john
/
McRogueFace
1
0
Fork 0
Code Issues 52 Pull Requests Projects 1 Releases Wiki Activity

Squashed commit of the following: [break_up_ui_h] 

Closes #43

No segfault found in cos_play after completing the checklist. Maybe I accidentally fixed it...?

commit 6aa151aba3
Author: John McCardle <mccardle.john@gmail.com>
Date:   Fri Apr 19 21:43:58 2024 -0400

    UISprite.h/.cpp cleanup

commit ec0374ef50
Author: John McCardle <mccardle.john@gmail.com>
Date:   Fri Apr 19 21:37:39 2024 -0400

    UIGridPoint.h/.cpp reorganization

commit 2cb7339535
Author: John McCardle <mccardle.john@gmail.com>
Date:   Fri Apr 19 21:19:25 2024 -0400

    UIGrid.h/.cpp cleanup. I have reservations about the UIEntityCollection[Iter] classes + methods living there, but not enough to fix it right now.

commit 5d6af324bf
Author: John McCardle <mccardle.john@gmail.com>
Date:   Thu Apr 18 22:14:57 2024 -0400

    UIFrame - moving static method into class namespace; no type object access

commit 567218cd7b
Author: John McCardle <mccardle.john@gmail.com>
Date:   Thu Apr 18 21:23:49 2024 -0400

    UIEntity fixes for the UI.h split: There are segfaults in cos_play, I may have missed a type usage or something

commit 76693acd28
Author: John McCardle <mccardle.john@gmail.com>
Date:   Sat Apr 13 00:18:37 2024 -0400

    delete leftover comments

commit 9efe998a33
Author: John McCardle <mccardle.john@gmail.com>
Date:   Sat Apr 13 00:17:43 2024 -0400

    some work on UICaption and UICollection; fixing segfaults resulting from mcrfpydef namepace TypeObject usage

commit 714965da45
Author: John McCardle <mccardle.john@gmail.com>
Date:   Fri Apr 12 14:15:00 2024 -0400

    eliminate extra includes on UICaption

commit 8efa25878f
Author: John McCardle <mccardle.john@gmail.com>
Date:   Wed Apr 10 23:41:14 2024 -0400

    remove a lot of stuff

commit c186d8c7f3
Author: John McCardle <mccardle.john@gmail.com>
Date:   Wed Apr 10 23:10:15 2024 -0400

    We are compiling again! Started refactoring UICaption to be more idiomatic

commit 1b6e2a709b
Author: John McCardle <mccardle.john@gmail.com>
Date:   Tue Apr 9 22:42:02 2024 -0400

    Still not quite compiling; as predicted, a lot of interdependency and definition order bugs to untangle

commit aa7553a818
Author: John McCardle <mccardle.john@gmail.com>
Date:   Tue Apr 9 22:41:20 2024 -0400

    PyTexture clean up scribbles and experiments

commit c0201d989a
Author: John McCardle <mccardle.john@gmail.com>
Date:   Mon Apr 8 22:55:00 2024 -0400

    additional unsaved changes

commit 83a63a3093
Author: John McCardle <mccardle.john@gmail.com>
Date:   Mon Apr 8 22:45:00 2024 -0400

    doesn't compile, but UI.h/.cpp code has been divvy'd up.

    refs #43 @2h
This commit is contained in:
John McCardle 2024-04-20 10:32:04 -04:00
parent 1a7186f745
commit ac7f7052cd
20 changed files with 2814 additions and 3052 deletions
Show Stats Download Patch File Download Diff File Expand all files Collapse all files

26
src/PyTexture.cpp
View File

@ -28,36 +28,12 @@ sf::Sprite PyTexture::sprite(int index, sf::Vector2f pos, sf::Vector2f s)
PyObject* PyTexture::pyObject()
{
// method 1: works but with type weirdness
//PyObject* obj = PyType_GenericAlloc(&mcrfpydef::PyTextureType, 0);
//Py_SET_TYPE(obj, &mcrfpydef::PyTextureType);
// method 2: does not work (segfault on use of the mcrfpy.Texture object)
//PyObject* obj = PyTexture::pynew(&mcrfpydef::PyTextureType, Py_None, Py_None);
// method 3: does not work (segfault on use of the mcrfpy.Texture object)
std::cout << "Find type" << std::endl;
auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "Texture");
//auto type = obj->ob_type;
//auto type = &mcrfpydef::PyTextureType;
//std::cout << "assigned value 0x" << std::hex << reinterpret_cast<long>(type) << std::endl;
//std::cout << "Found PyTextureType: " << PyUnicode_AsUTF8(PyObject_Repr((PyObject*)type)) << std::endl;
//std::cout << "PyTextureType metatype: " << PyUnicode_AsUTF8(PyObject_Repr((PyObject_Type((PyObject*)type)))) << std::endl;
//std::cout << "tp_alloc: 0x" << std::hex << reinterpret_cast <long>(type->tp_alloc) << std::endl <<
// "tp_new: 0x" << std::hex << reinterpret_cast<long>(type->tp_new) << std::endl;
//PyObject* obj = ((PyTypeObject*)type)->tp_new((PyTypeObject*)type, Py_None, Py_None);
PyObject* obj = PyTexture::pynew(type, Py_None, Py_None);
//Py_SET_TYPE(obj, type);
PyObject* obj = PyTexture::pynew(type, Py_None, Py_None);
// method 4: call the type object?
std::cout << "Instantiated" << std::endl;
//Py_SET_TYPE(obj, &mcrfpydef::PyTextureType);
//PyObject_CallFunction(&mcrfpydef::PyTextureType,
try {
((PyTextureObject*)obj)->data = shared_from_this();
std::cout << "Sideloaded texture: " << PyUnicode_AsUTF8(PyObject_Repr(obj)) << std::endl;
}
catch (std::bad_weak_ptr& e)
{

527
src/UI.cpp
View File

@ -1,527 +0,0 @@
#include "UI.h"
#include "Resources.h"
#include "GameEngine.h"
/* //callability fields & methods
PyObject* click_callable;
virtual UIDrawable* click_at(sf::Vector2f point);
void click_register(PyObject*);
void click_unregister();
*/
UIDrawable::UIDrawable() { click_callable = NULL; }
UIDrawable* UIFrame::click_at(sf::Vector2f point)
{
for (auto e: *children)
{
auto p = e->click_at(point + box.getPosition());
if (p)
return p;
}
if (click_callable)
{
float x = box.getPosition().x, y = box.getPosition().y, w = box.getSize().x, h = box.getSize().y;
if (point.x > x && point.y > y && point.x < x+w && point.y < y+h) return this;
}
return NULL;
}
UIDrawable* UICaption::click_at(sf::Vector2f point)
{
if (click_callable)
{
if (text.getGlobalBounds().contains(point)) return this;
}
return NULL;
}
UIDrawable* UISprite::click_at(sf::Vector2f point)
{
if (click_callable)
{
if(sprite.getGlobalBounds().contains(point)) return this;
}
return NULL;
}
UIDrawable* UIGrid::click_at(sf::Vector2f point)
{
if (click_callable)
{
if(box.getGlobalBounds().contains(point)) return this;
}
return NULL;
}
void UIDrawable::click_register(PyObject* callable)
{
/*
if (click_callable)
{
// decrement reference before overwriting
Py_DECREF(click_callable);
}
click_callable = callable;
Py_INCREF(click_callable);
*/
click_callable = std::make_unique<PyClickCallable>(callable);
}
void UIDrawable::click_unregister()
{
/*
if (click_callable == NULL) return;
Py_DECREF(click_callable);
click_callable = NULL;
*/
click_callable.reset();
}
void UIDrawable::render()
{
//std::cout << "Rendering base UIDrawable\n";
render(sf::Vector2f());
}
UIFrame::UIFrame():
//x(0), y(0), w(0), h(0),
outline(0)
{
children = std::make_shared<std::vector<std::shared_ptr<UIDrawable>>>();
box.setPosition(0, 0);
box.setSize(sf::Vector2f(0, 0));
/*
pyOutlineColor = NULL;
pyFillColor = NULL;
_outlineColor = NULL;
_fillColor = NULL;
*/
}
UIFrame::UIFrame(float _x, float _y, float _w, float _h):
//x(_x), y(_y), w(_w), h(_h),
outline(0)
{
box.setPosition(_x, _y);
box.setSize(sf::Vector2f(_w, _h));
children = std::make_shared<std::vector<std::shared_ptr<UIDrawable>>>();
/*
pyOutlineColor = NULL;
pyFillColor = NULL;
_outlineColor = NULL;
_fillColor = NULL;
*/
}
UIFrame::~UIFrame()
{
children.reset();
/*
if (pyOutlineColor) Py_DECREF(pyOutlineColor);
else if (_outlineColor) delete _outlineColor;
if (pyFillColor) Py_DECREF(pyFillColor);
else if (_fillColor) delete _fillColor;
*/
}
/*
sf::Color& fillColor(); // getter
void fillColor(sf::Color c); // C++ setter
void fillColor(PyObject* pyColor); // Python setter
sf::Color& outlineColor(); // getter
void outlineColor(sf::Color c); // C++ setter
void outlineColor(PyObject* pyColor); // Python setter
*/
PyObjectsEnum UIFrame::derived_type()
{
return PyObjectsEnum::UIFRAME;
}
void UIFrame::render(sf::Vector2f offset)
{
//std::cout << "Rendering UIFrame w/ offset " << offset.x << ", " << offset.y << "\n";
//std::cout << "position = " << x << ", " << y << "\n";
box.move(offset);
Resources::game->getWindow().draw(box);
box.move(-offset);
//sf::RectangleShape box = sf::RectangleShape(sf::Vector2f(w,h));
//sf::Vector2f pos = sf::Vector2f(x, y);
//box.setPosition(offset + pos);
//if (_fillColor) { box.setFillColor(fillColor()); }
//if (_outlineColor) { box.setOutlineColor(outlineColor()); }
//box.setOutlineThickness(outline);
//Resources::game->getWindow().draw(box);
for (auto drawable : *children) {
drawable->render(offset + box.getPosition());
}
}
void UICaption::render(sf::Vector2f offset)
{
//std::cout << "Rendering Caption with offset\n";
text.move(offset);
Resources::game->getWindow().draw(text);
text.move(-offset);
}
UISprite::UISprite() {}
/*
// * tearing down the old IndexTexture way of life
UISprite::UISprite(IndexTexture* _itex, int _sprite_index, float x = 0.0, float y = 0.0, float s = 1.0)
: itex(_itex), sprite_index(_sprite_index)
{
sprite.setTexture(_itex->texture);
sprite.setTextureRect(_itex->spriteCoordinates(_sprite_index));
sprite.setPosition(sf::Vector2f(x, y));
sprite.setScale(sf::Vector2f(s, s));
}
UISprite::UISprite(IndexTexture* _itex, int _sprite_index, sf::Vector2f pos, float s = 1.0)
: itex(_itex), sprite_index(_sprite_index)
{
sprite.setTexture(_itex->texture);
sprite.setTextureRect(_itex->spriteCoordinates(_sprite_index));
sprite.setPosition(pos);
sprite.setScale(sf::Vector2f(s, s));
}
*/
UISprite::UISprite(std::shared_ptr<PyTexture> _ptex, int _sprite_index, sf::Vector2f _pos, float _scale)
: ptex(_ptex), sprite_index(_sprite_index)
{
sprite = ptex->sprite(sprite_index, _pos, sf::Vector2f(_scale, _scale));
}
//void UISprite::update()
//{
//auto& tex = Resources::game->textures[texture_index];
//sprite.setTexture(tex.texture);
//sprite.setScale(sf::Vector2f(scale, scale));
//sprite.setPosition(sf::Vector2f(x, y));
//std::cout << "Drawable position: " << x << ", " << y << " -> " << s.getPosition().x << ", " << s.getPosition().y << std::endl;
//sprite.setTextureRect(tex.spriteCoordinates(sprite_index));
//}
void UISprite::render(sf::Vector2f offset)
{
sprite.move(offset);
Resources::game->getWindow().draw(sprite);
sprite.move(-offset);
}
// 7DRL hack; needed to draw entities to UIGrid. TODO, apply this technique to all UIDrawables
void UISprite::render(sf::Vector2f offset, sf::RenderTexture& target)
{
sprite.move(offset);
target.draw(sprite);
sprite.move(-offset);
}
/*
void UISprite::setPosition(float x, float y)
{
setPosition(sf::Vector2f(x, y));
}
*/
void UISprite::setPosition(sf::Vector2f pos)
{
sprite.setPosition(pos);
}
void UISprite::setScale(sf::Vector2f s)
{
sprite.setScale(s);
}
void UISprite::setTexture(std::shared_ptr<PyTexture> _ptex, int _sprite_index)
{
ptex = _ptex;
if (_sprite_index != -1) // if you are changing textures, there's a good chance you need a new index too
sprite_index = _sprite_index;
sprite = ptex->sprite(sprite_index, sprite.getPosition(), sprite.getScale());
}
void UISprite::setSpriteIndex(int _sprite_index)
{
sprite_index = _sprite_index;
sprite = ptex->sprite(sprite_index, sprite.getPosition(), sprite.getScale());
}
sf::Vector2f UISprite::getScale()
{
return sprite.getScale();
}
sf::Vector2f UISprite::getPosition()
{
return sprite.getPosition();
}
std::shared_ptr<PyTexture> UISprite::getTexture()
{
return ptex;
}
int UISprite::getSpriteIndex()
{
return sprite_index;
}
PyObjectsEnum UICaption::derived_type()
{
return PyObjectsEnum::UICAPTION;
}
PyObjectsEnum UISprite::derived_type()
{
return PyObjectsEnum::UISPRITE;
}
// UIGrid support classes' methods
UIGridPoint::UIGridPoint()
:color(1.0f, 1.0f, 1.0f), color_overlay(0.0f, 0.0f, 0.0f), walkable(false), transparent(false),
tilesprite(-1), tile_overlay(-1), uisprite(-1)
{
}
UIEntity::UIEntity() {} // this will not work lol. TODO remove default constructor by finding the shared pointer inits that use it
UIEntity::UIEntity(UIGrid& grid)
: gridstate(grid.grid_x * grid.grid_y)
{
}
// UIGrid methods
UIGrid::UIGrid()
{
}
/*
UIGrid::UIGrid(int gx, int gy, std::shared_ptr<PyTexture> _ptex, float _x, float _y, float _w, float _h)
: grid_x(gx), grid_y(gy),
zoom(1.0f), center_x((gx/2) * _ptex->sheet_width), center_y((gy/2) * _ptex->sheet_height),
itex(_itex), points(gx * gy)
{
// set up blank list of entities
entities = std::make_shared<std::list<std::shared_ptr<UIEntity>>>();
box.setSize(sf::Vector2f(_w, _h));
box.setPosition(sf::Vector2f(_x, _y));
box.setFillColor(sf::Color(0,0,0,0));
renderTexture.create(_w, _h);
sprite.setTexture(_itex->texture);
output.setTextureRect(
sf::IntRect(0, 0,
box.getSize().x, box.getSize().y));
output.setPosition(box.getPosition());
// textures are upside-down inside renderTexture
output.setTexture(renderTexture.getTexture());
}
*/
UIGrid::UIGrid(int gx, int gy, std::shared_ptr<PyTexture> _ptex, sf::Vector2f _xy, sf::Vector2f _wh)
: grid_x(gx), grid_y(gy),
zoom(1.0f), center_x((gx/2) * _ptex->sprite_width), center_y((gy/2) * _ptex->sprite_height),
ptex(_ptex), points(gx * gy)
{
// set up blank list of entities
entities = std::make_shared<std::list<std::shared_ptr<UIEntity>>>();
box.setSize(_wh);
box.setPosition(_xy);
box.setFillColor(sf::Color(0,0,0,0));
//renderTexture.create(_wh.x, _wh.y);
// create renderTexture with maximum theoretical size; sprite can resize to show whatever amount needs to be rendered
renderTexture.create(1920, 1080); // TODO - renderTexture should be window size; above 1080p this will cause rendering errors
//sprite.setTexture(_itex->texture);
sprite = ptex->sprite(0);
output.setTextureRect(
sf::IntRect(0, 0,
box.getSize().x, box.getSize().y));
output.setPosition(box.getPosition());
// textures are upside-down inside renderTexture
output.setTexture(renderTexture.getTexture());
}
void UIGrid::update()
{
}
/*
void UIGrid::setSprite(int ti)
{
//int tx = ti % itex->grid_width, ty = ti / itex->grid_width;
// sprite.setTextureRect(sf::IntRect(tx * itex->grid_size, ty * itex->grid_size, itex->grid_size, itex->grid_size));
sprite = ptex->sprite(ti);
}
*/
void UIGrid::render(sf::Vector2f)
{
output.setPosition(box.getPosition()); // output sprite can move; update position when drawing
// output size can change; update size when drawing
output.setTextureRect(
sf::IntRect(0, 0,
box.getSize().x, box.getSize().y));
renderTexture.clear(sf::Color(8, 8, 8, 255)); // TODO - UIGrid needs a "background color" field
// sprites that are visible according to zoom, center_x, center_y, and box width
float center_x_sq = center_x / ptex->sprite_width;
float center_y_sq = center_y / ptex->sprite_height;
float width_sq = box.getSize().x / (ptex->sprite_width * zoom);
float height_sq = box.getSize().y / (ptex->sprite_height * zoom);
float left_edge = center_x_sq - (width_sq / 2.0);
float top_edge = center_y_sq - (height_sq / 2.0);
int left_spritepixels = center_x - (box.getSize().x / 2.0 / zoom);
int top_spritepixels = center_y - (box.getSize().y / 2.0 / zoom);
//sprite.setScale(sf::Vector2f(zoom, zoom));
sf::RectangleShape r; // for colors and overlays
r.setSize(sf::Vector2f(ptex->sprite_width * zoom, ptex->sprite_height * zoom));
r.setOutlineThickness(0);
int x_limit = left_edge + width_sq + 2;
if (x_limit > grid_x) x_limit = grid_x;
int y_limit = top_edge + height_sq + 2;
if (y_limit > grid_y) y_limit = grid_y;
// base layer - bottom color, tile sprite ("ground")
for (int x = (left_edge - 1 >= 0 ? left_edge - 1 : 0);
x < x_limit; //x < view_width;
x+=1)
{
//for (float y = (top_edge >= 0 ? top_edge : 0);
for (int y = (top_edge - 1 >= 0 ? top_edge - 1 : 0);
y < y_limit; //y < view_height;
y+=1)
{
auto pixel_pos = sf::Vector2f(
(x*ptex->sprite_width - left_spritepixels) * zoom,
(y*ptex->sprite_height - top_spritepixels) * zoom );
auto gridpoint = at(std::floor(x), std::floor(y));
//sprite.setPosition(pixel_pos);
r.setPosition(pixel_pos);
r.setFillColor(gridpoint.color);
renderTexture.draw(r);
// tilesprite
// if discovered but not visible, set opacity to 90%
// if not discovered... just don't draw it?
if (gridpoint.tilesprite != -1) {
sprite = ptex->sprite(gridpoint.tilesprite, pixel_pos, sf::Vector2f(zoom, zoom)); //setSprite(gridpoint.tilesprite);;
renderTexture.draw(sprite);
}
}
}
// middle layer - entities
// disabling entity rendering until I can render their UISprite inside the rendertexture (not directly to window)
for (auto e : *entities) {
// TODO skip out-of-bounds entities (grid square not visible at all, check for partially on visible grid squares / floating point grid position)
//auto drawent = e->cGrid->indexsprite.drawable();
auto& drawent = e->sprite;
//drawent.setScale(zoom, zoom);
drawent.setScale(sf::Vector2f(zoom, zoom));
auto pixel_pos = sf::Vector2f(
(e->position.x*ptex->sprite_width - left_spritepixels) * zoom,
(e->position.y*ptex->sprite_height - top_spritepixels) * zoom );
//drawent.setPosition(pixel_pos);
//renderTexture.draw(drawent);
drawent.render(pixel_pos, renderTexture);
}
// top layer - opacity for discovered / visible status (debug, basically)
/* // Disabled until I attach a "perspective"
for (int x = (left_edge - 1 >= 0 ? left_edge - 1 : 0);
x < x_limit; //x < view_width;
x+=1)
{
//for (float y = (top_edge >= 0 ? top_edge : 0);
for (int y = (top_edge - 1 >= 0 ? top_edge - 1 : 0);
y < y_limit; //y < view_height;
y+=1)
{
auto pixel_pos = sf::Vector2f(
(x*itex->grid_size - left_spritepixels) * zoom,
(y*itex->grid_size - top_spritepixels) * zoom );
auto gridpoint = at(std::floor(x), std::floor(y));
sprite.setPosition(pixel_pos);
r.setPosition(pixel_pos);
// visible & discovered layers for testing purposes
if (!gridpoint.discovered) {
r.setFillColor(sf::Color(16, 16, 20, 192)); // 255 opacity for actual blackout
renderTexture.draw(r);
} else if (!gridpoint.visible) {
r.setFillColor(sf::Color(32, 32, 40, 128));
renderTexture.draw(r);
}
// overlay
// uisprite
}
}
*/
// grid lines for testing & validation
/*
sf::Vertex line[] =
{
sf::Vertex(sf::Vector2f(0, 0), sf::Color::Red),
sf::Vertex(box.getSize(), sf::Color::Red),
};
renderTexture.draw(line, 2, sf::Lines);
sf::Vertex lineb[] =
{
sf::Vertex(sf::Vector2f(0, box.getSize().y), sf::Color::Blue),
sf::Vertex(sf::Vector2f(box.getSize().x, 0), sf::Color::Blue),
};
renderTexture.draw(lineb, 2, sf::Lines);
*/
// render to window
renderTexture.display();
Resources::game->getWindow().draw(output);
}
UIGridPoint& UIGrid::at(int x, int y)
{
return points[y * grid_x + x];
}
PyObjectsEnum UIGrid::derived_type()
{
return PyObjectsEnum::UIGRID;
}
std::shared_ptr<PyTexture> UIGrid::getTexture()
{
return ptex;
}

2509
src/UI.h
View File

File diff suppressed because it is too large Load Diff

32
src/UIBase.h Normal file
View File

@ -0,0 +1,32 @@
#pragma once
class UIEntity;
typedef struct {
PyObject_HEAD
std::shared_ptr<UIEntity> data;
} PyUIEntityObject;
class UIFrame;
typedef struct {
PyObject_HEAD
std::shared_ptr<UIFrame> data;
} PyUIFrameObject;
class UICaption;
typedef struct {
PyObject_HEAD
std::shared_ptr<UICaption> data;
PyObject* font;
} PyUICaptionObject;
class UIGrid;
typedef struct {
PyObject_HEAD
std::shared_ptr<UIGrid> data;
} PyUIGridObject;
class UISprite;
typedef struct {
PyObject_HEAD
std::shared_ptr<UISprite> data;
} PyUISpriteObject;

261
src/UICaption.cpp Normal file
View File

@ -0,0 +1,261 @@
#include "UICaption.h"
#include "GameEngine.h"
#include "PyColor.h"
#include "PyVector.h"
#include "PyFont.h"
UIDrawable* UICaption::click_at(sf::Vector2f point)
{
if (click_callable)
{
if (text.getGlobalBounds().contains(point)) return this;
}
return NULL;
}
void UICaption::render(sf::Vector2f offset)
{
text.move(offset);
Resources::game->getWindow().draw(text);
text.move(-offset);
}
PyObjectsEnum UICaption::derived_type()
{
return PyObjectsEnum::UICAPTION;
}
PyObject* UICaption::get_float_member(PyUICaptionObject* self, void* closure)
{
auto member_ptr = reinterpret_cast<long>(closure);
if (member_ptr == 0)
return PyFloat_FromDouble(self->data->text.getPosition().x);
else if (member_ptr == 1)
return PyFloat_FromDouble(self->data->text.getPosition().y);
else if (member_ptr == 4)
return PyFloat_FromDouble(self->data->text.getOutlineThickness());
else if (member_ptr == 5)
return PyLong_FromLong(self->data->text.getCharacterSize());
else
{
PyErr_SetString(PyExc_AttributeError, "Invalid attribute");
return nullptr;
}
}
int UICaption::set_float_member(PyUICaptionObject* self, PyObject* value, void* closure)
{
float val;
auto member_ptr = reinterpret_cast<long>(closure);
if (PyFloat_Check(value))
{
val = PyFloat_AsDouble(value);
}
else if (PyLong_Check(value))
{
val = PyLong_AsLong(value);
}
else
{
PyErr_SetString(PyExc_TypeError, "Value must be an integer.");
return -1;
}
if (member_ptr == 0) //x
self->data->text.setPosition(val, self->data->text.getPosition().y);
else if (member_ptr == 1) //y
self->data->text.setPosition(self->data->text.getPosition().x, val);
else if (member_ptr == 4) //outline
self->data->text.setOutlineThickness(val);
else if (member_ptr == 5) // character size
self->data->text.setCharacterSize(val);
return 0;
}
PyObject* UICaption::get_vec_member(PyUICaptionObject* self, void* closure)
{
return PyVector(self->data->text.getPosition()).pyObject();
}
int UICaption::set_vec_member(PyUICaptionObject* self, PyObject* value, void* closure)
{
self->data->text.setPosition(PyVector::fromPy(value));
return 0;
}
PyObject* UICaption::get_color_member(PyUICaptionObject* self, void* closure)
{
// TODO: migrate this code to a switch statement - validate closure & return values in one tighter, more extensible structure
// validate closure (should be impossible to be wrong, but it's thorough)
auto member_ptr = reinterpret_cast<long>(closure);
if (member_ptr != 0 && member_ptr != 1)
{
PyErr_SetString(PyExc_AttributeError, "Invalid attribute");
return nullptr;
}
// TODO: manually calling tp_alloc to create a PyColorObject seems like an antipattern
// fetch correct member data
sf::Color color;
if (member_ptr == 0)
{
color = self->data->text.getFillColor();
}
else if (member_ptr == 1)
{
color = self->data->text.getOutlineColor();
}
return PyColor(color).pyObject();
}
int UICaption::set_color_member(PyUICaptionObject* self, PyObject* value, void* closure)
{
auto member_ptr = reinterpret_cast<long>(closure);
//TODO: this logic of (PyColor instance OR tuple -> sf::color) should be encapsulated for reuse
int r, g, b, a;
if (PyObject_IsInstance(value, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Color") /*(PyObject*)&mcrfpydef::PyColorType)*/))
{
// get value from mcrfpy.Color instance
auto c = ((PyColorObject*)value)->data;
r = c.r; g = c.g; b = c.b; a = c.a;
std::cout << "got " << int(r) << ", " << int(g) << ", " << int(b) << ", " << int(a) << std::endl;
}
else if (!PyTuple_Check(value) || PyTuple_Size(value) < 3 || PyTuple_Size(value) > 4)
{
// reject non-Color, non-tuple value
PyErr_SetString(PyExc_TypeError, "Value must be a tuple of 3 or 4 integers or an mcrfpy.Color object.");
return -1;
}
else // get value from tuples
{
r = PyLong_AsLong(PyTuple_GetItem(value, 0));
g = PyLong_AsLong(PyTuple_GetItem(value, 1));
b = PyLong_AsLong(PyTuple_GetItem(value, 2));
a = 255;
if (PyTuple_Size(value) == 4)
{
a = PyLong_AsLong(PyTuple_GetItem(value, 3));
}
}
if (r < 0 || r > 255 || g < 0 || g > 255 || b < 0 || b > 255 || a < 0 || a > 255)
{
PyErr_SetString(PyExc_ValueError, "Color values must be between 0 and 255.");
return -1;
}
if (member_ptr == 0)
{
self->data->text.setFillColor(sf::Color(r, g, b, a));
}
else if (member_ptr == 1)
{
self->data->text.setOutlineColor(sf::Color(r, g, b, a));
}
else
{
PyErr_SetString(PyExc_AttributeError, "Invalid attribute");
return -1;
}
return 0;
}
//TODO: evaluate use of Resources::caption_buffer... can't I do this with a std::string?
PyObject* UICaption::get_text(PyUICaptionObject* self, void* closure)
{
Resources::caption_buffer = self->data->text.getString();
return PyUnicode_FromString(Resources::caption_buffer.c_str());
}
int UICaption::set_text(PyUICaptionObject* self, PyObject* value, void* closure)
{
PyObject* s = PyObject_Str(value);
PyObject * temp_bytes = PyUnicode_AsEncodedString(s, "UTF-8", "strict"); // Owned reference
if (temp_bytes != NULL) {
Resources::caption_buffer = PyBytes_AS_STRING(temp_bytes); // Borrowed pointer
Py_DECREF(temp_bytes);
}
self->data->text.setString(Resources::caption_buffer);
return 0;
}
PyGetSetDef UICaption::getsetters[] = {
{"x", (getter)UICaption::get_float_member, (setter)UICaption::set_float_member, "X coordinate of top-left corner", (void*)0},
{"y", (getter)UICaption::get_float_member, (setter)UICaption::set_float_member, "Y coordinate of top-left corner", (void*)1},
{"pos", (getter)UICaption::get_vec_member, (setter)UICaption::set_vec_member, "(x, y) vector", (void*)0},
//{"w", (getter)PyUIFrame_get_float_member, (setter)PyUIFrame_set_float_member, "width of the rectangle", (void*)2},
//{"h", (getter)PyUIFrame_get_float_member, (setter)PyUIFrame_set_float_member, "height of the rectangle", (void*)3},
{"outline", (getter)UICaption::get_float_member, (setter)UICaption::set_float_member, "Thickness of the border", (void*)4},
{"fill_color", (getter)UICaption::get_color_member, (setter)UICaption::set_color_member, "Fill color of the text", (void*)0},
{"outline_color", (getter)UICaption::get_color_member, (setter)UICaption::set_color_member, "Outline color of the text", (void*)1},
//{"children", (getter)PyUIFrame_get_children, NULL, "UICollection of objects on top of this one", NULL},
{"text", (getter)UICaption::get_text, (setter)UICaption::set_text, "The text displayed", NULL},
{"size", (getter)UICaption::get_float_member, (setter)UICaption::set_float_member, "Text size (integer) in points", (void*)5},
{"click", (getter)UIDrawable::get_click, (setter)UIDrawable::set_click, "Object called with (x, y, button) when clicked", (void*)PyObjectsEnum::UICAPTION},
{NULL}
};
PyObject* UICaption::repr(PyUICaptionObject* self)
{
std::ostringstream ss;
if (!self->data) ss << "<Caption (invalid internal object)>";
else {
auto text = self->data->text;
auto fc = text.getFillColor();
auto oc = text.getOutlineColor();
ss << "<Caption (x=" << text.getPosition().x << ", y=" << text.getPosition().y << ", " <<
"text='" << (std::string)text.getString() << "', " <<
"outline=" << text.getOutlineThickness() << ", " <<
"fill_color=(" << (int)fc.r << ", " << (int)fc.g << ", " << (int)fc.b << ", " << (int)fc.a <<"), " <<
"outlinecolor=(" << (int)oc.r << ", " << (int)oc.g << ", " << (int)oc.b << ", " << (int)oc.a <<"), " <<
")>";
}
std::string repr_str = ss.str();
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
}
int UICaption::init(PyUICaptionObject* self, PyObject* args, PyObject* kwds)
{
using namespace mcrfpydef;
static const char* keywords[] = { "x", "y", "text", "font", "fill_color", "outline_color", nullptr };
float x = 0.0f, y = 0.0f;
char* text;
PyObject* font, fill_color, outline_color;
if (!PyArg_ParseTupleAndKeywords(args, kwds, "|ffzOOO",
const_cast<char**>(keywords), &x, &y, &text, &font, &fill_color, &outline_color))
{
return -1;
}
// check types for font, fill_color, outline_color
std::cout << PyUnicode_AsUTF8(PyObject_Repr(font)) << std::endl;
if (font != NULL && !PyObject_IsInstance(font, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Font")/*(PyObject*)&PyFontType)*/)){
PyErr_SetString(PyExc_TypeError, "font must be a mcrfpy.Font instance");
return -1;
} else if (font != NULL)
{
auto font_obj = (PyFontObject*)font;
self->data->text.setFont(font_obj->data->font);
self->font = font;
Py_INCREF(font);
} else
{
// default font
//self->data->text.setFont(Resources::game->getFont());
}
self->data->text.setPosition(sf::Vector2f(x, y));
self->data->text.setString((std::string)text);
self->data->text.setFillColor(sf::Color(0,0,0,255));
self->data->text.setOutlineColor(sf::Color(128,128,128,255));
return 0;
}

62
src/UICaption.h Normal file
View File

@ -0,0 +1,62 @@
#pragma once
#include "Common.h"
#include "Python.h"
#include "UIDrawable.h"
class UICaption: public UIDrawable
{
public:
sf::Text text;
void render(sf::Vector2f) override final;
PyObjectsEnum derived_type() override final;
virtual UIDrawable* click_at(sf::Vector2f point) override final;
static PyObject* get_float_member(PyUICaptionObject* self, void* closure);
static int set_float_member(PyUICaptionObject* self, PyObject* value, void* closure);
static PyObject* get_vec_member(PyUICaptionObject* self, void* closure);
static int set_vec_member(PyUICaptionObject* self, PyObject* value, void* closure);
static PyObject* get_color_member(PyUICaptionObject* self, void* closure);
static int set_color_member(PyUICaptionObject* self, PyObject* value, void* closure);
static PyObject* get_text(PyUICaptionObject* self, void* closure);
static int set_text(PyUICaptionObject* self, PyObject* value, void* closure);
static PyGetSetDef getsetters[];
static PyObject* repr(PyUICaptionObject* self);
static int init(PyUICaptionObject* self, PyObject* args, PyObject* kwds);
};
namespace mcrfpydef {
static PyTypeObject PyUICaptionType = {
.tp_name = "mcrfpy.Caption",
.tp_basicsize = sizeof(PyUICaptionObject),
.tp_itemsize = 0,
// TODO - move tp_dealloc to .cpp file as static function (UICaption::dealloc)
.tp_dealloc = (destructor)[](PyObject* self)
{
PyUICaptionObject* obj = (PyUICaptionObject*)self;
// TODO - reevaluate with PyFont usage; UICaption does not own the font
// release reference to font object
if (obj->font) Py_DECREF(obj->font);
obj->data.reset();
Py_TYPE(self)->tp_free(self);
},
.tp_repr = (reprfunc)UICaption::repr,
//.tp_hash = NULL,
//.tp_iter
//.tp_iternext
.tp_flags = Py_TPFLAGS_DEFAULT,
.tp_doc = PyDoc_STR("docstring"),
//.tp_methods = PyUIFrame_methods,
//.tp_members = PyUIFrame_members,
.tp_getset = UICaption::getsetters,
//.tp_base = NULL,
.tp_init = (initproc)UICaption::init,
// TODO - move tp_new to .cpp file as a static function (UICaption::new)
.tp_new = [](PyTypeObject* type, PyObject* args, PyObject* kwds) -> PyObject*
{
PyUICaptionObject* self = (PyUICaptionObject*)type->tp_alloc(type, 0);
if (self) self->data = std::make_shared<UICaption>();
return (PyObject*)self;
}
};
}

203
src/UICollection.cpp Normal file
View File

@ -0,0 +1,203 @@
#include "UICollection.h"
#include "UIFrame.h"
#include "UICaption.h"
#include "UISprite.h"
#include "UIGrid.h"
#include "McRFPy_API.h"
using namespace mcrfpydef;
int UICollectionIter::init(PyUICollectionIterObject* self, PyObject* args, PyObject* kwds)
{
PyErr_SetString(PyExc_TypeError, "UICollection cannot be instantiated: a C++ data source is required.");
return -1;
}
PyObject* UICollectionIter::next(PyUICollectionIterObject* self)
{
if (self->data->size() != self->start_size)
{
PyErr_SetString(PyExc_RuntimeError, "collection changed size during iteration");
return NULL;
}
if (self->index > self->start_size - 1)
{
PyErr_SetNone(PyExc_StopIteration);
return NULL;
}
self->index++;
auto vec = self->data.get();
if (!vec)
{
PyErr_SetString(PyExc_RuntimeError, "the collection store returned a null pointer");
return NULL;
}
auto target = (*vec)[self->index-1];
// TODO build PyObject* of the correct UIDrawable subclass to return
//return py_instance(target);
return NULL;
}
PyObject* UICollectionIter::repr(PyUICollectionIterObject* self)
{
std::ostringstream ss;
if (!self->data) ss << "<UICollectionIter (invalid internal object)>";
else {
ss << "<UICollectionIter (" << self->data->size() << " child objects, @ index " << self->index << ")>";
}
std::string repr_str = ss.str();
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
}
Py_ssize_t UICollection::len(PyUICollectionObject* self) {
return self->data->size();
}
PyObject* UICollection::getitem(PyUICollectionObject* self, Py_ssize_t index) {
// build a Python version of item at self->data[index]
// Copy pasted::
auto vec = self->data.get();
if (!vec)
{
PyErr_SetString(PyExc_RuntimeError, "the collection store returned a null pointer");
return NULL;
}
while (index < 0) index += self->data->size();
if (index > self->data->size() - 1)
{
PyErr_SetString(PyExc_IndexError, "UICollection index out of range");
return NULL;
}
auto target = (*vec)[index];
RET_PY_INSTANCE(target);
return NULL;
}
PySequenceMethods UICollection::sqmethods = {
.sq_length = (lenfunc)UICollection::len,
.sq_item = (ssizeargfunc)UICollection::getitem,
//.sq_item_by_index = PyUICollection_getitem
//.sq_slice - return a subset of the iterable
//.sq_ass_item - called when `o[x] = y` is executed (x is any object type)
//.sq_ass_slice - cool; no thanks, for now
//.sq_contains - called when `x in o` is executed
//.sq_ass_item_by_index - called when `o[x] = y` is executed (x is explictly an integer)
};
/* Idiomatic way to fetch complete types from the API rather than referencing their PyTypeObject struct
auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "Texture");
I never identified why `using namespace mcrfpydef;` doesn't solve the segfault issue.
The horrible macro in UIDrawable was originally a workaround for this, but as I interact with the types outside of the monster UI.h, a more general (and less icky) solution is required.
*/
PyObject* UICollection::append(PyUICollectionObject* self, PyObject* o)
{
// if not UIDrawable subclass, reject it
// self->data->push_back( c++ object inside o );
// this would be a great use case for .tp_base
if (!PyObject_IsInstance(o, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Frame")) &&
!PyObject_IsInstance(o, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Sprite")) &&
!PyObject_IsInstance(o, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Caption")) &&
!PyObject_IsInstance(o, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Grid"))
)
{
PyErr_SetString(PyExc_TypeError, "Only Frame, Caption, Sprite, and Grid objects can be added to UICollection");
return NULL;
}
if (PyObject_IsInstance(o, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Frame")))
{
PyUIFrameObject* frame = (PyUIFrameObject*)o;
self->data->push_back(frame->data);
}
if (PyObject_IsInstance(o, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Caption")))
{
PyUICaptionObject* caption = (PyUICaptionObject*)o;
self->data->push_back(caption->data);
}
if (PyObject_IsInstance(o, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Sprite")))
{
PyUISpriteObject* sprite = (PyUISpriteObject*)o;
self->data->push_back(sprite->data);
}
if (PyObject_IsInstance(o, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Grid")))
{
PyUIGridObject* grid = (PyUIGridObject*)o;
self->data->push_back(grid->data);
}
Py_INCREF(Py_None);
return Py_None;
}
PyObject* UICollection::remove(PyUICollectionObject* self, PyObject* o)
{
if (!PyLong_Check(o))
{
PyErr_SetString(PyExc_TypeError, "UICollection.remove requires an integer index to remove");
return NULL;
}
long index = PyLong_AsLong(o);
if (index >= self->data->size())
{
PyErr_SetString(PyExc_ValueError, "Index out of range");
return NULL;
}
else if (index < 0)
{
PyErr_SetString(PyExc_NotImplementedError, "reverse indexing is not implemented.");
return NULL;
}
// release the shared pointer at self->data[index];
self->data->erase(self->data->begin() + index);
Py_INCREF(Py_None);
return Py_None;
}
PyMethodDef UICollection::methods[] = {
{"append", (PyCFunction)UICollection::append, METH_O},
//{"extend", (PyCFunction)PyUICollection_extend, METH_O}, // TODO
{"remove", (PyCFunction)UICollection::remove, METH_O},
{NULL, NULL, 0, NULL}
};
PyObject* UICollection::repr(PyUICollectionObject* self)
{
std::ostringstream ss;
if (!self->data) ss << "<UICollection (invalid internal object)>";
else {
ss << "<UICollection (" << self->data->size() << " child objects)>";
}
std::string repr_str = ss.str();
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
}
int UICollection::init(PyUICollectionObject* self, PyObject* args, PyObject* kwds)
{
PyErr_SetString(PyExc_TypeError, "UICollection cannot be instantiated: a C++ data source is required.");
return -1;
}
PyObject* UICollection::iter(PyUICollectionObject* self)
{
PyUICollectionIterObject* iterObj;
iterObj = (PyUICollectionIterObject*)PyUICollectionIterType.tp_alloc(&PyUICollectionIterType, 0);
if (iterObj == NULL) {
return NULL; // Failed to allocate memory for the iterator object
}
iterObj->data = self->data;
iterObj->index = 0;
iterObj->start_size = self->data->size();
return (PyObject*)iterObj;
}

88
src/UICollection.h Normal file
View File

@ -0,0 +1,88 @@
#pragma once
#include "Common.h"
#include "Python.h"
#include "UIDrawable.h"
class UICollectionIter
{
// really more of a namespace: all the members are public and static. But being consistent with other UI objects
public:
static int init(PyUICollectionIterObject* self, PyObject* args, PyObject* kwds);
static PyObject* next(PyUICollectionIterObject* self);
static PyObject* repr(PyUICollectionIterObject* self);
};
class UICollection
{
// really more of a namespace: all the members are public and static. But being consistent with other UI objects
public:
static Py_ssize_t len(PyUICollectionObject* self);
static PyObject* getitem(PyUICollectionObject* self, Py_ssize_t index);
static PySequenceMethods sqmethods;
static PyObject* append(PyUICollectionObject* self, PyObject* o);
static PyObject* remove(PyUICollectionObject* self, PyObject* o);
static PyMethodDef methods[];
static PyObject* repr(PyUICollectionObject* self);
static int init(PyUICollectionObject* self, PyObject* args, PyObject* kwds);
static PyObject* iter(PyUICollectionObject* self);
};
namespace mcrfpydef {
static PyTypeObject PyUICollectionIterType = {
//PyVarObject_HEAD_INIT(NULL, 0)
.tp_name = "mcrfpy.UICollectionIter",
.tp_basicsize = sizeof(PyUICollectionIterObject),
.tp_itemsize = 0,
//TODO - as static method, not inline lambda def, please
.tp_dealloc = (destructor)[](PyObject* self)
{
PyUICollectionIterObject* obj = (PyUICollectionIterObject*)self;
obj->data.reset();
Py_TYPE(self)->tp_free(self);
},
.tp_repr = (reprfunc)UICollectionIter::repr,
.tp_flags = Py_TPFLAGS_DEFAULT,
.tp_doc = PyDoc_STR("Iterator for a collection of UI objects"),
.tp_iternext = (iternextfunc)UICollectionIter::next,
//.tp_getset = PyUICollection_getset,
.tp_init = (initproc)UICollectionIter::init, // just raise an exception
//TODO - as static method, not inline lambda def, please
.tp_new = [](PyTypeObject* type, PyObject* args, PyObject* kwds) -> PyObject*
{
PyErr_SetString(PyExc_TypeError, "UICollection cannot be instantiated: a C++ data source is required.");
return NULL;
}
};
static PyTypeObject PyUICollectionType = {
//PyVarObject_/HEAD_INIT(NULL, 0)
.tp_name = "mcrfpy.UICollection",
.tp_basicsize = sizeof(PyUICollectionObject),
.tp_itemsize = 0,
//TODO - as static method, not inline lambda def, please
.tp_dealloc = (destructor)[](PyObject* self)
{
PyUICollectionObject* obj = (PyUICollectionObject*)self;
obj->data.reset();
Py_TYPE(self)->tp_free(self);
},
.tp_repr = (reprfunc)UICollection::repr,
.tp_as_sequence = &UICollection::sqmethods,
.tp_flags = Py_TPFLAGS_DEFAULT,
.tp_doc = PyDoc_STR("Iterable, indexable collection of UI objects"),
.tp_iter = (getiterfunc)UICollection::iter,
.tp_methods = UICollection::methods, // append, remove
//.tp_getset = PyUICollection_getset,
.tp_init = (initproc)UICollection::init, // just raise an exception
//TODO - as static method, not inline lambda def, please
.tp_new = [](PyTypeObject* type, PyObject* args, PyObject* kwds) -> PyObject*
{
// Does PyUICollectionType need __new__ if it's not supposed to be instantiable by the user?
// Should I just raise an exception? Or is the uninitialized shared_ptr enough of a blocker?
PyErr_SetString(PyExc_TypeError, "UICollection cannot be instantiated: a C++ data source is required.");
return NULL;
}
};
}

81
src/UIDrawable.cpp Normal file
View File

@ -0,0 +1,81 @@
#include "UIDrawable.h"
#include "UIFrame.h"
#include "UICaption.h"
#include "UISprite.h"
#include "UIGrid.h"
UIDrawable::UIDrawable() { click_callable = NULL; }
void UIDrawable::click_unregister()
{
click_callable.reset();
}
void UIDrawable::render()
{
render(sf::Vector2f());
}
PyObject* UIDrawable::get_click(PyObject* self, void* closure) {
PyObjectsEnum objtype = static_cast<PyObjectsEnum>(reinterpret_cast<long>(closure)); // trust me bro, it's an Enum
PyObject* ptr;
switch (objtype)
{
case PyObjectsEnum::UIFRAME:
ptr = ((PyUIFrameObject*)self)->data->click_callable->borrow();
break;
case PyObjectsEnum::UICAPTION:
ptr = ((PyUICaptionObject*)self)->data->click_callable->borrow();
break;
case PyObjectsEnum::UISPRITE:
ptr = ((PyUISpriteObject*)self)->data->click_callable->borrow();
break;
case PyObjectsEnum::UIGRID:
ptr = ((PyUIGridObject*)self)->data->click_callable->borrow();
break;
default:
PyErr_SetString(PyExc_TypeError, "no idea how you did that; invalid UIDrawable derived instance for _get_click");
return NULL;
}
if (ptr && ptr != Py_None)
return ptr;
else
return Py_None;
}
int UIDrawable::set_click(PyObject* self, PyObject* value, void* closure) {
PyObjectsEnum objtype = static_cast<PyObjectsEnum>(reinterpret_cast<long>(closure)); // trust me bro, it's an Enum
UIDrawable* target;
switch (objtype)
{
case PyObjectsEnum::UIFRAME:
target = (((PyUIFrameObject*)self)->data.get());
break;
case PyObjectsEnum::UICAPTION:
target = (((PyUICaptionObject*)self)->data.get());
break;
case PyObjectsEnum::UISPRITE:
target = (((PyUISpriteObject*)self)->data.get());
break;
case PyObjectsEnum::UIGRID:
target = (((PyUIGridObject*)self)->data.get());
break;
default:
PyErr_SetString(PyExc_TypeError, "no idea how you did that; invalid UIDrawable derived instance for _set_click");
return -1;
}
if (value == Py_None)
{
target->click_unregister();
} else {
target->click_register(value);
}
return 0;
}
void UIDrawable::click_register(PyObject* callable)
{
click_callable = std::make_unique<PyClickCallable>(callable);
}

176
src/UIDrawable.h Normal file
View File

@ -0,0 +1,176 @@
#pragma once
#include "Common.h"
#include "Python.h"
#include "structmember.h"
#include "IndexTexture.h"
#include "Resources.h"
#include <list>
#include "PyCallable.h"
#include "PyTexture.h"
#include "PyColor.h"
#include "PyVector.h"
#include "PyFont.h"
#include "Resources.h"
#include "UIBase.h"
class UIFrame; class UICaption; class UISprite; class UIEntity; class UIGrid;
enum PyObjectsEnum : int
{
UIFRAME = 1,
UICAPTION,
UISPRITE,
UIGRID
};
class UIDrawable
{
public:
void render();
virtual void render(sf::Vector2f) = 0;
virtual PyObjectsEnum derived_type() = 0;
// Mouse input handling - callable object, methods to find event's destination
std::unique_ptr<PyClickCallable> click_callable;
virtual UIDrawable* click_at(sf::Vector2f point) = 0;
void click_register(PyObject*);
void click_unregister();
UIDrawable();
static PyObject* get_click(PyObject* self, void* closure);
static int set_click(PyObject* self, PyObject* value, void* closure);
};
typedef struct {
PyObject_HEAD
std::shared_ptr<std::vector<std::shared_ptr<UIDrawable>>> data;
} PyUICollectionObject;
typedef struct {
PyObject_HEAD
std::shared_ptr<std::vector<std::shared_ptr<UIDrawable>>> data;
int index;
int start_size;
} PyUICollectionIterObject;
namespace mcrfpydef {
//PyObject* py_instance(std::shared_ptr<UIDrawable> source);
// This function segfaults on tp_alloc for an unknown reason, but works inline with mcrfpydef:: methods.
#define RET_PY_INSTANCE(target) { \
switch (target->derived_type()) \
{ \
case PyObjectsEnum::UIFRAME: \
{ \
PyUIFrameObject* o = (PyUIFrameObject*)((&PyUIFrameType)->tp_alloc(&PyUIFrameType, 0)); \
if (o) \
{ \
auto p = std::static_pointer_cast<UIFrame>(target); \
o->data = p; \
auto utarget = o->data; \
} \
return (PyObject*)o; \
} \
case PyObjectsEnum::UICAPTION: \
{ \
PyUICaptionObject* o = (PyUICaptionObject*)((&PyUICaptionType)->tp_alloc(&PyUICaptionType, 0)); \
if (o) \
{ \
auto p = std::static_pointer_cast<UICaption>(target); \
o->data = p; \
auto utarget = o->data; \
} \
return (PyObject*)o; \
} \
case PyObjectsEnum::UISPRITE: \
{ \
PyUISpriteObject* o = (PyUISpriteObject*)((&PyUISpriteType)->tp_alloc(&PyUISpriteType, 0)); \
if (o) \
{ \
auto p = std::static_pointer_cast<UISprite>(target); \
o->data = p; \
auto utarget = o->data; \
} \
return (PyObject*)o; \
} \
case PyObjectsEnum::UIGRID: \
{ \
PyUIGridObject* o = (PyUIGridObject*)((&PyUIGridType)->tp_alloc(&PyUIGridType, 0)); \
if (o) \
{ \
auto p = std::static_pointer_cast<UIGrid>(target); \
o->data = p; \
auto utarget = o->data; \
} \
return (PyObject*)o; \
} \
} \
}
// end macro definition
//TODO: add this method to class scope; move implementation to .cpp file
/*
static PyObject* PyUIDrawable_get_click(PyObject* self, void* closure) {
PyObjectsEnum objtype = static_cast<PyObjectsEnum>(reinterpret_cast<long>(closure)); // trust me bro, it's an Enum
PyObject* ptr;
switch (objtype)
{
case PyObjectsEnum::UIFRAME:
ptr = ((PyUIFrameObject*)self)->data->click_callable->borrow();
break;
case PyObjectsEnum::UICAPTION:
ptr = ((PyUICaptionObject*)self)->data->click_callable->borrow();
break;
case PyObjectsEnum::UISPRITE:
ptr = ((PyUISpriteObject*)self)->data->click_callable->borrow();
break;
case PyObjectsEnum::UIGRID:
ptr = ((PyUIGridObject*)self)->data->click_callable->borrow();
break;
default:
PyErr_SetString(PyExc_TypeError, "no idea how you did that; invalid UIDrawable derived instance for _get_click");
return NULL;
}
if (ptr && ptr != Py_None)
return ptr;
else
return Py_None;
}*/
//TODO: add this method to class scope; move implementation to .cpp file
/*
static int PyUIDrawable_set_click(PyObject* self, PyObject* value, void* closure) {
PyObjectsEnum objtype = static_cast<PyObjectsEnum>(reinterpret_cast<long>(closure)); // trust me bro, it's an Enum
UIDrawable* target;
switch (objtype)
{
case PyObjectsEnum::UIFRAME:
target = (((PyUIFrameObject*)self)->data.get());
break;
case PyObjectsEnum::UICAPTION:
target = (((PyUICaptionObject*)self)->data.get());
break;
case PyObjectsEnum::UISPRITE:
target = (((PyUISpriteObject*)self)->data.get());
break;
case PyObjectsEnum::UIGRID:
target = (((PyUIGridObject*)self)->data.get());
break;
default:
PyErr_SetString(PyExc_TypeError, "no idea how you did that; invalid UIDrawable derived instance for _set_click");
return -1;
}
if (value == Py_None)
{
target->click_unregister();
} else {
target->click_register(value);
}
return 0;
}
*/
}

165
src/UIEntity.cpp Normal file
View File

@ -0,0 +1,165 @@
#include "UIEntity.h"
#include "UIGrid.h"
#include "McRFPy_API.h"
UIEntity::UIEntity() {} // this will not work lol. TODO remove default constructor by finding the shared pointer inits that use it
UIEntity::UIEntity(UIGrid& grid)
: gridstate(grid.grid_x * grid.grid_y)
{
}
PyObject* UIEntity::at(PyUIEntityObject* self, PyObject* o) {
int x, y;
if (!PyArg_ParseTuple(o, "ii", &x, &y)) {
PyErr_SetString(PyExc_TypeError, "UIEntity.at requires two integer arguments: (x, y)");
return NULL;
}
if (self->data->grid == NULL) {
PyErr_SetString(PyExc_ValueError, "Entity cannot access surroundings because it is not associated with a grid");
return NULL;
}
/*
PyUIGridPointStateObject* obj = (PyUIGridPointStateObject*)((&mcrfpydef::PyUIGridPointStateType)->tp_alloc(&mcrfpydef::PyUIGridPointStateType, 0));
*/
auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "GridPointState");
auto obj = (PyUIGridPointStateObject*)type->tp_alloc(type, 0);
//auto target = std::static_pointer_cast<UIEntity>(target);
obj->data = &(self->data->gridstate[y + self->data->grid->grid_x * x]);
obj->grid = self->data->grid;
obj->entity = self->data;
return (PyObject*)obj;
}
int UIEntity::init(PyUIEntityObject* self, PyObject* args, PyObject* kwds) {
static const char* keywords[] = { "x", "y", "texture", "sprite_index", "grid", nullptr };
float x = 0.0f, y = 0.0f, scale = 1.0f;
int sprite_index = -1;
PyObject* texture = NULL;
PyObject* grid = NULL;
if (!PyArg_ParseTupleAndKeywords(args, kwds, "ffOi|O",
const_cast<char**>(keywords), &x, &y, &texture, &sprite_index, &grid))
{
return -1;
}
// check types for texture
//
// Set Texture
//
if (texture != NULL && !PyObject_IsInstance(texture, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Texture"))){
PyErr_SetString(PyExc_TypeError, "texture must be a mcrfpy.Texture instance");
return -1;
} /*else if (texture != NULL) // this section needs to go; texture isn't optional and isn't managed by the UI objects anymore
{
self->texture = texture;
Py_INCREF(texture);
} else
{
// default tex?
}*/
if (grid != NULL && !PyObject_IsInstance(grid, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Grid"))) {
PyErr_SetString(PyExc_TypeError, "grid must be a mcrfpy.Grid instance");
return -1;
}
auto pytexture = (PyTextureObject*)texture;
if (grid == NULL)
self->data = std::make_shared<UIEntity>();
else
self->data = std::make_shared<UIEntity>(*((PyUIGridObject*)grid)->data);
// TODO - PyTextureObjects and IndexTextures are a little bit of a mess with shared/unshared pointers
self->data->sprite = UISprite(pytexture->data, sprite_index, sf::Vector2f(0,0), 1.0);
self->data->position = sf::Vector2f(x, y);
if (grid != NULL) {
PyUIGridObject* pygrid = (PyUIGridObject*)grid;
self->data->grid = pygrid->data;
// todone - on creation of Entity with Grid assignment, also append it to the entity list
pygrid->data->entities->push_back(self->data);
}
return 0;
}
PyObject* UIEntity::get_spritenumber(PyUIEntityObject* self, void* closure) {
return PyLong_FromDouble(self->data->sprite.getSpriteIndex());
}
PyObject* sfVector2f_to_PyObject(sf::Vector2f vector) {
return Py_BuildValue("(ff)", vector.x, vector.y);
}
sf::Vector2f PyObject_to_sfVector2f(PyObject* obj) {
float x, y;
if (!PyArg_ParseTuple(obj, "ff", &x, &y)) {
return sf::Vector2f(); // TODO / reconsider this default: Return default vector on parse error
}
return sf::Vector2f(x, y);
}
// TODO - deprecate / remove this helper
PyObject* UIGridPointState_to_PyObject(const UIGridPointState& state) {
return PyObject_New(PyObject, (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "GridPointState"));
}
PyObject* UIGridPointStateVector_to_PyList(const std::vector<UIGridPointState>& vec) {
PyObject* list = PyList_New(vec.size());
if (!list) return PyErr_NoMemory();
for (size_t i = 0; i < vec.size(); ++i) {
PyObject* obj = UIGridPointState_to_PyObject(vec[i]);
if (!obj) { // Cleanup on failure
Py_DECREF(list);
return NULL;
}
PyList_SET_ITEM(list, i, obj); // This steals a reference to obj
}
return list;
}
PyObject* UIEntity::get_position(PyUIEntityObject* self, void* closure) {
return sfVector2f_to_PyObject(self->data->position);
}
int UIEntity::set_position(PyUIEntityObject* self, PyObject* value, void* closure) {
self->data->position = PyObject_to_sfVector2f(value);
return 0;
}
PyObject* UIEntity::get_gridstate(PyUIEntityObject* self, void* closure) {
// Assuming a function to convert std::vector<UIGridPointState> to PyObject* list
return UIGridPointStateVector_to_PyList(self->data->gridstate);
}
int UIEntity::set_spritenumber(PyUIEntityObject* self, PyObject* value, void* closure) {
int val;
if (PyLong_Check(value))
val = PyLong_AsLong(value);
else
{
PyErr_SetString(PyExc_TypeError, "Value must be an integer.");
return -1;
}
//self->data->sprite.sprite_index = val;
self->data->sprite.setSpriteIndex(val); // todone - I don't like ".sprite.sprite" in this stack of UIEntity.UISprite.sf::Sprite
return 0;
}
PyMethodDef UIEntity::methods[] = {
{"at", (PyCFunction)UIEntity::at, METH_O},
{NULL, NULL, 0, NULL}
};
PyGetSetDef UIEntity::getsetters[] = {
{"position", (getter)UIEntity::get_position, (setter)UIEntity::set_position, "Entity position", NULL},
{"gridstate", (getter)UIEntity::get_gridstate, NULL, "Grid point states for the entity", NULL},
{"sprite_number", (getter)UIEntity::get_spritenumber, (setter)UIEntity::set_spritenumber, "Sprite number (index) on the texture on the display", NULL},
{NULL} /* Sentinel */
};

74
src/UIEntity.h Normal file
View File

@ -0,0 +1,74 @@
#pragma once
#include "Common.h"
#include "Python.h"
#include "structmember.h"
#include "IndexTexture.h"
#include "Resources.h"
#include <list>
#include "PyCallable.h"
#include "PyTexture.h"
#include "PyColor.h"
#include "PyVector.h"
#include "PyFont.h"
#include "UIGridPoint.h"
#include "UIDrawable.h"
#include "UIBase.h"
#include "UISprite.h"
class UIGrid;
//class UIEntity;
//typedef struct {
// PyObject_HEAD
// std::shared_ptr<UIEntity> data;
//} PyUIEntityObject;
// helper methods with no namespace requirement
static PyObject* sfVector2f_to_PyObject(sf::Vector2f vector);
static sf::Vector2f PyObject_to_sfVector2f(PyObject* obj);
static PyObject* UIGridPointState_to_PyObject(const UIGridPointState& state);
static PyObject* UIGridPointStateVector_to_PyList(const std::vector<UIGridPointState>& vec);
// TODO: make UIEntity a drawable
class UIEntity//: public UIDrawable
{
public:
//PyObject* self;
std::shared_ptr<UIGrid> grid;
std::vector<UIGridPointState> gridstate;
UISprite sprite;
sf::Vector2f position; //(x,y) in grid coordinates; float for animation
void render(sf::Vector2f); //override final;
UIEntity();
UIEntity(UIGrid&);
static PyObject* at(PyUIEntityObject* self, PyObject* o);
static int init(PyUIEntityObject* self, PyObject* args, PyObject* kwds);
static PyObject* get_position(PyUIEntityObject* self, void* closure);
static int set_position(PyUIEntityObject* self, PyObject* value, void* closure);
static PyObject* get_gridstate(PyUIEntityObject* self, void* closure);
static PyObject* get_spritenumber(PyUIEntityObject* self, void* closure);
static int set_spritenumber(PyUIEntityObject* self, PyObject* value, void* closure);
static PyMethodDef methods[];
static PyGetSetDef getsetters[];
};
namespace mcrfpydef {
static PyTypeObject PyUIEntityType = {
//PyVarObject_HEAD_INIT(NULL, 0)
.tp_name = "mcrfpy.Entity",
.tp_basicsize = sizeof(PyUIEntityObject),
.tp_itemsize = 0,
// Methods omitted for brevity
.tp_flags = Py_TPFLAGS_DEFAULT,
.tp_doc = "UIEntity objects",
.tp_methods = UIEntity::methods,
.tp_getset = UIEntity::getsetters,
.tp_init = (initproc)UIEntity::init,
.tp_new = PyType_GenericNew,
};
}

265
src/UIFrame.cpp Normal file
View File

@ -0,0 +1,265 @@
#include "UIFrame.h"
#include "UICollection.h"
#include "GameEngine.h"
UIDrawable* UIFrame::click_at(sf::Vector2f point)
{
for (auto e: *children)
{
auto p = e->click_at(point + box.getPosition());
if (p)
return p;
}
if (click_callable)
{
float x = box.getPosition().x, y = box.getPosition().y, w = box.getSize().x, h = box.getSize().y;
if (point.x > x && point.y > y && point.x < x+w && point.y < y+h) return this;
}
return NULL;
}
UIFrame::UIFrame()
: outline(0)
{
children = std::make_shared<std::vector<std::shared_ptr<UIDrawable>>>();
box.setPosition(0, 0);
box.setSize(sf::Vector2f(0, 0));
}
UIFrame::UIFrame(float _x, float _y, float _w, float _h)
: outline(0)
{
box.setPosition(_x, _y);
box.setSize(sf::Vector2f(_w, _h));
children = std::make_shared<std::vector<std::shared_ptr<UIDrawable>>>();
}
UIFrame::~UIFrame()
{
children.reset();
}
PyObjectsEnum UIFrame::derived_type()
{
return PyObjectsEnum::UIFRAME;
}
void UIFrame::render(sf::Vector2f offset)
{
box.move(offset);
Resources::game->getWindow().draw(box);
box.move(-offset);
for (auto drawable : *children) {
drawable->render(offset + box.getPosition());
}
}
PyObject* UIFrame::get_children(PyUIFrameObject* self, void* closure)
{
// create PyUICollection instance pointing to self->data->children
//PyUICollectionObject* o = (PyUICollectionObject*)mcrfpydef::PyUICollectionType.tp_alloc(&mcrfpydef::PyUICollectionType, 0);
auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "UICollection");
auto o = (PyUICollectionObject*)type->tp_alloc(type, 0);
if (o)
o->data = self->data->children;
return (PyObject*)o;
}
PyObject* UIFrame::get_float_member(PyUIFrameObject* self, void* closure)
{
auto member_ptr = reinterpret_cast<long>(closure);
if (member_ptr == 0)
return PyFloat_FromDouble(self->data->box.getPosition().x);
else if (member_ptr == 1)
return PyFloat_FromDouble(self->data->box.getPosition().y);
else if (member_ptr == 2)
return PyFloat_FromDouble(self->data->box.getSize().x);
else if (member_ptr == 3)
return PyFloat_FromDouble(self->data->box.getSize().y);
else if (member_ptr == 4)
return PyFloat_FromDouble(self->data->box.getOutlineThickness());
else
{
PyErr_SetString(PyExc_AttributeError, "Invalid attribute");
return nullptr;
}
}
int UIFrame::set_float_member(PyUIFrameObject* self, PyObject* value, void* closure)
{
float val;
auto member_ptr = reinterpret_cast<long>(closure);
if (PyFloat_Check(value))
{
val = PyFloat_AsDouble(value);
}
else if (PyLong_Check(value))
{
val = PyLong_AsLong(value);
}
else
{
PyErr_SetString(PyExc_TypeError, "Value must be an integer.");
return -1;
}
if (member_ptr == 0) //x
self->data->box.setPosition(val, self->data->box.getPosition().y);
else if (member_ptr == 1) //y
self->data->box.setPosition(self->data->box.getPosition().x, val);
else if (member_ptr == 2) //w
self->data->box.setSize(sf::Vector2f(val, self->data->box.getSize().y));
else if (member_ptr == 3) //h
self->data->box.setSize(sf::Vector2f(self->data->box.getSize().x, val));
else if (member_ptr == 4) //outline
self->data->box.setOutlineThickness(val);
return 0;
}
PyObject* UIFrame::get_color_member(PyUIFrameObject* self, void* closure)
{
// validate closure (should be impossible to be wrong, but it's thorough)
auto member_ptr = reinterpret_cast<long>(closure);
if (member_ptr != 0 && member_ptr != 1)
{
PyErr_SetString(PyExc_AttributeError, "Invalid attribute");
return nullptr;
}
//PyTypeObject* colorType = &PyColorType;
auto colorType = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "Color");
PyObject* pyColor = colorType->tp_alloc(colorType, 0);
if (pyColor == NULL)
{
std::cout << "failure to allocate mcrfpy.Color / PyColorType" << std::endl;
return NULL;
}
PyColorObject* pyColorObj = reinterpret_cast<PyColorObject*>(pyColor);
// fetch correct member data
sf::Color color;
if (member_ptr == 0)
{
color = self->data->box.getFillColor();
//return Py_BuildValue("(iii)", color.r, color.g, color.b);
}
else if (member_ptr == 1)
{
color = self->data->box.getOutlineColor();
//return Py_BuildValue("(iii)", color.r, color.g, color.b);
}
return PyColor(color).pyObject();
}
int UIFrame::set_color_member(PyUIFrameObject* self, PyObject* value, void* closure)
{
//TODO: this logic of (PyColor instance OR tuple -> sf::color) should be encapsulated for reuse
auto member_ptr = reinterpret_cast<long>(closure);
int r, g, b, a;
if (PyObject_IsInstance(value, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Color")))
{
sf::Color c = ((PyColorObject*)value)->data;
r = c.r; g = c.g; b = c.b; a = c.a;
}
else if (!PyTuple_Check(value) || PyTuple_Size(value) < 3 || PyTuple_Size(value) > 4)
{
// reject non-Color, non-tuple value
PyErr_SetString(PyExc_TypeError, "Value must be a tuple of 3 or 4 integers or an mcrfpy.Color object.");
return -1;
}
else // get value from tuples
{
r = PyLong_AsLong(PyTuple_GetItem(value, 0));
g = PyLong_AsLong(PyTuple_GetItem(value, 1));
b = PyLong_AsLong(PyTuple_GetItem(value, 2));
a = 255;
if (PyTuple_Size(value) == 4)
{
a = PyLong_AsLong(PyTuple_GetItem(value, 3));
}
}
if (r < 0 || r > 255 || g < 0 || g > 255 || b < 0 || b > 255 || a < 0 || a > 255)
{
PyErr_SetString(PyExc_ValueError, "Color values must be between 0 and 255.");
return -1;
}
if (member_ptr == 0)
{
self->data->box.setFillColor(sf::Color(r, g, b, a));
}
else if (member_ptr == 1)
{
self->data->box.setOutlineColor(sf::Color(r, g, b, a));
}
else
{
PyErr_SetString(PyExc_AttributeError, "Invalid attribute");
return -1;
}
return 0;
}
PyGetSetDef UIFrame::getsetters[] = {
{"x", (getter)UIFrame::get_float_member, (setter)UIFrame::set_float_member, "X coordinate of top-left corner", (void*)0},
{"y", (getter)UIFrame::get_float_member, (setter)UIFrame::set_float_member, "Y coordinate of top-left corner", (void*)1},
{"w", (getter)UIFrame::get_float_member, (setter)UIFrame::set_float_member, "width of the rectangle", (void*)2},
{"h", (getter)UIFrame::get_float_member, (setter)UIFrame::set_float_member, "height of the rectangle", (void*)3},
{"outline", (getter)UIFrame::get_float_member, (setter)UIFrame::set_float_member, "Thickness of the border", (void*)4},
{"fill_color", (getter)UIFrame::get_color_member, (setter)UIFrame::set_color_member, "Fill color of the rectangle", (void*)0},
{"outline_color", (getter)UIFrame::get_color_member, (setter)UIFrame::set_color_member, "Outline color of the rectangle", (void*)1},
{"children", (getter)UIFrame::get_children, NULL, "UICollection of objects on top of this one", NULL},
{"click", (getter)UIDrawable::get_click, (setter)UIDrawable::set_click, "Object called with (x, y, button) when clicked", (void*)PyObjectsEnum::UIFRAME},
{NULL}
};
PyObject* UIFrame::repr(PyUIFrameObject* self)
{
std::ostringstream ss;
if (!self->data) ss << "<Frame (invalid internal object)>";
else {
auto box = self->data->box;
auto fc = box.getFillColor();
auto oc = box.getOutlineColor();
ss << "<Frame (x=" << box.getPosition().x << ", y=" << box.getPosition().y << ", x=" <<
box.getSize().x << ", w=" << box.getSize().y << ", " <<
"outline=" << box.getOutlineThickness() << ", " <<
"fill_color=(" << (int)fc.r << ", " << (int)fc.g << ", " << (int)fc.b << ", " << (int)fc.a <<"), " <<
"outline_color=(" << (int)oc.r << ", " << (int)oc.g << ", " << (int)oc.b << ", " << (int)oc.a <<"), " <<
self->data->children->size() << " child objects" <<
")>";
}
std::string repr_str = ss.str();
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
}
int UIFrame::init(PyUIFrameObject* self, PyObject* args, PyObject* kwds)
{
//std::cout << "Init called\n";
const char* keywords[] = { "x", "y", "w", "h", "fill_color", "outline_color", "outline", nullptr };
float x = 0.0f, y = 0.0f, w = 0.0f, h=0.0f, outline=0.0f;
PyObject* fill_color = 0;
PyObject* outline_color = 0;
if (!PyArg_ParseTupleAndKeywords(args, kwds, "ffff|OOf", const_cast<char**>(keywords), &x, &y, &w, &h, &fill_color, &outline_color, &outline))
{
return -1;
}
self->data->box.setPosition(sf::Vector2f(x, y));
self->data->box.setSize(sf::Vector2f(w, h));
self->data->box.setOutlineThickness(outline);
// getsetter abuse because I haven't standardized Color object parsing (TODO)
int err_val = 0;
if (fill_color && fill_color != Py_None) err_val = UIFrame::set_color_member(self, fill_color, (void*)0);
else self->data->box.setFillColor(sf::Color(0,0,0,255));
if (err_val) return err_val;
if (outline_color && outline_color != Py_None) err_val = UIFrame::set_color_member(self, outline_color, (void*)1);
else self->data->box.setOutlineColor(sf::Color(128,128,128,255));
if (err_val) return err_val;
return 0;
}

77
src/UIFrame.h Normal file
View File

@ -0,0 +1,77 @@
#pragma once
#include "Common.h"
#include "Python.h"
#include "structmember.h"
#include "IndexTexture.h"
#include "Resources.h"
#include <list>
#include "PyCallable.h"
#include "PyColor.h"
#include "PyVector.h"
#include "UIDrawable.h"
#include "UIBase.h"
//class UIFrame;
//
//typedef struct {
// PyObject_HEAD
// std::shared_ptr<UIFrame> data;
//} PyUIFrameObject;
class UIFrame: public UIDrawable
{
public:
UIFrame(float, float, float, float);
UIFrame();
~UIFrame();
sf::RectangleShape box;
float outline;
std::shared_ptr<std::vector<std::shared_ptr<UIDrawable>>> children;
void render(sf::Vector2f) override final;
void move(sf::Vector2f);
PyObjectsEnum derived_type() override final;
virtual UIDrawable* click_at(sf::Vector2f point) override final;
static PyObject* get_children(PyUIFrameObject* self, void* closure);
static PyObject* get_float_member(PyUIFrameObject* self, void* closure);
static int set_float_member(PyUIFrameObject* self, PyObject* value, void* closure);
static PyObject* get_color_member(PyUIFrameObject* self, void* closure);
static int set_color_member(PyUIFrameObject* self, PyObject* value, void* closure);
static PyGetSetDef getsetters[];
static PyObject* repr(PyUIFrameObject* self);
static int init(PyUIFrameObject* self, PyObject* args, PyObject* kwds);
};
namespace mcrfpydef {
static PyTypeObject PyUIFrameType = {
//PyVarObject_HEAD_INIT(NULL, 0)
.tp_name = "mcrfpy.Frame",
.tp_basicsize = sizeof(PyUIFrameObject),
.tp_itemsize = 0,
.tp_dealloc = (destructor)[](PyObject* self)
{
PyUIFrameObject* obj = (PyUIFrameObject*)self;
obj->data.reset();
Py_TYPE(self)->tp_free(self);
},
.tp_repr = (reprfunc)UIFrame::repr,
//.tp_hash = NULL,
//.tp_iter
//.tp_iternext
.tp_flags = Py_TPFLAGS_DEFAULT,
.tp_doc = PyDoc_STR("docstring"),
//.tp_methods = PyUIFrame_methods,
//.tp_members = PyUIFrame_members,
.tp_getset = UIFrame::getsetters,
//.tp_base = NULL,
.tp_init = (initproc)UIFrame::init,
.tp_new = [](PyTypeObject* type, PyObject* args, PyObject* kwds) -> PyObject*
{
PyUIFrameObject* self = (PyUIFrameObject*)type->tp_alloc(type, 0);
if (self) self->data = std::make_shared<UIFrame>();
return (PyObject*)self;
}
};
}

608
src/UIGrid.cpp Normal file
View File

@ -0,0 +1,608 @@
#include "UIGrid.h"
#include "GameEngine.h"
#include "McRFPy_API.h"
UIGrid::UIGrid() {}
UIGrid::UIGrid(int gx, int gy, std::shared_ptr<PyTexture> _ptex, sf::Vector2f _xy, sf::Vector2f _wh)
: grid_x(gx), grid_y(gy),
zoom(1.0f), center_x((gx/2) * _ptex->sprite_width), center_y((gy/2) * _ptex->sprite_height),
ptex(_ptex), points(gx * gy)
{
entities = std::make_shared<std::list<std::shared_ptr<UIEntity>>>();
box.setSize(_wh);
box.setPosition(_xy);
box.setFillColor(sf::Color(0,0,0,0));
// create renderTexture with maximum theoretical size; sprite can resize to show whatever amount needs to be rendered
renderTexture.create(1920, 1080); // TODO - renderTexture should be window size; above 1080p this will cause rendering errors
sprite = ptex->sprite(0);
output.setTextureRect(
sf::IntRect(0, 0,
box.getSize().x, box.getSize().y));
output.setPosition(box.getPosition());
// textures are upside-down inside renderTexture
output.setTexture(renderTexture.getTexture());
}
void UIGrid::update() {}
void UIGrid::render(sf::Vector2f)
{
output.setPosition(box.getPosition()); // output sprite can move; update position when drawing
// output size can change; update size when drawing
output.setTextureRect(
sf::IntRect(0, 0,
box.getSize().x, box.getSize().y));
renderTexture.clear(sf::Color(8, 8, 8, 255)); // TODO - UIGrid needs a "background color" field
// sprites that are visible according to zoom, center_x, center_y, and box width
float center_x_sq = center_x / ptex->sprite_width;
float center_y_sq = center_y / ptex->sprite_height;
float width_sq = box.getSize().x / (ptex->sprite_width * zoom);
float height_sq = box.getSize().y / (ptex->sprite_height * zoom);
float left_edge = center_x_sq - (width_sq / 2.0);
float top_edge = center_y_sq - (height_sq / 2.0);
int left_spritepixels = center_x - (box.getSize().x / 2.0 / zoom);
int top_spritepixels = center_y - (box.getSize().y / 2.0 / zoom);
//sprite.setScale(sf::Vector2f(zoom, zoom));
sf::RectangleShape r; // for colors and overlays
r.setSize(sf::Vector2f(ptex->sprite_width * zoom, ptex->sprite_height * zoom));
r.setOutlineThickness(0);
int x_limit = left_edge + width_sq + 2;
if (x_limit > grid_x) x_limit = grid_x;
int y_limit = top_edge + height_sq + 2;
if (y_limit > grid_y) y_limit = grid_y;
// base layer - bottom color, tile sprite ("ground")
for (int x = (left_edge - 1 >= 0 ? left_edge - 1 : 0);
x < x_limit; //x < view_width;
x+=1)
{
//for (float y = (top_edge >= 0 ? top_edge : 0);
for (int y = (top_edge - 1 >= 0 ? top_edge - 1 : 0);
y < y_limit; //y < view_height;
y+=1)
{
auto pixel_pos = sf::Vector2f(
(x*ptex->sprite_width - left_spritepixels) * zoom,
(y*ptex->sprite_height - top_spritepixels) * zoom );
auto gridpoint = at(std::floor(x), std::floor(y));
//sprite.setPosition(pixel_pos);
r.setPosition(pixel_pos);
r.setFillColor(gridpoint.color);
renderTexture.draw(r);
// tilesprite
// if discovered but not visible, set opacity to 90%
// if not discovered... just don't draw it?
if (gridpoint.tilesprite != -1) {
sprite = ptex->sprite(gridpoint.tilesprite, pixel_pos, sf::Vector2f(zoom, zoom)); //setSprite(gridpoint.tilesprite);;
renderTexture.draw(sprite);
}
}
}
// middle layer - entities
// disabling entity rendering until I can render their UISprite inside the rendertexture (not directly to window)
for (auto e : *entities) {
// TODO skip out-of-bounds entities (grid square not visible at all, check for partially on visible grid squares / floating point grid position)
//auto drawent = e->cGrid->indexsprite.drawable();
auto& drawent = e->sprite;
//drawent.setScale(zoom, zoom);
drawent.setScale(sf::Vector2f(zoom, zoom));
auto pixel_pos = sf::Vector2f(
(e->position.x*ptex->sprite_width - left_spritepixels) * zoom,
(e->position.y*ptex->sprite_height - top_spritepixels) * zoom );
//drawent.setPosition(pixel_pos);
//renderTexture.draw(drawent);
drawent.render(pixel_pos, renderTexture);
}
// top layer - opacity for discovered / visible status (debug, basically)
/* // Disabled until I attach a "perspective"
for (int x = (left_edge - 1 >= 0 ? left_edge - 1 : 0);
x < x_limit; //x < view_width;
x+=1)
{
//for (float y = (top_edge >= 0 ? top_edge : 0);
for (int y = (top_edge - 1 >= 0 ? top_edge - 1 : 0);
y < y_limit; //y < view_height;
y+=1)
{
auto pixel_pos = sf::Vector2f(
(x*itex->grid_size - left_spritepixels) * zoom,
(y*itex->grid_size - top_spritepixels) * zoom );
auto gridpoint = at(std::floor(x), std::floor(y));
sprite.setPosition(pixel_pos);
r.setPosition(pixel_pos);
// visible & discovered layers for testing purposes
if (!gridpoint.discovered) {
r.setFillColor(sf::Color(16, 16, 20, 192)); // 255 opacity for actual blackout
renderTexture.draw(r);
} else if (!gridpoint.visible) {
r.setFillColor(sf::Color(32, 32, 40, 128));
renderTexture.draw(r);
}
// overlay
// uisprite
}
}
*/
// grid lines for testing & validation
/*
sf::Vertex line[] =
{
sf::Vertex(sf::Vector2f(0, 0), sf::Color::Red),
sf::Vertex(box.getSize(), sf::Color::Red),
};
renderTexture.draw(line, 2, sf::Lines);
sf::Vertex lineb[] =
{
sf::Vertex(sf::Vector2f(0, box.getSize().y), sf::Color::Blue),
sf::Vertex(sf::Vector2f(box.getSize().x, 0), sf::Color::Blue),
};
renderTexture.draw(lineb, 2, sf::Lines);
*/
// render to window
renderTexture.display();
Resources::game->getWindow().draw(output);
}
UIGridPoint& UIGrid::at(int x, int y)
{
return points[y * grid_x + x];
}
PyObjectsEnum UIGrid::derived_type()
{
return PyObjectsEnum::UIGRID;
}
std::shared_ptr<PyTexture> UIGrid::getTexture()
{
return ptex;
}
UIDrawable* UIGrid::click_at(sf::Vector2f point)
{
if (click_callable)
{
if(box.getGlobalBounds().contains(point)) return this;
}
return NULL;
}
int UIGrid::init(PyUIGridObject* self, PyObject* args, PyObject* kwds) {
int grid_x, grid_y;
PyObject* textureObj;
float box_x, box_y, box_w, box_h;
if (!PyArg_ParseTuple(args, "iiOffff", &grid_x, &grid_y, &textureObj, &box_x, &box_y, &box_w, &box_h)) {
return -1; // If parsing fails, return an error
}
// Convert PyObject texture to IndexTexture*
// This requires the texture object to have been initialized similar to UISprite's texture handling
//if (!PyObject_IsInstance(textureObj, (PyObject*)&PyTextureType)) {
if (!PyObject_IsInstance(textureObj, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Texture"))) {
PyErr_SetString(PyExc_TypeError, "texture must be a mcrfpy.Texture instance");
return -1;
}
PyTextureObject* pyTexture = reinterpret_cast<PyTextureObject*>(textureObj);
// TODO (7DRL day 2, item 4.) use shared_ptr / PyTextureObject on UIGrid
//IndexTexture* texture = pyTexture->data.get();
// Initialize UIGrid
//self->data = new UIGrid(grid_x, grid_y, texture, sf::Vector2f(box_x, box_y), sf::Vector2f(box_w, box_h));
self->data = std::make_shared<UIGrid>(grid_x, grid_y, pyTexture->data,
sf::Vector2f(box_x, box_y), sf::Vector2f(box_w, box_h));
return 0; // Success
}
PyObject* UIGrid::get_grid_size(PyUIGridObject* self, void* closure) {
return Py_BuildValue("(ii)", self->data->grid_x, self->data->grid_y);
}
PyObject* UIGrid::get_position(PyUIGridObject* self, void* closure) {
auto& box = self->data->box;
return Py_BuildValue("(ff)", box.getPosition().x, box.getPosition().y);
}
int UIGrid::set_position(PyUIGridObject* self, PyObject* value, void* closure) {
float x, y;
if (!PyArg_ParseTuple(value, "ff", &x, &y)) {
PyErr_SetString(PyExc_ValueError, "Position must be a tuple of two floats");
return -1;
}
self->data->box.setPosition(x, y);
return 0;
}
PyObject* UIGrid::get_size(PyUIGridObject* self, void* closure) {
auto& box = self->data->box;
return Py_BuildValue("(ff)", box.getSize().x, box.getSize().y);
}
int UIGrid::set_size(PyUIGridObject* self, PyObject* value, void* closure) {
float w, h;
if (!PyArg_ParseTuple(value, "ff", &w, &h)) {
PyErr_SetString(PyExc_ValueError, "Size must be a tuple of two floats");
return -1;
}
self->data->box.setSize(sf::Vector2f(w, h));
return 0;
}
PyObject* UIGrid::get_center(PyUIGridObject* self, void* closure) {
return Py_BuildValue("(ff)", self->data->center_x, self->data->center_y);
}
int UIGrid::set_center(PyUIGridObject* self, PyObject* value, void* closure) {
float x, y;
if (!PyArg_ParseTuple(value, "ff", &x, &y)) {
PyErr_SetString(PyExc_ValueError, "Size must be a tuple of two floats");
return -1;
}
self->data->center_x = x;
self->data->center_y = y;
return 0;
}
PyObject* UIGrid::get_float_member(PyUIGridObject* self, void* closure)
{
auto member_ptr = reinterpret_cast<long>(closure);
if (member_ptr == 0) // x
return PyFloat_FromDouble(self->data->box.getPosition().x);
else if (member_ptr == 1) // y
return PyFloat_FromDouble(self->data->box.getPosition().y);
else if (member_ptr == 2) // w
return PyFloat_FromDouble(self->data->box.getSize().x);
else if (member_ptr == 3) // h
return PyFloat_FromDouble(self->data->box.getSize().y);
else if (member_ptr == 4) // center_x
return PyFloat_FromDouble(self->data->center_x);
else if (member_ptr == 5) // center_y
return PyFloat_FromDouble(self->data->center_y);
else if (member_ptr == 6) // zoom
return PyFloat_FromDouble(self->data->zoom);
else
{
PyErr_SetString(PyExc_AttributeError, "Invalid attribute");
return nullptr;
}
}
int UIGrid::set_float_member(PyUIGridObject* self, PyObject* value, void* closure)
{
float val;
auto member_ptr = reinterpret_cast<long>(closure);
if (PyFloat_Check(value))
{
val = PyFloat_AsDouble(value);
}
else if (PyLong_Check(value))
{
val = PyLong_AsLong(value);
}
else
{
PyErr_SetString(PyExc_TypeError, "Value must be a floating point number.");
return -1;
}
if (member_ptr == 0) // x
self->data->box.setPosition(val, self->data->box.getPosition().y);
else if (member_ptr == 1) // y
self->data->box.setPosition(self->data->box.getPosition().x, val);
else if (member_ptr == 2) // w
self->data->box.setSize(sf::Vector2f(val, self->data->box.getSize().y));
else if (member_ptr == 3) // h
self->data->box.setSize(sf::Vector2f(self->data->box.getSize().x, val));
else if (member_ptr == 4) // center_x
self->data->center_x = val;
else if (member_ptr == 5) // center_y
self->data->center_y = val;
else if (member_ptr == 6) // zoom
self->data->zoom = val;
return 0;
}
// TODO (7DRL Day 2, item 5.) return Texture object
/*
PyObject* UIGrid::get_texture(PyUIGridObject* self, void* closure) {
Py_INCREF(self->texture);
return self->texture;
}
*/
PyObject* UIGrid::get_texture(PyUIGridObject* self, void* closure) {
//return self->data->getTexture()->pyObject();
// PyObject_GetAttrString(McRFPy_API::mcrf_module, "GridPointState")
//PyTextureObject* obj = (PyTextureObject*)((&PyTextureType)->tp_alloc(&PyTextureType, 0));
auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "Texture");
auto obj = (PyTextureObject*)type->tp_alloc(type, 0);
obj->data = self->data->getTexture();
return (PyObject*)obj;
}
PyObject* UIGrid::py_at(PyUIGridObject* self, PyObject* o)
{
int x, y;
if (!PyArg_ParseTuple(o, "ii", &x, &y)) {
PyErr_SetString(PyExc_TypeError, "UIGrid.at requires two integer arguments: (x, y)");
return NULL;
}
if (x < 0 || x >= self->data->grid_x) {
PyErr_SetString(PyExc_ValueError, "x value out of range (0, Grid.grid_y)");
return NULL;
}
if (y < 0 || y >= self->data->grid_y) {
PyErr_SetString(PyExc_ValueError, "y value out of range (0, Grid.grid_y)");
return NULL;
}
//PyUIGridPointObject* obj = (PyUIGridPointObject*)((&PyUIGridPointType)->tp_alloc(&PyUIGridPointType, 0));
auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "GridPoint");
auto obj = (PyUIGridPointObject*)type->tp_alloc(type, 0);
//auto target = std::static_pointer_cast<UIEntity>(target);
obj->data = &(self->data->points[x + self->data->grid_x * y]);
obj->grid = self->data;
return (PyObject*)obj;
}
PyMethodDef UIGrid::methods[] = {
{"at", (PyCFunction)UIGrid::py_at, METH_O},
{NULL, NULL, 0, NULL}
};
PyGetSetDef UIGrid::getsetters[] = {
// TODO - refactor into get_vector_member with field identifier values `(void*)n`
{"grid_size", (getter)UIGrid::get_grid_size, NULL, "Grid dimensions (grid_x, grid_y)", NULL},
{"position", (getter)UIGrid::get_position, (setter)UIGrid::set_position, "Position of the grid (x, y)", NULL},
{"size", (getter)UIGrid::get_size, (setter)UIGrid::set_size, "Size of the grid (width, height)", NULL},
{"center", (getter)UIGrid::get_center, (setter)UIGrid::set_center, "Grid coordinate at the center of the Grid's view (pan)", NULL},
{"entities", (getter)UIGrid::get_children, NULL, "EntityCollection of entities on this grid", NULL},
{"x", (getter)UIGrid::get_float_member, (setter)UIGrid::set_float_member, "top-left corner X-coordinate", (void*)0},
{"y", (getter)UIGrid::get_float_member, (setter)UIGrid::set_float_member, "top-left corner Y-coordinate", (void*)1},
{"w", (getter)UIGrid::get_float_member, (setter)UIGrid::set_float_member, "visible widget width", (void*)2},
{"h", (getter)UIGrid::get_float_member, (setter)UIGrid::set_float_member, "visible widget height", (void*)3},
{"center_x", (getter)UIGrid::get_float_member, (setter)UIGrid::set_float_member, "center of the view X-coordinate", (void*)4},
{"center_y", (getter)UIGrid::get_float_member, (setter)UIGrid::set_float_member, "center of the view Y-coordinate", (void*)5},
{"zoom", (getter)UIGrid::get_float_member, (setter)UIGrid::set_float_member, "zoom factor for displaying the Grid", (void*)6},
{"click", (getter)UIDrawable::get_click, (setter)UIDrawable::set_click, "Object called with (x, y, button) when clicked", (void*)PyObjectsEnum::UIGRID},
{"texture", (getter)UIGrid::get_texture, NULL, "Texture of the grid", NULL}, //TODO 7DRL-day2-item5
{NULL} /* Sentinel */
};
PyObject* UIGrid::get_children(PyUIGridObject* self, void* closure)
{
// create PyUICollection instance pointing to self->data->children
//PyUIEntityCollectionObject* o = (PyUIEntityCollectionObject*)PyUIEntityCollectionType.tp_alloc(&PyUIEntityCollectionType, 0);
auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "EntityCollection");
auto o = (PyUIEntityCollectionObject*)type->tp_alloc(type, 0);
if (o) {
o->data = self->data->entities; // todone. / BUGFIX - entities isn't a shared pointer on UIGrid, what to do? -- I made it a sp<list<sp<UIEntity>>>
o->grid = self->data;
}
return (PyObject*)o;
}
/* // TODO standard pointer would need deleted, but I opted for a shared pointer. tp_dealloc currently not even defined in the PyTypeObject
void PyUIGrid_dealloc(PyUIGridObject* self) {
delete self->data; // Clean up the allocated UIGrid object
Py_TYPE(self)->tp_free((PyObject*)self);
}
*/
int UIEntityCollectionIter::init(PyUIEntityCollectionIterObject* self, PyObject* args, PyObject* kwds)
{
PyErr_SetString(PyExc_TypeError, "UICollection cannot be instantiated: a C++ data source is required.");
return -1;
}
PyObject* UIEntityCollectionIter::next(PyUIEntityCollectionIterObject* self)
{
if (self->data->size() != self->start_size)
{
PyErr_SetString(PyExc_RuntimeError, "collection changed size during iteration");
return NULL;
}
if (self->index > self->start_size - 1)
{
PyErr_SetNone(PyExc_StopIteration);
return NULL;
}
self->index++;
auto vec = self->data.get();
if (!vec)
{
PyErr_SetString(PyExc_RuntimeError, "the collection store returned a null pointer");
return NULL;
}
// Advance list iterator since Entities are not stored in a vector (if this code even worked)
// vectors only: //auto target = (*vec)[self->index-1];
//auto l_front = (*vec).begin();
//std::advance(l_front, self->index-1);
// TODO build PyObject* of the correct UIDrawable subclass to return
//return py_instance(target);
return NULL;
}
PyObject* UIEntityCollectionIter::repr(PyUIEntityCollectionIterObject* self)
{
std::ostringstream ss;
if (!self->data) ss << "<UICollectionIter (invalid internal object)>";
else {
ss << "<UICollectionIter (" << self->data->size() << " child objects, @ index " << self->index << ")>";
}
std::string repr_str = ss.str();
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
}
Py_ssize_t UIEntityCollection::len(PyUIEntityCollectionObject* self) {
return self->data->size();
}
PyObject* UIEntityCollection::getitem(PyUIEntityCollectionObject* self, Py_ssize_t index) {
// build a Python version of item at self->data[index]
// Copy pasted::
auto vec = self->data.get();
if (!vec)
{
PyErr_SetString(PyExc_RuntimeError, "the collection store returned a null pointer");
return NULL;
}
while (index < 0) index += self->data->size();
if (index > self->data->size() - 1)
{
PyErr_SetString(PyExc_IndexError, "EntityCollection index out of range");
return NULL;
}
auto l_begin = (*vec).begin();
std::advance(l_begin, index);
auto target = *l_begin; //auto target = (*vec)[index];
//RET_PY_INSTANCE(target);
// construct and return an entity object that points directly into the UIGrid's entity vector
//PyUIEntityObject* o = (PyUIEntityObject*)((&PyUIEntityType)->tp_alloc(&PyUIEntityType, 0));
auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "Entity");
auto o = (PyUIEntityObject*)type->tp_alloc(type, 0);
auto p = std::static_pointer_cast<UIEntity>(target);
o->data = p;
return (PyObject*)o;
return NULL;
}
PySequenceMethods UIEntityCollection::sqmethods = {
.sq_length = (lenfunc)UIEntityCollection::len,
.sq_item = (ssizeargfunc)UIEntityCollection::getitem,
//.sq_item_by_index = UIEntityCollection::getitem
//.sq_slice - return a subset of the iterable
//.sq_ass_item - called when `o[x] = y` is executed (x is any object type)
//.sq_ass_slice - cool; no thanks, for now
//.sq_contains - called when `x in o` is executed
//.sq_ass_item_by_index - called when `o[x] = y` is executed (x is explictly an integer)
};
PyObject* UIEntityCollection::append(PyUIEntityCollectionObject* self, PyObject* o)
{
// if not UIDrawable subclass, reject it
// self->data->push_back( c++ object inside o );
// this would be a great use case for .tp_base
//if (!PyObject_IsInstance(o, (PyObject*)&PyUIEntityType))
if (!PyObject_IsInstance(o, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Entity")))
{
PyErr_SetString(PyExc_TypeError, "Only Entity objects can be added to EntityCollection");
return NULL;
}
PyUIEntityObject* entity = (PyUIEntityObject*)o;
self->data->push_back(entity->data);
entity->data->grid = self->grid;
Py_INCREF(Py_None);
return Py_None;
}
PyObject* UIEntityCollection::remove(PyUIEntityCollectionObject* self, PyObject* o)
{
if (!PyLong_Check(o))
{
PyErr_SetString(PyExc_TypeError, "UICollection.remove requires an integer index to remove");
return NULL;
}
long index = PyLong_AsLong(o);
if (index >= self->data->size())
{
PyErr_SetString(PyExc_ValueError, "Index out of range");
return NULL;
}
else if (index < 0)
{
PyErr_SetString(PyExc_NotImplementedError, "reverse indexing is not implemented.");
return NULL;
}
// release the shared pointer at correct part of the list
self->data->erase(std::next(self->data->begin(), index));
Py_INCREF(Py_None);
return Py_None;
}
PyMethodDef UIEntityCollection::methods[] = {
{"append", (PyCFunction)UIEntityCollection::append, METH_O},
//{"extend", (PyCFunction)UIEntityCollection::extend, METH_O}, // TODO
{"remove", (PyCFunction)UIEntityCollection::remove, METH_O},
{NULL, NULL, 0, NULL}
};
PyObject* UIEntityCollection::repr(PyUIEntityCollectionObject* self)
{
std::ostringstream ss;
if (!self->data) ss << "<UICollection (invalid internal object)>";
else {
ss << "<UICollection (" << self->data->size() << " child objects)>";
}
std::string repr_str = ss.str();
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
}
int UIEntityCollection::init(PyUIEntityCollectionObject* self, PyObject* args, PyObject* kwds)
{
PyErr_SetString(PyExc_TypeError, "EntityCollection cannot be instantiated: a C++ data source is required.");
return -1;
}
PyObject* UIEntityCollection::iter(PyUIEntityCollectionObject* self)
{
//PyUIEntityCollectionIterObject* iterObj;
//iterObj = (PyUIEntityCollectionIterObject*)PyUIEntityCollectionIterType.tp_alloc(&PyUIEntityCollectionIterType, 0);
auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "EntityCollectionIter");
auto iterObj = (PyUIEntityCollectionIterObject*)type->tp_alloc(type, 0);
if (iterObj == NULL) {
return NULL; // Failed to allocate memory for the iterator object
}
iterObj->data = self->data;
iterObj->index = 0;
iterObj->start_size = self->data->size();
return (PyObject*)iterObj;
}

183
src/UIGrid.h Normal file
View File

@ -0,0 +1,183 @@
#pragma once
#include "Common.h"
#include "Python.h"
#include "structmember.h"
#include "IndexTexture.h"
#include "Resources.h"
#include <list>
#include "PyCallable.h"
#include "PyTexture.h"
#include "PyColor.h"
#include "PyVector.h"
#include "PyFont.h"
#include "UIGridPoint.h"
#include "UIEntity.h"
#include "UIDrawable.h"
#include "UIBase.h"
class UIGrid: public UIDrawable
{
private:
std::shared_ptr<PyTexture> ptex;
public:
UIGrid();
//UIGrid(int, int, IndexTexture*, float, float, float, float);
UIGrid(int, int, std::shared_ptr<PyTexture>, sf::Vector2f, sf::Vector2f);
void update();
void render(sf::Vector2f) override final;
UIGridPoint& at(int, int);
PyObjectsEnum derived_type() override final;
//void setSprite(int);
virtual UIDrawable* click_at(sf::Vector2f point) override final;
int grid_x, grid_y;
//int grid_size; // grid sizes are implied by IndexTexture now
sf::RectangleShape box;
float center_x, center_y, zoom;
//IndexTexture* itex;
std::shared_ptr<PyTexture> getTexture();
sf::Sprite sprite, output;
sf::RenderTexture renderTexture;
std::vector<UIGridPoint> points;
std::shared_ptr<std::list<std::shared_ptr<UIEntity>>> entities;
static int init(PyUIGridObject* self, PyObject* args, PyObject* kwds);
static PyObject* get_grid_size(PyUIGridObject* self, void* closure);
static PyObject* get_position(PyUIGridObject* self, void* closure);
static int set_position(PyUIGridObject* self, PyObject* value, void* closure);
static PyObject* get_size(PyUIGridObject* self, void* closure);
static int set_size(PyUIGridObject* self, PyObject* value, void* closure);
static PyObject* get_center(PyUIGridObject* self, void* closure);
static int set_center(PyUIGridObject* self, PyObject* value, void* closure);
static PyObject* get_float_member(PyUIGridObject* self, void* closure);
static int set_float_member(PyUIGridObject* self, PyObject* value, void* closure);
static PyObject* get_texture(PyUIGridObject* self, void* closure);
static PyObject* py_at(PyUIGridObject* self, PyObject* o);
static PyMethodDef methods[];
static PyGetSetDef getsetters[];
static PyObject* get_children(PyUIGridObject* self, void* closure);
};
typedef struct {
PyObject_HEAD
std::shared_ptr<std::list<std::shared_ptr<UIEntity>>> data;
std::shared_ptr<UIGrid> grid;
} PyUIEntityCollectionObject;
class UIEntityCollection {
public:
static PySequenceMethods sqmethods;
static PyObject* append(PyUIEntityCollectionObject* self, PyObject* o);
static PyObject* remove(PyUIEntityCollectionObject* self, PyObject* o);
static PyMethodDef methods[];
static PyObject* repr(PyUIEntityCollectionObject* self);
static int init(PyUIEntityCollectionObject* self, PyObject* args, PyObject* kwds);
static PyObject* iter(PyUIEntityCollectionObject* self);
static Py_ssize_t len(PyUIEntityCollectionObject* self);
static PyObject* getitem(PyUIEntityCollectionObject* self, Py_ssize_t index);
};
typedef struct {
PyObject_HEAD
std::shared_ptr<std::list<std::shared_ptr<UIEntity>>> data;
int index;
int start_size;
} PyUIEntityCollectionIterObject;
class UIEntityCollectionIter {
public:
static int init(PyUIEntityCollectionIterObject* self, PyObject* args, PyObject* kwds);
static PyObject* next(PyUIEntityCollectionIterObject* self);
static PyObject* repr(PyUIEntityCollectionIterObject* self);
static PyObject* getitem(PyUIEntityCollectionObject* self, Py_ssize_t index);
};
namespace mcrfpydef {
static PyTypeObject PyUIGridType = {
//PyVarObject_HEAD_INIT(NULL, 0)
.tp_name = "mcrfpy.Grid",
.tp_basicsize = sizeof(PyUIGridObject),
.tp_itemsize = 0,
//.tp_dealloc = (destructor)[](PyObject* self)
//{
// PyUIGridObject* obj = (PyUIGridObject*)self;
// obj->data.reset();
// Py_TYPE(self)->tp_free(self);
//},
//TODO - PyUIGrid REPR def:
// .tp_repr = (reprfunc)UIGrid::repr,
//.tp_hash = NULL,
//.tp_iter
//.tp_iternext
.tp_flags = Py_TPFLAGS_DEFAULT,
.tp_doc = PyDoc_STR("docstring"),
.tp_methods = UIGrid::methods,
//.tp_members = UIGrid::members,
.tp_getset = UIGrid::getsetters,
//.tp_base = NULL,
.tp_init = (initproc)UIGrid::init,
.tp_new = [](PyTypeObject* type, PyObject* args, PyObject* kwds) -> PyObject*
{
PyUIGridObject* self = (PyUIGridObject*)type->tp_alloc(type, 0);
if (self) self->data = std::make_shared<UIGrid>();
return (PyObject*)self;
}
};
static PyTypeObject PyUIEntityCollectionIterType = {
//PyVarObject_HEAD_INIT(NULL, 0)
.tp_name = "mcrfpy.UICollectionIter",
.tp_basicsize = sizeof(PyUIEntityCollectionIterObject),
.tp_itemsize = 0,
.tp_dealloc = (destructor)[](PyObject* self)
{
PyUIEntityCollectionIterObject* obj = (PyUIEntityCollectionIterObject*)self;
obj->data.reset();
Py_TYPE(self)->tp_free(self);
},
.tp_repr = (reprfunc)UIEntityCollectionIter::repr,
.tp_flags = Py_TPFLAGS_DEFAULT,
.tp_doc = PyDoc_STR("Iterator for a collection of UI objects"),
.tp_iternext = (iternextfunc)UIEntityCollectionIter::next,
//.tp_getset = UIEntityCollection::getset,
.tp_init = (initproc)UIEntityCollectionIter::init, // just raise an exception
.tp_new = [](PyTypeObject* type, PyObject* args, PyObject* kwds) -> PyObject*
{
PyErr_SetString(PyExc_TypeError, "UICollection cannot be instantiated: a C++ data source is required.");
return NULL;
}
};
static PyTypeObject PyUIEntityCollectionType = {
//PyVarObject_/HEAD_INIT(NULL, 0)
.tp_name = "mcrfpy.EntityCollection",
.tp_basicsize = sizeof(PyUIEntityCollectionObject),
.tp_itemsize = 0,
.tp_dealloc = (destructor)[](PyObject* self)
{
PyUIEntityCollectionObject* obj = (PyUIEntityCollectionObject*)self;
obj->data.reset();
Py_TYPE(self)->tp_free(self);
},
.tp_repr = (reprfunc)UIEntityCollection::repr,
.tp_as_sequence = &UIEntityCollection::sqmethods,
.tp_flags = Py_TPFLAGS_DEFAULT,
.tp_doc = PyDoc_STR("Iterable, indexable collection of Entities"),
.tp_iter = (getiterfunc)UIEntityCollection::iter,
.tp_methods = UIEntityCollection::methods, // append, remove
//.tp_getset = UIEntityCollection::getset,
.tp_init = (initproc)UIEntityCollection::init, // just raise an exception
.tp_new = [](PyTypeObject* type, PyObject* args, PyObject* kwds) -> PyObject*
{
// Does PyUIEntityCollectionType need __new__ if it's not supposed to be instantiable by the user?
// Should I just raise an exception? Or is the uninitialized shared_ptr enough of a blocker?
PyErr_SetString(PyExc_TypeError, "EntityCollection cannot be instantiated: a C++ data source is required.");
return NULL;
}
};
}

134
src/UIGridPoint.cpp Normal file
View File

@ -0,0 +1,134 @@
#include "UIGridPoint.h"
UIGridPoint::UIGridPoint()
: color(1.0f, 1.0f, 1.0f), color_overlay(0.0f, 0.0f, 0.0f), walkable(false), transparent(false),
tilesprite(-1), tile_overlay(-1), uisprite(-1)
{}
// Utility function to convert sf::Color to PyObject*
PyObject* sfColor_to_PyObject(sf::Color color) {
return Py_BuildValue("(iiii)", color.r, color.g, color.b, color.a);
}
// Utility function to convert PyObject* to sf::Color
sf::Color PyObject_to_sfColor(PyObject* obj) {
int r, g, b, a = 255; // Default alpha to fully opaque if not specified
if (!PyArg_ParseTuple(obj, "iii|i", &r, &g, &b, &a)) {
return sf::Color(); // Return default color on parse error
}
return sf::Color(r, g, b, a);
}
PyObject* UIGridPoint::get_color(PyUIGridPointObject* self, void* closure) {
if (reinterpret_cast<long>(closure) == 0) { // color
return sfColor_to_PyObject(self->data->color);
} else { // color_overlay
return sfColor_to_PyObject(self->data->color_overlay);
}
}
int UIGridPoint::set_color(PyUIGridPointObject* self, PyObject* value, void* closure) {
sf::Color color = PyObject_to_sfColor(value);
if (reinterpret_cast<long>(closure) == 0) { // color
self->data->color = color;
} else { // color_overlay
self->data->color_overlay = color;
}
return 0;
}
PyObject* UIGridPoint::get_bool_member(PyUIGridPointObject* self, void* closure) {
if (reinterpret_cast<long>(closure) == 0) { // walkable
return PyBool_FromLong(self->data->walkable);
} else { // transparent
return PyBool_FromLong(self->data->transparent);
}
}
int UIGridPoint::set_bool_member(PyUIGridPointObject* self, PyObject* value, void* closure) {
if (value == Py_True) {
if (reinterpret_cast<long>(closure) == 0) { // walkable
self->data->walkable = true;
} else { // transparent
self->data->transparent = true;
}
} else if (value == Py_False) {
if (reinterpret_cast<long>(closure) == 0) { // walkable
self->data->walkable = false;
} else { // transparent
self->data->transparent = false;
}
} else {
PyErr_SetString(PyExc_ValueError, "Expected a boolean value");
return -1;
}
return 0;
}
PyObject* UIGridPoint::get_int_member(PyUIGridPointObject* self, void* closure) {
switch(reinterpret_cast<long>(closure)) {
case 0: return PyLong_FromLong(self->data->tilesprite);
case 1: return PyLong_FromLong(self->data->tile_overlay);
case 2: return PyLong_FromLong(self->data->uisprite);
default: PyErr_SetString(PyExc_RuntimeError, "Invalid closure"); return nullptr;
}
}
int UIGridPoint::set_int_member(PyUIGridPointObject* self, PyObject* value, void* closure) {
long val = PyLong_AsLong(value);
if (PyErr_Occurred()) return -1;
switch(reinterpret_cast<long>(closure)) {
case 0: self->data->tilesprite = val; break;
case 1: self->data->tile_overlay = val; break;
case 2: self->data->uisprite = val; break;
default: PyErr_SetString(PyExc_RuntimeError, "Invalid closure"); return -1;
}
return 0;
}
PyGetSetDef UIGridPoint::getsetters[] = {
{"color", (getter)UIGridPoint::get_color, (setter)UIGridPoint::set_color, "GridPoint color", (void*)0},
{"color_overlay", (getter)UIGridPoint::get_color, (setter)UIGridPoint::set_color, "GridPoint color overlay", (void*)1},
{"walkable", (getter)UIGridPoint::get_bool_member, (setter)UIGridPoint::set_bool_member, "Is the GridPoint walkable", (void*)0},
{"transparent", (getter)UIGridPoint::get_bool_member, (setter)UIGridPoint::set_bool_member, "Is the GridPoint transparent", (void*)1},
{"tilesprite", (getter)UIGridPoint::get_int_member, (setter)UIGridPoint::set_int_member, "Tile sprite index", (void*)0},
{"tile_overlay", (getter)UIGridPoint::get_int_member, (setter)UIGridPoint::set_int_member, "Tile overlay sprite index", (void*)1},
{"uisprite", (getter)UIGridPoint::get_int_member, (setter)UIGridPoint::set_int_member, "UI sprite index", (void*)2},
{NULL} /* Sentinel */
};
PyObject* UIGridPointState::get_bool_member(PyUIGridPointStateObject* self, void* closure) {
if (reinterpret_cast<long>(closure) == 0) { // visible
return PyBool_FromLong(self->data->visible);
} else { // discovered
return PyBool_FromLong(self->data->discovered);
}
}
int UIGridPointState::set_bool_member(PyUIGridPointStateObject* self, PyObject* value, void* closure) {
if (!PyBool_Check(value)) {
PyErr_SetString(PyExc_TypeError, "Value must be a boolean");
return -1;
}
int truthValue = PyObject_IsTrue(value);
if (truthValue < 0) {
return -1; // PyObject_IsTrue returns -1 on error
}
if (reinterpret_cast<long>(closure) == 0) { // visible
self->data->visible = truthValue;
} else { // discovered
self->data->discovered = truthValue;
}
return 0;
}
PyGetSetDef UIGridPointState::getsetters[] = {
{"visible", (getter)UIGridPointState::get_bool_member, (setter)UIGridPointState::set_bool_member, "Is the GridPointState visible", (void*)0},
{"discovered", (getter)UIGridPointState::get_bool_member, (setter)UIGridPointState::set_bool_member, "Has the GridPointState been discovered", (void*)1},
{NULL} /* Sentinel */
};

90
src/UIGridPoint.h Normal file
View File

@ -0,0 +1,90 @@
#pragma once
#include "Common.h"
#include "Python.h"
#include "structmember.h"
#include "IndexTexture.h"
#include "Resources.h"
#include <list>
#include "PyCallable.h"
#include "PyTexture.h"
#include "PyColor.h"
#include "PyVector.h"
#include "PyFont.h"
static PyObject* sfColor_to_PyObject(sf::Color color);
static sf::Color PyObject_to_sfColor(PyObject* obj);
class UIGrid;
class UIEntity;
class UIGridPoint;
class UIGridPointState;
typedef struct {
PyObject_HEAD
UIGridPoint* data;
std::shared_ptr<UIGrid> grid;
} PyUIGridPointObject;
typedef struct {
PyObject_HEAD
UIGridPointState* data;
std::shared_ptr<UIGrid> grid;
std::shared_ptr<UIEntity> entity;
} PyUIGridPointStateObject;
// UIGridPoint - revised grid data for each point
class UIGridPoint
{
public:
sf::Color color, color_overlay;
bool walkable, transparent;
int tilesprite, tile_overlay, uisprite;
UIGridPoint();
static int set_int_member(PyUIGridPointObject* self, PyObject* value, void* closure);
static PyGetSetDef getsetters[];
static PyObject* get_color(PyUIGridPointObject* self, void* closure);
static PyObject* get_int_member(PyUIGridPointObject* self, void* closure);
static int set_bool_member(PyUIGridPointObject* self, PyObject* value, void* closure);
static PyObject* get_bool_member(PyUIGridPointObject* self, void* closure);
static int set_color(PyUIGridPointObject* self, PyObject* value, void* closure);
};
// UIGridPointState - entity-specific info for each cell
class UIGridPointState
{
public:
bool visible, discovered;
static PyObject* get_bool_member(PyUIGridPointStateObject* self, void* closure);
static int set_bool_member(PyUIGridPointStateObject* self, PyObject* value, void* closure);
static PyGetSetDef getsetters[];
};
namespace mcrfpydef {
static PyTypeObject PyUIGridPointType = {
//PyVarObject_HEAD_INIT(NULL, 0)
.tp_name = "mcrfpy.GridPoint",
.tp_basicsize = sizeof(PyUIGridPointObject),
.tp_itemsize = 0,
// Methods omitted for brevity
.tp_flags = Py_TPFLAGS_DEFAULT,
.tp_doc = "UIGridPoint object",
.tp_getset = UIGridPoint::getsetters,
//.tp_init = (initproc)PyUIGridPoint_init, // TODO Define the init function
.tp_new = PyType_GenericNew,
};
static PyTypeObject PyUIGridPointStateType = {
//PyVarObject_HEAD_INIT(NULL, 0)
.tp_name = "mcrfpy.GridPointState",
.tp_basicsize = sizeof(PyUIGridPointStateObject),
.tp_itemsize = 0,
// Methods omitted for brevity
.tp_flags = Py_TPFLAGS_DEFAULT,
.tp_doc = "UIGridPointState object", // TODO: Add PyUIGridPointState tp_init
.tp_getset = UIGridPointState::getsetters,
.tp_new = PyType_GenericNew,
};
}

215
src/UISprite.cpp Normal file
View File

@ -0,0 +1,215 @@
#include "UISprite.h"
#include "GameEngine.h"
UIDrawable* UISprite::click_at(sf::Vector2f point)
{
if (click_callable)
{
if(sprite.getGlobalBounds().contains(point)) return this;
}
return NULL;
}
UISprite::UISprite() {}
UISprite::UISprite(std::shared_ptr<PyTexture> _ptex, int _sprite_index, sf::Vector2f _pos, float _scale)
: ptex(_ptex), sprite_index(_sprite_index)
{
sprite = ptex->sprite(sprite_index, _pos, sf::Vector2f(_scale, _scale));
}
void UISprite::render(sf::Vector2f offset)
{
sprite.move(offset);
Resources::game->getWindow().draw(sprite);
sprite.move(-offset);
}
void UISprite::render(sf::Vector2f offset, sf::RenderTexture& target)
{
sprite.move(offset);
target.draw(sprite);
sprite.move(-offset);
}
void UISprite::setPosition(sf::Vector2f pos)
{
sprite.setPosition(pos);
}
void UISprite::setScale(sf::Vector2f s)
{
sprite.setScale(s);
}
void UISprite::setTexture(std::shared_ptr<PyTexture> _ptex, int _sprite_index)
{
ptex = _ptex;
if (_sprite_index != -1) // if you are changing textures, there's a good chance you need a new index too
sprite_index = _sprite_index;
sprite = ptex->sprite(sprite_index, sprite.getPosition(), sprite.getScale());
}
void UISprite::setSpriteIndex(int _sprite_index)
{
sprite_index = _sprite_index;
sprite = ptex->sprite(sprite_index, sprite.getPosition(), sprite.getScale());
}
sf::Vector2f UISprite::getScale()
{
return sprite.getScale();
}
sf::Vector2f UISprite::getPosition()
{
return sprite.getPosition();
}
std::shared_ptr<PyTexture> UISprite::getTexture()
{
return ptex;
}
int UISprite::getSpriteIndex()
{
return sprite_index;
}
PyObjectsEnum UISprite::derived_type()
{
return PyObjectsEnum::UISPRITE;
}
PyObject* UISprite::get_float_member(PyUISpriteObject* self, void* closure)
{
auto member_ptr = reinterpret_cast<long>(closure);
if (member_ptr == 0)
return PyFloat_FromDouble(self->data->getPosition().x);
else if (member_ptr == 1)
return PyFloat_FromDouble(self->data->getPosition().y);
else if (member_ptr == 2)
return PyFloat_FromDouble(self->data->getScale().x); // scale X and Y are identical, presently
else
{
PyErr_SetString(PyExc_AttributeError, "Invalid attribute");
return nullptr;
}
}
int UISprite::set_float_member(PyUISpriteObject* self, PyObject* value, void* closure)
{
float val;
auto member_ptr = reinterpret_cast<long>(closure);
if (PyFloat_Check(value))
{
val = PyFloat_AsDouble(value);
}
else if (PyLong_Check(value))
{
val = PyLong_AsLong(value);
}
else
{
PyErr_SetString(PyExc_TypeError, "Value must be a floating point number.");
return -1;
}
if (member_ptr == 0) //x
self->data->setPosition(sf::Vector2f(val, self->data->getPosition().y));
else if (member_ptr == 1) //y
self->data->setPosition(sf::Vector2f(self->data->getPosition().x, val));
else if (member_ptr == 2) // scale
self->data->setScale(sf::Vector2f(val, val));
return 0;
}
PyObject* UISprite::get_int_member(PyUISpriteObject* self, void* closure)
{
auto member_ptr = reinterpret_cast<long>(closure);
if (true) {}
else
{
PyErr_SetString(PyExc_AttributeError, "Invalid attribute");
return nullptr;
}
return PyLong_FromDouble(self->data->getSpriteIndex());
}
int UISprite::set_int_member(PyUISpriteObject* self, PyObject* value, void* closure)
{
int val;
auto member_ptr = reinterpret_cast<long>(closure);
if (PyLong_Check(value))
{
val = PyLong_AsLong(value);
}
else
{
PyErr_SetString(PyExc_TypeError, "Value must be an integer.");
return -1;
}
self->data->setSpriteIndex(val);
return 0;
}
PyObject* UISprite::get_texture(PyUISpriteObject* self, void* closure)
{
return self->data->getTexture()->pyObject();
}
int UISprite::set_texture(PyUISpriteObject* self, PyObject* value, void* closure)
{
return -1;
}
PyGetSetDef UISprite::getsetters[] = {
{"x", (getter)UISprite::get_float_member, (setter)UISprite::set_float_member, "X coordinate of top-left corner", (void*)0},
{"y", (getter)UISprite::get_float_member, (setter)UISprite::set_float_member, "Y coordinate of top-left corner", (void*)1},
{"scale", (getter)UISprite::get_float_member, (setter)UISprite::set_float_member, "Size factor", (void*)2},
{"sprite_number", (getter)UISprite::get_int_member, (setter)UISprite::set_int_member, "Which sprite on the texture is shown", NULL},
{"texture", (getter)UISprite::get_texture, (setter)UISprite::set_texture, "Texture object", NULL},
{"click", (getter)UIDrawable::get_click, (setter)UIDrawable::set_click, "Object called with (x, y, button) when clicked", (void*)PyObjectsEnum::UISPRITE},
{NULL}
};
PyObject* UISprite::repr(PyUISpriteObject* self)
{
std::ostringstream ss;
if (!self->data) ss << "<Sprite (invalid internal object)>";
else {
//auto sprite = self->data->sprite;
ss << "<Sprite (x=" << self->data->getPosition().x << ", y=" << self->data->getPosition().y << ", " <<
"scale=" << self->data->getScale().x << ", " <<
"sprite_number=" << self->data->getSpriteIndex() << ")>";
}
std::string repr_str = ss.str();
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
}
int UISprite::init(PyUISpriteObject* self, PyObject* args, PyObject* kwds)
{
//std::cout << "Init called\n";
static const char* keywords[] = { "x", "y", "texture", "sprite_index", "scale", nullptr };
float x = 0.0f, y = 0.0f, scale = 1.0f;
int sprite_index;
PyObject* texture;
if (!PyArg_ParseTupleAndKeywords(args, kwds, "|ffOif",
const_cast<char**>(keywords), &x, &y, &texture, &sprite_index, &scale))
{
return -1;
}
// check types for texture
//if (texture != NULL && !PyObject_IsInstance(texture, (PyObject*)&PyTextureType)){
if (texture != NULL && !PyObject_IsInstance(texture, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Texture"))){
PyErr_SetString(PyExc_TypeError, "texture must be a mcrfpy.Texture instance");
return -1;
}
auto pytexture = (PyTextureObject*)texture;
self->data = std::make_shared<UISprite>(pytexture->data, sprite_index, sf::Vector2f(x, y), scale);
self->data->setPosition(sf::Vector2f(x, y));
return 0;
}

90
src/UISprite.h Normal file
View File

@ -0,0 +1,90 @@
#pragma once
#include "Common.h"
#include "Python.h"
#include "structmember.h"
#include "IndexTexture.h"
#include "Resources.h"
#include <list>
#include "PyCallable.h"
#include "PyTexture.h"
#include "PyColor.h"
#include "PyVector.h"
#include "PyFont.h"
#include "UIDrawable.h"
#include "UIBase.h"
class UISprite: public UIDrawable
{
private:
int sprite_index;
sf::Sprite sprite;
protected:
std::shared_ptr<PyTexture> ptex;
public:
UISprite();
UISprite(std::shared_ptr<PyTexture>, int, sf::Vector2f, float);
void update();
void render(sf::Vector2f) override final;
virtual UIDrawable* click_at(sf::Vector2f point) override final;
void render(sf::Vector2f, sf::RenderTexture&);
void setPosition(sf::Vector2f);
sf::Vector2f getPosition();
void setScale(sf::Vector2f);
sf::Vector2f getScale();
void setSpriteIndex(int);
int getSpriteIndex();
void setTexture(std::shared_ptr<PyTexture> _ptex, int _sprite_index=-1);
std::shared_ptr<PyTexture> getTexture();
PyObjectsEnum derived_type() override final;
static PyObject* get_float_member(PyUISpriteObject* self, void* closure);
static int set_float_member(PyUISpriteObject* self, PyObject* value, void* closure);
static PyObject* get_int_member(PyUISpriteObject* self, void* closure);
static int set_int_member(PyUISpriteObject* self, PyObject* value, void* closure);
static PyObject* get_texture(PyUISpriteObject* self, void* closure);
static int set_texture(PyUISpriteObject* self, PyObject* value, void* closure);
static PyGetSetDef getsetters[];
static PyObject* repr(PyUISpriteObject* self);
static int init(PyUISpriteObject* self, PyObject* args, PyObject* kwds);
};
namespace mcrfpydef {
static PyTypeObject PyUISpriteType = {
//PyVarObject_HEAD_INIT(NULL, 0)
.tp_name = "mcrfpy.Sprite",
.tp_basicsize = sizeof(PyUISpriteObject),
.tp_itemsize = 0,
.tp_dealloc = (destructor)[](PyObject* self)
{
PyUISpriteObject* obj = (PyUISpriteObject*)self;
// release reference to font object
//if (obj->texture) Py_DECREF(obj->texture);
obj->data.reset();
Py_TYPE(self)->tp_free(self);
},
.tp_repr = (reprfunc)UISprite::repr,
//.tp_hash = NULL,
//.tp_iter
//.tp_iternext
.tp_flags = Py_TPFLAGS_DEFAULT,
.tp_doc = PyDoc_STR("docstring"),
//.tp_methods = PyUIFrame_methods,
//.tp_members = PyUIFrame_members,
.tp_getset = UISprite::getsetters,
//.tp_base = NULL,
.tp_init = (initproc)UISprite::init,
.tp_new = [](PyTypeObject* type, PyObject* args, PyObject* kwds) -> PyObject*
{
PyUISpriteObject* self = (PyUISpriteObject*)type->tp_alloc(type, 0);
//if (self) self->data = std::make_shared<UICaption>();
return (PyObject*)self;
}
};
}