
||||
PyErr_SetString(PyExc_AttributeError, "Invalid attribute");
|
||||
return nullptr;
|
||||
}
|
||||
|
||||
return PyLong_FromDouble(self->data->getSpriteIndex());
|
||||
}
|
||||
|
||||
int UISprite::set_int_member(PyUISpriteObject* self, PyObject* value, void* closure)
|
||||
{
|
||||
int val;
|
||||
auto member_ptr = reinterpret_cast<long>(closure);
|
||||
if (PyLong_Check(value))
|
||||
{
|
||||
val = PyLong_AsLong(value);
|
||||
}
|
||||
else
|
||||
{
|
||||
PyErr_SetString(PyExc_TypeError, "Value must be an integer.");
|
||||
return -1;
|
||||
}
|
||||
self->data->setSpriteIndex(val);
|
||||
return 0;
|
||||
}
|
||||
|
||||
PyObject* UISprite::get_texture(PyUISpriteObject* self, void* closure)
|
||||
{
|
||||
return self->data->getTexture()->pyObject();
|
||||
}
|
||||
|
||||
int UISprite::set_texture(PyUISpriteObject* self, PyObject* value, void* closure)
|
||||
{
|
||||
return -1;
|
||||
}
|
||||
|
||||
PyGetSetDef UISprite::getsetters[] = {
|
||||
{"x", (getter)UISprite::get_float_member, (setter)UISprite::set_float_member, "X coordinate of top-left corner", (void*)0},
|
||||
{"y", (getter)UISprite::get_float_member, (setter)UISprite::set_float_member, "Y coordinate of top-left corner", (void*)1},
|
||||
{"scale", (getter)UISprite::get_float_member, (setter)UISprite::set_float_member, "Size factor", (void*)2},
|
||||
{"sprite_number", (getter)UISprite::get_int_member, (setter)UISprite::set_int_member, "Which sprite on the texture is shown", NULL},
|
||||
{"texture", (getter)UISprite::get_texture, (setter)UISprite::set_texture, "Texture object", NULL},
|
||||
{"click", (getter)UIDrawable::get_click, (setter)UIDrawable::set_click, "Object called with (x, y, button) when clicked", (void*)PyObjectsEnum::UISPRITE},
|
||||
{NULL}
|
||||
};
|
||||
|
||||
PyObject* UISprite::repr(PyUISpriteObject* self)
|
||||
{
|
||||
std::ostringstream ss;
|
||||
if (!self->data) ss << "<Sprite (invalid internal object)>";
|
||||
else {
|
||||
//auto sprite = self->data->sprite;
|
||||
ss << "<Sprite (x=" << self->data->getPosition().x << ", y=" << self->data->getPosition().y << ", " <<
|
||||
"scale=" << self->data->getScale().x << ", " <<
|
||||
"sprite_number=" << self->data->getSpriteIndex() << ")>";
|
||||
}
|
||||
std::string repr_str = ss.str();
|
||||
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
|
||||
}
|
||||
|
||||
int UISprite::init(PyUISpriteObject* self, PyObject* args, PyObject* kwds)
|
||||
{
|
||||
//std::cout << "Init called\n";
|
||||
static const char* keywords[] = { "x", "y", "texture", "sprite_index", "scale", nullptr };
|
||||
float x = 0.0f, y = 0.0f, scale = 1.0f;
|
||||
int sprite_index;
|
||||
PyObject* texture;
|
||||
|
||||
if (!PyArg_ParseTupleAndKeywords(args, kwds, "|ffOif",
|
||||
const_cast<char**>(keywords), &x, &y, &texture, &sprite_index, &scale))
|
||||
{
|
||||
return -1;
|
||||
}
|
||||
|
||||
// check types for texture
|
||||
//if (texture != NULL && !PyObject_IsInstance(texture, (PyObject*)&PyTextureType)){
|
||||
if (texture != NULL && !PyObject_IsInstance(texture, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Texture"))){
|
||||
PyErr_SetString(PyExc_TypeError, "texture must be a mcrfpy.Texture instance");
|
||||
return -1;
|
||||
}
|
||||
auto pytexture = (PyTextureObject*)texture;
|
||||
self->data = std::make_shared<UISprite>(pytexture->data, sprite_index, sf::Vector2f(x, y), scale);
|
||||
self->data->setPosition(sf::Vector2f(x, y));
|
||||
|
||||
return 0;
|
||||
}
|
|
@ -1,90 +0,0 @@
|
|||
#pragma once
|
||||
#include "Common.h"
|
||||
#include "Python.h"
|
||||
#include "structmember.h"
|
||||
#include "IndexTexture.h"
|
||||
#include "Resources.h"
|
||||
#include <list>
|
||||
|
||||
#include "PyCallable.h"
|
||||
#include "PyTexture.h"
|
||||
#include "PyColor.h"
|
||||
#include "PyVector.h"
|
||||
#include "PyFont.h"
|
||||
#include "UIDrawable.h"
|
||||
#include "UIBase.h"
|
||||
|
||||
class UISprite: public UIDrawable
|
||||
{
|
||||
private:
|
||||
int sprite_index;
|
||||
sf::Sprite sprite;
|
||||
protected:
|
||||
std::shared_ptr<PyTexture> ptex;
|
||||
public:
|
||||
UISprite();
|
||||
UISprite(std::shared_ptr<PyTexture>, int, sf::Vector2f, float);
|
||||
void update();
|
||||
void render(sf::Vector2f, sf::RenderTarget&) override final;
|
||||
virtual UIDrawable* click_at(sf::Vector2f point) override final;
|
||||
|
||||
//void render(sf::Vector2f, sf::RenderTexture&);
|
||||
|
||||
void setPosition(sf::Vector2f);
|
||||
sf::Vector2f getPosition();
|
||||
void setScale(sf::Vector2f);
|
||||
sf::Vector2f getScale();
|
||||
void setSpriteIndex(int);
|
||||
int getSpriteIndex();
|
||||
|
||||
void setTexture(std::shared_ptr<PyTexture> _ptex, int _sprite_index=-1);
|
||||
std::shared_ptr<PyTexture> getTexture();
|
||||
|
||||
PyObjectsEnum derived_type() override final;
|
||||
|
||||
|
||||
static PyObject* get_float_member(PyUISpriteObject* self, void* closure);
|
||||
static int set_float_member(PyUISpriteObject* self, PyObject* value, void* closure);
|
||||
static PyObject* get_int_member(PyUISpriteObject* self, void* closure);
|
||||
static int set_int_member(PyUISpriteObject* self, PyObject* value, void* closure);
|
||||
static PyObject* get_texture(PyUISpriteObject* self, void* closure);
|
||||
static int set_texture(PyUISpriteObject* self, PyObject* value, void* closure);
|
||||
static PyGetSetDef getsetters[];
|
||||
static PyObject* repr(PyUISpriteObject* self);
|
||||
static int init(PyUISpriteObject* self, PyObject* args, PyObject* kwds);
|
||||
|
||||
};
|
||||
|
||||
namespace mcrfpydef {
|
||||
static PyTypeObject PyUISpriteType = {
|
||||
.ob_base = {.ob_base = {.ob_refcnt = 1, .ob_type = NULL}, .ob_size = 0},
|
||||
.tp_name = "mcrfpy.Sprite",
|
||||
.tp_basicsize = sizeof(PyUISpriteObject),
|
||||
.tp_itemsize = 0,
|
||||
.tp_dealloc = (destructor)[](PyObject* self)
|
||||
{
|
||||
PyUISpriteObject* obj = (PyUISpriteObject*)self;
|
||||
// release reference to font object
|
||||
//if (obj->texture) Py_DECREF(obj->texture);
|
||||
obj->data.reset();
|
||||
Py_TYPE(self)->tp_free(self);
|
||||
},
|
||||
.tp_repr = (reprfunc)UISprite::repr,
|
||||
//.tp_hash = NULL,
|
||||
//.tp_iter
|
||||
//.tp_iternext
|
||||
.tp_flags = Py_TPFLAGS_DEFAULT,
|
||||
.tp_doc = PyDoc_STR("docstring"),
|
||||
//.tp_methods = PyUIFrame_methods,
|
||||
//.tp_members = PyUIFrame_members,
|
||||
.tp_getset = UISprite::getsetters,
|
||||
//.tp_base = NULL,
|
||||
.tp_init = (initproc)UISprite::init,
|
||||
.tp_new = [](PyTypeObject* type, PyObject* args, PyObject* kwds) -> PyObject*
|
||||
{
|
||||
PyUISpriteObject* self = (PyUISpriteObject*)type->tp_alloc(type, 0);
|
||||
//if (self) self->data = std::make_shared<UICaption>();
|
||||
return (PyObject*)self;
|
||||
}
|
||||
};
|
||||
}
|
|
@ -154,7 +154,7 @@ void UITestScene::doAction(std::string name, std::string type)
|
|||
*/
|
||||
}
|
||||
|
||||
void UITestScene::render()
|
||||
void UITestScene::sRender()
|
||||
{
|
||||
game->getWindow().clear();
|
||||
game->getWindow().draw(text);
|
||||
|
|
|
@ -18,5 +18,5 @@ public:
|
|||
UITestScene(GameEngine*);
|
||||
void update() override final;
|
||||
void doAction(std::string, std::string) override final;
|
||||
void render() override final;
|
||||
void sRender() override final;
|
||||
};
|
||||
|
|
|
@ -1,539 +0,0 @@
|
|||
import mcrfpy
|
||||
import random
|
||||
from cos_itemdata import itemdata
|
||||
#t = mcrfpy.Texture("assets/kenney_tinydungeon.png", 16, 16)
|
||||
t = mcrfpy.Texture("assets/kenney_TD_MR_IP.png", 16, 16)
|
||||
#def iterable_entities(grid):
|
||||
# """Workaround for UIEntityCollection bug; see issue #72"""
|
||||
# entities = []
|
||||
# for i in range(len(grid.entities)):
|
||||
# entities.append(grid.entities[i])
|
||||
# return entities
|
||||
|
||||
class COSEntity(): #mcrfpy.Entity): # Fake mcrfpy.Entity integration; engine bugs workarounds
|
||||
def __init__(self, g:mcrfpy.Grid, x=0, y=0, sprite_num=86, *, game):
|
||||
#self.e = mcrfpy.Entity((x, y), t, sprite_num)
|
||||
#super().__init__((x, y), t, sprite_num)
|
||||
self._entity = mcrfpy.Entity((x, y), t, sprite_num)
|
||||
#grid.entities.append(self.e)
|
||||
self.grid = g
|
||||
#g.entities.append(self._entity)
|
||||
self.game = game
|
||||
self.game.add_entity(self)
|
||||
|
||||
## Wrapping mcfrpy.Entity properties to emulate derived class... see issue #76
|
||||
@property
|
||||
def draw_pos(self):
|
||||
return self._entity.draw_pos
|
||||
|
||||
@draw_pos.setter
|
||||
def draw_pos(self, value):
|
||||
self._entity.draw_pos = value
|
||||
|
||||
@property
|
||||
def sprite_number(self):
|
||||
return self._entity.sprite_number
|
||||
|
||||
@sprite_number.setter
|
||||
def sprite_number(self, value):
|
||||
self._entity.sprite_number = value
|
||||
|
||||
def __repr__(self):
|
||||
return f"<{self.__class__.__name__} ({self.draw_pos})>"
|
||||
|
||||
def die(self):
|
||||
# ugly workaround! grid.entities isn't really iterable (segfaults)
|
||||
for i in range(len(self.grid.entities)):
|
||||
e = self.grid.entities[i]
|
||||
if e == self._entity:
|
||||
#if e == self:
|
||||
self.grid.entities.remove(i)
|
||||
break
|
||||
else:
|
||||
print(f"!!! {self!r} wasn't removed from grid on call to die()")
|
||||
|
||||
def bump(self, other, dx, dy, test=False):
|
||||
raise NotImplementedError
|
||||
|
||||
def do_move(self, tx, ty):
|
||||
"""Base class method to move this entity
|
||||
Assumes try_move succeeded, for everyone!
|
||||
from: self._entity.draw_pos
|
||||
to: (tx, ty)
|
||||
calls ev_exit for every entity at (draw_pos)
|
||||
calls ev_enter for every entity at (tx, ty)
|
||||
"""
|
||||
old_pos = self.draw_pos
|
||||
self.draw_pos = (tx, ty)
|
||||
for e in self.game.entities:
|
||||
if e is self: continue
|
||||
if e.draw_pos == old_pos: e.ev_exit(self)
|
||||
for e in self.game.entities:
|
||||
if e is self: continue
|
||||
if e.draw_pos == (tx, ty): e.ev_enter(self)
|
||||
|
||||
def act(self):
|
||||
pass
|
||||
|
||||
def ev_enter(self, other):
|
||||
pass
|
||||
|
||||
def ev_exit(self, other):
|
||||
pass
|
||||
|
||||
def try_move(self, dx, dy, test=False):
|
||||
x_max, y_max = self.grid.grid_size
|
||||
tx, ty = int(self.draw_pos[0] + dx), int(self.draw_pos[1] + dy)
|
||||
#for e in iterable_entities(self.grid):
|
||||
|
||||
# sorting entities to test against the boulder instead of the button when they overlap.
|
||||
for e in sorted(self.game.entities, key = lambda i: i.draw_order, reverse = True):
|
||||
if e.draw_pos == (tx, ty):
|
||||
#print(f"bumping {e}")
|
||||
return e.bump(self, dx, dy)
|
||||
|
||||
if tx < 0 or tx >= x_max:
|
||||
return False
|
||||
if ty < 0 or ty >= y_max:
|
||||
return False
|
||||
if self.grid.at((tx, ty)).walkable == True:
|
||||
if not test:
|
||||
#self.draw_pos = (tx, ty)
|
||||
self.do_move(tx, ty)
|
||||
return True
|
||||
else:
|
||||
#print("Bonk")
|
||||
return False
|
||||
|
||||
def _relative_move(self, dx, dy):
|
||||
tx, ty = int(self.draw_pos[0] + dx), int(self.draw_pos[1] + dy)
|
||||
#self.draw_pos = (tx, ty)
|
||||
self.do_move(tx, ty)
|
||||
|
||||
class Equippable:
|
||||
def __init__(self, hands = 0, hp_healing = 0, damage = 0, defense = 0, zap_damage = 1, zap_cooldown = 10, sprite = 129, boost=None, text="", text_color=(255, 255, 255), value=0):
|
||||
self.hands = hands
|
||||
self.hp_healing = hp_healing
|
||||
self.damage = damage
|
||||
self.defense = defense
|
||||
self.zap_damage = zap_damage
|
||||
self.zap_cooldown = zap_cooldown
|
||||
self.zap_cooldown_remaining = 0
|
||||
self.sprite = sprite
|
||||
self.quality = 0
|
||||
self.text = text
|
||||
self.text_color = text_color
|
||||
self.boost = boost
|
||||
self.value = value
|
||||
|
||||
def tick(self):
|
||||
if self.zap_cooldown_remaining:
|
||||
self.zap_cooldown_remaining -= 1
|
||||
if self.zap_cooldown_remaining < 0: self.zap_cooldown_remaining = 0
|
||||
|
||||
def __repr__(self):
|
||||
cooldown_str = f'({self.zap_cooldown_remaining} rounds until ready)'
|
||||
return f"<Equippable text={self.text}, hands={self.hands}, hp_healing={self.hp_healing}, damage={self.damage}, defense={self.defense}, zap_damage={self.zap_damage}, zap_cooldown={self.zap_cooldown}{cooldown_str if self.zap_cooldown_remaining else ''}, sprite={self.sprite}>"
|
||||
|
||||
def classify(self):
|
||||
categories = []
|
||||
if self.hands==0:
|
||||
categories.append("consumable")
|
||||
elif self.damage > 0:
|
||||
categories.append(f"{self.hands}-handed weapon")
|
||||
elif self.defense > 0:
|
||||
categories.append(f"defense")
|
||||
elif self.zap_damage > 0:
|
||||
categories.append("{self.hands}-handed magic weapon")
|
||||
if len(categories) == 0:
|
||||
return "unclassifiable"
|
||||
elif len(categories) == 1:
|
||||
return categories[0]
|
||||
else:
|
||||
return "Erratic: " + ', '.join(categories)
|
||||
|
||||
def consume(self, consumer):
|
||||
if self.boost == "green_pot":
|
||||
consumer.base_damage += self.value
|
||||
elif self.boost == "blue_pot":
|
||||
b = self.value
|
||||
while b: #split bonus between damage and faster cooldown
|
||||
bonus = random.choice(["damage", "cooldown", "range"])
|
||||
if bonus == "damage":
|
||||
consumer.base_zap_damage += 1
|
||||
elif bonus == "cooldown":
|
||||
consumer.base_zap_cooldown += 1
|
||||
else:
|
||||
consumer.base_zap_range += 1
|
||||
b -= 1
|
||||
elif self.boost == "grey_pot":
|
||||
consumer.base_defense += self.value
|
||||
elif self.boost == "sm_grey_pot":
|
||||
consumer.luck += self.value
|
||||
elif self.hp_healing:
|
||||
consumer.hp += self.hp_healing
|
||||
if consumer.hp > consumer.max_hp: consumer.hp = consumer.max_hp
|
||||
|
||||
def do_zap(self, caster, entities):
|
||||
if self.zap_damage == 0:
|
||||
print("This item can't zap.")
|
||||
return False
|
||||
if self.zap_cooldown_remaining != 0:
|
||||
print("zap is cooling down.")
|
||||
return False
|
||||
fx, fy = caster.draw_pos
|
||||
x, y = int(fx), int (fy)
|
||||
dist = lambda tx, ty: abs(int(tx) - x) + abs(int(ty) - y)
|
||||
targets = []
|
||||
for e in entities:
|
||||
if type(e) != EnemyEntity: continue
|
||||
if dist(*e.draw_pos) > caster.base_zap_range:
|
||||
continue
|
||||
if e.hp <= 0: continue
|
||||
targets.append(e)
|
||||
if not targets:
|
||||
print("No targets found in range.")
|
||||
return False
|
||||
target = random.choice(targets)
|
||||
print(f"Zap! {target}")
|
||||
target.get_zapped(self.zap_damage)
|
||||
self.zap_cooldown_remaining = self.zap_cooldown
|
||||
return True
|
||||
|
||||
#def compare(self, other):
|
||||
# my_class = self.classify()
|
||||
# o_class = other.classify()
|
||||
# if my_class == "unclassifiable" or o_class == "unclassifiable":
|
||||
# return None
|
||||
# if my_class == "consumable":
|
||||
# return other.hp_healing - self.hp_healing
|
||||
|
||||
|
||||
class PlayerEntity(COSEntity):
|
||||
def __init__(self, *, game):
|
||||
#print(f"spawn at origin")
|
||||
self.draw_order = 10
|
||||
super().__init__(game.grid, 0, 0, sprite_num=84, game=game)
|
||||
self.hp = 10
|
||||
self.max_hp = 10
|
||||
self.base_damage = 1
|
||||
self.base_defense = 0
|
||||
self.luck = 0
|
||||
self.archetype = None
|
||||
self.equipped = []
|
||||
self.inventory = []
|
||||
self.base_zap_damage = 0
|
||||
self.base_zap_cooldown = 0
|
||||
self.base_zap_range = 4
|
||||
|
||||
def tick(self):
|
||||
for i in self.equipped:
|
||||
i.tick()
|
||||
|
||||
def calc_damage(self):
|
||||
dmg = self.base_damage
|
||||
for i in self.equipped:
|
||||
dmg += i.damage
|
||||
return dmg
|
||||
|
||||
def calc_defense(self):
|
||||
defense = self.base_defense
|
||||
for i in self.equipped:
|
||||
defense += i.defense
|
||||
return defense
|
||||
|
||||
def do_zap(self):
|
||||
for i in self.equipped:
|
||||
if i.zap_damage and i.zap_cooldown_remaining == 0:
|
||||
if i.do_zap(self, self.game.entities):
|
||||
break
|
||||
else:
|
||||
print("Couldn't zap")
|
||||
|
||||
def bump(self, other, dx, dy, test=False):
|
||||
if type(other) == BoulderEntity:
|
||||
print("Boulder hit w/ knockback!")
|
||||
return self.game.pull_boulder_move((-dx, -dy), other)
|
||||
#print(f"oof, ouch, {other} bumped the player - {other.base_damage} damage from {other}")
|
||||
self.hp = max(self.hp - max(other.base_damage - self.calc_defense(), 0), 0)
|
||||
|
||||
def receive(self, equip):
|
||||
print(equip)
|
||||
if (equip.hands == 0):
|
||||
if len([i for i in self.inventory if i is not None]) < 3:
|
||||
if None in self.inventory:
|
||||
self.inventory[self.inventory.index(None)] = equip
|
||||
else:
|
||||
self.inventory.append(equip)
|
||||
return
|
||||
else:
|
||||
print("something something, consumable GUI")
|
||||
elif (equip.hands == 1):
|
||||
if len(self.equipped) < 2:
|
||||
self.equipped.append(equip)
|
||||
return
|
||||
else:
|
||||
print("Something something, 1h GUI")
|
||||
else: # equip.hands == 2:
|
||||
if len(self.equipped) == 0:
|
||||
self.equipped.append(equip)
|
||||
return
|
||||
else:
|
||||
print("Something something, 2h GUI")
|
||||
|
||||
def respawn(self, avoid=None):
|
||||
# find spawn point
|
||||
x_max, y_max = g.size
|
||||
spawn_points = []
|
||||
for x in range(x_max):
|
||||
for y in range(y_max):
|
||||
if g.at((x, y)).walkable:
|
||||
spawn_points.append((x, y))
|
||||
random.shuffle(spawn_points)
|
||||
## TODO - find other entities to avoid spawning on top of
|
||||
for spawn in spawn_points:
|
||||
for e in avoid or []:
|
||||
if e.draw_pos == spawn: break
|
||||
else:
|
||||
break
|
||||
self.draw_pos = spawn
|
||||
|
||||
def __repr__(self):
|
||||
return f"<PlayerEntity {self.draw_pos}, {self.grid}>"
|
||||
|
||||
|
||||
class BoulderEntity(COSEntity):
|
||||
def __init__(self, x, y, *, game):
|
||||
self.draw_order = 8
|
||||
super().__init__(game.grid, x, y, 66, game=game)
|
||||
|
||||
def bump(self, other, dx, dy, test=False):
|
||||
if type(other) == BoulderEntity:
|
||||
#print("Boulders can't push boulders")
|
||||
return False
|
||||
elif type(other) == EnemyEntity:
|
||||
if not other.can_push: return False
|
||||
#tx, ty = int(self.e.position[0] + dx), int(self.e.position[1] + dy)
|
||||
tx, ty = int(self.draw_pos[0] + dx), int(self.draw_pos[1] + dy)
|
||||
# Is the boulder blocked the same direction as the bumper? If not, let's both move
|
||||
old_pos = int(self.draw_pos[0]), int(self.draw_pos[1])
|
||||
if self.try_move(dx, dy, test=test):
|
||||
if not test:
|
||||
other.do_move(*old_pos)
|
||||
#other.draw_pos = old_pos
|
||||
return True
|
||||
|
||||
class ButtonEntity(COSEntity):
|
||||
def __init__(self, x, y, exit_entity, *, game):
|
||||
self.draw_order = 1
|
||||
super().__init__(game.grid, x, y, 250, game=game)
|
||||
self.exit = exit_entity
|
||||
|
||||
def ev_enter(self, other):
|
||||
print("Button makes a satisfying click!")
|
||||
self.exit.unlock()
|
||||
|
||||
def ev_exit(self, other):
|
||||
print("Button makes a disappointing click.")
|
||||
self.exit.lock()
|
||||
|
||||
def bump(self, other, dx, dy, test=False):
|
||||
#if type(other) == BoulderEntity:
|
||||
# self.exit.unlock()
|
||||
# TODO: unlock, and then lock again, when player steps on/off
|
||||
if not test:
|
||||
pos = int(self.draw_pos[0]), int(self.draw_pos[1])
|
||||
other.do_move(*pos)
|
||||
return True
|
||||
|
||||
class ExitEntity(COSEntity):
|
||||
def __init__(self, x, y, bx, by, *, game):
|
||||
self.draw_order = 2
|
||||
super().__init__(game.grid, x, y, 45, game=game)
|
||||
self.my_button = ButtonEntity(bx, by, self, game=game)
|
||||
self.unlocked = False
|
||||
#global cos_entities
|
||||
#cos_entities.append(self.my_button)
|
||||
|
||||
def unlock(self):
|
||||
self.sprite_number = 21
|
||||
self.unlocked = True
|
||||
|
||||
def lock(self):
|
||||
self.sprite_number = 45
|
||||
self.unlocked = False
|
||||
|
||||
def bump(self, other, dx, dy, test=False):
|
||||
if type(other) == BoulderEntity:
|
||||
return False
|
||||
if self.unlocked:
|
||||
if not test:
|
||||
other._relative_move(dx, dy)
|
||||
#TODO - player go down a level logic
|
||||
if type(other) == PlayerEntity:
|
||||
self.game.depth += 1
|
||||
#print(f"welcome to level {self.game.depth}")
|
||||
self.game.create_level(self.game.depth)
|
||||
self.game.swap_level(self.game.level, self.game.spawn_point)
|
||||
|
||||
class EnemyEntity(COSEntity):
|
||||
def __init__(self, x, y, hp=2, base_damage=1, base_defense=0, sprite=123, can_push=False, crushable=True, sight=8, move_cooldown=1, *, game):
|
||||
self.draw_order = 7
|
||||
super().__init__(game.grid, x, y, sprite, game=game)
|
||||
self.hp = hp
|
||||
self.base_damage = base_damage
|
||||
self.base_defense = base_defense
|
||||
self.base_sprite = sprite
|
||||
self.can_push = can_push
|
||||
self.crushable = crushable
|
||||
self.sight = sight
|
||||
self.move_cooldown = move_cooldown
|
||||
self.moved_last = 0
|
||||
|
||||
def bump(self, other, dx, dy, test=False):
|
||||
if self.hp == 0:
|
||||
if not test:
|
||||
old_pos = int(self.draw_pos[0]), int(self.draw_pos[1])
|
||||
other.do_move(*old_pos)
|
||||
return True
|
||||
if type(other) == PlayerEntity:
|
||||
# TODO - get damage from player, take damage, decide to die or not
|
||||
d = other.calc_damage()
|
||||
self.hp -= d
|
||||
self.hp = max(self.hp, 0)
|
||||
if self.hp == 0:
|
||||
self._entity.sprite_number = self.base_sprite + 246
|
||||
self.draw_order = 1
|
||||
print(f"Player hit for {d}. HP = {self.hp}")
|
||||
#self.hp = 0
|
||||
return False
|
||||
elif type(other) == BoulderEntity:
|
||||
if not self.crushable and self.hp > 0:
|
||||
print("Uncrushable!")
|
||||
return False
|
||||
if self.hp > 0:
|
||||
print("Ouch, my entire body!!")
|
||||
self._entity.sprite_number = self.base_sprite + 246
|
||||
self.hp = 0
|
||||
old_pos = int(self.draw_pos[0]), int(self.draw_pos[1])
|
||||
if not test:
|
||||
other.do_move(*old_pos)
|
||||
return True
|
||||
|
||||
def act(self):
|
||||
if self.hp > 0:
|
||||
# if player nearby: attack
|
||||
x, y = self.draw_pos
|
||||
px, py = self.game.player.draw_pos
|
||||
for d in ((1, 0), (0, 1), (-1, 0), (1, 0)):
|
||||
if int(x + d[0]) == int(px) and int(y + d[1]) == int(py):
|
||||
self.try_move(*d)
|
||||
return
|
||||
|
||||
# slow movement (doesn't affect ability to attack)
|
||||
if self.moved_last > 0:
|
||||
self.moved_last -= 1
|
||||
#print(f"Deducting move cooldown, now {self.moved_last} / {self.move_cooldown}")
|
||||
return
|
||||
else:
|
||||
#print(f"Restaring move cooldown - {self.move_cooldown}")
|
||||
self.moved_last = self.move_cooldown
|
||||
|
||||
# if player is not nearby, wander
|
||||
if abs(x - px) + abs(y - py) > self.sight:
|
||||
d = random.choice(((1, 0), (0, 1), (-1, 0), (1, 0)))
|
||||
self.try_move(*d)
|
||||
|
||||
# if can_push and player in a line: KICK
|
||||
if self.can_push:
|
||||
if int(x) == int(px):# vertical kick
|
||||
self.try_move(0, 1 if y < py else -1)
|
||||
elif int(y) == int(py):# horizontal kick
|
||||
self.try_move(1 if x < px else -1, 0)
|
||||
|
||||
# else, nearby pursue
|
||||
towards = []
|
||||
dist = lambda dx, dy: abs(px - (x + dx)) + abs(py - (y + dy))
|
||||
#current_dist = dist(0, 0)
|
||||
#for d in ((1, 0), (0, 1), (-1, 0), (1, 0)):
|
||||
# if dist(*d) <= current_dist + 0.75: towards.append(d)
|
||||
#print(current_dist, towards)
|
||||
if px >= x:
|
||||
towards.append((1, 0))
|
||||
if px <= x:
|
||||
towards.append((-1, 0))
|
||||
if py >= y:
|
||||
towards.append((0, 1))
|
||||
if py <= y:
|
||||
towards.append((0, -1))
|
||||
towards = [p for p in towards if self.game.grid.at((int(x + p[0]), int(y + p[1]))).walkable]
|
||||
towards.sort(key = lambda p: dist(*p))
|
||||
target_dir = towards[0]
|
||||
self.try_move(*target_dir)
|
||||
|
||||
def get_zapped(self, d):
|
||||
self.hp -= d
|
||||
self.hp = max(self.hp, 0)
|
||||
if self.hp == 0:
|
||||
self._entity.sprite_number = self.base_sprite + 246
|
||||
self.draw_order = 1
|
||||
print(f"Player zapped for {d}. HP = {self.hp}")
|
||||
|
||||
|
||||
class TreasureEntity(COSEntity):
|
||||
def __init__(self, x, y, treasure_table=None, *, game):
|
||||
self.draw_order = 6
|
||||
super().__init__(game.grid, x, y, 89, game=game)
|
||||
self.popped = False
|
||||
self.treasure_table = treasure_table
|
||||
|
||||
def generate(self):
|
||||
items = list(self.treasure_table.keys())
|
||||
weights = [self.treasure_table[k] for k in items]
|
||||
item = random.choices(items, weights=weights)[0]
|
||||
bonus_stats_max = (self.game.depth + (self.game.player.luck*2)) * 0.66
|
||||
bonus_stats = random.randint(0, int(bonus_stats_max))
|
||||
bonus_colors = {1: (192, 255, 192), 2: (128, 128, 192), 3: (255, 192, 255),
|
||||
4: (255, 192, 192), 5: (255, 0, 0)}
|
||||
|
||||
data = itemdata[item]
|
||||
if item in ("sword", "sword2", "sword3", "axe", "axe2", "axe3"):
|
||||
equip = Equippable(hands=data.handedness, sprite=data.sprite, damage=data.base_value+bonus_stats, text=data.base_name)
|
||||
elif item in ("buckler", "shield"):
|
||||
equip = Equippable(hands=data.handedness, sprite=data.sprite, defense=data.base_value+bonus_stats, text=data.base_name)
|
||||
elif item in ("wand", "staff", "staff2"):
|
||||
equip = Equippable(hands=data.handedness, sprite=data.sprite, zap_damage=data.base_value[0], zap_cooldown=data.base_value[1], text=data.base_name)
|
||||
if bonus_stats:
|
||||
b = bonus_stats
|
||||
while b: # split bonus between damage and faster cooldown
|
||||
if equip.zap_cooldown == 2 or random.random() > 0.66:
|
||||
equip.zap_damage += 1
|
||||
else:
|
||||
equip.zap_cooldown -= 1
|
||||
b -= 1
|
||||
elif item == "red_pot":
|
||||
equip = Equippable(hands=data.handedness, sprite=data.sprite, hp_healing=data.base_value+bonus_stats, text=data.base_name)
|
||||
elif item in ("blue_pot", "green_pot", "grey_pot", "sm_grey_pot"):
|
||||
print(f"Permanent stat boost ({item})")
|
||||
equip = Equippable(hands=data.handedness, sprite=data.sprite, text=data.base_name, boost=item, value=data.base_value + bonus_stats)
|
||||
else:
|
||||
print(f"Unfound item: {item}")
|
||||
equip = Equippable()
|
||||
|
||||
if bonus_stats:
|
||||
equip.text = equip.text + f" (+{bonus_stats})"
|
||||
equip.text_color = bonus_colors[bonus_stats if bonus_stats <=5 else 5]
|
||||
return equip
|
||||
|
||||
def bump(self, other, dx, dy, test=False):
|
||||
if type(other) != PlayerEntity:
|
||||
return False
|
||||
if self.popped:
|
||||
print("It's already open.")
|
||||
return True
|
||||
print("Take me, I'm yours!")
|
||||
self._entity.sprite_number = 91
|
||||
self.popped = True
|
||||
#print(self.treasure_table)
|
||||
other.receive(self.generate())
|
||||
return False
|
|
@ -1,62 +0,0 @@
|
|||
from dataclasses import dataclass
|
||||
|
||||
@dataclass
|
||||
class ItemData:
|
||||
min_lv: int
|
||||
max_lv: int
|
||||
base_wt: float
|
||||
sprite: int
|
||||
base_value: int
|
||||
base_name: str
|
||||
affinity: str # player archetype that makes it more common
|
||||
handedness: int
|
||||
|
||||
itemdata = {
|
||||
"buckler": ItemData(min_lv = 1, max_lv = 10, base_wt = 0.25, sprite=101, base_value=1,
|
||||
base_name="Buckler", affinity="knight", handedness=1),
|
||||
|
||||
"shield": ItemData(min_lv = 2, max_lv = 99, base_wt = 0.15, sprite=102, base_value=2,
|
||||
base_name="Shield", affinity="knight", handedness=1),
|
||||
|
||||
"sword": ItemData(min_lv = 1, max_lv = 10, base_wt = 0.25, sprite=103, base_value=1,
|
||||
base_name="Shortsword", affinity="knight", handedness=1),
|
||||
|
||||
"sword2": ItemData(min_lv = 2, max_lv = 16, base_wt = 0.15, sprite=104, base_value=2,
|
||||
base_name="Longsword", affinity="knight", handedness=1),
|
||||
|
||||
"sword3": ItemData(min_lv = 5, max_lv = 99, base_wt = 0.08, sprite=105, base_value=5,
|
||||
base_name="Claymore", affinity="knight", handedness=2),
|
||||
|
||||
"axe": ItemData(min_lv = 1, max_lv = 10, base_wt = 0.25, sprite=119, base_value=1,
|
||||
base_name="Hatchet", affinity="viking", handedness=1),
|
||||
|
||||
"axe2": ItemData(min_lv = 2, max_lv = 16, base_wt = 0.15, sprite=120, base_value=4,
|
||||
base_name="Broad Axe", affinity="viking", handedness=2),
|
||||
|
||||
"axe3": ItemData(min_lv = 5, max_lv = 99, base_wt = 0.08, sprite=121, base_value=6,
|
||||
base_name="Bearded Axe", affinity="viking", handedness=2),
|
||||
|
||||
"wand": ItemData(min_lv = 1, max_lv = 10, base_wt = 0.25, sprite=132, base_value=(1, 10),
|
||||
base_name="Wand", affinity="wizard", handedness=1),
|
||||
|
||||
"staff": ItemData(min_lv = 2, max_lv = 16, base_wt = 0.15, sprite=130, base_value=(2, 8),
|
||||
base_name="Sceptre", affinity="wizard", handedness=2),
|
||||
|
||||
"staff2": ItemData(min_lv = 5, max_lv = 99, base_wt = 0.08, sprite=131, base_value=(3, 7),
|
||||
base_name="Wizard's Staff", affinity="wizard", handedness=2),
|
||||
|
||||
"red_pot": ItemData(min_lv = 1, max_lv = 99, base_wt = 0.25, sprite=115, base_value=1,
|
||||
base_name="Health Potion", affinity=None, handedness=0),
|
||||
|
||||
"blue_pot": ItemData(min_lv = 1, max_lv = 99, base_wt = 0.10, sprite=116, base_value=1,
|
||||
base_name="Sorcery Potion", affinity="wizard", handedness=0),
|
||||
|
||||
"green_pot": ItemData(min_lv = 1, max_lv = 99, base_wt = 0.10, sprite=114, base_value=1,
|
||||
base_name="Strength Potion", affinity="viking", handedness=0),
|
||||
|
||||
"grey_pot": ItemData(min_lv = 1, max_lv = 99, base_wt = 0.10, sprite=113, base_value=1,
|
||||
base_name="Defense Potion", affinity="knight", handedness=0),
|
||||
|
||||
"sm_grey_pot": ItemData(min_lv = 1, max_lv = 99, base_wt = 0.05, sprite=125, base_value=1,
|
||||
base_name="Luck Potion", affinity=None, handedness=0),
|
||||
}
|
|
@ -1,292 +0,0 @@
|
|||
import random
|
||||
import mcrfpy
|
||||
import cos_tiles as ct
|
||||
|
||||
t = mcrfpy.Texture("assets/kenney_TD_MR_IP.png", 16, 16)
|
||||
|
||||
def binary_space_partition(x, y, w, h):
|
||||
d = random.choices(["vert", "horiz"], weights=[w/(w+h), h/(w+h)])[0]
|
||||
split = random.randint(30, 70) / 100.0
|
||||
if d == "vert":
|
||||
coord = int(w * split)
|
||||
return (x, y, coord, h), (x+coord, y, w-coord, h)
|
||||
else: # horizontal
|
||||
coord = int(h * split)
|
||||
return (x, y, w, coord), (x, y+coord, w, h-coord)
|
||||
|
||||
room_area = lambda x, y, w, h: w * h
|
||||
|
||||
class BinaryRoomNode:
|
||||
def __init__(self, xywh):
|
||||
self.data = xywh
|
||||
self.left = None
|
||||
self.right = None
|
||||
|
||||
def __repr__(self):
|
||||
return f"<RoomNode {self.data}>"
|
||||
|
||||
def center(self):
|
||||
x, y, w, h = self.data
|
||||
return (x + w // 2, y + h // 2)
|
||||
|
||||
def split(self):
|
||||
new_data = binary_space_partition(*self.data)
|
||||
self.left = BinaryRoomNode(new_data[0])
|
||||
self.right = BinaryRoomNode(new_data[1])
|
||||
|
||||
def walk(self):
|
||||
if self.left and self.right:
|
||||
return self.left.walk() + self.right.walk()
|
||||
return [self]
|
||||
|
||||
def contains(self, pt):
|
||||
x, y, w, h = self.data
|
||||
tx, ty = pt
|
||||
return x <= tx <= x + w and y <= ty <= y + h
|
||||
|
||||
class RoomGraph:
|
||||
def __init__(self, xywh):
|
||||
self.root = BinaryRoomNode(xywh)
|
||||
|
||||
def __repr__(self):
|
||||
return f"<RoomGraph, root={self.root}, {len(self.walk())} rooms>"
|
||||
|
||||
def walk(self):
|
||||
w = self.root.walk() if self.root else []
|
||||
#print(w)
|
||||
return w
|
||||
|
||||
def room_coord(room, margin=0):
|
||||
x, y, w, h = room.data
|
||||
#print(x,y,w,h, f'{margin=}', end=';')
|
||||
w -= 1
|
||||
h -= 1
|
||||
margin += 1
|
||||
x += margin
|
||||
y += margin
|
||||
w -= margin
|
||||
h -= margin
|
||||
if w < 0: w = 0
|
||||
if h < 0: h = 0
|
||||
#print(x,y,w,h, end=' -> ')
|
||||
tx = x if w==0 else random.randint(x, x+w)
|
||||
ty = y if h==0 else random.randint(y, y+h)
|
||||
#print((tx, ty))
|
||||
return (tx, ty)
|
||||
|
||||
def adjacent_rooms(r, rooms):
|
||||
x, y, w, h = r.data
|
||||
adjacents = {}
|
||||
|
||||
for i, other_r in enumerate(rooms):
|
||||
rx, ry, rw, rh = other_r.data
|
||||
if (rx, ry, rw, rh) == r:
|
||||
continue # Skip self
|
||||
|
||||
# Check vertical adjacency (above or below)
|
||||
if rx < x + w and x < rx + rw: # Overlapping width
|
||||
if ry + rh == y: # Above
|
||||
adjacents[i] = (x + w // 2, y - 1)
|
||||
elif y + h == ry: # Below
|
||||
adjacents[i] = (x + w // 2, y + h + 1)
|
||||
|
||||
# Check horizontal adjacency (left or right)
|
||||
if ry < y + h and y < ry + rh: # Overlapping height
|
||||
if rx + rw == x: # Left
|
||||
adjacents[i] = (x - 1, y + h // 2)
|
||||
elif x + w == rx: # Right
|
||||
adjacents[i] = (x + w + 1, y + h // 2)
|
||||
|
||||
return adjacents
|
||||
|
||||
class Level:
|
||||
def __init__(self, width, height):
|
||||
self.width = width
|
||||
self.height = height
|
||||
#self.graph = [(0, 0, width, height)]
|
||||
self.graph = RoomGraph( (0, 0, width, height) )
|
||||
self.grid = mcrfpy.Grid(width, height, t, (10, 5), (1014, 700))
|
||||
self.highlighted = -1 #debug view feature
|
||||
self.walled_rooms = [] # for tracking "hallway rooms" vs "walled rooms"
|
||||
|
||||
def fill(self, xywh, highlight = False):
|
||||
if highlight:
|
||||
ts = 0
|
||||
else:
|
||||
ts = room_area(*xywh) % 131
|
||||
X, Y, W, H = xywh
|
||||
for x in range(X, X+W):
|
||||
for y in range(Y, Y+H):
|
||||
self.grid.at((x, y)).tilesprite = ts
|
||||
|
||||
def highlight(self, delta):
|
||||
rooms = self.graph.walk()
|
||||
if self.highlighted < len(rooms):
|
||||
#print(f"reset {self.highlighted}")
|
||||
self.fill(rooms[self.highlighted].data) # reset
|
||||
self.highlighted += delta
|
||||
print(f"highlight {self.highlighted}")
|
||||
self.highlighted = self.highlighted % len(rooms)
|
||||
self.fill(rooms[self.highlighted].data, highlight = True)
|
||||
|
||||
def reset(self):
|
||||
self.graph = RoomGraph( (0, 0, self.width, self.height) )
|
||||
for x in range(self.width):
|
||||
for y in range(self.height):
|
||||
self.grid.at((x, y)).walkable = True
|
||||
self.grid.at((x, y)).transparent = True
|
||||
self.grid.at((x, y)).tilesprite = 0 #random.choice([40, 28])
|
||||
|
||||
def split(self, single=False):
|
||||
if single:
|
||||
areas = {g.data: room_area(*g.data) for g in self.graph.walk()}
|
||||
largest = sorted(self.graph.walk(), key=lambda g: areas[g.data])[-1]
|
||||
largest.split()
|
||||
else:
|
||||
for room in self.graph.walk(): room.split()
|
||||
self.fill_rooms()
|
||||
|
||||
def fill_rooms(self, features=None):
|
||||
rooms = self.graph.walk()
|
||||
#print(f"rooms: {len(rooms)}")
|
||||
for i, g in enumerate(rooms):
|
||||
X, Y, W, H = g.data
|
||||
#c = [random.randint(0, 255) for _ in range(3)]
|
||||
ts = room_area(*g.data) % 131 + i # modulo - consistent tile pick
|
||||
for x in range(X, X+W):
|
||||
for y in range(Y, Y+H):
|
||||
self.grid.at((x, y)).tilesprite = ts
|
||||
|
||||
def wall_rooms(self):
|
||||
self.walled_rooms = []
|
||||
rooms = self.graph.walk()
|
||||
for i, g in enumerate(rooms):
|
||||
# unwalled / hallways: not selected for small dungeons, first, last, and 65% of all other rooms
|
||||
if len(rooms) > 3 and i > 1 and i < len(rooms) - 2 and random.random() < 0.35:
|
||||
self.walled_rooms.append(False)
|
||||
continue
|
||||
self.walled_rooms.append(True)
|
||||
X, Y, W, H = g.data
|
||||
for x in range(X, X+W):
|
||||
self.grid.at((x, Y)).walkable = False
|
||||
#self.grid.at((x, Y+H-1)).walkable = False
|
||||
for y in range(Y, Y+H):
|
||||
self.grid.at((X, y)).walkable = False
|
||||
#self.grid.at((X+W-1, y)).walkable = False
|
||||
# boundary of entire level
|
||||
for x in range(0, self.width):
|
||||
# self.grid.at((x, 0)).walkable = False
|
||||
self.grid.at((x, self.height-1)).walkable = False
|
||||
for y in range(0, self.height):
|
||||
# self.grid.at((0, y)).walkable = False
|
||||
self.grid.at((self.width-1, y)).walkable = False
|
||||
|
||||
def dig_path(self, start:"Tuple[int, int]", end:"Tuple[int, int]", walkable=True, color=None, sprite=None):
|
||||
print(f"Digging: {start} -> {end}")
|
||||
# get x1,y1 and x2,y2 coordinates: top left and bottom right points on the rect formed by two random points, one from each of the 2 rooms
|
||||
x1 = min([start[0], end[0]])
|
||||
x2 = max([start[0], end[0]])
|
||||
dw = x2 - x1
|
||||
y1 = min([start[1], end[1]])
|
||||
y2 = max([start[1], end[1]])
|
||||
dh = y2 - y1
|
||||
|
||||
# random: top left or bottom right as the corner between the paths
|
||||
tx, ty = (x1, y1) if random.random() >= 0.5 else (x2, y2)
|
||||
|
||||
for x in range(x1, x1+dw):
|
||||
try:
|
||||
if walkable:
|
||||
self.grid.at((x, ty)).walkable = walkable
|
||||
if color:
|
||||
self.grid.at((x, ty)).color = color
|
||||
if sprite is not None:
|
||||
self.grid.at((x, ty)).tilesprite = sprite
|
||||
except:
|
||||
pass
|
||||
for y in range(y1, y1+dh):
|
||||
try:
|
||||
if walkable:
|
||||
self.grid.at((tx, y)).walkable = True
|
||||
if color:
|
||||
self.grid.at((tx, y)).color = color
|
||||
if sprite is not None:
|
||||
self.grid.at((tx, y)).tilesprite = sprite
|
||||
except:
|
||||
pass
|
||||
|
||||
def generate(self, level_plan): #target_rooms = 5, features=None):
|
||||
self.reset()
|
||||
target_rooms = len(level_plan)
|
||||
if type(level_plan) is set:
|
||||
level_plan = random.choice(list(level_plan))
|
||||
while len(self.graph.walk()) < target_rooms:
|
||||
self.split(single=len(self.graph.walk()) > target_rooms * .5)
|
||||
|
||||
# Player path planning
|
||||
#self.fill_rooms()
|
||||
self.wall_rooms()
|
||||
rooms = self.graph.walk()
|
||||
feature_coords = []
|
||||
prev_room = None
|
||||
print(level_plan)
|
||||
for room_num, room in enumerate(rooms):
|
||||
room_plan = level_plan[room_num]
|
||||
if type(room_plan) == str: room_plan = [room_plan] # single item plans became single-character plans...
|
||||
for f in room_plan:
|
||||
#feature_coords.append((f, room_coord(room, margin=4 if f in ("boulder",) else 1)))
|
||||
# boulders are breaking my brain. If I can't get boulders away from walls with margin, I'm just going to dig them out.
|
||||
#if f == "boulder":
|
||||
# x, y = room_coord(room, margin=0)
|
||||
# if x < 2: x += 1
|
||||
# if y < 2: y += 1
|
||||
# if x > self.grid.grid_size[0] - 2: x -= 1
|
||||
# if y > self.grid.grid_size[1] - 2: y -= 1
|
||||
# for _x in (1, 0, -1):
|
||||
# for _y in (1, 0, -1):
|
||||
# self.grid.at((x + _x, y + _y)).walkable = True
|
||||
# feature_coords.append((f, (x, y)))
|
||||
#else:
|
||||
# feature_coords.append((f, room_coord(room, margin=0)))
|
||||
fcoord = None
|
||||
while not fcoord:
|
||||
fc = room_coord(room, margin=0)
|
||||
if not self.grid.at(fc).walkable: continue
|
||||
if fc in [_i[1] for _i in feature_coords]: continue
|
||||
fcoord = fc
|
||||
feature_coords.append((f, fcoord))
|
||||
print(feature_coords[-1])
|
||||
|
||||
## Hallway generation
|
||||
# plow an inelegant path
|
||||
if prev_room:
|
||||
start = room_coord(prev_room, margin=2)
|
||||
end = room_coord(room, margin=2)
|
||||
self.dig_path(start, end, color=(0, 64, 0))
|
||||
prev_room = room
|
||||
|
||||
# Tile painting
|
||||
possibilities = None
|
||||
while possibilities or possibilities is None:
|
||||
possibilities = ct.wfc_pass(self.grid, possibilities)
|
||||
|
||||
## "hallway room" repainting
|
||||
#for i, hall_room in enumerate(rooms):
|
||||
# if self.walled_rooms[i]:
|
||||
# print(f"walled room: {hall_room}")
|
||||
# continue
|
||||
# print(f"hall room: {hall_room}")
|
||||
# x, y, w, h = hall_room.data
|
||||
# for _x in range(x+1, x+w-1):
|
||||
# for _y in range(y+1, y+h-1):
|
||||
# self.grid.at((_x, _y)).walkable = False
|
||||
# self.grid.at((_x, _y)).tilesprite = -1
|
||||
# self.grid.at((_x, _y)).color = (0, 0, 0) # pit!
|
||||
# targets = adjacent_rooms(hall_room, rooms)
|
||||
# print(targets)
|
||||
# for k, v in targets.items():
|
||||
# self.dig_path(hall_room.center(), v, color=(64, 32, 32))
|
||||
# for _, p in feature_coords:
|
||||
# if hall_room.contains(p): self.dig_path(hall_room.center(), p, color=(92, 48, 48))
|
||||
|
||||
return feature_coords
|
|
@ -0,0 +1,300 @@
|
|||
import mcrfpy
|
||||
mcrfpy.createScene("play")
|
||||
ui = mcrfpy.sceneUI("play")
|
||||
t = mcrfpy.Texture("assets/kenney_tinydungeon.png", 16, 16) # 12, 11)
|
||||
font = mcrfpy.Font("assets/JetbrainsMono.ttf")
|
||||
|
||||
frame_color = (64, 64, 128)
|
||||
|
||||
grid = mcrfpy.Grid(20, 15, t, 10, 10, 800, 595)
|
||||
grid.zoom = 2.0
|
||||
entity_frame = mcrfpy.Frame(815, 10, 194, 595, fill_color = frame_color)
|
||||
inventory_frame = mcrfpy.Frame(10, 610, 800, 143, fill_color = frame_color)
|
||||
stats_frame = mcrfpy.Frame(815, 610, 194, 143, fill_color = frame_color)
|
||||
|
||||
begin_btn = mcrfpy.Frame(350,250,100,100, fill_color = (255,0,0))
|
||||
begin_btn.children.append(mcrfpy.Caption(5, 5, "Begin", font))
|
||||
def cos_keys(key, state):
|
||||
if key == 'M' and state == 'start':
|
||||
mapgen()
|
||||
elif state == "end": return
|
||||
elif key == "W":
|
||||
player.move("N")
|
||||
elif key == "A":
|
||||
player.move("W")
|
||||
elif key == "S":
|
||||
player.move("S")
|
||||
elif key == "D":
|
||||
player.move("E")
|
||||
|
||||
|
||||
def cos_init(*args):
|
||||
if args[3] != "start": return
|
||||
mcrfpy.keypressScene(cos_keys)
|
||||
ui.remove(4)
|
||||
|
||||
begin_btn.click = cos_init
|
||||
|
||||
[ui.append(e) for e in (grid, entity_frame, inventory_frame, stats_frame, begin_btn)]
|
||||
|
||||
import random
|
||||
def rcolor():
|
||||
return tuple([random.randint(0, 255) for i in range(3)]) # TODO list won't work with GridPoint.color, so had to cast to tuple
|
||||
|
||||
x_max, y_max = grid.grid_size
|
||||
for x in range(x_max):
|
||||
for y in range(y_max):
|
||||
grid.at((x,y)).color = rcolor()
|
||||
|
||||
from math import pi, cos, sin
|
||||
def mapgen(room_size_max = 7, room_size_min = 3, room_count = 4):
|
||||
# reset map
|
||||
for x in range(x_max):
|
||||
for y in range(y_max):
|
||||
grid.at((x, y)).walkable = False
|
||||
grid.at((x, y)).transparent= False
|
||||
grid.at((x,y)).tilesprite = random.choices([40, 28], weights=[.8, .2])[0]
|
||||
global cos_entities
|
||||
for e in cos_entities:
|
||||
e.e.position = (999,999) # TODO
|
||||
e.die()
|
||||
cos_entities = []
|
||||
|
||||
#Dungeon generation
|
||||
centers = []
|
||||
attempts = 0
|
||||
while len(centers) < room_count:
|
||||
# Leaving this attempt here for later comparison. These rooms sucked.
|
||||
# overlapping, uninteresting hallways, crowded into the corners sometimes, etc.
|
||||
attempts += 1
|
||||
if attempts > room_count * 15: break
|
||||
# room_left = random.randint(1, x_max)
|
||||
# room_top = random.randint(1, y_max)
|
||||
|
||||
# Take 2 - circular distribution of rooms
|
||||
angle_mid = (len(centers) / room_count) * 2 * pi + 0.785
|
||||
angle = random.uniform(angle_mid - 0.25, angle_mid + 0.25)
|
||||
radius = random.uniform(3, 14)
|
||||
room_left = int(radius * cos(angle)) + int(x_max/2)
|
||||
if room_left <= 1: room_left = 1
|
||||
if room_left > x_max - 1: room_left = x_max - 2
|
||||
room_top = int(radius * sin(angle)) + int(y_max/2)
|
||||
if room_top <= 1: room_top = 1
|
||||
if room_top > y_max - 1: room_top = y_max - 2
|
||||
room_w = random.randint(room_size_min, room_size_max)
|
||||
if room_w + room_left >= x_max: room_w = x_max - room_left - 2
|
||||
room_h = random.randint(room_size_min, room_size_max)
|
||||
if room_h + room_top >= y_max: room_h = y_max - room_top - 2
|
||||
#print(room_left, room_top, room_left + room_w, room_top + room_h)
|
||||
if any( # centers contained in this randomly generated room
|
||||
[c[0] >= room_left and c[0] <= room_left + room_w and c[1] >= room_top and c[1] <= room_top + room_h for c in centers]
|
||||
):
|
||||
continue # re-randomize the room position
|
||||
centers.append(
|
||||
(int(room_left + (room_w/2)), int(room_top + (room_h/2)))
|
||||
)
|
||||
|
||||
for x in range(room_w):
|
||||
for y in range(room_h):
|
||||
grid.at((room_left+x, room_top+y)).walkable=True
|
||||
grid.at((room_left+x, room_top+y)).transparent=True
|
||||
grid.at((room_left+x, room_top+y)).tilesprite = random.choice([48, 49, 50, 51, 52, 53])
|
||||
|
||||
# generate a boulder
|
||||
if (room_w > 2 and room_h > 2):
|
||||
room_boulder_x, room_boulder_y = random.randint(room_left+1, room_left+room_w-1), random.randint(room_top+1, room_top+room_h-1)
|
||||
cos_entities.append(BoulderEntity(room_boulder_x, room_boulder_y))
|
||||
|
||||
print(f"{room_count} rooms generated after {attempts} attempts.")
|
||||
#print(centers)
|
||||
# hallways
|
||||
pairs = []
|
||||
for c1 in centers:
|
||||
for c2 in centers:
|
||||
if c1 == c2: continue
|
||||
if (c2, c1) in pairs or (c1, c2) in pairs: continue
|
||||
left = min(c1[0], c2[0])
|
||||
right = max(c1[0], c2[0])
|
||||
top = min(c1[1], c2[1])
|
||||
bottom = max(c1[1], c2[1])
|
||||
|
||||
corners = [(left, top), (left, bottom), (right, top), (right, bottom)]
|
||||
corners.remove(c1)
|
||||
corners.remove(c2)
|
||||
random.shuffle(corners)
|
||||
target, other = corners
|
||||
for x in range(target[0], other[0], -1 if target[0] > other[0] else 1):
|
||||
was_walkable = grid.at((x, target[1])).walkable
|
||||
grid.at((x, target[1])).walkable=True
|
||||
grid.at((x, target[1])).transparent=True
|
||||
if not was_walkable:
|
||||
grid.at((x, target[1])).tilesprite = random.choices([0, 12, 24], weights=[.6, .3, .1])[0]
|
||||
for y in range(target[1], other[1], -1 if target[1] > other[1] else 1):
|
||||
was_walkable = grid.at((target[0], y)).walkable
|
||||
grid.at((target[0], y)).walkable=True
|
||||
grid.at((target[0], y)).transparent=True
|
||||
if not was_walkable:
|
||||
grid.at((target[0], y)).tilesprite = random.choices([0, 12, 24], weights=[0.4, 0.3, 0.3])[0]
|
||||
pairs.append((c1, c2))
|
||||
|
||||
|
||||
# spawn exit and button
|
||||
spawn_points = []
|
||||
for x in range(x_max):
|
||||
for y in range(y_max):
|
||||
if grid.at((x, y)).walkable:
|
||||
spawn_points.append((x, y))
|
||||
random.shuffle(spawn_points)
|
||||
door_spawn, button_spawn = spawn_points[:2]
|
||||
cos_entities.append(ExitEntity(*door_spawn, *button_spawn))
|
||||
|
||||
# respawn player
|
||||
global player
|
||||
if player:
|
||||
player.position = (999,999) # TODO - die() is broken and I don't know why
|
||||
player = PlayerEntity()
|
||||
|
||||
|
||||
#for x in range(x_max):
|
||||
# for y in range(y_max):
|
||||
# if grid.at((x, y)).walkable:
|
||||
# #grid.at((x,y)).tilesprite = random.choice([48, 49, 50, 51, 52, 53])
|
||||
# pass
|
||||
# else:
|
||||
# #grid.at((x,y)).tilesprite = random.choices([40, 28], weights=[.8, .2])[0]
|
||||
|
||||
#131 - last sprite
|
||||
#123, 124 - brown, grey rats
|
||||
#121 - ghost
|
||||
#114, 115, 116 - green, red, blue potion
|
||||
#102 - shield
|
||||
#98 - low armor guy, #97 - high armor guy
|
||||
#89 - chest, #91 - empty chest
|
||||
#84 - wizard
|
||||
#82 - barrel
|
||||
#66 - boulder
|
||||
#64, 65 - graves
|
||||
#48 - 53: ground (not going to figure out how they fit together tonight)
|
||||
#42 - button-looking ground
|
||||
#40 - basic solid wall
|
||||
#36, 37, 38 - wall (left, middle, right)
|
||||
#28 solid wall but with a grate
|
||||
#21 - wide open door, 33 medium open, 45 closed door
|
||||
#0 - basic dirt
|
||||
class MyEntity:
|
||||
def __init__(self, x=0, y=0, sprite_num=86):
|
||||
self.e = mcrfpy.Entity(x, y, t, sprite_num)
|
||||
grid.entities.append(self.e)
|
||||
def die(self):
|
||||
for i in range(len(grid.entities)):
|
||||
e = grid.entities[i]
|
||||
if e == self.e:
|
||||
grid.entities.remove(i)
|
||||
break
|
||||
def bump(self, other, dx, dy):
|
||||
raise NotImplementedError
|
||||
|
||||
def try_move(self, dx, dy):
|
||||
tx, ty = int(self.e.position[0] + dx), int(self.e.position[1] + dy)
|
||||
for e in cos_entities:
|
||||
if e.e.position == (tx, ty):
|
||||
#print(f"bumping {e}")
|
||||
return e.bump(self, dx, dy)
|
||||
if tx < 0 or tx >= x_max:
|
||||
#print("out of bounds horizontally")
|
||||
return False
|
||||
if ty < 0 or ty >= y_max:
|
||||
#print("out of bounds vertically")
|
||||
return False
|
||||
if grid.at((tx, ty)).walkable == True:
|
||||
#print("Motion!")
|
||||
self.e.position = (tx, ty)
|
||||
return True
|
||||
else:
|
||||
#print("Bonk")
|
||||
return False
|
||||
|
||||
def _relative_move(self, dx, dy):
|
||||
tx, ty = int(self.e.position[0] + dx), int(self.e.position[1] + dy)
|
||||
self.e.position = (tx, ty)
|
||||
|
||||
|
||||
def move(self, direction):
|
||||
if direction == "N":
|
||||
self.try_move(0, -1)
|
||||
elif direction == "E":
|
||||
self.try_move(1, 0)
|
||||
elif direction == "S":
|
||||
self.try_move(0, 1)
|
||||
elif direction == "W":
|
||||
self.try_move(-1, 0)
|
||||
|
||||
cos_entities = []
|
||||
|
||||
class PlayerEntity(MyEntity):
|
||||
def __init__(self):
|
||||
# find spawn point
|
||||
spawn_points = []
|
||||
for x in range(x_max):
|
||||
for y in range(y_max):
|
||||
if grid.at((x, y)).walkable:
|
||||
spawn_points.append((x, y))
|
||||
random.shuffle(spawn_points)
|
||||
for spawn in spawn_points:
|
||||
for e in cos_entities:
|
||||
if e.e.position == spawn: break
|
||||
else:
|
||||
break
|
||||
|
||||
#print(f"spawn at {spawn}")
|
||||
super().__init__(spawn[0], spawn[1], sprite_num=84)
|
||||
|
||||
class BoulderEntity(MyEntity):
|
||||
def __init__(self, x, y):
|
||||
super().__init__(x, y, 66)
|
||||
|
||||
def bump(self, other, dx, dy):
|
||||
if type(other) == BoulderEntity:
|
||||
#print("Boulders can't push boulders")
|
||||
return False
|
||||
tx, ty = int(self.e.position[0] + dx), int(self.e.position[1] + dy)
|
||||
# Is the boulder blocked the same direction as the bumper? If not, let's both move
|
||||
old_pos = int(self.e.position[0]), int(self.e.position[1])
|
||||
if self.try_move(dx, dy):
|
||||
other.e.position = old_pos
|
||||
return True
|
||||
|
||||
class ButtonEntity(MyEntity):
|
||||
def __init__(self, x, y, exit):
|
||||
super().__init__(x, y, 42)
|
||||
self.exit = exit
|
||||
|
||||
def bump(self, other, dx, dy):
|
||||
if type(other) == BoulderEntity:
|
||||
self.exit.unlock()
|
||||
other._relative_move(dx, dy)
|
||||
return True
|
||||
|
||||
class ExitEntity(MyEntity):
|
||||
def __init__(self, x, y, bx, by):
|
||||
super().__init__(x, y, 45)
|
||||
self.my_button = ButtonEntity(bx, by, self)
|
||||
self.unlocked = False
|
||||
global cos_entities
|
||||
cos_entities.append(self.my_button)
|
||||
|
||||
def unlock(self):
|
||||
self.e.sprite_number = 21
|
||||
self.unlocked = True
|
||||
|
||||
def lock(self):
|
||||
self.e.sprite_number = 45
|
||||
self.unlocked = True
|
||||
|
||||
def bump(self, other, dx, dy):
|
||||
if type(other) == BoulderEntity:
|
||||
return False
|
||||
if self.unlocked:
|
||||
other._relative_move(dx, dy)
|
||||
|
||||
player = None
|
|
@ -1,223 +0,0 @@
|
|||
tiles = {}
|
||||
deltas = [
|
||||
(-1, -1), ( 0, -1), (+1, -1),
|
||||
(-1, 0), ( 0, 0), (+1, 0),
|
||||
(-1, +1), ( 0, +1), (+1, +1)
|
||||
]
|
||||
|
||||
class TileInfo:
|
||||
GROUND, WALL, DONTCARE = True, False, None
|
||||
chars = {
|
||||
"X": WALL,
|
||||
"_": GROUND,
|
||||
"?": DONTCARE
|
||||
}
|
||||
symbols = {v: k for k, v in chars.items()}
|
||||
|
||||
def __init__(self, values:dict):
|
||||
self._values = values
|
||||
self.rules = []
|
||||
self.chance = 1.0
|
||||
|
||||
@staticmethod
|
||||
def from_grid(grid, xy:tuple):
|
||||
values = {}
|
||||
for d in deltas:
|
||||
tx, ty = d[0] + xy[0], d[1] + xy[1]
|
||||
try:
|
||||
values[d] = grid.at((tx, ty)).walkable
|
||||
except ValueError:
|
||||
values[d] = True
|
||||
return TileInfo(values)
|
||||
|
||||
@staticmethod
|
||||
def from_string(s):
|
||||
values = {}
|
||||
for d, c in zip(deltas, s):
|
||||
values[d] = TileInfo.chars[c]
|
||||
return TileInfo(values)
|
||||
|
||||
def __hash__(self):
|
||||
"""for use as a dictionary key"""
|
||||
return hash(tuple(self._values.items()))
|
||||
|
||||
def match(self, other:"TileInfo"):
|
||||
for d, rule in self._values.items():
|
||||
if rule is TileInfo.DONTCARE: continue
|
||||
if other._values[d] is TileInfo.DONTCARE: continue
|
||||
if rule != other._values[d]: return False
|
||||
return True
|
||||
|
||||
def show(self):
|
||||
nine = ['', '', '\n'] * 3
|
||||
for k, end in zip(deltas, nine):
|
||||
c = TileInfo.symbols[self._values[k]]
|
||||
print(c, end=end)
|
||||
|
||||
def __repr__(self):
|
||||
return f"<TileInfo {self._values}>"
|
||||
|
||||
cardinal_directions = {
|
||||
"N": ( 0, -1),
|
||||
"S": ( 0, +1),
|
||||
"E": (-1, 0),
|
||||
"W": (+1, 0)
|
||||
}
|
||||
|
||||
def special_rule_verify(rule, grid, xy, unverified_tiles, pass_unverified=False):
|
||||
cardinal, allowed_tile = rule
|
||||
dxy = cardinal_directions[cardinal.upper()]
|
||||
tx, ty = xy[0] + dxy[0], xy[1] + dxy[1]
|
||||
#print(f"Special rule: {cardinal} {allowed_tile} {type(allowed_tile)} -> ({tx}, {ty}) [{grid.at((tx, ty)).tilesprite}]{'*' if (tx, ty) in unverified_tiles else ''}")
|
||||
if (tx, ty) in unverified_tiles and cardinal in "nsew": return pass_unverified
|
||||
try:
|
||||
return grid.at((tx, ty)).tilesprite == allowed_tile
|
||||
except ValueError:
|
||||
return False
|
||||
|
||||
import random
|
||||
tile_of_last_resort = 431
|
||||
|
||||
def find_possible_tiles(grid, x, y, unverified_tiles=None, pass_unverified=False):
|
||||
ti = TileInfo.from_grid(grid, (x, y))
|
||||
if unverified_tiles is None: unverified_tiles = []
|
||||
matches = [(k, v) for k, v in tiles.items() if k.match(ti)]
|
||||
if not matches:
|
||||
return []
|
||||
possible = []
|
||||
if not any([tileinfo.rules for tileinfo, _ in matches]):
|
||||
# make weighted choice, as the tile does not depend on verification
|
||||
wts = [k.chance for k, v in matches]
|
||||
tileinfo, tile = random.choices(matches, weights=wts)[0]
|
||||
return [tile]
|
||||
|
||||
for tileinfo, tile in matches:
|
||||
if not tileinfo.rules:
|
||||
possible.append(tile)
|
||||
continue
|
||||
for r in tileinfo.rules: #for r in ...: if ... continue == more readable than an "any" 1-liner
|
||||
p = special_rule_verify(r, grid, (x,y),
|
||||
unverified_tiles=unverified_tiles,
|
||||
pass_unverified = pass_unverified
|
||||
)
|
||||
if p:
|
||||
possible.append(tile)
|
||||
continue
|
||||
return list(set(list(possible)))
|
||||
|
||||
def wfc_first_pass(grid):
|
||||
w, h = grid.grid_size
|
||||
possibilities = {}
|
||||
for x in range(0, w):
|
||||
for y in range(0, h):
|
||||
matches = find_possible_tiles(grid, x, y, pass_unverified=True)
|
||||
if len(matches) == 0:
|
||||
grid.at((x, y)).tilesprite = tile_of_last_resort
|
||||
possibilities[(x,y)] = matches
|
||||
elif len(matches) == 1:
|
||||
grid.at((x, y)).tilesprite = matches[0]
|
||||
else:
|
||||
possibilities[(x,y)] = matches
|
||||
return possibilities
|
||||
|
||||
def wfc_pass(grid, possibilities=None):
|
||||
w, h = grid.grid_size
|
||||
if possibilities is None:
|
||||
#print("first pass results:")
|
||||
possibilities = wfc_first_pass(grid)
|
||||
counts = {}
|
||||
for v in possibilities.values():
|
||||
if len(v) in counts: counts[len(v)] += 1
|
||||
else: counts[len(v)] = 1
|
||||
#print(counts)
|
||||
return possibilities
|
||||
elif len(possibilities) == 0:
|
||||
print("We're done!")
|
||||
return
|
||||
old_possibilities = possibilities
|
||||
possibilities = {}
|
||||
for (x, y) in old_possibilities.keys():
|
||||
matches = find_possible_tiles(grid, x, y, unverified_tiles=old_possibilities.keys(), pass_unverified = True)
|
||||
if len(matches) == 0:
|
||||
print((x,y), matches)
|
||||
grid.at((x, y)).tilesprite = tile_of_last_resort
|
||||
possibilities[(x,y)] = matches
|
||||
elif len(matches) == 1:
|
||||
grid.at((x, y)).tilesprite = matches[0]
|
||||
else:
|
||||
grid.at((x, y)).tilesprite = -1
|
||||
grid.at((x, y)).color = (32 * len(matches), 32 * len(matches), 32 * len(matches))
|
||||
possibilities[(x,y)] = matches
|
||||
|
||||
if len(possibilities) == len(old_possibilities):
|
||||
#print("No more tiles could be solved without collapse")
|
||||
counts = {}
|
||||
for v in possibilities.values():
|
||||
if len(v) in counts: counts[len(v)] += 1
|
||||
else: counts[len(v)] = 1
|
||||
#print(counts)
|
||||
if 0 in counts: del counts[0]
|
||||
if len(counts) == 0:
|
||||
print("Contrats! You broke it! (insufficient tile defs to solve remaining tiles)")
|
||||
return []
|
||||
target = min(list(counts.keys()))
|
||||
while possibilities:
|
||||
for (x, y) in possibilities.keys():
|
||||
if len(possibilities[(x, y)]) != target:
|
||||
continue
|
||||
ti = TileInfo.from_grid(grid, (x, y))
|
||||
matches = [(k, v) for k, v in tiles.items() if k.match(ti)]
|
||||
verifiable_matches = find_possible_tiles(grid, x, y, unverified_tiles=possibilities.keys())
|
||||
if not verifiable_matches: continue
|
||||
#print(f"collapsing {(x, y)} ({target} choices)")
|
||||
matches = [(k, v) for k, v in matches if v in verifiable_matches]
|
||||
wts = [k.chance for k, v in matches]
|
||||
tileinfo, tile = random.choices(matches, weights=wts)[0]
|
||||
grid.at((x, y)).tilesprite = tile
|
||||
del possibilities[(x, y)]
|
||||
break
|
||||
else:
|
||||
selected = random.choice(list(possibilities.keys()))
|
||||
#print(f"No tiles have verifable solutions: QUANTUM -> {selected}")
|
||||
# sprinkle some quantumness on it
|
||||
ti = TileInfo.from_grid(grid, (x, y))
|
||||
matches = [(k, v) for k, v in tiles.items() if k.match(ti)]
|
||||
wts = [k.chance for k, v in matches]
|
||||
if not wts:
|
||||
print(f"This one: {(x,y)} {matches}\n{wts}")
|
||||
del possibilities[(x, y)]
|
||||
return possibilities
|
||||
tileinfo, tile = random.choices(matches, weights=wts)[0]
|
||||
grid.at((x, y)).tilesprite = tile
|
||||
del possibilities[(x, y)]
|
||||
|
||||
return possibilities
|
||||
|
||||
#with open("scripts/tile_def.txt", "r") as f:
|
||||
with open("scripts/simple_tiles.txt", "r") as f:
|
||||
for block in f.read().split('\n\n'):
|
||||
info, constraints = block.split('\n', 1)
|
||||
if '#' in info:
|
||||
info, comment = info.split('#', 1)
|
||||
rules = []
|
||||
if '@' in info:
|
||||
info, *block_rules = info.split('@')
|
||||
#print(block_rules)
|
||||
for r in block_rules:
|
||||
rules.append((r[0], int(r[1:])))
|
||||
#cardinal_dir = block_rules[0]
|
||||
#partner
|
||||
if ':' not in info:
|
||||
tile_id = int(info)
|
||||
chance = 1.0
|
||||
else:
|
||||
tile_id, chance = info.split(':')
|
||||
tile_id = int(tile_id)
|
||||
chance = float(chance.strip())
|
||||
constraints = constraints.replace('\n', '')
|
||||
k = TileInfo.from_string(constraints)
|
||||
k.rules = rules
|
||||
k.chance = chance
|
||||
tiles[k] = tile_id
|
||||
|
||||
|
|
@ -1,677 +1,55 @@
|
|||
import mcrfpy
|
||||
import code
|
||||
|
||||
#t = mcrfpy.Texture("assets/kenney_tinydungeon.png", 16, 16) # 12, 11)
|
||||
t = mcrfpy.Texture("assets/kenney_TD_MR_IP.png", 16, 16) # 12, 11)
|
||||
btn_tex = mcrfpy.Texture("assets/48px_ui_icons-KenneyNL.png", 48, 48)
|
||||
font = mcrfpy.Font("assets/JetbrainsMono.ttf")
|
||||
texture = mcrfpy.Texture("assets/kenney_tinydungeon.png", 16, 16)
|
||||
|
||||
print("[game.py] Default texture:")
|
||||
print(mcrfpy.default_texture)
|
||||
print(type(mcrfpy.default_texture))
|
||||
|
||||
# build test widgets
|
||||
|
||||
mcrfpy.createScene("pytest")
|
||||
mcrfpy.setScene("pytest")
|
||||
ui = mcrfpy.sceneUI("pytest")
|
||||
|
||||
# Frame
|
||||
f = mcrfpy.Frame(25, 19, 462, 346, fill_color=(255, 92, 92))
|
||||
# fill (LinkedColor / Color): f.fill_color
|
||||
# outline (LinkedColor / Color): f.outline_color
|
||||
# pos (LinkedVector / Vector): f.pos
|
||||
# size (LinkedVector / Vector): f.size
|
||||
|
||||
# Caption
|
||||
c = mcrfpy.Caption(512+25, 19, "Hi.", font)
|
||||
# fill (LinkedColor / Color): c.fill_color
|
||||
#color_val = c.fill_color
|
||||
print(c.fill_color)
|
||||
print("Set a fill color")
|
||||
c.fill_color = (255, 255, 255)
|
||||
print("Lol, did it segfault?")
|
||||
# outline (LinkedColor / Color): c.outline_color
|
||||
# font (Font): c.font
|
||||
# pos (LinkedVector / Vector): c.pos
|
||||
|
||||
# Sprite
|
||||
s = mcrfpy.Sprite(25, 384+19, texture, 86, 9.0)
|
||||
# pos (LinkedVector / Vector): s.pos
|
||||
# texture (Texture): s.texture
|
||||
|
||||
# Grid
|
||||
g = mcrfpy.Grid(10, 10, texture, 512+25, 384+19, 462, 346)
|
||||
# texture (Texture): g.texture
|
||||
# pos (LinkedVector / Vector): g.pos
|
||||
# size (LinkedVector / Vector): g.size
|
||||
|
||||
for _x in range(10):
|
||||
for _y in range(10):
|
||||
g.at((_x, _y)).color = (255 - _x*25, 255 - _y*25, 255)
|
||||
g.zoom = 2.0
|
||||
|
||||
[ui.append(d) for d in (f, c, s, g)]
|
||||
|
||||
print("built!")
|
||||
|
||||
# tests
|
||||
|
||||
frame_color = (64, 64, 128)
|
||||
|
||||
import random
|
||||
import cos_entities as ce
|
||||
import cos_level as cl
|
||||
from cos_itemdata import itemdata
|
||||
#import cos_tiles as ct
|
||||
|
||||
class Resources:
|
||||
def __init__(self):
|
||||
self.music_enabled = True
|
||||
self.music_volume = 40
|
||||
self.sfx_enabled = True
|
||||
self.sfx_volume = 100
|
||||
self.master_volume = 100
|
||||
|
||||
# load the music/sfx files here
|
||||
self.splats = []
|
||||
for i in range(1, 10):
|
||||
mcrfpy.createSoundBuffer(f"assets/sfx/splat{i}.ogg")
|
||||
|
||||
|
||||
def play_sfx(self, sfx_id):
|
||||
if self.sfx_enabled and self.sfx_volume and self.master_volume:
|
||||
mcrfpy.setSoundVolume(self.master_volume/100 * self.sfx_volume)
|
||||
mcrfpy.playSound(sfx_id)
|
||||
|
||||
def play_music(self, track_id):
|
||||
if self.music_enabled and self.music_volume and self.master_volume:
|
||||
mcrfpy.setMusicVolume(self.master_volume/100 * self.music_volume)
|
||||
mcrfpy.playMusic(...)
|
||||
|
||||
resources = Resources()
|
||||
|
||||
class Crypt:
|
||||
def __init__(self):
|
||||
mcrfpy.createScene("play")
|
||||
self.ui = mcrfpy.sceneUI("play")
|
||||
|
||||
entity_frame = mcrfpy.Frame(815, 10, 194, 595, fill_color = frame_color)
|
||||
inventory_frame = mcrfpy.Frame(10, 610, 800, 143, fill_color = frame_color)
|
||||
stats_frame = mcrfpy.Frame(815, 610, 194, 143, fill_color = frame_color)
|
||||
|
||||
#self.level = cl.Level(30, 23)
|
||||
self.entities = []
|
||||
self.depth=1
|
||||
self.stuck_btn = SweetButton(self.ui, (810, 700), "Stuck", icon=19, box_width=150, box_height = 60, click=self.stuck)
|
||||
|
||||
self.level_plan = {
|
||||
1: [("spawn", "button", "boulder"), ("exit")],
|
||||
2: [("spawn", "button", "treasure", "treasure", "treasure", "rat", "rat", "boulder"), ("exit")],
|
||||
#2: [("spawn", "button", "boulder"), ("rat"), ("exit")],
|
||||
3: [("spawn", "button", "boulder"), ("rat"), ("exit")],
|
||||
4: [("spawn", "button", "rat"), ("boulder", "rat", "treasure"), ("exit")],
|
||||
5: [("spawn", "button", "rat"), ("boulder", "rat"), ("exit")],
|
||||
6: {(("spawn", "button"), ("boulder", "treasure", "exit")),
|
||||
(("spawn", "boulder"), ("button", "treasure", "exit"))},
|
||||
7: {(("spawn", "button"), ("boulder", "treasure", "exit")),
|
||||
(("spawn", "boulder"), ("button", "treasure", "exit"))},
|
||||
8: {(("spawn", "treasure", "button"), ("boulder", "treasure", "exit")),
|
||||
(("spawn", "treasure", "boulder"), ("button", "treasure", "exit"))}
|
||||
#9: self.lv_planner
|
||||
}
|
||||
|
||||
# empty void for the player to initialize into
|
||||
self.headsup = mcrfpy.Frame(10, 684, 320, 64, fill_color = (0, 0, 0, 0))
|
||||
self.sidebar = mcrfpy.Frame(860, 4, 160, 600, fill_color = (96, 96, 160))
|
||||
|
||||
# Heads Up (health bar, armor bar) config
|
||||
self.health_bar = [mcrfpy.Sprite(32*i, 2, t, 659, 2) for i in range(10)]
|
||||
[self.headsup.children.append(i) for i in self.health_bar]
|
||||
self.armor_bar = [mcrfpy.Sprite(32*i, 42, t, 659, 2) for i in range(10)]
|
||||
[self.headsup.children.append(i) for i in self.armor_bar]
|
||||
# (40, 3), caption, font, fill_color=font_color
|
||||
self.stat_captions = mcrfpy.Caption((325,0), "HP:10\nDef:0(+0)", font, fill_color=(255, 255, 255))
|
||||
self.stat_captions.outline = 3
|
||||
self.stat_captions.outline_color = (0, 0, 0)
|
||||
self.headsup.children.append(self.stat_captions)
|
||||
|
||||
# Side Bar (inventory, level info) config
|
||||
self.level_caption = mcrfpy.Caption((5,5), "Level: 1", font, fill_color=(255, 255, 255))
|
||||
self.level_caption.size = 26
|
||||
self.level_caption.outline = 3
|
||||
self.level_caption.outline_color = (0, 0, 0)
|
||||
self.sidebar.children.append(self.level_caption)
|
||||
self.inv_sprites = [mcrfpy.Sprite(15, 70 + 95*i, t, 659, 6.0) for i in range(5)]
|
||||
for i in self.inv_sprites:
|
||||
self.sidebar.children.append(i)
|
||||
self.key_captions = [
|
||||
mcrfpy.Sprite(75, 130 + (95*2) + 95 * i, t, 384 + i, 3.0) for i in range(3)
|
||||
]
|
||||
for i in self.key_captions:
|
||||
self.sidebar.children.append(i)
|
||||
self.inv_captions = [
|
||||
mcrfpy.Caption((25, 130 + 95 * i), "x", font, fill_color=(255, 255, 255)) for i in range(5)
|
||||
]
|
||||
for i in self.inv_captions:
|
||||
i.size = 16
|
||||
self.sidebar.children.append(i)
|
||||
|
||||
liminal_void = mcrfpy.Grid(1, 1, t, (0, 0), (16, 16))
|
||||
self.grid = liminal_void
|
||||
self.player = ce.PlayerEntity(game=self)
|
||||
self.spawn_point = (0, 0)
|
||||
|
||||
# level creation moves player to the game level at the generated spawn point
|
||||
self.create_level(self.depth)
|
||||
#self.grid = mcrfpy.Grid(20, 15, t, (10, 10), (1014, 758))
|
||||
self.swap_level(self.level, self.spawn_point)
|
||||
|
||||
# Test Entities
|
||||
#ce.BoulderEntity(9, 7, game=self)
|
||||
#ce.BoulderEntity(9, 8, game=self)
|
||||
#ce.ExitEntity(12, 6, 14, 4, game=self)
|
||||
# scene setup
|
||||
|
||||
## might be done by self.swap_level
|
||||
#[self.ui.append(e) for e in (self.grid, self.stuck_btn.base_frame)] # entity_frame, inventory_frame, stats_frame)]
|
||||
|
||||
self.possibilities = None # track WFC possibilities between rounds
|
||||
self.enemies = []
|
||||
#mcrfpy.setTimer("enemy_test", self.enemy_movement, 750)
|
||||
|
||||
#mcrfpy.Frame(x, y, box_width+shadow_offset, box_height, fill_color = (0, 0, 0, 255))
|
||||
#Sprite(0, 3, btn_tex, icon, icon_scale)
|
||||
|
||||
#def enemy_movement(self, *args):
|
||||
# for e in self.enemies: e.act()
|
||||
|
||||
#def spawn_test_rat(self):
|
||||
# success = False
|
||||
# while not success:
|
||||
# x, y = [random.randint(0, i-1) for i in self.grid.grid_size]
|
||||
# success = self.grid.at((x,y)).walkable
|
||||
# self.enemies.append(ce.EnemyEntity(x, y, game=self))
|
||||
|
||||
def gui_update(self):
|
||||
self.stat_captions.text = f"HP:{self.player.hp}\nDef:{self.player.calc_defense()}(+{self.player.calc_defense() - self.player.base_defense})"
|
||||
for i, hs in enumerate(self.health_bar):
|
||||
full_hearts = self.player.hp - (i*2)
|
||||
empty_hearts = self.player.max_hp - (i*2)
|
||||
hs.sprite_number = 659
|
||||
if empty_hearts >= 2:
|
||||
hs.sprite_number = 208
|
||||
if full_hearts >= 2:
|
||||
hs.sprite_number = 210
|
||||
elif full_hearts == 1:
|
||||
hs.sprite_number = 209
|
||||
for i, arm_s in enumerate(self.armor_bar):
|
||||
full_hearts = self.player.calc_defense() - (i*2)
|
||||
arm_s.sprite_number = 659
|
||||
if full_hearts >= 2:
|
||||
arm_s.sprite_number = 211
|
||||
elif full_hearts == 1:
|
||||
arm_s.sprite_number = 212
|
||||
|
||||
#items = self.player.equipped[:] + self.player.inventory[:]
|
||||
for i in range(5):
|
||||
if i == 0:
|
||||
item = self.player.equipped[0] if len(self.player.equipped) > 0 else None
|
||||
elif i == 1:
|
||||
item = self.player.equipped[1] if len(self.player.equipped) > 1 else None
|
||||
elif i == 2:
|
||||
item = self.player.inventory[0] if len(self.player.inventory) > 0 else None
|
||||
elif i == 3:
|
||||
item = self.player.inventory[1] if len(self.player.inventory) > 1 else None
|
||||
elif i == 4:
|
||||
item = self.player.inventory[2] if len(self.player.inventory) > 2 else None
|
||||
if item is None:
|
||||
self.inv_sprites[i].sprite_number = 659
|
||||
if i > 1: self.key_captions[i - 2].sprite_number = 659
|
||||
self.inv_captions[i].text = ""
|
||||
continue
|
||||
self.inv_sprites[i].sprite_number = item.sprite
|
||||
if i > 1:
|
||||
self.key_captions[i - 2].sprite_number = 384 + (i - 2)
|
||||
if item.zap_cooldown_remaining:
|
||||
self.inv_captions[i].text = f"[{item.zap_cooldown_remaining}] {item.text})"
|
||||
else:
|
||||
self.inv_captions[i].text = item.text
|
||||
self.inv_captions[i].fill_color = item.text_color
|
||||
|
||||
def lv_planner(self, target_level):
|
||||
"""Plan room sequence in levels > 9"""
|
||||
monsters = (target_level - 6) // 2
|
||||
target_rooms = min(int(target_level // 2), 6)
|
||||
target_treasure = min(int(target_level // 3), 4)
|
||||
rooms = []
|
||||
for i in range(target_rooms):
|
||||
rooms.append([])
|
||||
for o in ("spawn", "boulder", "button", "exit"):
|
||||
r = random.randint(0, target_rooms-1)
|
||||
rooms[r].append(o)
|
||||
monster_table = {
|
||||
"rat": int(monsters * 0.8) + 2,
|
||||
"big rat": max(int(monsters * 0.2) - 2, 0),
|
||||
"cyclops": max(int(monsters * 0.1) - 3, 0)
|
||||
}
|
||||
monster_table = {k: v for k, v in monster_table.items() if v > 0}
|
||||
monster_names = list(monster_table.keys())
|
||||
monster_weights = [monster_table[k] for k in monster_names]
|
||||
for m in range(monsters):
|
||||
r = random.randint(0, target_rooms - 1)
|
||||
rooms[r].append(random.choices(monster_names, weights = monster_weights)[0])
|
||||
|
||||
for t in range(target_treasure):
|
||||
r = random.randint(0, target_rooms - 1)
|
||||
rooms[r].append("treasure")
|
||||
|
||||
return rooms
|
||||
|
||||
def treasure_planner(self, treasure_level):
|
||||
"""Plan treasure contents at all levels"""
|
||||
|
||||
# find item name in base_wts key (base weight of the category)
|
||||
#base_weight = lambda s: base_wts[list([t for t in base_wts.keys() if s in t])[0]]
|
||||
#weights = {d[0]: base_weight(d[0]) for d in item_minlv.items() if treasure_level > d[1]}
|
||||
#if self.player.archetype is None:
|
||||
# prefs = []
|
||||
#elif self.player.archetype == "viking":
|
||||
# prefs = ["axe2", "axe3", "green_pot"]
|
||||
#elif self.player.archetype == "knight":
|
||||
# prefs = ["sword2", "shield", "grey_pot"]
|
||||
#elif self.player.archetype == "wizard":
|
||||
# prefs = ["staff", "staff2", "blue_pot"]
|
||||
#for i in prefs:
|
||||
# if i in weights: weights[i] *= 3
|
||||
weights = {}
|
||||
for item in itemdata:
|
||||
data = itemdata[item]
|
||||
if data.min_lv > treasure_level or treasure_level > data.max_lv: continue
|
||||
weights[item] = data.base_wt
|
||||
if self.player.archetype is not None and data.affinity == self.player.archetype:
|
||||
weights[item] *= 3
|
||||
return weights
|
||||
|
||||
def start(self):
|
||||
resources.play_sfx(1)
|
||||
mcrfpy.setScene("play")
|
||||
mcrfpy.keypressScene(self.cos_keys)
|
||||
|
||||
def add_entity(self, e:ce.COSEntity):
|
||||
self.entities.append(e)
|
||||
self.entities.sort(key = lambda e: e.draw_order, reverse=False)
|
||||
# hack / workaround for grid.entities not interable
|
||||
while len(self.grid.entities): # while there are entities on the grid,
|
||||
self.grid.entities.remove(0) # remove the 1st ("0th")
|
||||
for e in self.entities:
|
||||
self.grid.entities.append(e._entity)
|
||||
|
||||
def create_level(self, depth, _luck = 0):
|
||||
#if depth < 3:
|
||||
# features = None
|
||||
self.level = cl.Level(20, 20)
|
||||
self.grid = self.level.grid
|
||||
if depth in self.level_plan:
|
||||
plan = self.level_plan[depth]
|
||||
else:
|
||||
plan = self.lv_planner(depth)
|
||||
coords = self.level.generate(plan)
|
||||
self.entities = []
|
||||
if self.player:
|
||||
luck = self.player.luck
|
||||
else:
|
||||
luck = 0
|
||||
buttons = []
|
||||
for k, v in sorted(coords, key=lambda i: i[0]): # "button" before "exit"; "button", "button", "door", "exit" -> alphabetical is correct sequence
|
||||
if k == "spawn":
|
||||
if self.player:
|
||||
self.add_entity(self.player)
|
||||
#self.player.draw_pos = v
|
||||
self.spawn_point = v
|
||||
elif k == "boulder":
|
||||
ce.BoulderEntity(v[0], v[1], game=self)
|
||||
elif k == "treasure":
|
||||
ce.TreasureEntity(v[0], v[1], treasure_table = self.treasure_planner(depth + luck), game=self)
|
||||
elif k == "button":
|
||||
buttons.append(v)
|
||||
elif k == "exit":
|
||||
btn = buttons.pop(0)
|
||||
ce.ExitEntity(v[0], v[1], btn[0], btn[1], game=self)
|
||||
elif k == "rat":
|
||||
ce.EnemyEntity(*v, game=self)
|
||||
elif k == "big rat":
|
||||
ce.EnemyEntity(*v, game=self, base_damage=2, hp=4, sprite=130)
|
||||
elif k == "cyclops":
|
||||
ce.EnemyEntity(*v, game=self, base_damage=3, hp=8, sprite=109, base_defense=2)
|
||||
|
||||
#if self.depth > 2:
|
||||
#for i in range(10):
|
||||
# self.spawn_test_rat()
|
||||
|
||||
def stuck(self, sweet_btn, args):
|
||||
if args[3] == "end": return
|
||||
self.create_level(self.depth)
|
||||
self.swap_level(self.level, self.spawn_point)
|
||||
|
||||
def cos_keys(self, key, state):
|
||||
d = None
|
||||
if state == "end": return
|
||||
elif key == "Grave":
|
||||
code.InteractiveConsole(locals=globals()).interact()
|
||||
return
|
||||
elif key == "Z":
|
||||
self.player.do_zap()
|
||||
self.enemy_turn()
|
||||
return
|
||||
elif key == "W": d = (0, -1)
|
||||
elif key == "A": d = (-1, 0)
|
||||
elif key == "S": d = (0, 1)
|
||||
elif key == "D": d = (1, 0)
|
||||
elif key == "Num1":
|
||||
if len(self.player.inventory) > 0:
|
||||
self.player.inventory[0].consume(self.player)
|
||||
self.player.inventory[0] = None
|
||||
self.enemy_turn()
|
||||
else:
|
||||
print("No item")
|
||||
elif key == "Num2":
|
||||
if len(self.player.inventory) > 1:
|
||||
self.player.inventory[1].consume(self.player)
|
||||
self.player.inventory[1] = None
|
||||
else:
|
||||
print("No item")
|
||||
elif key == "Num3":
|
||||
if len(self.player.inventory) > 2:
|
||||
self.player.inventory[2].consume(self.player)
|
||||
self.player.inventory[2] = None
|
||||
else:
|
||||
print("No item")
|
||||
|
||||
#elif key == "M": self.level.generate()
|
||||
#elif key == "R":
|
||||
# self.level.reset()
|
||||
# self.possibilities = None
|
||||
#elif key == "T":
|
||||
# self.level.split()
|
||||
# self.possibilities = None
|
||||
#elif key == "Y": self.level.split(single=True)
|
||||
#elif key == "U": self.level.highlight(+1)
|
||||
#elif key == "I": self.level.highlight(-1)
|
||||
#elif key == "O":
|
||||
# self.level.wall_rooms()
|
||||
# self.possibilities = None
|
||||
#elif key == "P": ct.format_tiles(self.grid)
|
||||
#elif key == "P":
|
||||
#self.possibilities = ct.wfc_pass(self.grid, self.possibilities)
|
||||
elif key == "P":
|
||||
self.depth += 1
|
||||
print(f"Descending: lv {self.depth}")
|
||||
self.stuck(None, [1,2,3,4])
|
||||
elif key == "Period":
|
||||
self.enemy_turn()
|
||||
elif key == "X":
|
||||
self.pull_boulder_search()
|
||||
else:
|
||||
print(key)
|
||||
if d:
|
||||
self.entities.sort(key = lambda e: e.draw_order, reverse=False)
|
||||
self.player.try_move(*d)
|
||||
self.enemy_turn()
|
||||
|
||||
def enemy_turn(self):
|
||||
self.entities.sort(key = lambda e: e.draw_order, reverse=False)
|
||||
for e in self.entities:
|
||||
e.act()
|
||||
# end of enemy turn = player turn
|
||||
for i in self.player.equipped:
|
||||
i.tick()
|
||||
self.gui_update()
|
||||
|
||||
|
||||
|
||||
def pull_boulder_search(self):
|
||||
for dx, dy in ( (0, -1), (-1, 0), (1, 0), (0, 1) ):
|
||||
for e in self.entities:
|
||||
if e.draw_pos != (self.player.draw_pos[0] + dx, self.player.draw_pos[1] + dy): continue
|
||||
if type(e) == ce.BoulderEntity:
|
||||
self.pull_boulder_move((dx, dy), e)
|
||||
return self.enemy_turn()
|
||||
else:
|
||||
print("No boulder found to pull.")
|
||||
|
||||
def pull_boulder_move(self, p, target_boulder):
|
||||
print(p, target_boulder)
|
||||
self.entities.sort(key = lambda e: e.draw_order, reverse=False)
|
||||
if self.player.try_move(-p[0], -p[1], test=True):
|
||||
old_pos = self.player.draw_pos
|
||||
self.player.try_move(-p[0], -p[1])
|
||||
target_boulder.do_move(*old_pos)
|
||||
|
||||
def swap_level(self, new_level, spawn_point):
|
||||
self.level = new_level
|
||||
self.grid = self.level.grid
|
||||
self.grid.zoom = 2.0
|
||||
# TODO, make an entity mover function
|
||||
#self.add_entity(self.player)
|
||||
self.player.grid = self.grid
|
||||
self.player.draw_pos = spawn_point
|
||||
#self.grid.entities.append(self.player._entity)
|
||||
|
||||
# reform UI (workaround to ui collection iterators crashing)
|
||||
while len(self.ui) > 0:
|
||||
try:
|
||||
self.ui.remove(0)
|
||||
except:
|
||||
pass
|
||||
self.ui.append(self.grid)
|
||||
self.ui.append(self.stuck_btn.base_frame)
|
||||
self.ui.append(self.headsup)
|
||||
|
||||
self.level_caption.text = f"Level: {self.depth}"
|
||||
self.ui.append(self.sidebar)
|
||||
self.gui_update()
|
||||
|
||||
class SweetButton:
|
||||
def __init__(self, ui:mcrfpy.UICollection,
|
||||
pos:"Tuple[int, int]",
|
||||
caption:str, font=font, font_size=24, font_color=(255,255,255), font_outline_color=(0, 0, 0), font_outline_width=2,
|
||||
shadow_offset = 8, box_width=200, box_height = 80, shadow_color=(64, 64, 86), box_color=(96, 96, 160),
|
||||
icon=4, icon_scale=1.75, shadow=True, click=lambda *args: None):
|
||||
self.ui = ui
|
||||
#self.shadow_box = mcrfpy.Frame
|
||||
x, y = pos
|
||||
|
||||
# box w/ drop shadow
|
||||
self.shadow_offset = shadow_offset
|
||||
self.base_frame = mcrfpy.Frame(x, y, box_width+shadow_offset, box_height, fill_color = (0, 0, 0, 255))
|
||||
self.base_frame.click = self.do_click
|
||||
|
||||
# drop shadow won't need configured, append directly
|
||||
if shadow:
|
||||
self.base_frame.children.append(mcrfpy.Frame(0, 0, box_width, box_height, fill_color = shadow_color))
|
||||
|
||||
# main button is where the content lives
|
||||
self.main_button = mcrfpy.Frame(shadow_offset, shadow_offset, box_width, box_height, fill_color = box_color)
|
||||
self.click = click
|
||||
self.base_frame.children.append(self.main_button)
|
||||
|
||||
# main button icon
|
||||
self.icon = mcrfpy.Sprite(0, 3, btn_tex, icon, icon_scale)
|
||||
self.main_button.children.append(self.icon)
|
||||
|
||||
# main button caption
|
||||
self.caption = mcrfpy.Caption((40, 3), caption, font, fill_color=font_color)
|
||||
self.caption.size = font_size
|
||||
self.caption.outline_color=font_outline_color
|
||||
self.caption.outline=font_outline_width
|
||||
self.main_button.children.append(self.caption)
|
||||
|
||||
def unpress(self):
|
||||
"""Helper func for when graphics changes or glitches make the button stuck down"""
|
||||
self.main_button.x, self.main_button.y = (self.shadow_offset, self.shadow_offset)
|
||||
|
||||
def do_click(self, x, y, mousebtn, event):
|
||||
if event == "start":
|
||||
self.main_button.x, self.main_button.y = (0, 0)
|
||||
elif event == "end":
|
||||
self.main_button.x, self.main_button.y = (self.shadow_offset, self.shadow_offset)
|
||||
result = self.click(self, (x, y, mousebtn, event))
|
||||
if result: # return True from event function to instantly un-pop
|
||||
self.main_button.x, self.main_button.y = (self.shadow_offset, self.shadow_offset)
|
||||
|
||||
@property
|
||||
def text(self):
|
||||
return self.caption.text
|
||||
|
||||
@text.setter
|
||||
def text(self, value):
|
||||
self.caption.text = value
|
||||
|
||||
@property
|
||||
def sprite_number(self):
|
||||
return self.icon.sprite_number
|
||||
|
||||
@sprite_number.setter
|
||||
def sprite_number(self, value):
|
||||
self.icon.sprite_number = value
|
||||
|
||||
class MainMenu:
|
||||
def __init__(self):
|
||||
mcrfpy.createScene("menu")
|
||||
self.ui = mcrfpy.sceneUI("menu")
|
||||
mcrfpy.setScene("menu")
|
||||
self.crypt = None
|
||||
|
||||
components = []
|
||||
# demo grid
|
||||
self.demo = cl.Level(20, 20)
|
||||
self.grid = self.demo.grid
|
||||
self.grid.zoom = 1.75
|
||||
coords = self.demo.generate(
|
||||
[("boulder", "boulder", "rat", "cyclops", "boulder"), ("spawn"), ("rat", "big rat"), ("button", "boulder", "exit")]
|
||||
)
|
||||
self.entities = []
|
||||
self.add_entity = lambda e: self.entities.append(e)
|
||||
#self.create_level = lambda *args: None
|
||||
buttons = []
|
||||
#self.depth = 20
|
||||
for k, v in sorted(coords, key=lambda i: i[0]): # "button" before "exit"; "button", "button", "door", "exit" -> alphabetical is correct sequence
|
||||
if k == "spawn":
|
||||
self.player = ce.PlayerEntity(game=self)
|
||||
self.player.draw_pos = v
|
||||
#if self.player:
|
||||
# self.add_entity(self.player)
|
||||
# #self.player.draw_pos = v
|
||||
# self.spawn_point = v
|
||||
elif k == "boulder":
|
||||
ce.BoulderEntity(v[0], v[1], game=self)
|
||||
elif k == "treasure":
|
||||
ce.TreasureEntity(v[0], v[1], treasure_table = {}, game=self)
|
||||
elif k == "button":
|
||||
buttons.append(v)
|
||||
elif k == "exit":
|
||||
btn = buttons.pop(0)
|
||||
ce.ExitEntity(v[0], v[1], btn[0], btn[1], game=self)
|
||||
elif k == "rat":
|
||||
ce.EnemyEntity(*v, game=self)
|
||||
elif k == "big rat":
|
||||
ce.EnemyEntity(*v, game=self, base_damage=2, hp=4, sprite=124)
|
||||
elif k == "cyclops":
|
||||
ce.EnemyEntity(*v, game=self, base_damage=3, hp=8, sprite=109, base_defense=2, can_push=True, move_cooldown=0)
|
||||
#self.demo = cl.Level(20, 20)
|
||||
#self.create_level(self.depth)
|
||||
for e in self.entities:
|
||||
self.grid.entities.append(e._entity)
|
||||
def just_wiggle(*args):
|
||||
try:
|
||||
self.player.try_move(*random.choice(((1, 0),(-1, 0),(0, 1),(0, -1))))
|
||||
for e in self.entities:
|
||||
e.act()
|
||||
except:
|
||||
pass
|
||||
mcrfpy.setTimer("demo_motion", just_wiggle, 100)
|
||||
components.append(
|
||||
self.demo.grid
|
||||
)
|
||||
|
||||
|
||||
# title text
|
||||
drop_shadow = mcrfpy.Caption((150, 10), "Crypt Of Sokoban", font, fill_color=(96, 96, 96), outline_color=(192, 0, 0))
|
||||
drop_shadow.outline = 3
|
||||
drop_shadow.size = 64
|
||||
components.append(
|
||||
drop_shadow
|
||||
)
|
||||
|
||||
title_txt = mcrfpy.Caption((158, 18), "Crypt Of Sokoban", font, fill_color=(255, 255, 255))
|
||||
title_txt.size = 64
|
||||
components.append(
|
||||
title_txt
|
||||
)
|
||||
|
||||
# toast: text over the demo grid that fades out on a timer
|
||||
self.toast = mcrfpy.Caption((150, 400), "", font, fill_color=(0, 0, 0))
|
||||
self.toast.size = 28
|
||||
self.toast.outline = 2
|
||||
self.toast.outline_color = (255, 255, 255)
|
||||
self.toast_event = None
|
||||
components.append(self.toast)
|
||||
|
||||
# button - PLAY
|
||||
#playbtn = mcrfpy.Frame(284, 548, 456, 120, fill_color =
|
||||
play_btn = SweetButton(self.ui, (20, 248), "PLAY", box_width=200, box_height=110, icon=1, icon_scale=2.0, click=self.play)
|
||||
components.append(play_btn.base_frame)
|
||||
|
||||
# button - config menu pane
|
||||
#self.config = lambda self, sweet_btn, *args: print(f"boop, sweet button {sweet_btn} config {args}")
|
||||
config_btn = SweetButton(self.ui, (10, 678), "Settings", icon=2, click=self.show_config)
|
||||
components.append(config_btn.base_frame)
|
||||
|
||||
# button - insta-1080p scaling
|
||||
scale_btn = SweetButton(self.ui, (10+256, 678), "Scale up\nto 1080p", icon=15, click=self.scale)
|
||||
self.scaled = False
|
||||
components.append(scale_btn.base_frame)
|
||||
|
||||
# button - music toggle
|
||||
music_btn = SweetButton(self.ui, (10+256*2, 678), "Music\nON", icon=12, click=self.music_toggle)
|
||||
resources.music_enabled = True
|
||||
resources.music_volume = 40
|
||||
components.append(music_btn.base_frame)
|
||||
|
||||
# button - sfx toggle
|
||||
sfx_btn = SweetButton(self.ui, (10+256*3, 678), "SFX\nON", icon=0, click=self.sfx_toggle)
|
||||
resources.sfx_enabled = True
|
||||
resources.sfx_volume = 40
|
||||
components.append(sfx_btn.base_frame)
|
||||
|
||||
|
||||
[self.ui.append(e) for e in components]
|
||||
|
||||
def toast_say(self, txt, delay=10):
|
||||
"kick off a toast event"
|
||||
if self.toast_event is not None:
|
||||
mcrfpy.delTimer("toast_timer")
|
||||
self.toast.text = txt
|
||||
self.toast_event = 350
|
||||
self.toast.fill_color = (255, 255, 255, 255)
|
||||
self.toast.outline = 2
|
||||
self.toast.outline_color = (0, 0, 0, 255)
|
||||
mcrfpy.setTimer("toast_timer", self.toast_callback, 100)
|
||||
|
||||
def toast_callback(self, *args):
|
||||
"fade out the toast text"
|
||||
self.toast_event -= 5
|
||||
if self.toast_event < 0:
|
||||
self.toast_event = None
|
||||
mcrfpy.delTimer("toast_timer")
|
||||
mcrfpy.text = ""
|
||||
return
|
||||
a = min(self.toast_event, 255)
|
||||
self.toast.fill_color = (255, 255, 255, a)
|
||||
self.toast.outline_color = (0, 0, 0, a)
|
||||
|
||||
def show_config(self, sweet_btn, args):
|
||||
self.toast_say("Beep, Boop! Configurations will go here.")
|
||||
|
||||
def play(self, sweet_btn, args):
|
||||
#if args[3] == "start": return # DRAMATIC on release action!
|
||||
if args[3] == "end": return
|
||||
self.crypt = Crypt()
|
||||
#mcrfpy.setScene("play")
|
||||
self.crypt.start()
|
||||
|
||||
def scale(self, sweet_btn, args, window_scale=None):
|
||||
if args[3] == "end": return
|
||||
if not window_scale:
|
||||
self.scaled = not self.scaled
|
||||
window_scale = 1.3
|
||||
else:
|
||||
self.scaled = True
|
||||
sweet_btn.unpress()
|
||||
if self.scaled:
|
||||
self.toast_say("Windowed mode only, sorry!\nCheck Settings for for fine-tuned controls.")
|
||||
mcrfpy.setScale(window_scale)
|
||||
sweet_btn.text = "Scale down\n to 1.0x"
|
||||
else:
|
||||
mcrfpy.setScale(1.0)
|
||||
sweet_btn.text = "Scale up\nto 1080p"
|
||||
|
||||
def music_toggle(self, sweet_btn, args):
|
||||
if args[3] == "end": return
|
||||
resources.music_enabled = not resources.music_enabled
|
||||
print(f"music: {resources.music_enabled}")
|
||||
if resources.music_enabled:
|
||||
mcrfpy.setMusicVolume(self.music_volume)
|
||||
sweet_btn.text = "Music is ON"
|
||||
sweet_btn.sprite_number = 12
|
||||
else:
|
||||
self.toast_say("Use your volume keys or\nlook in Settings for a volume meter.")
|
||||
mcrfpy.setMusicVolume(0)
|
||||
sweet_btn.text = "Music is OFF"
|
||||
sweet_btn.sprite_number = 17
|
||||
|
||||
def sfx_toggle(self, sweet_btn, args):
|
||||
if args[3] == "end": return
|
||||
resources.sfx_enabled = not resources.sfx_enabled
|
||||
#print(f"sfx: {resources.sfx_enabled}")
|
||||
if resources.sfx_enabled:
|
||||
mcrfpy.setSoundVolume(self.sfx_volume)
|
||||
sweet_btn.text = "SFX are ON"
|
||||
sweet_btn.sprite_number = 0
|
||||
else:
|
||||
self.toast_say("Use your volume keys or\nlook in Settings for a volume meter.")
|
||||
mcrfpy.setSoundVolume(0)
|
||||
sweet_btn.text = "SFX are OFF"
|
||||
sweet_btn.sprite_number = 17
|
||||
|
||||
mainmenu = MainMenu()
|
||||
|
|
|
@ -0,0 +1,221 @@
|
|||
#print("Hello mcrogueface")
|
||||
import mcrfpy
|
||||
import cos_play
|
||||
# Universal stuff
|
||||
font = mcrfpy.Font("assets/JetbrainsMono.ttf")
|
||||
texture = mcrfpy.Texture("assets/kenney_tinydungeon.png", 16, 16) #12, 11)
|
||||
texture_cold = mcrfpy.Texture("assets/kenney_ice.png", 16, 16) #12, 11)
|
||||
texture_hot = mcrfpy.Texture("assets/kenney_lava.png", 16, 16) #12, 11)
|
||||
|
||||
# Test stuff
|
||||
mcrfpy.createScene("boom")
|
||||
mcrfpy.setScene("boom")
|
||||
ui = mcrfpy.sceneUI("boom")
|
||||
box = mcrfpy.Frame(40, 60, 200, 300, fill_color=(255,128,0), outline=4.0, outline_color=(64,64,255,96))
|
||||
ui.append(box)
|
||||
|
||||
#caption = mcrfpy.Caption(10, 10, "Clicky", font, (255, 255, 255, 255), (0, 0, 0, 255))
|
||||
#box.click = lambda x, y, btn, type: print("Hello callback: ", x, y, btn, type)
|
||||
#box.children.append(caption)
|
||||
|
||||
test_sprite_number = 86
|
||||
sprite = mcrfpy.Sprite(20, 60, texture, test_sprite_number, 4.0)
|
||||
spritecap = mcrfpy.Caption(5, 5, "60", font)
|
||||
def click_sprite(x, y, btn, action):
|
||||
global test_sprite_number
|
||||
if action != "start": return
|
||||
if btn in ("left", "wheel_up"):
|
||||
test_sprite_number -= 1
|
||||
elif btn in ("right", "wheel_down"):
|
||||
test_sprite_number += 1
|
||||
sprite.sprite_number = test_sprite_number # TODO - inconsistent naming for __init__, __repr__ and getsetter: sprite_number vs sprite_index
|
||||
spritecap.text = test_sprite_number
|
||||
|
||||
sprite.click = click_sprite # TODO - sprites don't seem to correct for screen position or scale when clicking
|
||||
box.children.append(sprite)
|
||||
box.children.append(spritecap)
|
||||
box.click = click_sprite
|
||||
|
||||
f_a = mcrfpy.Frame(250, 60, 80, 80, fill_color=(255, 92, 92))
|
||||
f_a_txt = mcrfpy.Caption(5, 5, "0", font)
|
||||
|
||||
f_b = mcrfpy.Frame(340, 60, 80, 80, fill_color=(92, 255, 92))
|
||||
f_b_txt = mcrfpy.Caption(5, 5, "0", font)
|
||||
|
||||
f_c = mcrfpy.Frame(430, 60, 80, 80, fill_color=(92, 92, 255))
|
||||
f_c_txt = mcrfpy.Caption(5, 5, "0", font)
|
||||
|
||||
|
||||
ui.append(f_a)
|
||||
f_a.children.append(f_a_txt)
|
||||
ui.append(f_b)
|
||||
f_b.children.append(f_b_txt)
|
||||
ui.append(f_c)
|
||||
f_c.children.append(f_c_txt)
|
||||
|
||||
import sys
|
||||
def ding(*args):
|
||||
f_a_txt.text = str(sys.getrefcount(ding)) + " refs"
|
||||
f_b_txt.text = sys.getrefcount(dong)
|
||||
f_c_txt.text = sys.getrefcount(stress_test)
|
||||
|
||||
def dong(*args):
|
||||
f_a_txt.text = str(sys.getrefcount(ding)) + " refs"
|
||||
f_b_txt.text = sys.getrefcount(dong)
|
||||
f_c_txt.text = sys.getrefcount(stress_test)
|
||||
|
||||
running = False
|
||||
timers = []
|
||||
|
||||
def add_ding():
|
||||
global timers
|
||||
n = len(timers)
|
||||
mcrfpy.setTimer(f"timer{n}", ding, 100)
|
||||
print("+1 ding:", timers)
|
||||
|
||||
def add_dong():
|
||||
global timers
|
||||
n = len(timers)
|
||||
mcrfpy.setTimer(f"timer{n}", dong, 100)
|
||||
print("+1 dong:", timers)
|
||||
|
||||
def remove_random():
|
||||
global timers
|
||||
target = random.choice(timers)
|
||||
print("-1 timer:", target)
|
||||
print("remove from list")
|
||||
timers.remove(target)
|
||||
print("delTimer")
|
||||
mcrfpy.delTimer(target)
|
||||
print("done")
|
||||
|
||||
import random
|
||||
import time
|
||||
def stress_test(*args):
|
||||
global running
|
||||
global timers
|
||||
if not running:
|
||||
print("stress test initial")
|
||||
running = True
|
||||
timers.append("recurse")
|
||||
add_ding()
|
||||
add_dong()
|
||||
mcrfpy.setTimer("recurse", stress_test, 1000)
|
||||
mcrfpy.setTimer("terminate", lambda *args: mcrfpy.delTimer("recurse"), 30000)
|
||||
ding(); dong()
|
||||
else:
|
||||
#print("stress test random activity")
|
||||
#random.choice([
|
||||
# add_ding,
|
||||
# add_dong,
|
||||
# remove_random
|
||||
# ])()
|
||||
#print(timers)
|
||||
print("Segfaultin' time")
|
||||
mcrfpy.delTimer("recurse")
|
||||
print("Does this still work?")
|
||||
time.sleep(0.5)
|
||||
print("How about now?")
|
||||
|
||||
|
||||
stress_test()
|
||||
|
||||
|
||||
# Loading Screen
|
||||
mcrfpy.createScene("loading")
|
||||
ui = mcrfpy.sceneUI("loading")
|
||||
#mcrfpy.setScene("loading")
|
||||
logo_texture = mcrfpy.Texture("assets/temp_logo.png", 1024, 1024)#1, 1)
|
||||
logo_sprite = mcrfpy.Sprite(50, 50, logo_texture, 0, 0.5)
|
||||
ui.append(logo_sprite)
|
||||
logo_sprite.click = lambda *args: mcrfpy.setScene("menu")
|
||||
logo_caption = mcrfpy.Caption(70, 600, "Click to Proceed", font, (255, 0, 0, 255), (0, 0, 0, 255))
|
||||
#logo_caption.fill_color =(255, 0, 0, 255)
|
||||
ui.append(logo_caption)
|
||||
|
||||
|
||||
# menu screen
|
||||
mcrfpy.createScene("menu")
|
||||
|
||||
for e in [
|
||||
mcrfpy.Caption(10, 10, "Crypt of Sokoban", font, (255, 255, 255), (0, 0, 0)),
|
||||
mcrfpy.Caption(20, 55, "a McRogueFace demo project", font, (192, 192, 192), (0, 0, 0)),
|
||||
mcrfpy.Frame(15, 70, 150, 60, fill_color=(64, 64, 128)),
|
||||
mcrfpy.Frame(15, 145, 150, 60, fill_color=(64, 64, 128)),
|
||||
mcrfpy.Frame(15, 220, 150, 60, fill_color=(64, 64, 128)),
|
||||
mcrfpy.Frame(15, 295, 150, 60, fill_color=(64, 64, 128)),
|
||||
#mcrfpy.Frame(900, 10, 100, 100, fill_color=(255, 0, 0)),
|
||||
]:
|
||||
mcrfpy.sceneUI("menu").append(e)
|
||||
|
||||
def click_once(fn):
|
||||
def wraps(*args, **kwargs):
|
||||
#print(args)
|
||||
action = args[3]
|
||||
if action != "start": return
|
||||
return fn(*args, **kwargs)
|
||||
return wraps
|
||||
|
||||
@click_once
|
||||
def asdf(x, y, btn, action):
|
||||
print(f"clicky @({x},{y}) {action}->{btn}")
|
||||
|
||||
@click_once
|
||||
def clicked_exit(*args):
|
||||
mcrfpy.exit()
|
||||
|
||||
menu_btns = [
|
||||
("Boom", lambda *args: 1 / 0),
|
||||
("Exit", clicked_exit),
|
||||
("About", lambda *args: mcrfpy.setScene("about")),
|
||||
("Settings", lambda *args: mcrfpy.setScene("settings")),
|
||||
("Start", lambda *args: mcrfpy.setScene("play"))
|
||||
]
|
||||
for i in range(len(mcrfpy.sceneUI("menu"))):
|
||||
e = mcrfpy.sceneUI("menu")[i] # TODO - fix iterator
|
||||
#print(e, type(e))
|
||||
if type(e) is not mcrfpy.Frame: continue
|
||||
label, fn = menu_btns.pop()
|
||||
#print(label)
|
||||
e.children.append(mcrfpy.Caption(5, 5, label, font, (192, 192, 255), (0,0,0)))
|
||||
e.click = fn
|
||||
|
||||
|
||||
# settings screen
|
||||
mcrfpy.createScene("settings")
|
||||
window_scaling = 1.0
|
||||
|
||||
scale_caption = mcrfpy.Caption(180, 70, "1.0x", font, (255, 255, 255), (0, 0, 0))
|
||||
#scale_caption.fill_color = (255, 255, 255) # TODO - mcrfpy.Caption.__init__ is not setting colors
|
||||
for e in [
|
||||
mcrfpy.Caption(10, 10, "Settings", font, (255, 255, 255), (0, 0, 0)),
|
||||
mcrfpy.Frame(15, 70, 150, 60, fill_color=(64, 64, 128)), # +
|
||||
mcrfpy.Frame(300, 70, 150, 60, fill_color=(64, 64, 128)), # -
|
||||
mcrfpy.Frame(15, 295, 150, 60, fill_color=(64, 64, 128)),
|
||||
scale_caption,
|
||||
]:
|
||||
mcrfpy.sceneUI("settings").append(e)
|
||||
|
||||
@click_once
|
||||
def game_scale(x, y, btn, action, delta):
|
||||
global window_scaling
|
||||
print(f"WIP - scale the window from {window_scaling:.1f} to {window_scaling+delta:.1f}")
|
||||
window_scaling += delta
|
||||
scale_caption.text = f"{window_scaling:.1f}x"
|
||||
mcrfpy.setScale(window_scaling)
|
||||
#mcrfpy.setScale(2)
|
||||
|
||||
settings_btns = [
|
||||
("back", lambda *args: mcrfpy.setScene("menu")),
|
||||
("-", lambda x, y, btn, action: game_scale(x, y, btn, action, -0.1)),
|
||||
("+", lambda x, y, btn, action: game_scale(x, y, btn, action, +0.1))
|
||||
]
|
||||
|
||||
for i in range(len(mcrfpy.sceneUI("settings"))):
|
||||
e = mcrfpy.sceneUI("settings")[i] # TODO - fix iterator
|
||||
#print(e, type(e))
|
||||
if type(e) is not mcrfpy.Frame: continue
|
||||
label, fn = settings_btns.pop()
|
||||
#print(label, fn)
|
||||
e.children.append(mcrfpy.Caption(5, 5, label, font, (192, 192, 255), (0,0,0)))
|
||||
e.click = fn
|
|
@ -1,144 +0,0 @@
|
|||
145# open space
|
||||
???
|
||||
?_?
|
||||
???
|
||||
|
||||
184:0.03# open space variant
|
||||
???
|
||||
?_?
|
||||
???
|
||||
|
||||
146# lone wall / pillar
|
||||
___
|
||||
_X_
|
||||
___
|
||||
|
||||
132# top left corner
|
||||
?_?
|
||||
_XX
|
||||
?X?
|
||||
|
||||
133# plain horizontal wall
|
||||
???
|
||||
XXX
|
||||
?_?
|
||||
|
||||
182:0.04# plain horizontal wall variant
|
||||
???
|
||||
XXX
|
||||
?_?
|
||||
|
||||
183:0.04# plain horizontal wall variant
|
||||
???
|
||||
XXX
|
||||
?_?
|
||||
|
||||
157:0.01# plain horizontal wall variant
|
||||
???
|
||||
XXX
|
||||
?_?
|
||||
|
||||
135# top right corner
|
||||
?_?
|
||||
XX_
|
||||
?X?
|
||||
|
||||
144@N132@s144@n144@n192@s192@S156@n171@s169@n180# Left side wall. Space on both sides rule may make the dungeon less robust (no double-walls allowed)
|
||||
?X?
|
||||
?X_
|
||||
?X?
|
||||
|
||||
147@N135@s147@n147@n193@s193@S159@n170@s168@n181# Right side wall
|
||||
?X?
|
||||
_X?
|
||||
?X?
|
||||
|
||||
156# bottom left corner
|
||||
?X?
|
||||
_XX
|
||||
?_?
|
||||
|
||||
159# bottom right corner
|
||||
?X?
|
||||
XX_
|
||||
?_?
|
||||
|
||||
192@n144@s144@s169# vertical T, left wall
|
||||
?X?
|
||||
?XX
|
||||
?X?
|
||||
|
||||
193@n147@s147@s168# vertical T, right wall
|
||||
?X?
|
||||
XX?
|
||||
?X?
|
||||
|
||||
180@s144@s144@s169# horizontal T, left wall
|
||||
???
|
||||
XXX
|
||||
?X?
|
||||
|
||||
181@s147@s147@s168# horizontal T, right wall
|
||||
???
|
||||
XXX
|
||||
?X?
|
||||
|
||||
195@W133@W182@W183@W157# wall for edge of a gap
|
||||
??_
|
||||
XX_
|
||||
?__
|
||||
|
||||
195
|
||||
?__
|
||||
XX_
|
||||
?__
|
||||
|
||||
194@E133@E182@E183@E157# wall for edge of a gap (R)
|
||||
_??
|
||||
_XX
|
||||
__?
|
||||
|
||||
194
|
||||
__?
|
||||
_XX
|
||||
__?
|
||||
|
||||
195@W133@W182@W183@W157# wall for edge of a gap
|
||||
?__
|
||||
XX_
|
||||
??_
|
||||
|
||||
194@E133@E182@E183@E157# wall for edge of a gap (R)
|
||||
__?
|
||||
_XX
|
||||
_??
|
||||
|
||||
195@W133@W182@W183@W157# wall for edge of a gap
|
||||
??_
|
||||
XX_
|
||||
?__
|
||||
|
||||
194@E133@E182@E183@E157# wall for edge of a gap (R)
|
||||
_??
|
||||
_XX
|
||||
__?
|
||||
|
||||
168@n147@n170@n135@n181@n193# right vertical wall, gap below
|
||||
?X?
|
||||
_X_
|
||||
?_?
|
||||
|
||||
169@n144@n171@n132@n192@n180# left vertical wall, gap below
|
||||
?X?
|
||||
_X_
|
||||
?_?
|
||||
|
||||
170@s147@s168@s133@s182@s183@s157@s193@s181# right vertical wall, gap above
|
||||
?_?
|
||||
_X_
|
||||
?X?
|
||||
|
||||
171@s144@s169@s133@s182@s183@s157@s171@s180# left vertical wall, gap above
|
||||
?_?
|
||||
_X_
|
||||
?X?
|
Loading…
Reference in New Issue