Compare commits
10 Commits
raii_pyobj
...
master
Author | SHA1 | Date |
---|---|---|
John McCardle | 232105a893 | |
John McCardle | c2de9b08d6 | |
John McCardle | a465a9861d | |
John McCardle | ac7f7052cd | |
John McCardle | 1a7186f745 | |
John McCardle | fbf263a038 | |
John McCardle | f82508b753 | |
John McCardle | 4ffe438d1b | |
John McCardle | cdaf309272 | |
John McCardle | 2c3c1449ee |
|
@ -0,0 +1,157 @@
|
|||
aqua #00FFFF
|
||||
black #000000
|
||||
blue #0000FF
|
||||
fuchsia #FF00FF
|
||||
gray #808080
|
||||
green #008000
|
||||
lime #00FF00
|
||||
maroon #800000
|
||||
navy #000080
|
||||
olive #808000
|
||||
purple #800080
|
||||
red #FF0000
|
||||
silver #C0C0C0
|
||||
teal #008080
|
||||
white #FFFFFF
|
||||
yellow #FFFF00
|
||||
aliceblue #F0F8FF
|
||||
antiquewhite #FAEBD7
|
||||
aqua #00FFFF
|
||||
aquamarine #7FFFD4
|
||||
azure #F0FFFF
|
||||
beige #F5F5DC
|
||||
bisque #FFE4C4
|
||||
black #000000
|
||||
blanchedalmond #FFEBCD
|
||||
blue #0000FF
|
||||
blueviolet #8A2BE2
|
||||
brown #A52A2A
|
||||
burlywood #DEB887
|
||||
cadetblue #5F9EA0
|
||||
chartreuse #7FFF00
|
||||
chocolate #D2691E
|
||||
coral #FF7F50
|
||||
cornflowerblue #6495ED
|
||||
cornsilk #FFF8DC
|
||||
crimson #DC143C
|
||||
cyan #00FFFF
|
||||
darkblue #00008B
|
||||
darkcyan #008B8B
|
||||
darkgoldenrod #B8860B
|
||||
darkgray #A9A9A9
|
||||
darkgreen #006400
|
||||
darkkhaki #BDB76B
|
||||
darkmagenta #8B008B
|
||||
darkolivegreen #556B2F
|
||||
darkorange #FF8C00
|
||||
darkorchid #9932CC
|
||||
darkred #8B0000
|
||||
darksalmon #E9967A
|
||||
darkseagreen #8FBC8F
|
||||
darkslateblue #483D8B
|
||||
darkslategray #2F4F4F
|
||||
darkturquoise #00CED1
|
||||
darkviolet #9400D3
|
||||
deeppink #FF1493
|
||||
deepskyblue #00BFFF
|
||||
dimgray #696969
|
||||
dodgerblue #1E90FF
|
||||
firebrick #B22222
|
||||
floralwhite #FFFAF0
|
||||
forestgreen #228B22
|
||||
fuchsia #FF00FF
|
||||
gainsboro #DCDCDC
|
||||
ghostwhite #F8F8FF
|
||||
gold #FFD700
|
||||
goldenrod #DAA520
|
||||
gray #7F7F7F
|
||||
green #008000
|
||||
greenyellow #ADFF2F
|
||||
honeydew #F0FFF0
|
||||
hotpink #FF69B4
|
||||
indianred #CD5C5C
|
||||
indigo #4B0082
|
||||
ivory #FFFFF0
|
||||
khaki #F0E68C
|
||||
lavender #E6E6FA
|
||||
lavenderblush #FFF0F5
|
||||
lawngreen #7CFC00
|
||||
lemonchiffon #FFFACD
|
||||
lightblue #ADD8E6
|
||||
lightcoral #F08080
|
||||
lightcyan #E0FFFF
|
||||
lightgoldenrodyellow #FAFAD2
|
||||
lightgreen #90EE90
|
||||
lightgrey #D3D3D3
|
||||
lightpink #FFB6C1
|
||||
lightsalmon #FFA07A
|
||||
lightseagreen #20B2AA
|
||||
lightskyblue #87CEFA
|
||||
lightslategray #778899
|
||||
lightsteelblue #B0C4DE
|
||||
lightyellow #FFFFE0
|
||||
lime #00FF00
|
||||
limegreen #32CD32
|
||||
linen #FAF0E6
|
||||
magenta #FF00FF
|
||||
maroon #800000
|
||||
mediumaquamarine #66CDAA
|
||||
mediumblue #0000CD
|
||||
mediumorchid #BA55D3
|
||||
mediumpurple #9370DB
|
||||
mediumseagreen #3CB371
|
||||
mediumslateblue #7B68EE
|
||||
mediumspringgreen #00FA9A
|
||||
mediumturquoise #48D1CC
|
||||
mediumvioletred #C71585
|
||||
midnightblue #191970
|
||||
mintcream #F5FFFA
|
||||
mistyrose #FFE4E1
|
||||
moccasin #FFE4B5
|
||||
navajowhite #FFDEAD
|
||||
navy #000080
|
||||
navyblue #9FAFDF
|
||||
oldlace #FDF5E6
|
||||
olive #808000
|
||||
olivedrab #6B8E23
|
||||
orange #FFA500
|
||||
orangered #FF4500
|
||||
orchid #DA70D6
|
||||
palegoldenrod #EEE8AA
|
||||
palegreen #98FB98
|
||||
paleturquoise #AFEEEE
|
||||
palevioletred #DB7093
|
||||
papayawhip #FFEFD5
|
||||
peachpuff #FFDAB9
|
||||
peru #CD853F
|
||||
pink #FFC0CB
|
||||
plum #DDA0DD
|
||||
powderblue #B0E0E6
|
||||
purple #800080
|
||||
red #FF0000
|
||||
rosybrown #BC8F8F
|
||||
royalblue #4169E1
|
||||
saddlebrown #8B4513
|
||||
salmon #FA8072
|
||||
sandybrown #FA8072
|
||||
seagreen #2E8B57
|
||||
seashell #FFF5EE
|
||||
sienna #A0522D
|
||||
silver #C0C0C0
|
||||
skyblue #87CEEB
|
||||
slateblue #6A5ACD
|
||||
slategray #708090
|
||||
snow #FFFAFA
|
||||
springgreen #00FF7F
|
||||
steelblue #4682B4
|
||||
tan #D2B48C
|
||||
teal #008080
|
||||
thistle #D8BFD8
|
||||
tomato #FF6347
|
||||
turquoise #40E0D0
|
||||
violet #EE82EE
|
||||
wheat #F5DEB3
|
||||
white #FFFFFF
|
||||
whitesmoke #F5F5F5
|
||||
yellow #FFFF00
|
||||
yellowgreen #9ACD32
|
|
@ -0,0 +1,111 @@
|
|||
# data sources: CSS docs, jennyscrayoncollection 2017 article on Crayola colors, XKCD color survey
|
||||
|
||||
# target: Single C++ header file to provide a struct of color RGB codes and names.
|
||||
# This file pre-computes the nearest neighbor of every color.
|
||||
# if an RGB code being searched for is closer than the nearest neighbor, it's the closest color name.
|
||||
|
||||
def hex_to_rgb(txt):
|
||||
if '#' in txt: txt = txt.replace('#', '')
|
||||
r = txt[0:2]
|
||||
g = txt[2:4]
|
||||
b = txt[4:6]
|
||||
return tuple([int(s, 16) for s in (r,g,b)])
|
||||
|
||||
class palette:
|
||||
def __init__(self, name, filename, priority):
|
||||
self.name = name
|
||||
self.priority = priority
|
||||
with open(filename, "r") as f:
|
||||
print(f"scanning {filename}")
|
||||
self.colors = {}
|
||||
for line in f.read().split('\n'):
|
||||
if len(line.split('\t')) < 2: continue
|
||||
name, code = line.split('\t')
|
||||
#print(name, code)
|
||||
self.colors[name] = hex_to_rgb(code)
|
||||
|
||||
def __repr__(self):
|
||||
return f"<Palette '{self.name}' - {len(self.colors)} colors, priority = {self.priority}>"
|
||||
|
||||
palettes = [
|
||||
#palette("jenny", "jenny_colors.txt", 3), # I should probably use wikipedia as a source for copyright reasons
|
||||
palette("crayon", "wikicrayons_colors.txt", 2),
|
||||
palette("xkcd", "xkcd_colors.txt", 1),
|
||||
palette("css", "css_colors.txt", 0),
|
||||
#palette("matplotlib", "matplotlib_colors.txt", 2) # there's like 10 colors total, I think we'll survive without them
|
||||
]
|
||||
|
||||
all_colors = []
|
||||
|
||||
from math import sqrt
|
||||
def rgbdist(c1, c2):
|
||||
return sqrt((c1.r - c2.r)**2 + (c1.g - c2.g)**2 + (c1.b - c2.b)**2)
|
||||
|
||||
class Color:
|
||||
def __init__(self, r, g, b, name, prefix, priority):
|
||||
self.r = r
|
||||
self.g = g
|
||||
self.b = b
|
||||
self.name = name
|
||||
self.prefix = prefix
|
||||
self.priority = priority
|
||||
self.nearest_neighbor = None
|
||||
|
||||
def __repr__(self):
|
||||
return f"<Color ({self.r}, {self.g}, {self.b}) - '{self.prefix}:{self.name}', priority = {self.priority}, nearest_neighbor={self.nearest_neighbor.name if self.nearest_neighbor is not None else None}>"
|
||||
|
||||
def nn(self, colors):
|
||||
nearest = None
|
||||
nearest_dist = 999999
|
||||
for c in colors:
|
||||
dist = rgbdist(self, c)
|
||||
if dist == 0: continue
|
||||
if dist < nearest_dist:
|
||||
nearest = c
|
||||
nearest_dist = dist
|
||||
self.nearest_neighbor = nearest
|
||||
|
||||
for p in palettes:
|
||||
prefix = p.name
|
||||
priority = p.priority
|
||||
for name, rgb in p.colors.items():
|
||||
all_colors.append(Color(*rgb, name, prefix, priority))
|
||||
print(f"{prefix}->{len(all_colors)}")
|
||||
|
||||
for c in all_colors:
|
||||
c.nn(all_colors)
|
||||
|
||||
smallest_dist = 9999999999999
|
||||
largest_dist = 0
|
||||
for c in all_colors:
|
||||
dist = rgbdist(c, c.nearest_neighbor)
|
||||
if dist > largest_dist: largest_dist = dist
|
||||
if dist < smallest_dist: smallest_dist = dist
|
||||
#print(f"{c.prefix}:{c.name} -> {c.nearest_neighbor.prefix}:{c.nearest_neighbor.name}\t{rgbdist(c, c.nearest_neighbor):.2f}")
|
||||
# questions -
|
||||
|
||||
# are there any colors where their nearest neighbor's nearest neighbor isn't them? (There should be)
|
||||
nonnear_pairs = 0
|
||||
for c in all_colors:
|
||||
neighbor = c.nearest_neighbor
|
||||
their_neighbor = neighbor.nearest_neighbor
|
||||
if c is not their_neighbor:
|
||||
#print(f"{c.prefix}:{c.name} -> {neighbor.prefix}:{neighbor.name} -> {their_neighbor.prefix}:{their_neighbor.name}")
|
||||
nonnear_pairs += 1
|
||||
print("Non-near pairs:", nonnear_pairs)
|
||||
#print(f"{c.prefix}:{c.name} -> {c.nearest_neighbor.prefix}:{c.nearest_neighbor.name}\t{rgbdist(c, c.nearest_neighbor):.2f}")
|
||||
|
||||
# Are there duplicates? They should be removed from the palette that won't be used
|
||||
dupes = 0
|
||||
for c in all_colors:
|
||||
for c2 in all_colors:
|
||||
if c is c2: continue
|
||||
if c.r == c2.r and c.g == c2.g and c.b == c2.b:
|
||||
dupes += 1
|
||||
print("dupes:", dupes, "this many will need to be removed:", dupes / 2)
|
||||
|
||||
# What order to put them in? Do we want large radiuses first, or some sort of "common color" table?
|
||||
|
||||
# does manhattan distance change any answers over the 16.7M RGB values?
|
||||
|
||||
# What's the worst case lookup? (Checking all 1200 colors to find the name?)
|
|
@ -59,7 +59,7 @@ void GameEngine::run()
|
|||
if (!paused)
|
||||
{
|
||||
}
|
||||
currentScene()->sRender();
|
||||
currentScene()->render();
|
||||
currentFrame++;
|
||||
frameTime = clock.restart().asSeconds();
|
||||
fps = 1 / frameTime;
|
||||
|
|
|
@ -9,6 +9,11 @@ std::vector<sf::SoundBuffer> McRFPy_API::soundbuffers;
|
|||
sf::Music McRFPy_API::music;
|
||||
sf::Sound McRFPy_API::sfx;
|
||||
|
||||
std::shared_ptr<PyFont> McRFPy_API::default_font;
|
||||
std::shared_ptr<PyTexture> McRFPy_API::default_texture;
|
||||
PyObject* McRFPy_API::mcrf_module;
|
||||
|
||||
|
||||
static PyMethodDef mcrfpyMethods[] = {
|
||||
{"registerPyAction", McRFPy_API::_registerPyAction, METH_VARARGS,
|
||||
"Register a callable Python object to correspond to an action string. (actionstr, callable)"},
|
||||
|
@ -39,8 +44,15 @@ static PyMethodDef mcrfpyMethods[] = {
|
|||
};
|
||||
|
||||
static PyModuleDef mcrfpyModule = {
|
||||
PyModuleDef_HEAD_INIT, "mcrfpy", NULL, -1, mcrfpyMethods,
|
||||
NULL, NULL, NULL, NULL
|
||||
PyModuleDef_HEAD_INIT, /* m_base - Always initialize this member to PyModuleDef_HEAD_INIT. */
|
||||
"mcrfpy", /* m_name */
|
||||
NULL, /* m_doc - Docstring for the module; usually a docstring variable created with PyDoc_STRVAR is used. */
|
||||
-1, /* m_size - Setting m_size to -1 means that the module does not support sub-interpreters, because it has global state. */
|
||||
mcrfpyMethods, /* m_methods */
|
||||
NULL, /* m_slots - An array of slot definitions ... When using single-phase initialization, m_slots must be NULL. */
|
||||
NULL, /* traverseproc m_traverse - A traversal function to call during GC traversal of the module object */
|
||||
NULL, /* inquiry m_clear - A clear function to call during GC clearing of the module object */
|
||||
NULL /* freefunc m_free - A function to call during deallocation of the module object */
|
||||
};
|
||||
|
||||
// Module initializer fn, passed to PyImport_AppendInittab
|
||||
|
@ -53,34 +65,38 @@ PyObject* PyInit_mcrfpy()
|
|||
return NULL;
|
||||
}
|
||||
|
||||
// This code runs, but Python segfaults when accessing the UIFrame type.
|
||||
//std::cout << "Adding UIFrame object to module\n";
|
||||
PyModule_AddType(m, &mcrfpydef::PyColorType);
|
||||
PyModule_AddType(m, &mcrfpydef::PyFontType);
|
||||
PyModule_AddType(m, &mcrfpydef::PyUICaptionType);
|
||||
PyModule_AddType(m, &mcrfpydef::PyTextureType);
|
||||
PyModule_AddType(m, &mcrfpydef::PyUISpriteType);
|
||||
using namespace mcrfpydef;
|
||||
PyTypeObject* pytypes[] = {
|
||||
/*SFML exposed types*/
|
||||
&PyColorType, /*&PyLinkedColorType,*/ &PyFontType, &PyTextureType, &PyVectorType,
|
||||
|
||||
if (PyModule_AddType(m, &mcrfpydef::PyUIFrameType) < 0)
|
||||
/*UI widgets*/
|
||||
&PyUICaptionType, &PyUISpriteType, &PyUIFrameType, &PyUIEntityType, &PyUIGridType,
|
||||
|
||||
/*game map & perspective data*/
|
||||
&PyUIGridPointType, &PyUIGridPointStateType,
|
||||
|
||||
/*collections & iterators*/
|
||||
&PyUICollectionType, &PyUICollectionIterType,
|
||||
&PyUIEntityCollectionType, &PyUIEntityCollectionIterType,
|
||||
nullptr};
|
||||
int i = 0;
|
||||
auto t = pytypes[i];
|
||||
while (t != nullptr)
|
||||
{
|
||||
std::cout << "Error adding UIFrame type to module; aborting" << std::endl;
|
||||
Py_DECREF(&mcrfpydef::PyUIFrameType);
|
||||
return NULL;
|
||||
/*std::cout << */ PyType_Ready(t); /*<< std::endl; */
|
||||
PyModule_AddType(m, t);
|
||||
t = pytypes[i++];
|
||||
}
|
||||
PyModule_AddType(m, &mcrfpydef::PyUICollectionType);
|
||||
PyModule_AddType(m, &mcrfpydef::PyUICollectionIterType);
|
||||
|
||||
PyModule_AddType(m, &mcrfpydef::PyUIGridPointType);
|
||||
PyModule_AddType(m, &mcrfpydef::PyUIGridPointStateType);
|
||||
PyModule_AddType(m, &mcrfpydef::PyUIEntityType);
|
||||
|
||||
PyModule_AddType(m, &mcrfpydef::PyUIEntityCollectionIterType);
|
||||
PyModule_AddType(m, &mcrfpydef::PyUIEntityCollectionType);
|
||||
|
||||
PyModule_AddType(m, &mcrfpydef::PyUIGridType);
|
||||
|
||||
|
||||
|
||||
// Add default_font and default_texture to module
|
||||
McRFPy_API::default_font = std::make_shared<PyFont>("assets/JetbrainsMono.ttf");
|
||||
McRFPy_API::default_texture = std::make_shared<PyTexture>("assets/kenney_tinydungeon.png", 16, 16);
|
||||
//PyModule_AddObject(m, "default_font", McRFPy_API::default_font->pyObject());
|
||||
//PyModule_AddObject(m, "default_texture", McRFPy_API::default_texture->pyObject());
|
||||
PyModule_AddObject(m, "default_font", Py_None);
|
||||
PyModule_AddObject(m, "default_texture", Py_None);
|
||||
//McRFPy_API::mcrf_module = m;
|
||||
return m;
|
||||
}
|
||||
|
||||
|
@ -132,9 +148,13 @@ PyStatus init_python(const char *program_name)
|
|||
#endif
|
||||
|
||||
status = Py_InitializeFromConfig(&config);
|
||||
|
||||
PyConfig_Clear(&config);
|
||||
|
||||
return status;
|
||||
}
|
||||
|
||||
/*
|
||||
void McRFPy_API::setSpriteTexture(int ti)
|
||||
{
|
||||
int tx = ti % texture_width, ty = ti / texture_width;
|
||||
|
@ -143,6 +163,7 @@ void McRFPy_API::setSpriteTexture(int ti)
|
|||
ty * texture_size,
|
||||
texture_size, texture_size));
|
||||
}
|
||||
*/
|
||||
|
||||
// functionality
|
||||
//void McRFPy_API::
|
||||
|
@ -159,6 +180,15 @@ void McRFPy_API::api_init() {
|
|||
//texture_sprite_count = texture_width * texture_height;
|
||||
//texture.setSmooth(false);
|
||||
|
||||
// Add default_font and default_texture to module
|
||||
McRFPy_API::mcrf_module = PyImport_ImportModule("mcrfpy");
|
||||
std::cout << PyUnicode_AsUTF8(PyObject_Repr(McRFPy_API::mcrf_module)) << std::endl;
|
||||
|
||||
//PyModule_AddObject(McRFPy_API::mcrf_module, "default_font", McRFPy_API::default_font->pyObject());
|
||||
PyObject_SetAttrString(McRFPy_API::mcrf_module, "default_font", McRFPy_API::default_font->pyObject());
|
||||
//PyModule_AddObject(McRFPy_API::mcrf_module, "default_texture", McRFPy_API::default_texture->pyObject());
|
||||
PyObject_SetAttrString(McRFPy_API::mcrf_module, "default_texture", McRFPy_API::default_texture->pyObject());
|
||||
|
||||
//sprite.setTexture(texture);
|
||||
//sprite.setScale(sf::Vector2f(4.0f, 4.0f));
|
||||
//setSpriteTexture(0);
|
||||
|
|
|
@ -3,6 +3,9 @@
|
|||
#include "Python.h"
|
||||
#include <list>
|
||||
|
||||
#include "PyFont.h"
|
||||
#include "PyTexture.h"
|
||||
|
||||
class GameEngine; // forward declared (circular members)
|
||||
|
||||
class McRFPy_API
|
||||
|
@ -14,10 +17,14 @@ private:
|
|||
|
||||
McRFPy_API();
|
||||
|
||||
|
||||
public:
|
||||
inline static sf::Sprite sprite;
|
||||
inline static sf::Texture texture;
|
||||
static void setSpriteTexture(int);
|
||||
static PyObject* mcrf_module;
|
||||
static std::shared_ptr<PyFont> default_font;
|
||||
static std::shared_ptr<PyTexture> default_texture;
|
||||
//inline static sf::Sprite sprite;
|
||||
//inline static sf::Texture texture;
|
||||
//static void setSpriteTexture(int);
|
||||
inline static GameEngine* game;
|
||||
static void api_init();
|
||||
static void api_shutdown();
|
||||
|
|
|
@ -0,0 +1,150 @@
|
|||
#include "PyColor.h"
|
||||
#include "McRFPy_API.h"
|
||||
|
||||
PyGetSetDef PyColor::getsetters[] = {
|
||||
{"r", (getter)PyColor::get_member, (setter)PyColor::set_member, "Red component", (void*)0},
|
||||
{"g", (getter)PyColor::get_member, (setter)PyColor::set_member, "Green component", (void*)1},
|
||||
{"b", (getter)PyColor::get_member, (setter)PyColor::set_member, "Blue component", (void*)2},
|
||||
{"a", (getter)PyColor::get_member, (setter)PyColor::set_member, "Alpha component", (void*)3},
|
||||
{NULL}
|
||||
};
|
||||
|
||||
PyColor::PyColor(sf::Color target)
|
||||
:data(target) {}
|
||||
|
||||
PyObject* PyColor::pyObject()
|
||||
{
|
||||
PyObject* obj = PyType_GenericAlloc(&mcrfpydef::PyColorType, 0);
|
||||
Py_INCREF(obj);
|
||||
PyColorObject* self = (PyColorObject*)obj;
|
||||
self->data = data;
|
||||
return obj;
|
||||
}
|
||||
|
||||
sf::Color PyColor::fromPy(PyObject* obj)
|
||||
{
|
||||
PyColorObject* self = (PyColorObject*)obj;
|
||||
return self->data;
|
||||
}
|
||||
|
||||
sf::Color PyColor::fromPy(PyColorObject* self)
|
||||
{
|
||||
return self->data;
|
||||
}
|
||||
|
||||
void PyColor::set(sf::Color color)
|
||||
{
|
||||
data = color;
|
||||
}
|
||||
|
||||
sf::Color PyColor::get()
|
||||
{
|
||||
return data;
|
||||
}
|
||||
|
||||
Py_hash_t PyColor::hash(PyObject* obj)
|
||||
{
|
||||
auto self = (PyColorObject*)obj;
|
||||
Py_hash_t value = 0;
|
||||
value += self->data.r;
|
||||
value << 8; value += self->data.g;
|
||||
value << 8; value += self->data.b;
|
||||
value << 8; value += self->data.a;
|
||||
|
||||
return value;
|
||||
}
|
||||
|
||||
PyObject* PyColor::repr(PyObject* obj)
|
||||
{
|
||||
PyColorObject* self = (PyColorObject*)obj;
|
||||
std::ostringstream ss;
|
||||
sf::Color c = self->data;
|
||||
ss << "<Color (" << int(c.r) << ", " << int(c.g) << ", " << int(c.b) << ", " << int(c.a) << ")>";
|
||||
|
||||
std::string repr_str = ss.str();
|
||||
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
|
||||
}
|
||||
|
||||
|
||||
int PyColor::init(PyColorObject* self, PyObject* args, PyObject* kwds) {
|
||||
//using namespace mcrfpydef;
|
||||
static const char* keywords[] = { "r", "g", "b", "a", nullptr };
|
||||
PyObject* leader;
|
||||
int r = -1, g = -1, b = -1, a = 255;
|
||||
|
||||
if (!PyArg_ParseTupleAndKeywords(args, kwds, "O|iii", const_cast<char**>(keywords), &leader, &g, &b, &a)) {
|
||||
PyErr_SetString(PyExc_TypeError, "mcrfpy.Color requires a 3-tuple, 4-tuple, color name, or integer values within 0-255 (r, g, b, optionally a)");
|
||||
return -1;
|
||||
}
|
||||
|
||||
//std::cout << "Arg parsing succeeded. Values: " << r << " " << g << " " << b << " " << a <<std::endl;
|
||||
//std::cout << PyUnicode_AsUTF8(PyObject_Repr(leader)) << std::endl;
|
||||
// Tuple cases
|
||||
if (PyTuple_Check(leader)) {
|
||||
Py_ssize_t tupleSize = PyTuple_Size(leader);
|
||||
if (tupleSize < 3 || tupleSize > 4) {
|
||||
PyErr_SetString(PyExc_TypeError, "Invalid tuple length: mcrfpy.Color requires a 3-tuple, 4-tuple, color name, or integer values within 0-255 (r, g, b, optionally a)");
|
||||
return -1;
|
||||
}
|
||||
r = PyLong_AsLong(PyTuple_GetItem(leader, 0));
|
||||
g = PyLong_AsLong(PyTuple_GetItem(leader, 1));
|
||||
b = PyLong_AsLong(PyTuple_GetItem(leader, 2));
|
||||
if (tupleSize == 4) {
|
||||
a = PyLong_AsLong(PyTuple_GetItem(leader, 3));
|
||||
}
|
||||
}
|
||||
// Color name (not implemented yet)
|
||||
else if (PyUnicode_Check(leader)) {
|
||||
PyErr_SetString(PyExc_NotImplementedError, "Color names aren't ready yet");
|
||||
return -1;
|
||||
}
|
||||
// Check if the leader is actually an integer for the r value
|
||||
else if (PyLong_Check(leader)) {
|
||||
r = PyLong_AsLong(leader);
|
||||
// Additional validation not shown; g, b are required to be parsed
|
||||
} else {
|
||||
PyErr_SetString(PyExc_TypeError, "mcrfpy.Color requires a 3-tuple, 4-tuple, color name, or integer values within 0-255 (r, g, b, optionally a)");
|
||||
return -1;
|
||||
}
|
||||
|
||||
// Validate color values
|
||||
if (r < 0 || r > 255 || g < 0 || g > 255 || b < 0 || b > 255 || a < 0 || a > 255) {
|
||||
PyErr_SetString(PyExc_ValueError, "Color values must be between 0 and 255.");
|
||||
return -1;
|
||||
}
|
||||
|
||||
self->data = sf::Color(r, g, b, a);
|
||||
return 0;
|
||||
}
|
||||
|
||||
PyObject* PyColor::pynew(PyTypeObject* type, PyObject* args, PyObject* kwds)
|
||||
{
|
||||
auto obj = (PyObject*)type->tp_alloc(type, 0);
|
||||
//Py_INCREF(obj);
|
||||
return obj;
|
||||
}
|
||||
|
||||
PyObject* PyColor::get_member(PyObject* obj, void* closure)
|
||||
{
|
||||
// TODO
|
||||
return Py_None;
|
||||
}
|
||||
|
||||
int PyColor::set_member(PyObject* obj, PyObject* value, void* closure)
|
||||
{
|
||||
// TODO
|
||||
return 0;
|
||||
}
|
||||
|
||||
PyColorObject* PyColor::from_arg(PyObject* args)
|
||||
{
|
||||
auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "Color");
|
||||
if (PyObject_IsInstance(args, (PyObject*)type)) return (PyColorObject*)args;
|
||||
auto obj = (PyColorObject*)type->tp_alloc(type, 0);
|
||||
int err = init(obj, args, NULL);
|
||||
if (err) {
|
||||
Py_DECREF(obj);
|
||||
return NULL;
|
||||
}
|
||||
return obj;
|
||||
}
|
|
@ -0,0 +1,48 @@
|
|||
#pragma once
|
||||
#include "Common.h"
|
||||
#include "Python.h"
|
||||
|
||||
class PyColor;
|
||||
class UIDrawable; // forward declare for pointer
|
||||
|
||||
typedef struct {
|
||||
PyObject_HEAD
|
||||
sf::Color data;
|
||||
} PyColorObject;
|
||||
|
||||
class PyColor
|
||||
{
|
||||
private:
|
||||
public:
|
||||
sf::Color data;
|
||||
PyColor(sf::Color);
|
||||
void set(sf::Color);
|
||||
sf::Color get();
|
||||
PyObject* pyObject();
|
||||
static sf::Color fromPy(PyObject*);
|
||||
static sf::Color fromPy(PyColorObject*);
|
||||
static PyObject* repr(PyObject*);
|
||||
static Py_hash_t hash(PyObject*);
|
||||
static int init(PyColorObject*, PyObject*, PyObject*);
|
||||
static PyObject* pynew(PyTypeObject* type, PyObject* args=NULL, PyObject* kwds=NULL);
|
||||
static PyObject* get_member(PyObject*, void*);
|
||||
static int set_member(PyObject*, PyObject*, void*);
|
||||
|
||||
static PyGetSetDef getsetters[];
|
||||
static PyColorObject* from_arg(PyObject*);
|
||||
};
|
||||
|
||||
namespace mcrfpydef {
|
||||
static PyTypeObject PyColorType = {
|
||||
.tp_name = "mcrfpy.Color",
|
||||
.tp_basicsize = sizeof(PyColorObject),
|
||||
.tp_itemsize = 0,
|
||||
.tp_repr = PyColor::repr,
|
||||
.tp_hash = PyColor::hash,
|
||||
.tp_flags = Py_TPFLAGS_DEFAULT,
|
||||
.tp_doc = PyDoc_STR("SFML Color Object"),
|
||||
.tp_getset = PyColor::getsetters,
|
||||
.tp_init = (initproc)PyColor::init,
|
||||
.tp_new = PyColor::pynew,
|
||||
};
|
||||
}
|
|
@ -0,0 +1,63 @@
|
|||
#include "PyFont.h"
|
||||
#include "McRFPy_API.h"
|
||||
|
||||
|
||||
PyFont::PyFont(std::string filename)
|
||||
: source(filename)
|
||||
{
|
||||
font = sf::Font();
|
||||
font.loadFromFile(source);
|
||||
}
|
||||
|
||||
PyObject* PyFont::pyObject()
|
||||
{
|
||||
auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "Font");
|
||||
//PyObject* obj = PyType_GenericAlloc(&mcrfpydef::PyFontType, 0);
|
||||
PyObject* obj = PyFont::pynew(type, Py_None, Py_None);
|
||||
try {
|
||||
((PyFontObject*)obj)->data = shared_from_this();
|
||||
}
|
||||
catch (std::bad_weak_ptr& e)
|
||||
{
|
||||
std::cout << "Bad weak ptr: shared_from_this() failed in PyFont::pyObject(); did you create a PyFont outside of std::make_shared? enjoy your segfault, soon!" << std::endl;
|
||||
}
|
||||
// TODO - shared_from_this will raise an exception if the object does not have a shared pointer. Constructor should be made private; write a factory function
|
||||
return obj;
|
||||
}
|
||||
|
||||
PyObject* PyFont::repr(PyObject* obj)
|
||||
{
|
||||
PyFontObject* self = (PyFontObject*)obj;
|
||||
std::ostringstream ss;
|
||||
if (!self->data)
|
||||
{
|
||||
ss << "<Font [invalid internal object]>";
|
||||
std::string repr_str = ss.str();
|
||||
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
|
||||
}
|
||||
auto& pfont = *(self->data);
|
||||
ss << "<Font (family=" << pfont.font.getInfo().family << ") source=`" << pfont.source << "`>";
|
||||
std::string repr_str = ss.str();
|
||||
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
|
||||
}
|
||||
|
||||
Py_hash_t PyFont::hash(PyObject* obj)
|
||||
{
|
||||
auto self = (PyFontObject*)obj;
|
||||
return reinterpret_cast<Py_hash_t>(self->data.get());
|
||||
}
|
||||
|
||||
int PyFont::init(PyFontObject* self, PyObject* args, PyObject* kwds)
|
||||
{
|
||||
static const char* keywords[] = { "filename", nullptr };
|
||||
char* filename;
|
||||
if (!PyArg_ParseTupleAndKeywords(args, kwds, "s", const_cast<char**>(keywords), &filename))
|
||||
return -1;
|
||||
self->data = std::make_shared<PyFont>(filename);
|
||||
return 0;
|
||||
}
|
||||
|
||||
PyObject* PyFont::pynew(PyTypeObject* type, PyObject* args, PyObject* kwds)
|
||||
{
|
||||
return (PyObject*)type->tp_alloc(type, 0);
|
||||
}
|
|
@ -0,0 +1,39 @@
|
|||
#pragma once
|
||||
#include "Common.h"
|
||||
#include "Python.h"
|
||||
|
||||
class PyFont;
|
||||
|
||||
typedef struct {
|
||||
PyObject_HEAD
|
||||
std::shared_ptr<PyFont> data;
|
||||
} PyFontObject;
|
||||
|
||||
class PyFont : public std::enable_shared_from_this<PyFont>
|
||||
{
|
||||
private:
|
||||
std::string source;
|
||||
public:
|
||||
PyFont(std::string filename);
|
||||
sf::Font font;
|
||||
PyObject* pyObject();
|
||||
static PyObject* repr(PyObject*);
|
||||
static Py_hash_t hash(PyObject*);
|
||||
static int init(PyFontObject*, PyObject*, PyObject*);
|
||||
static PyObject* pynew(PyTypeObject* type, PyObject* args=NULL, PyObject* kwds=NULL);
|
||||
};
|
||||
|
||||
namespace mcrfpydef {
|
||||
static PyTypeObject PyFontType = {
|
||||
.tp_name = "mcrfpy.Font",
|
||||
.tp_basicsize = sizeof(PyFontObject),
|
||||
.tp_itemsize = 0,
|
||||
.tp_repr = PyFont::repr,
|
||||
//.tp_hash = PyFont::hash,
|
||||
.tp_flags = Py_TPFLAGS_DEFAULT,
|
||||
.tp_doc = PyDoc_STR("SFML Font Object"),
|
||||
//.tp_base = &PyBaseObject_Type,
|
||||
.tp_init = (initproc)PyFont::init,
|
||||
.tp_new = PyType_GenericNew, //PyFont::pynew,
|
||||
};
|
||||
}
|
|
@ -59,7 +59,7 @@ void PyScene::doAction(std::string name, std::string type)
|
|||
}
|
||||
}
|
||||
|
||||
void PyScene::sRender()
|
||||
void PyScene::render()
|
||||
{
|
||||
game->getWindow().clear();
|
||||
|
||||
|
|
|
@ -11,7 +11,7 @@ public:
|
|||
PyScene(GameEngine*);
|
||||
void update() override final;
|
||||
void doAction(std::string, std::string) override final;
|
||||
void sRender() override final;
|
||||
void render() override final;
|
||||
|
||||
void do_mouse_input(std::string, std::string);
|
||||
};
|
||||
|
|
|
@ -0,0 +1,82 @@
|
|||
#include "PyTexture.h"
|
||||
#include "McRFPy_API.h"
|
||||
|
||||
PyTexture::PyTexture(std::string filename, int sprite_w, int sprite_h)
|
||||
: source(filename), sprite_width(sprite_w), sprite_height(sprite_h)
|
||||
{
|
||||
texture = sf::Texture();
|
||||
texture.loadFromFile(source);
|
||||
auto size = texture.getSize();
|
||||
sheet_width = (size.x / sprite_width);
|
||||
sheet_height = (size.y / sprite_height);
|
||||
if (size.x % sprite_width != 0 || size.y % sprite_height != 0)
|
||||
{
|
||||
std::cout << "Warning: Texture `" << source << "` is not an even number of sprite widths or heights across." << std::endl
|
||||
<< "Sprite size given was " << sprite_w << "x" << sprite_h << "px but the file has a resolution of " << sheet_width << "x" << sheet_height << "px." << std::endl;
|
||||
}
|
||||
}
|
||||
|
||||
sf::Sprite PyTexture::sprite(int index, sf::Vector2f pos, sf::Vector2f s)
|
||||
{
|
||||
int tx = index % sheet_width, ty = index / sheet_width;
|
||||
auto ir = sf::IntRect(tx * sprite_width, ty * sprite_height, sprite_width, sprite_height);
|
||||
auto sprite = sf::Sprite(texture, ir);
|
||||
sprite.setPosition(pos);
|
||||
sprite.setScale(s);
|
||||
return sprite;
|
||||
}
|
||||
|
||||
PyObject* PyTexture::pyObject()
|
||||
{
|
||||
std::cout << "Find type" << std::endl;
|
||||
auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "Texture");
|
||||
PyObject* obj = PyTexture::pynew(type, Py_None, Py_None);
|
||||
|
||||
try {
|
||||
((PyTextureObject*)obj)->data = shared_from_this();
|
||||
}
|
||||
catch (std::bad_weak_ptr& e)
|
||||
{
|
||||
std::cout << "Bad weak ptr: shared_from_this() failed in PyTexture::pyObject(); did you create a PyTexture outside of std::make_shared? enjoy your segfault, soon!" << std::endl;
|
||||
}
|
||||
// TODO - shared_from_this will raise an exception if the object does not have a shared pointer. Constructor should be made private; write a factory function
|
||||
return obj;
|
||||
}
|
||||
|
||||
PyObject* PyTexture::repr(PyObject* obj)
|
||||
{
|
||||
PyTextureObject* self = (PyTextureObject*)obj;
|
||||
std::ostringstream ss;
|
||||
if (!self->data)
|
||||
{
|
||||
ss << "<Texture [invalid internal object]>";
|
||||
std::string repr_str = ss.str();
|
||||
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
|
||||
}
|
||||
auto& ptex = *(self->data);
|
||||
ss << "<Texture " << ptex.sheet_height << " rows, " << ptex.sheet_width << " columns; " << ptex.sprite_width << "x" << ptex.sprite_height << "px sprites. source='" << ptex.source << "'>";
|
||||
std::string repr_str = ss.str();
|
||||
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
|
||||
}
|
||||
|
||||
Py_hash_t PyTexture::hash(PyObject* obj)
|
||||
{
|
||||
auto self = (PyTextureObject*)obj;
|
||||
return reinterpret_cast<Py_hash_t>(self->data.get());
|
||||
}
|
||||
|
||||
int PyTexture::init(PyTextureObject* self, PyObject* args, PyObject* kwds)
|
||||
{
|
||||
static const char* keywords[] = { "filename", "sprite_width", "sprite_height", nullptr };
|
||||
char* filename;
|
||||
int sprite_width, sprite_height;
|
||||
if (!PyArg_ParseTupleAndKeywords(args, kwds, "sii", const_cast<char**>(keywords), &filename, &sprite_width, &sprite_height))
|
||||
return -1;
|
||||
self->data = std::make_shared<PyTexture>(filename, sprite_width, sprite_height);
|
||||
return 0;
|
||||
}
|
||||
|
||||
PyObject* PyTexture::pynew(PyTypeObject* type, PyObject* args, PyObject* kwds)
|
||||
{
|
||||
return (PyObject*)type->tp_alloc(type, 0);
|
||||
}
|
|
@ -0,0 +1,43 @@
|
|||
#pragma once
|
||||
#include "Common.h"
|
||||
#include "Python.h"
|
||||
|
||||
class PyTexture;
|
||||
|
||||
typedef struct {
|
||||
PyObject_HEAD
|
||||
std::shared_ptr<PyTexture> data;
|
||||
} PyTextureObject;
|
||||
|
||||
class PyTexture : public std::enable_shared_from_this<PyTexture>
|
||||
{
|
||||
private:
|
||||
sf::Texture texture;
|
||||
std::string source;
|
||||
int sheet_width, sheet_height;
|
||||
public:
|
||||
int sprite_width, sprite_height; // just use them read only, OK?
|
||||
PyTexture(std::string filename, int sprite_w, int sprite_h);
|
||||
sf::Sprite sprite(int index, sf::Vector2f pos = sf::Vector2f(0, 0), sf::Vector2f s = sf::Vector2f(1.0, 1.0));
|
||||
|
||||
PyObject* pyObject();
|
||||
static PyObject* repr(PyObject*);
|
||||
static Py_hash_t hash(PyObject*);
|
||||
static int init(PyTextureObject*, PyObject*, PyObject*);
|
||||
static PyObject* pynew(PyTypeObject* type, PyObject* args=NULL, PyObject* kwds=NULL);
|
||||
};
|
||||
|
||||
namespace mcrfpydef {
|
||||
static PyTypeObject PyTextureType = {
|
||||
.tp_name = "mcrfpy.Texture",
|
||||
.tp_basicsize = sizeof(PyTextureObject),
|
||||
.tp_itemsize = 0,
|
||||
.tp_repr = PyTexture::repr,
|
||||
.tp_hash = PyTexture::hash,
|
||||
.tp_flags = Py_TPFLAGS_DEFAULT,
|
||||
.tp_doc = PyDoc_STR("SFML Texture Object"),
|
||||
//.tp_base = &PyBaseObject_Type,
|
||||
.tp_init = (initproc)PyTexture::init,
|
||||
.tp_new = PyType_GenericNew, //PyTexture::pynew,
|
||||
};
|
||||
}
|
|
@ -0,0 +1,111 @@
|
|||
#include "PyVector.h"
|
||||
|
||||
PyGetSetDef PyVector::getsetters[] = {
|
||||
{"x", (getter)PyVector::get_member, (setter)PyVector::set_member, "X/horizontal component", (void*)0},
|
||||
{"y", (getter)PyVector::get_member, (setter)PyVector::set_member, "Y/vertical component", (void*)1},
|
||||
{NULL}
|
||||
};
|
||||
|
||||
PyVector::PyVector(sf::Vector2f target)
|
||||
:data(target) {}
|
||||
|
||||
PyObject* PyVector::pyObject()
|
||||
{
|
||||
PyObject* obj = PyType_GenericAlloc(&mcrfpydef::PyVectorType, 0);
|
||||
Py_INCREF(obj);
|
||||
PyVectorObject* self = (PyVectorObject*)obj;
|
||||
self->data = data;
|
||||
return obj;
|
||||
}
|
||||
|
||||
sf::Vector2f PyVector::fromPy(PyObject* obj)
|
||||
{
|
||||
PyVectorObject* self = (PyVectorObject*)obj;
|
||||
return self->data;
|
||||
}
|
||||
|
||||
sf::Vector2f PyVector::fromPy(PyVectorObject* self)
|
||||
{
|
||||
return self->data;
|
||||
}
|
||||
|
||||
Py_hash_t PyVector::hash(PyObject* obj)
|
||||
{
|
||||
auto self = (PyVectorObject*)obj;
|
||||
Py_hash_t value = 0;
|
||||
value += self->data.x;
|
||||
value << 8; value += self->data.y;
|
||||
|
||||
return value;
|
||||
}
|
||||
|
||||
PyObject* PyVector::repr(PyObject* obj)
|
||||
{
|
||||
PyVectorObject* self = (PyVectorObject*)obj;
|
||||
std::ostringstream ss;
|
||||
sf::Vector2f v = self->data;
|
||||
ss << "<Vector (" << v.x << ", " << v.y << ")>";
|
||||
|
||||
std::string repr_str = ss.str();
|
||||
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
|
||||
}
|
||||
|
||||
|
||||
int PyVector::init(PyVectorObject* self, PyObject* args, PyObject* kwds)
|
||||
{
|
||||
using namespace mcrfpydef;
|
||||
static const char* keywords[] = { "x", "y", nullptr };
|
||||
PyObject* leader = NULL;
|
||||
float x=0, y=0;
|
||||
if (!PyArg_ParseTupleAndKeywords(args, kwds, "|Of", const_cast<char**>(keywords), &leader, &y))
|
||||
{
|
||||
//PyErr_SetString(PyExc_TypeError, "mcrfpy.Vector requires a 2-tuple or two numeric values");
|
||||
return -1;
|
||||
}
|
||||
if (leader == NULL || leader == Py_None)
|
||||
{
|
||||
self->data = sf::Vector2f();
|
||||
return 0;
|
||||
}
|
||||
|
||||
if (PyTuple_Check(leader))
|
||||
{
|
||||
if (PyTuple_Size(leader) != 2)
|
||||
{
|
||||
PyErr_SetString(PyExc_TypeError, "Invalid tuple length: mcrfpy.Vector requires a 2-tuple");
|
||||
return -1;
|
||||
}
|
||||
x = PyFloat_AsDouble(PyTuple_GetItem(leader, 0));
|
||||
y = PyFloat_AsDouble(PyTuple_GetItem(leader, 1));
|
||||
|
||||
self->data = sf::Vector2f(x, y);
|
||||
return 0;
|
||||
}
|
||||
// else -
|
||||
else if (!PyFloat_Check(leader) && !(PyLong_Check(leader)))
|
||||
{
|
||||
PyErr_SetString(PyExc_TypeError, "mcrfpy.Vector requires a 2-tuple or two numeric values");
|
||||
return -1;
|
||||
}
|
||||
if (PyFloat_Check(leader)) x = PyFloat_AsDouble(leader);
|
||||
else x = PyLong_AsDouble(leader);
|
||||
self->data = sf::Vector2f(x, y);
|
||||
return 0;
|
||||
}
|
||||
|
||||
PyObject* PyVector::pynew(PyTypeObject* type, PyObject* args, PyObject* kwds)
|
||||
{
|
||||
return (PyObject*)type->tp_alloc(type, 0);
|
||||
}
|
||||
|
||||
PyObject* PyVector::get_member(PyObject* obj, void* closure)
|
||||
{
|
||||
// TODO
|
||||
return Py_None;
|
||||
}
|
||||
|
||||
int PyVector::set_member(PyObject* obj, PyObject* value, void* closure)
|
||||
{
|
||||
// TODO
|
||||
return 0;
|
||||
}
|
|
@ -0,0 +1,42 @@
|
|||
#pragma once
|
||||
#include "Common.h"
|
||||
#include "Python.h"
|
||||
|
||||
typedef struct {
|
||||
PyObject_HEAD
|
||||
sf::Vector2f data;
|
||||
} PyVectorObject;
|
||||
|
||||
class PyVector
|
||||
{
|
||||
public:
|
||||
sf::Vector2f data;
|
||||
PyVector(sf::Vector2f);
|
||||
PyVector();
|
||||
PyObject* pyObject();
|
||||
static sf::Vector2f fromPy(PyObject*);
|
||||
static sf::Vector2f fromPy(PyVectorObject*);
|
||||
static PyObject* repr(PyObject*);
|
||||
static Py_hash_t hash(PyObject*);
|
||||
static int init(PyVectorObject*, PyObject*, PyObject*);
|
||||
static PyObject* pynew(PyTypeObject* type, PyObject* args=NULL, PyObject* kwds=NULL);
|
||||
static PyObject* get_member(PyObject*, void*);
|
||||
static int set_member(PyObject*, PyObject*, void*);
|
||||
|
||||
static PyGetSetDef getsetters[];
|
||||
};
|
||||
|
||||
namespace mcrfpydef {
|
||||
static PyTypeObject PyVectorType = {
|
||||
.tp_name = "mcrfpy.Vector",
|
||||
.tp_basicsize = sizeof(PyVectorObject),
|
||||
.tp_itemsize = 0,
|
||||
.tp_repr = PyVector::repr,
|
||||
.tp_hash = PyVector::hash,
|
||||
.tp_flags = Py_TPFLAGS_DEFAULT,
|
||||
.tp_doc = PyDoc_STR("SFML Vector Object"),
|
||||
.tp_getset = PyVector::getsetters,
|
||||
.tp_init = (initproc)PyVector::init,
|
||||
.tp_new = PyVector::pynew,
|
||||
};
|
||||
}
|
|
@ -31,7 +31,7 @@ public:
|
|||
//Scene();
|
||||
Scene(GameEngine*);
|
||||
virtual void update() = 0;
|
||||
virtual void sRender() = 0;
|
||||
virtual void render() = 0;
|
||||
virtual void doAction(std::string, std::string) = 0;
|
||||
bool hasAction(std::string);
|
||||
bool hasAction(int);
|
||||
|
|
471
src/UI.cpp
471
src/UI.cpp
|
@ -1,471 +0,0 @@
|
|||
#include "UI.h"
|
||||
#include "Resources.h"
|
||||
#include "GameEngine.h"
|
||||
|
||||
/* //callability fields & methods
|
||||
PyObject* click_callable;
|
||||
virtual UIDrawable* click_at(sf::Vector2f point);
|
||||
void click_register(PyObject*);
|
||||
void click_unregister();
|
||||
*/
|
||||
|
||||
UIDrawable::UIDrawable() { click_callable = NULL; }
|
||||
|
||||
UIDrawable* UIFrame::click_at(sf::Vector2f point)
|
||||
{
|
||||
for (auto e: *children)
|
||||
{
|
||||
auto p = e->click_at(point + box.getPosition());
|
||||
if (p)
|
||||
return p;
|
||||
}
|
||||
if (click_callable)
|
||||
{
|
||||
float x = box.getPosition().x, y = box.getPosition().y, w = box.getSize().x, h = box.getSize().y;
|
||||
if (point.x > x && point.y > y && point.x < x+w && point.y < y+h) return this;
|
||||
}
|
||||
return NULL;
|
||||
}
|
||||
|
||||
UIDrawable* UICaption::click_at(sf::Vector2f point)
|
||||
{
|
||||
if (click_callable)
|
||||
{
|
||||
if (text.getGlobalBounds().contains(point)) return this;
|
||||
}
|
||||
return NULL;
|
||||
}
|
||||
|
||||
UIDrawable* UISprite::click_at(sf::Vector2f point)
|
||||
{
|
||||
if (click_callable)
|
||||
{
|
||||
if(sprite.getGlobalBounds().contains(point)) return this;
|
||||
}
|
||||
return NULL;
|
||||
}
|
||||
|
||||
UIDrawable* UIGrid::click_at(sf::Vector2f point)
|
||||
{
|
||||
if (click_callable)
|
||||
{
|
||||
if(box.getGlobalBounds().contains(point)) return this;
|
||||
}
|
||||
return NULL;
|
||||
}
|
||||
|
||||
void UIDrawable::click_register(PyObject* callable)
|
||||
{
|
||||
/*
|
||||
if (click_callable)
|
||||
{
|
||||
// decrement reference before overwriting
|
||||
Py_DECREF(click_callable);
|
||||
}
|
||||
click_callable = callable;
|
||||
Py_INCREF(click_callable);
|
||||
*/
|
||||
click_callable = std::make_unique<PyClickCallable>(callable);
|
||||
}
|
||||
|
||||
void UIDrawable::click_unregister()
|
||||
{
|
||||
/*
|
||||
if (click_callable == NULL) return;
|
||||
Py_DECREF(click_callable);
|
||||
click_callable = NULL;
|
||||
*/
|
||||
click_callable.reset();
|
||||
}
|
||||
|
||||
void UIDrawable::render()
|
||||
{
|
||||
//std::cout << "Rendering base UIDrawable\n";
|
||||
render(sf::Vector2f());
|
||||
}
|
||||
UIFrame::UIFrame():
|
||||
//x(0), y(0), w(0), h(0),
|
||||
outline(0)
|
||||
{
|
||||
children = std::make_shared<std::vector<std::shared_ptr<UIDrawable>>>();
|
||||
box.setPosition(0, 0);
|
||||
box.setSize(sf::Vector2f(0, 0));
|
||||
/*
|
||||
pyOutlineColor = NULL;
|
||||
pyFillColor = NULL;
|
||||
_outlineColor = NULL;
|
||||
_fillColor = NULL;
|
||||
*/
|
||||
}
|
||||
|
||||
UIFrame::UIFrame(float _x, float _y, float _w, float _h):
|
||||
//x(_x), y(_y), w(_w), h(_h),
|
||||
outline(0)
|
||||
{
|
||||
box.setPosition(_x, _y);
|
||||
box.setSize(sf::Vector2f(_w, _h));
|
||||
children = std::make_shared<std::vector<std::shared_ptr<UIDrawable>>>();
|
||||
/*
|
||||
pyOutlineColor = NULL;
|
||||
pyFillColor = NULL;
|
||||
_outlineColor = NULL;
|
||||
_fillColor = NULL;
|
||||
*/
|
||||
}
|
||||
|
||||
UIFrame::~UIFrame()
|
||||
{
|
||||
children.reset();
|
||||
/*
|
||||
if (pyOutlineColor) Py_DECREF(pyOutlineColor);
|
||||
else if (_outlineColor) delete _outlineColor;
|
||||
if (pyFillColor) Py_DECREF(pyFillColor);
|
||||
else if (_fillColor) delete _fillColor;
|
||||
*/
|
||||
}
|
||||
|
||||
/*
|
||||
sf::Color& fillColor(); // getter
|
||||
void fillColor(sf::Color c); // C++ setter
|
||||
void fillColor(PyObject* pyColor); // Python setter
|
||||
|
||||
sf::Color& outlineColor(); // getter
|
||||
void outlineColor(sf::Color c); // C++ setter
|
||||
void outlineColor(PyObject* pyColor); // Python setter
|
||||
*/
|
||||
|
||||
|
||||
PyObjectsEnum UIFrame::derived_type()
|
||||
{
|
||||
return PyObjectsEnum::UIFRAME;
|
||||
}
|
||||
|
||||
void UIFrame::render(sf::Vector2f offset)
|
||||
{
|
||||
//std::cout << "Rendering UIFrame w/ offset " << offset.x << ", " << offset.y << "\n";
|
||||
//std::cout << "position = " << x << ", " << y << "\n";
|
||||
box.move(offset);
|
||||
Resources::game->getWindow().draw(box);
|
||||
box.move(-offset);
|
||||
//sf::RectangleShape box = sf::RectangleShape(sf::Vector2f(w,h));
|
||||
//sf::Vector2f pos = sf::Vector2f(x, y);
|
||||
//box.setPosition(offset + pos);
|
||||
//if (_fillColor) { box.setFillColor(fillColor()); }
|
||||
//if (_outlineColor) { box.setOutlineColor(outlineColor()); }
|
||||
//box.setOutlineThickness(outline);
|
||||
//Resources::game->getWindow().draw(box);
|
||||
for (auto drawable : *children) {
|
||||
drawable->render(offset + box.getPosition());
|
||||
}
|
||||
}
|
||||
|
||||
void UICaption::render(sf::Vector2f offset)
|
||||
{
|
||||
//std::cout << "Rendering Caption with offset\n";
|
||||
text.move(offset);
|
||||
Resources::game->getWindow().draw(text);
|
||||
text.move(-offset);
|
||||
}
|
||||
|
||||
UISprite::UISprite() {}
|
||||
|
||||
UISprite::UISprite(IndexTexture* _itex, int _sprite_index, float x = 0.0, float y = 0.0, float s = 1.0)
|
||||
: itex(_itex), sprite_index(_sprite_index)
|
||||
{
|
||||
sprite.setTexture(_itex->texture);
|
||||
sprite.setTextureRect(_itex->spriteCoordinates(_sprite_index));
|
||||
sprite.setPosition(sf::Vector2f(x, y));
|
||||
sprite.setScale(sf::Vector2f(s, s));
|
||||
}
|
||||
|
||||
UISprite::UISprite(IndexTexture* _itex, int _sprite_index, sf::Vector2f pos, float s = 1.0)
|
||||
: itex(_itex), sprite_index(_sprite_index)
|
||||
{
|
||||
sprite.setTexture(_itex->texture);
|
||||
sprite.setTextureRect(_itex->spriteCoordinates(_sprite_index));
|
||||
sprite.setPosition(pos);
|
||||
sprite.setScale(sf::Vector2f(s, s));
|
||||
}
|
||||
|
||||
//void UISprite::update()
|
||||
//{
|
||||
//auto& tex = Resources::game->textures[texture_index];
|
||||
//sprite.setTexture(tex.texture);
|
||||
//sprite.setScale(sf::Vector2f(scale, scale));
|
||||
//sprite.setPosition(sf::Vector2f(x, y));
|
||||
//std::cout << "Drawable position: " << x << ", " << y << " -> " << s.getPosition().x << ", " << s.getPosition().y << std::endl;
|
||||
//sprite.setTextureRect(tex.spriteCoordinates(sprite_index));
|
||||
//}
|
||||
|
||||
void UISprite::render(sf::Vector2f offset)
|
||||
{
|
||||
sprite.move(offset);
|
||||
Resources::game->getWindow().draw(sprite);
|
||||
sprite.move(-offset);
|
||||
}
|
||||
|
||||
// 7DRL hack; needed to draw entities to UIGrid. TODO, apply this technique to all UIDrawables
|
||||
void UISprite::render(sf::Vector2f offset, sf::RenderTexture& target)
|
||||
{
|
||||
sprite.move(offset);
|
||||
target.draw(sprite);
|
||||
sprite.move(-offset);
|
||||
}
|
||||
|
||||
void UISprite::setPosition(float x, float y)
|
||||
{
|
||||
setPosition(sf::Vector2f(x, y));
|
||||
}
|
||||
|
||||
void UISprite::setPosition(sf::Vector2f pos)
|
||||
{
|
||||
sprite.setPosition(pos);
|
||||
}
|
||||
|
||||
void UISprite::setScale(float s)
|
||||
{
|
||||
sprite.setScale(sf::Vector2f(s, s));
|
||||
}
|
||||
|
||||
PyObjectsEnum UICaption::derived_type()
|
||||
{
|
||||
return PyObjectsEnum::UICAPTION;
|
||||
}
|
||||
|
||||
PyObjectsEnum UISprite::derived_type()
|
||||
{
|
||||
return PyObjectsEnum::UISPRITE;
|
||||
}
|
||||
|
||||
// UIGrid support classes' methods
|
||||
|
||||
UIGridPoint::UIGridPoint()
|
||||
:color(1.0f, 1.0f, 1.0f), color_overlay(0.0f, 0.0f, 0.0f), walkable(false), transparent(false),
|
||||
tilesprite(-1), tile_overlay(-1), uisprite(-1)
|
||||
{
|
||||
}
|
||||
|
||||
UIEntity::UIEntity() {} // this will not work lol. TODO remove default constructor by finding the shared pointer inits that use it
|
||||
|
||||
UIEntity::UIEntity(UIGrid& grid)
|
||||
: gridstate(grid.grid_x * grid.grid_y)
|
||||
{
|
||||
}
|
||||
|
||||
// UIGrid methods
|
||||
|
||||
UIGrid::UIGrid()
|
||||
{
|
||||
}
|
||||
|
||||
UIGrid::UIGrid(int gx, int gy, IndexTexture* _itex, float _x, float _y, float _w, float _h)
|
||||
: grid_x(gx), grid_y(gy),
|
||||
zoom(1.0f), center_x((gx/2) * _itex->grid_size), center_y((gy/2) * _itex->grid_size),
|
||||
itex(_itex), points(gx * gy)
|
||||
{
|
||||
// set up blank list of entities
|
||||
entities = std::make_shared<std::list<std::shared_ptr<UIEntity>>>();
|
||||
|
||||
box.setSize(sf::Vector2f(_w, _h));
|
||||
box.setPosition(sf::Vector2f(_x, _y));
|
||||
|
||||
box.setFillColor(sf::Color(0,0,0,0));
|
||||
renderTexture.create(_w, _h);
|
||||
sprite.setTexture(_itex->texture);
|
||||
output.setTextureRect(
|
||||
sf::IntRect(0, 0,
|
||||
box.getSize().x, box.getSize().y));
|
||||
output.setPosition(box.getPosition());
|
||||
// textures are upside-down inside renderTexture
|
||||
output.setTexture(renderTexture.getTexture());
|
||||
}
|
||||
|
||||
UIGrid::UIGrid(int gx, int gy, IndexTexture* _itex, sf::Vector2f _xy, sf::Vector2f _wh)
|
||||
: grid_x(gx), grid_y(gy),
|
||||
zoom(1.0f), center_x((gx/2) * _itex->grid_size), center_y((gy/2) * _itex->grid_size),
|
||||
itex(_itex), points(gx * gy)
|
||||
{
|
||||
// set up blank list of entities
|
||||
entities = std::make_shared<std::list<std::shared_ptr<UIEntity>>>();
|
||||
|
||||
box.setSize(_wh);
|
||||
box.setPosition(_xy);
|
||||
|
||||
box.setFillColor(sf::Color(0,0,0,0));
|
||||
//renderTexture.create(_wh.x, _wh.y);
|
||||
// create renderTexture with maximum theoretical size; sprite can resize to show whatever amount needs to be rendered
|
||||
renderTexture.create(1920, 1080); // TODO - renderTexture should be window size; above 1080p this will cause rendering errors
|
||||
|
||||
sprite.setTexture(_itex->texture);
|
||||
output.setTextureRect(
|
||||
sf::IntRect(0, 0,
|
||||
box.getSize().x, box.getSize().y));
|
||||
output.setPosition(box.getPosition());
|
||||
// textures are upside-down inside renderTexture
|
||||
output.setTexture(renderTexture.getTexture());
|
||||
|
||||
}
|
||||
|
||||
void UIGrid::update()
|
||||
{
|
||||
}
|
||||
|
||||
void UIGrid::setSprite(int ti)
|
||||
{
|
||||
int tx = ti % itex->grid_width, ty = ti / itex->grid_width;
|
||||
sprite.setTextureRect(sf::IntRect(tx * itex->grid_size, ty * itex->grid_size, itex->grid_size, itex->grid_size));
|
||||
}
|
||||
|
||||
void UIGrid::render(sf::Vector2f)
|
||||
{
|
||||
output.setPosition(box.getPosition()); // output sprite can move; update position when drawing
|
||||
// output size can change; update size when drawing
|
||||
output.setTextureRect(
|
||||
sf::IntRect(0, 0,
|
||||
box.getSize().x, box.getSize().y));
|
||||
renderTexture.clear(sf::Color(8, 8, 8, 255)); // TODO - UIGrid needs a "background color" field
|
||||
// sprites that are visible according to zoom, center_x, center_y, and box width
|
||||
float center_x_sq = center_x / itex->grid_size;
|
||||
float center_y_sq = center_y / itex->grid_size;
|
||||
|
||||
float width_sq = box.getSize().x / (itex->grid_size * zoom);
|
||||
float height_sq = box.getSize().y / (itex->grid_size * zoom);
|
||||
float left_edge = center_x_sq - (width_sq / 2.0);
|
||||
float top_edge = center_y_sq - (height_sq / 2.0);
|
||||
|
||||
int left_spritepixels = center_x - (box.getSize().x / 2.0 / zoom);
|
||||
int top_spritepixels = center_y - (box.getSize().y / 2.0 / zoom);
|
||||
|
||||
sprite.setScale(sf::Vector2f(zoom, zoom));
|
||||
sf::RectangleShape r; // for colors and overlays
|
||||
r.setSize(sf::Vector2f(itex->grid_size * zoom, itex->grid_size * zoom));
|
||||
r.setOutlineThickness(0);
|
||||
|
||||
int x_limit = left_edge + width_sq + 2;
|
||||
if (x_limit > grid_x) x_limit = grid_x;
|
||||
|
||||
int y_limit = top_edge + height_sq + 2;
|
||||
if (y_limit > grid_y) y_limit = grid_y;
|
||||
|
||||
// base layer - bottom color, tile sprite ("ground")
|
||||
for (int x = (left_edge - 1 >= 0 ? left_edge - 1 : 0);
|
||||
x < x_limit; //x < view_width;
|
||||
x+=1)
|
||||
{
|
||||
//for (float y = (top_edge >= 0 ? top_edge : 0);
|
||||
for (int y = (top_edge - 1 >= 0 ? top_edge - 1 : 0);
|
||||
y < y_limit; //y < view_height;
|
||||
y+=1)
|
||||
{
|
||||
auto pixel_pos = sf::Vector2f(
|
||||
(x*itex->grid_size - left_spritepixels) * zoom,
|
||||
(y*itex->grid_size - top_spritepixels) * zoom );
|
||||
|
||||
auto gridpoint = at(std::floor(x), std::floor(y));
|
||||
|
||||
sprite.setPosition(pixel_pos);
|
||||
|
||||
r.setPosition(pixel_pos);
|
||||
r.setFillColor(gridpoint.color);
|
||||
renderTexture.draw(r);
|
||||
|
||||
// tilesprite
|
||||
// if discovered but not visible, set opacity to 90%
|
||||
// if not discovered... just don't draw it?
|
||||
if (gridpoint.tilesprite != -1) {
|
||||
setSprite(gridpoint.tilesprite);
|
||||
renderTexture.draw(sprite);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// middle layer - entities
|
||||
// disabling entity rendering until I can render their UISprite inside the rendertexture (not directly to window)
|
||||
for (auto e : *entities) {
|
||||
// TODO skip out-of-bounds entities (grid square not visible at all, check for partially on visible grid squares / floating point grid position)
|
||||
//auto drawent = e->cGrid->indexsprite.drawable();
|
||||
auto& drawent = e->sprite;
|
||||
//drawent.setScale(zoom, zoom);
|
||||
drawent.setScale(zoom);
|
||||
auto pixel_pos = sf::Vector2f(
|
||||
(e->position.x*itex->grid_size - left_spritepixels) * zoom,
|
||||
(e->position.y*itex->grid_size - top_spritepixels) * zoom );
|
||||
//drawent.setPosition(pixel_pos);
|
||||
//renderTexture.draw(drawent);
|
||||
drawent.render(pixel_pos, renderTexture);
|
||||
}
|
||||
|
||||
|
||||
// top layer - opacity for discovered / visible status (debug, basically)
|
||||
/* // Disabled until I attach a "perspective"
|
||||
for (int x = (left_edge - 1 >= 0 ? left_edge - 1 : 0);
|
||||
x < x_limit; //x < view_width;
|
||||
x+=1)
|
||||
{
|
||||
//for (float y = (top_edge >= 0 ? top_edge : 0);
|
||||
for (int y = (top_edge - 1 >= 0 ? top_edge - 1 : 0);
|
||||
y < y_limit; //y < view_height;
|
||||
y+=1)
|
||||
{
|
||||
|
||||
auto pixel_pos = sf::Vector2f(
|
||||
(x*itex->grid_size - left_spritepixels) * zoom,
|
||||
(y*itex->grid_size - top_spritepixels) * zoom );
|
||||
|
||||
auto gridpoint = at(std::floor(x), std::floor(y));
|
||||
|
||||
sprite.setPosition(pixel_pos);
|
||||
|
||||
r.setPosition(pixel_pos);
|
||||
|
||||
// visible & discovered layers for testing purposes
|
||||
if (!gridpoint.discovered) {
|
||||
r.setFillColor(sf::Color(16, 16, 20, 192)); // 255 opacity for actual blackout
|
||||
renderTexture.draw(r);
|
||||
} else if (!gridpoint.visible) {
|
||||
r.setFillColor(sf::Color(32, 32, 40, 128));
|
||||
renderTexture.draw(r);
|
||||
}
|
||||
|
||||
// overlay
|
||||
|
||||
// uisprite
|
||||
}
|
||||
}
|
||||
*/
|
||||
|
||||
// grid lines for testing & validation
|
||||
/*
|
||||
sf::Vertex line[] =
|
||||
{
|
||||
sf::Vertex(sf::Vector2f(0, 0), sf::Color::Red),
|
||||
sf::Vertex(box.getSize(), sf::Color::Red),
|
||||
|
||||
};
|
||||
|
||||
renderTexture.draw(line, 2, sf::Lines);
|
||||
sf::Vertex lineb[] =
|
||||
{
|
||||
sf::Vertex(sf::Vector2f(0, box.getSize().y), sf::Color::Blue),
|
||||
sf::Vertex(sf::Vector2f(box.getSize().x, 0), sf::Color::Blue),
|
||||
|
||||
};
|
||||
|
||||
renderTexture.draw(lineb, 2, sf::Lines);
|
||||
*/
|
||||
|
||||
// render to window
|
||||
renderTexture.display();
|
||||
Resources::game->getWindow().draw(output);
|
||||
|
||||
}
|
||||
|
||||
UIGridPoint& UIGrid::at(int x, int y)
|
||||
{
|
||||
return points[y * grid_x + x];
|
||||
}
|
||||
|
||||
PyObjectsEnum UIGrid::derived_type()
|
||||
{
|
||||
return PyObjectsEnum::UIGRID;
|
||||
}
|
|
@ -0,0 +1,32 @@
|
|||
#pragma once
|
||||
|
||||
class UIEntity;
|
||||
typedef struct {
|
||||
PyObject_HEAD
|
||||
std::shared_ptr<UIEntity> data;
|
||||
} PyUIEntityObject;
|
||||
|
||||
class UIFrame;
|
||||
typedef struct {
|
||||
PyObject_HEAD
|
||||
std::shared_ptr<UIFrame> data;
|
||||
} PyUIFrameObject;
|
||||
|
||||
class UICaption;
|
||||
typedef struct {
|
||||
PyObject_HEAD
|
||||
std::shared_ptr<UICaption> data;
|
||||
PyObject* font;
|
||||
} PyUICaptionObject;
|
||||
|
||||
class UIGrid;
|
||||
typedef struct {
|
||||
PyObject_HEAD
|
||||
std::shared_ptr<UIGrid> data;
|
||||
} PyUIGridObject;
|
||||
|
||||
class UISprite;
|
||||
typedef struct {
|
||||
PyObject_HEAD
|
||||
std::shared_ptr<UISprite> data;
|
||||
} PyUISpriteObject;
|
|
@ -0,0 +1,283 @@
|
|||
#include "UICaption.h"
|
||||
#include "GameEngine.h"
|
||||
#include "PyColor.h"
|
||||
#include "PyVector.h"
|
||||
#include "PyFont.h"
|
||||
|
||||
UIDrawable* UICaption::click_at(sf::Vector2f point)
|
||||
{
|
||||
if (click_callable)
|
||||
{
|
||||
if (text.getGlobalBounds().contains(point)) return this;
|
||||
}
|
||||
return NULL;
|
||||
}
|
||||
|
||||
void UICaption::render(sf::Vector2f offset)
|
||||
{
|
||||
text.move(offset);
|
||||
Resources::game->getWindow().draw(text);
|
||||
text.move(-offset);
|
||||
}
|
||||
|
||||
PyObjectsEnum UICaption::derived_type()
|
||||
{
|
||||
return PyObjectsEnum::UICAPTION;
|
||||
}
|
||||
|
||||
PyObject* UICaption::get_float_member(PyUICaptionObject* self, void* closure)
|
||||
{
|
||||
auto member_ptr = reinterpret_cast<long>(closure);
|
||||
if (member_ptr == 0)
|
||||
return PyFloat_FromDouble(self->data->text.getPosition().x);
|
||||
else if (member_ptr == 1)
|
||||
return PyFloat_FromDouble(self->data->text.getPosition().y);
|
||||
else if (member_ptr == 4)
|
||||
return PyFloat_FromDouble(self->data->text.getOutlineThickness());
|
||||
else if (member_ptr == 5)
|
||||
return PyLong_FromLong(self->data->text.getCharacterSize());
|
||||
else
|
||||
{
|
||||
PyErr_SetString(PyExc_AttributeError, "Invalid attribute");
|
||||
return nullptr;
|
||||
}
|
||||
}
|
||||
|
||||
int UICaption::set_float_member(PyUICaptionObject* self, PyObject* value, void* closure)
|
||||
{
|
||||
float val;
|
||||
auto member_ptr = reinterpret_cast<long>(closure);
|
||||
if (PyFloat_Check(value))
|
||||
{
|
||||
val = PyFloat_AsDouble(value);
|
||||
}
|
||||
else if (PyLong_Check(value))
|
||||
{
|
||||
val = PyLong_AsLong(value);
|
||||
}
|
||||
else
|
||||
{
|
||||
PyErr_SetString(PyExc_TypeError, "Value must be an integer.");
|
||||
return -1;
|
||||
}
|
||||
if (member_ptr == 0) //x
|
||||
self->data->text.setPosition(val, self->data->text.getPosition().y);
|
||||
else if (member_ptr == 1) //y
|
||||
self->data->text.setPosition(self->data->text.getPosition().x, val);
|
||||
else if (member_ptr == 4) //outline
|
||||
self->data->text.setOutlineThickness(val);
|
||||
else if (member_ptr == 5) // character size
|
||||
self->data->text.setCharacterSize(val);
|
||||
return 0;
|
||||
}
|
||||
|
||||
PyObject* UICaption::get_vec_member(PyUICaptionObject* self, void* closure)
|
||||
{
|
||||
return PyVector(self->data->text.getPosition()).pyObject();
|
||||
}
|
||||
|
||||
int UICaption::set_vec_member(PyUICaptionObject* self, PyObject* value, void* closure)
|
||||
{
|
||||
self->data->text.setPosition(PyVector::fromPy(value));
|
||||
return 0;
|
||||
}
|
||||
|
||||
PyObject* UICaption::get_color_member(PyUICaptionObject* self, void* closure)
|
||||
{
|
||||
// TODO: migrate this code to a switch statement - validate closure & return values in one tighter, more extensible structure
|
||||
|
||||
// validate closure (should be impossible to be wrong, but it's thorough)
|
||||
auto member_ptr = reinterpret_cast<long>(closure);
|
||||
if (member_ptr != 0 && member_ptr != 1)
|
||||
{
|
||||
PyErr_SetString(PyExc_AttributeError, "Invalid attribute");
|
||||
return nullptr;
|
||||
}
|
||||
|
||||
// TODO: manually calling tp_alloc to create a PyColorObject seems like an antipattern
|
||||
// fetch correct member data
|
||||
sf::Color color;
|
||||
|
||||
if (member_ptr == 0)
|
||||
{
|
||||
color = self->data->text.getFillColor();
|
||||
}
|
||||
else if (member_ptr == 1)
|
||||
{
|
||||
color = self->data->text.getOutlineColor();
|
||||
}
|
||||
|
||||
return PyColor(color).pyObject();
|
||||
}
|
||||
|
||||
int UICaption::set_color_member(PyUICaptionObject* self, PyObject* value, void* closure)
|
||||
{
|
||||
auto member_ptr = reinterpret_cast<long>(closure);
|
||||
//TODO: this logic of (PyColor instance OR tuple -> sf::color) should be encapsulated for reuse
|
||||
int r, g, b, a;
|
||||
if (PyObject_IsInstance(value, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Color") /*(PyObject*)&mcrfpydef::PyColorType)*/))
|
||||
{
|
||||
// get value from mcrfpy.Color instance
|
||||
auto c = ((PyColorObject*)value)->data;
|
||||
r = c.r; g = c.g; b = c.b; a = c.a;
|
||||
std::cout << "got " << int(r) << ", " << int(g) << ", " << int(b) << ", " << int(a) << std::endl;
|
||||
}
|
||||
else if (!PyTuple_Check(value) || PyTuple_Size(value) < 3 || PyTuple_Size(value) > 4)
|
||||
{
|
||||
// reject non-Color, non-tuple value
|
||||
PyErr_SetString(PyExc_TypeError, "Value must be a tuple of 3 or 4 integers or an mcrfpy.Color object.");
|
||||
return -1;
|
||||
}
|
||||
else // get value from tuples
|
||||
{
|
||||
r = PyLong_AsLong(PyTuple_GetItem(value, 0));
|
||||
g = PyLong_AsLong(PyTuple_GetItem(value, 1));
|
||||
b = PyLong_AsLong(PyTuple_GetItem(value, 2));
|
||||
a = 255;
|
||||
|
||||
if (PyTuple_Size(value) == 4)
|
||||
{
|
||||
a = PyLong_AsLong(PyTuple_GetItem(value, 3));
|
||||
}
|
||||
}
|
||||
|
||||
if (r < 0 || r > 255 || g < 0 || g > 255 || b < 0 || b > 255 || a < 0 || a > 255)
|
||||
{
|
||||
PyErr_SetString(PyExc_ValueError, "Color values must be between 0 and 255.");
|
||||
return -1;
|
||||
}
|
||||
|
||||
if (member_ptr == 0)
|
||||
{
|
||||
self->data->text.setFillColor(sf::Color(r, g, b, a));
|
||||
}
|
||||
else if (member_ptr == 1)
|
||||
{
|
||||
self->data->text.setOutlineColor(sf::Color(r, g, b, a));
|
||||
}
|
||||
else
|
||||
{
|
||||
PyErr_SetString(PyExc_AttributeError, "Invalid attribute");
|
||||
return -1;
|
||||
}
|
||||
|
||||
return 0;
|
||||
}
|
||||
|
||||
|
||||
//TODO: evaluate use of Resources::caption_buffer... can't I do this with a std::string?
|
||||
PyObject* UICaption::get_text(PyUICaptionObject* self, void* closure)
|
||||
{
|
||||
Resources::caption_buffer = self->data->text.getString();
|
||||
return PyUnicode_FromString(Resources::caption_buffer.c_str());
|
||||
}
|
||||
|
||||
int UICaption::set_text(PyUICaptionObject* self, PyObject* value, void* closure)
|
||||
{
|
||||
PyObject* s = PyObject_Str(value);
|
||||
PyObject * temp_bytes = PyUnicode_AsEncodedString(s, "UTF-8", "strict"); // Owned reference
|
||||
if (temp_bytes != NULL) {
|
||||
Resources::caption_buffer = PyBytes_AS_STRING(temp_bytes); // Borrowed pointer
|
||||
Py_DECREF(temp_bytes);
|
||||
}
|
||||
self->data->text.setString(Resources::caption_buffer);
|
||||
return 0;
|
||||
}
|
||||
|
||||
PyGetSetDef UICaption::getsetters[] = {
|
||||
{"x", (getter)UICaption::get_float_member, (setter)UICaption::set_float_member, "X coordinate of top-left corner", (void*)0},
|
||||
{"y", (getter)UICaption::get_float_member, (setter)UICaption::set_float_member, "Y coordinate of top-left corner", (void*)1},
|
||||
{"pos", (getter)UICaption::get_vec_member, (setter)UICaption::set_vec_member, "(x, y) vector", (void*)0},
|
||||
//{"w", (getter)PyUIFrame_get_float_member, (setter)PyUIFrame_set_float_member, "width of the rectangle", (void*)2},
|
||||
//{"h", (getter)PyUIFrame_get_float_member, (setter)PyUIFrame_set_float_member, "height of the rectangle", (void*)3},
|
||||
{"outline", (getter)UICaption::get_float_member, (setter)UICaption::set_float_member, "Thickness of the border", (void*)4},
|
||||
{"fill_color", (getter)UICaption::get_color_member, (setter)UICaption::set_color_member, "Fill color of the text", (void*)0},
|
||||
{"outline_color", (getter)UICaption::get_color_member, (setter)UICaption::set_color_member, "Outline color of the text", (void*)1},
|
||||
//{"children", (getter)PyUIFrame_get_children, NULL, "UICollection of objects on top of this one", NULL},
|
||||
{"text", (getter)UICaption::get_text, (setter)UICaption::set_text, "The text displayed", NULL},
|
||||
{"size", (getter)UICaption::get_float_member, (setter)UICaption::set_float_member, "Text size (integer) in points", (void*)5},
|
||||
{"click", (getter)UIDrawable::get_click, (setter)UIDrawable::set_click, "Object called with (x, y, button) when clicked", (void*)PyObjectsEnum::UICAPTION},
|
||||
{NULL}
|
||||
};
|
||||
|
||||
PyObject* UICaption::repr(PyUICaptionObject* self)
|
||||
{
|
||||
std::ostringstream ss;
|
||||
if (!self->data) ss << "<Caption (invalid internal object)>";
|
||||
else {
|
||||
auto text = self->data->text;
|
||||
auto fc = text.getFillColor();
|
||||
auto oc = text.getOutlineColor();
|
||||
ss << "<Caption (x=" << text.getPosition().x << ", y=" << text.getPosition().y << ", " <<
|
||||
"text='" << (std::string)text.getString() << "', " <<
|
||||
"outline=" << text.getOutlineThickness() << ", " <<
|
||||
"fill_color=(" << (int)fc.r << ", " << (int)fc.g << ", " << (int)fc.b << ", " << (int)fc.a <<"), " <<
|
||||
"outline_color=(" << (int)oc.r << ", " << (int)oc.g << ", " << (int)oc.b << ", " << (int)oc.a <<"), " <<
|
||||
")>";
|
||||
}
|
||||
std::string repr_str = ss.str();
|
||||
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
|
||||
}
|
||||
|
||||
int UICaption::init(PyUICaptionObject* self, PyObject* args, PyObject* kwds)
|
||||
{
|
||||
using namespace mcrfpydef;
|
||||
static const char* keywords[] = { "x", "y", "text", "font", "fill_color", "outline_color", "outline", nullptr };
|
||||
float x = 0.0f, y = 0.0f, outline = 0.0f;
|
||||
char* text;
|
||||
PyObject* font=NULL, *fill_color=NULL, *outline_color=NULL;
|
||||
|
||||
if (!PyArg_ParseTupleAndKeywords(args, kwds, "|ffzOOOf",
|
||||
const_cast<char**>(keywords), &x, &y, &text, &font, &fill_color, &outline_color, &outline))
|
||||
{
|
||||
return -1;
|
||||
}
|
||||
|
||||
// check types for font, fill_color, outline_color
|
||||
|
||||
std::cout << PyUnicode_AsUTF8(PyObject_Repr(font)) << std::endl;
|
||||
if (font != NULL && !PyObject_IsInstance(font, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Font")/*(PyObject*)&PyFontType)*/)){
|
||||
PyErr_SetString(PyExc_TypeError, "font must be a mcrfpy.Font instance");
|
||||
return -1;
|
||||
} else if (font != NULL)
|
||||
{
|
||||
auto font_obj = (PyFontObject*)font;
|
||||
self->data->text.setFont(font_obj->data->font);
|
||||
self->font = font;
|
||||
Py_INCREF(font);
|
||||
} else
|
||||
{
|
||||
// default font
|
||||
//self->data->text.setFont(Resources::game->getFont());
|
||||
}
|
||||
|
||||
self->data->text.setPosition(sf::Vector2f(x, y));
|
||||
self->data->text.setString((std::string)text);
|
||||
self->data->text.setOutlineThickness(outline);
|
||||
if (fill_color) {
|
||||
auto fc = PyColor::from_arg(fill_color);
|
||||
if (!fc) {
|
||||
PyErr_SetString(PyExc_TypeError, "fill_color must be mcrfpy.Color or arguments to mcrfpy.Color.__init__");
|
||||
return -1;
|
||||
}
|
||||
self->data->text.setFillColor(PyColor::fromPy(fc));
|
||||
//Py_DECREF(fc);
|
||||
} else {
|
||||
self->data->text.setFillColor(sf::Color(0,0,0,255));
|
||||
}
|
||||
|
||||
if (outline_color) {
|
||||
auto oc = PyColor::from_arg(outline_color);
|
||||
if (!oc) {
|
||||
PyErr_SetString(PyExc_TypeError, "outline_color must be mcrfpy.Color or arguments to mcrfpy.Color.__init__");
|
||||
return -1;
|
||||
}
|
||||
self->data->text.setOutlineColor(PyColor::fromPy(oc));
|
||||
//Py_DECREF(oc);
|
||||
} else {
|
||||
self->data->text.setOutlineColor(sf::Color(128,128,128,255));
|
||||
}
|
||||
|
||||
return 0;
|
||||
}
|
||||
|
|
@ -0,0 +1,62 @@
|
|||
#pragma once
|
||||
#include "Common.h"
|
||||
#include "Python.h"
|
||||
#include "UIDrawable.h"
|
||||
|
||||
class UICaption: public UIDrawable
|
||||
{
|
||||
public:
|
||||
sf::Text text;
|
||||
void render(sf::Vector2f) override final;
|
||||
PyObjectsEnum derived_type() override final;
|
||||
virtual UIDrawable* click_at(sf::Vector2f point) override final;
|
||||
|
||||
static PyObject* get_float_member(PyUICaptionObject* self, void* closure);
|
||||
static int set_float_member(PyUICaptionObject* self, PyObject* value, void* closure);
|
||||
static PyObject* get_vec_member(PyUICaptionObject* self, void* closure);
|
||||
static int set_vec_member(PyUICaptionObject* self, PyObject* value, void* closure);
|
||||
static PyObject* get_color_member(PyUICaptionObject* self, void* closure);
|
||||
static int set_color_member(PyUICaptionObject* self, PyObject* value, void* closure);
|
||||
static PyObject* get_text(PyUICaptionObject* self, void* closure);
|
||||
static int set_text(PyUICaptionObject* self, PyObject* value, void* closure);
|
||||
static PyGetSetDef getsetters[];
|
||||
static PyObject* repr(PyUICaptionObject* self);
|
||||
static int init(PyUICaptionObject* self, PyObject* args, PyObject* kwds);
|
||||
|
||||
};
|
||||
|
||||
namespace mcrfpydef {
|
||||
static PyTypeObject PyUICaptionType = {
|
||||
.tp_name = "mcrfpy.Caption",
|
||||
.tp_basicsize = sizeof(PyUICaptionObject),
|
||||
.tp_itemsize = 0,
|
||||
// TODO - move tp_dealloc to .cpp file as static function (UICaption::dealloc)
|
||||
.tp_dealloc = (destructor)[](PyObject* self)
|
||||
{
|
||||
PyUICaptionObject* obj = (PyUICaptionObject*)self;
|
||||
// TODO - reevaluate with PyFont usage; UICaption does not own the font
|
||||
// release reference to font object
|
||||
if (obj->font) Py_DECREF(obj->font);
|
||||
obj->data.reset();
|
||||
Py_TYPE(self)->tp_free(self);
|
||||
},
|
||||
.tp_repr = (reprfunc)UICaption::repr,
|
||||
//.tp_hash = NULL,
|
||||
//.tp_iter
|
||||
//.tp_iternext
|
||||
.tp_flags = Py_TPFLAGS_DEFAULT,
|
||||
.tp_doc = PyDoc_STR("docstring"),
|
||||
//.tp_methods = PyUIFrame_methods,
|
||||
//.tp_members = PyUIFrame_members,
|
||||
.tp_getset = UICaption::getsetters,
|
||||
//.tp_base = NULL,
|
||||
.tp_init = (initproc)UICaption::init,
|
||||
// TODO - move tp_new to .cpp file as a static function (UICaption::new)
|
||||
.tp_new = [](PyTypeObject* type, PyObject* args, PyObject* kwds) -> PyObject*
|
||||
{
|
||||
PyUICaptionObject* self = (PyUICaptionObject*)type->tp_alloc(type, 0);
|
||||
if (self) self->data = std::make_shared<UICaption>();
|
||||
return (PyObject*)self;
|
||||
}
|
||||
};
|
||||
}
|
|
@ -0,0 +1,203 @@
|
|||
#include "UICollection.h"
|
||||
|
||||
#include "UIFrame.h"
|
||||
#include "UICaption.h"
|
||||
#include "UISprite.h"
|
||||
#include "UIGrid.h"
|
||||
#include "McRFPy_API.h"
|
||||
|
||||
using namespace mcrfpydef;
|
||||
|
||||
int UICollectionIter::init(PyUICollectionIterObject* self, PyObject* args, PyObject* kwds)
|
||||
{
|
||||
PyErr_SetString(PyExc_TypeError, "UICollection cannot be instantiated: a C++ data source is required.");
|
||||
return -1;
|
||||
}
|
||||
|
||||
PyObject* UICollectionIter::next(PyUICollectionIterObject* self)
|
||||
{
|
||||
if (self->data->size() != self->start_size)
|
||||
{
|
||||
PyErr_SetString(PyExc_RuntimeError, "collection changed size during iteration");
|
||||
return NULL;
|
||||
}
|
||||
|
||||
if (self->index > self->start_size - 1)
|
||||
{
|
||||
PyErr_SetNone(PyExc_StopIteration);
|
||||
return NULL;
|
||||
}
|
||||
self->index++;
|
||||
auto vec = self->data.get();
|
||||
if (!vec)
|
||||
{
|
||||
PyErr_SetString(PyExc_RuntimeError, "the collection store returned a null pointer");
|
||||
return NULL;
|
||||
}
|
||||
auto target = (*vec)[self->index-1];
|
||||
// TODO build PyObject* of the correct UIDrawable subclass to return
|
||||
//return py_instance(target);
|
||||
return NULL;
|
||||
}
|
||||
|
||||
PyObject* UICollectionIter::repr(PyUICollectionIterObject* self)
|
||||
{
|
||||
std::ostringstream ss;
|
||||
if (!self->data) ss << "<UICollectionIter (invalid internal object)>";
|
||||
else {
|
||||
ss << "<UICollectionIter (" << self->data->size() << " child objects, @ index " << self->index << ")>";
|
||||
}
|
||||
std::string repr_str = ss.str();
|
||||
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
|
||||
}
|
||||
|
||||
Py_ssize_t UICollection::len(PyUICollectionObject* self) {
|
||||
return self->data->size();
|
||||
}
|
||||
|
||||
PyObject* UICollection::getitem(PyUICollectionObject* self, Py_ssize_t index) {
|
||||
// build a Python version of item at self->data[index]
|
||||
// Copy pasted::
|
||||
auto vec = self->data.get();
|
||||
if (!vec)
|
||||
{
|
||||
PyErr_SetString(PyExc_RuntimeError, "the collection store returned a null pointer");
|
||||
return NULL;
|
||||
}
|
||||
while (index < 0) index += self->data->size();
|
||||
if (index > self->data->size() - 1)
|
||||
{
|
||||
PyErr_SetString(PyExc_IndexError, "UICollection index out of range");
|
||||
return NULL;
|
||||
}
|
||||
auto target = (*vec)[index];
|
||||
RET_PY_INSTANCE(target);
|
||||
return NULL;
|
||||
|
||||
|
||||
}
|
||||
|
||||
PySequenceMethods UICollection::sqmethods = {
|
||||
.sq_length = (lenfunc)UICollection::len,
|
||||
.sq_item = (ssizeargfunc)UICollection::getitem,
|
||||
//.sq_item_by_index = PyUICollection_getitem
|
||||
//.sq_slice - return a subset of the iterable
|
||||
//.sq_ass_item - called when `o[x] = y` is executed (x is any object type)
|
||||
//.sq_ass_slice - cool; no thanks, for now
|
||||
//.sq_contains - called when `x in o` is executed
|
||||
//.sq_ass_item_by_index - called when `o[x] = y` is executed (x is explictly an integer)
|
||||
};
|
||||
|
||||
/* Idiomatic way to fetch complete types from the API rather than referencing their PyTypeObject struct
|
||||
|
||||
auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "Texture");
|
||||
|
||||
I never identified why `using namespace mcrfpydef;` doesn't solve the segfault issue.
|
||||
The horrible macro in UIDrawable was originally a workaround for this, but as I interact with the types outside of the monster UI.h, a more general (and less icky) solution is required.
|
||||
|
||||
*/
|
||||
|
||||
PyObject* UICollection::append(PyUICollectionObject* self, PyObject* o)
|
||||
{
|
||||
// if not UIDrawable subclass, reject it
|
||||
// self->data->push_back( c++ object inside o );
|
||||
|
||||
// this would be a great use case for .tp_base
|
||||
if (!PyObject_IsInstance(o, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Frame")) &&
|
||||
!PyObject_IsInstance(o, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Sprite")) &&
|
||||
!PyObject_IsInstance(o, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Caption")) &&
|
||||
!PyObject_IsInstance(o, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Grid"))
|
||||
)
|
||||
{
|
||||
PyErr_SetString(PyExc_TypeError, "Only Frame, Caption, Sprite, and Grid objects can be added to UICollection");
|
||||
return NULL;
|
||||
}
|
||||
|
||||
if (PyObject_IsInstance(o, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Frame")))
|
||||
{
|
||||
PyUIFrameObject* frame = (PyUIFrameObject*)o;
|
||||
self->data->push_back(frame->data);
|
||||
}
|
||||
if (PyObject_IsInstance(o, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Caption")))
|
||||
{
|
||||
PyUICaptionObject* caption = (PyUICaptionObject*)o;
|
||||
self->data->push_back(caption->data);
|
||||
}
|
||||
if (PyObject_IsInstance(o, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Sprite")))
|
||||
{
|
||||
PyUISpriteObject* sprite = (PyUISpriteObject*)o;
|
||||
self->data->push_back(sprite->data);
|
||||
}
|
||||
if (PyObject_IsInstance(o, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Grid")))
|
||||
{
|
||||
PyUIGridObject* grid = (PyUIGridObject*)o;
|
||||
self->data->push_back(grid->data);
|
||||
}
|
||||
|
||||
Py_INCREF(Py_None);
|
||||
return Py_None;
|
||||
}
|
||||
|
||||
PyObject* UICollection::remove(PyUICollectionObject* self, PyObject* o)
|
||||
{
|
||||
if (!PyLong_Check(o))
|
||||
{
|
||||
PyErr_SetString(PyExc_TypeError, "UICollection.remove requires an integer index to remove");
|
||||
return NULL;
|
||||
}
|
||||
long index = PyLong_AsLong(o);
|
||||
if (index >= self->data->size())
|
||||
{
|
||||
PyErr_SetString(PyExc_ValueError, "Index out of range");
|
||||
return NULL;
|
||||
}
|
||||
else if (index < 0)
|
||||
{
|
||||
PyErr_SetString(PyExc_NotImplementedError, "reverse indexing is not implemented.");
|
||||
return NULL;
|
||||
}
|
||||
|
||||
// release the shared pointer at self->data[index];
|
||||
self->data->erase(self->data->begin() + index);
|
||||
Py_INCREF(Py_None);
|
||||
return Py_None;
|
||||
}
|
||||
|
||||
PyMethodDef UICollection::methods[] = {
|
||||
{"append", (PyCFunction)UICollection::append, METH_O},
|
||||
//{"extend", (PyCFunction)PyUICollection_extend, METH_O}, // TODO
|
||||
{"remove", (PyCFunction)UICollection::remove, METH_O},
|
||||
{NULL, NULL, 0, NULL}
|
||||
};
|
||||
|
||||
PyObject* UICollection::repr(PyUICollectionObject* self)
|
||||
{
|
||||
std::ostringstream ss;
|
||||
if (!self->data) ss << "<UICollection (invalid internal object)>";
|
||||
else {
|
||||
ss << "<UICollection (" << self->data->size() << " child objects)>";
|
||||
}
|
||||
std::string repr_str = ss.str();
|
||||
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
|
||||
}
|
||||
|
||||
int UICollection::init(PyUICollectionObject* self, PyObject* args, PyObject* kwds)
|
||||
{
|
||||
PyErr_SetString(PyExc_TypeError, "UICollection cannot be instantiated: a C++ data source is required.");
|
||||
return -1;
|
||||
}
|
||||
|
||||
PyObject* UICollection::iter(PyUICollectionObject* self)
|
||||
{
|
||||
PyUICollectionIterObject* iterObj;
|
||||
iterObj = (PyUICollectionIterObject*)PyUICollectionIterType.tp_alloc(&PyUICollectionIterType, 0);
|
||||
if (iterObj == NULL) {
|
||||
return NULL; // Failed to allocate memory for the iterator object
|
||||
}
|
||||
|
||||
iterObj->data = self->data;
|
||||
iterObj->index = 0;
|
||||
iterObj->start_size = self->data->size();
|
||||
|
||||
return (PyObject*)iterObj;
|
||||
}
|
|
@ -0,0 +1,88 @@
|
|||
#pragma once
|
||||
#include "Common.h"
|
||||
#include "Python.h"
|
||||
|
||||
#include "UIDrawable.h"
|
||||
|
||||
class UICollectionIter
|
||||
{
|
||||
// really more of a namespace: all the members are public and static. But being consistent with other UI objects
|
||||
public:
|
||||
static int init(PyUICollectionIterObject* self, PyObject* args, PyObject* kwds);
|
||||
static PyObject* next(PyUICollectionIterObject* self);
|
||||
static PyObject* repr(PyUICollectionIterObject* self);
|
||||
};
|
||||
|
||||
class UICollection
|
||||
{
|
||||
// really more of a namespace: all the members are public and static. But being consistent with other UI objects
|
||||
public:
|
||||
static Py_ssize_t len(PyUICollectionObject* self);
|
||||
static PyObject* getitem(PyUICollectionObject* self, Py_ssize_t index);
|
||||
static PySequenceMethods sqmethods;
|
||||
static PyObject* append(PyUICollectionObject* self, PyObject* o);
|
||||
static PyObject* remove(PyUICollectionObject* self, PyObject* o);
|
||||
static PyMethodDef methods[];
|
||||
static PyObject* repr(PyUICollectionObject* self);
|
||||
static int init(PyUICollectionObject* self, PyObject* args, PyObject* kwds);
|
||||
static PyObject* iter(PyUICollectionObject* self);
|
||||
};
|
||||
|
||||
namespace mcrfpydef {
|
||||
static PyTypeObject PyUICollectionIterType = {
|
||||
//PyVarObject_HEAD_INIT(NULL, 0)
|
||||
.tp_name = "mcrfpy.UICollectionIter",
|
||||
.tp_basicsize = sizeof(PyUICollectionIterObject),
|
||||
.tp_itemsize = 0,
|
||||
//TODO - as static method, not inline lambda def, please
|
||||
.tp_dealloc = (destructor)[](PyObject* self)
|
||||
{
|
||||
PyUICollectionIterObject* obj = (PyUICollectionIterObject*)self;
|
||||
obj->data.reset();
|
||||
Py_TYPE(self)->tp_free(self);
|
||||
},
|
||||
.tp_repr = (reprfunc)UICollectionIter::repr,
|
||||
.tp_flags = Py_TPFLAGS_DEFAULT,
|
||||
.tp_doc = PyDoc_STR("Iterator for a collection of UI objects"),
|
||||
.tp_iternext = (iternextfunc)UICollectionIter::next,
|
||||
//.tp_getset = PyUICollection_getset,
|
||||
.tp_init = (initproc)UICollectionIter::init, // just raise an exception
|
||||
//TODO - as static method, not inline lambda def, please
|
||||
.tp_new = [](PyTypeObject* type, PyObject* args, PyObject* kwds) -> PyObject*
|
||||
{
|
||||
PyErr_SetString(PyExc_TypeError, "UICollection cannot be instantiated: a C++ data source is required.");
|
||||
return NULL;
|
||||
}
|
||||
};
|
||||
|
||||
static PyTypeObject PyUICollectionType = {
|
||||
//PyVarObject_/HEAD_INIT(NULL, 0)
|
||||
.tp_name = "mcrfpy.UICollection",
|
||||
.tp_basicsize = sizeof(PyUICollectionObject),
|
||||
.tp_itemsize = 0,
|
||||
//TODO - as static method, not inline lambda def, please
|
||||
.tp_dealloc = (destructor)[](PyObject* self)
|
||||
{
|
||||
PyUICollectionObject* obj = (PyUICollectionObject*)self;
|
||||
obj->data.reset();
|
||||
Py_TYPE(self)->tp_free(self);
|
||||
},
|
||||
.tp_repr = (reprfunc)UICollection::repr,
|
||||
.tp_as_sequence = &UICollection::sqmethods,
|
||||
.tp_flags = Py_TPFLAGS_DEFAULT,
|
||||
.tp_doc = PyDoc_STR("Iterable, indexable collection of UI objects"),
|
||||
.tp_iter = (getiterfunc)UICollection::iter,
|
||||
.tp_methods = UICollection::methods, // append, remove
|
||||
//.tp_getset = PyUICollection_getset,
|
||||
.tp_init = (initproc)UICollection::init, // just raise an exception
|
||||
//TODO - as static method, not inline lambda def, please
|
||||
.tp_new = [](PyTypeObject* type, PyObject* args, PyObject* kwds) -> PyObject*
|
||||
{
|
||||
// Does PyUICollectionType need __new__ if it's not supposed to be instantiable by the user?
|
||||
// Should I just raise an exception? Or is the uninitialized shared_ptr enough of a blocker?
|
||||
PyErr_SetString(PyExc_TypeError, "UICollection cannot be instantiated: a C++ data source is required.");
|
||||
return NULL;
|
||||
}
|
||||
};
|
||||
|
||||
}
|
|
@ -0,0 +1,81 @@
|
|||
#include "UIDrawable.h"
|
||||
#include "UIFrame.h"
|
||||
#include "UICaption.h"
|
||||
#include "UISprite.h"
|
||||
#include "UIGrid.h"
|
||||
|
||||
UIDrawable::UIDrawable() { click_callable = NULL; }
|
||||
|
||||
void UIDrawable::click_unregister()
|
||||
{
|
||||
click_callable.reset();
|
||||
}
|
||||
|
||||
void UIDrawable::render()
|
||||
{
|
||||
render(sf::Vector2f());
|
||||
}
|
||||
|
||||
PyObject* UIDrawable::get_click(PyObject* self, void* closure) {
|
||||
PyObjectsEnum objtype = static_cast<PyObjectsEnum>(reinterpret_cast<long>(closure)); // trust me bro, it's an Enum
|
||||
PyObject* ptr;
|
||||
|
||||
switch (objtype)
|
||||
{
|
||||
case PyObjectsEnum::UIFRAME:
|
||||
ptr = ((PyUIFrameObject*)self)->data->click_callable->borrow();
|
||||
break;
|
||||
case PyObjectsEnum::UICAPTION:
|
||||
ptr = ((PyUICaptionObject*)self)->data->click_callable->borrow();
|
||||
break;
|
||||
case PyObjectsEnum::UISPRITE:
|
||||
ptr = ((PyUISpriteObject*)self)->data->click_callable->borrow();
|
||||
break;
|
||||
case PyObjectsEnum::UIGRID:
|
||||
ptr = ((PyUIGridObject*)self)->data->click_callable->borrow();
|
||||
break;
|
||||
default:
|
||||
PyErr_SetString(PyExc_TypeError, "no idea how you did that; invalid UIDrawable derived instance for _get_click");
|
||||
return NULL;
|
||||
}
|
||||
if (ptr && ptr != Py_None)
|
||||
return ptr;
|
||||
else
|
||||
return Py_None;
|
||||
}
|
||||
|
||||
int UIDrawable::set_click(PyObject* self, PyObject* value, void* closure) {
|
||||
PyObjectsEnum objtype = static_cast<PyObjectsEnum>(reinterpret_cast<long>(closure)); // trust me bro, it's an Enum
|
||||
UIDrawable* target;
|
||||
switch (objtype)
|
||||
{
|
||||
case PyObjectsEnum::UIFRAME:
|
||||
target = (((PyUIFrameObject*)self)->data.get());
|
||||
break;
|
||||
case PyObjectsEnum::UICAPTION:
|
||||
target = (((PyUICaptionObject*)self)->data.get());
|
||||
break;
|
||||
case PyObjectsEnum::UISPRITE:
|
||||
target = (((PyUISpriteObject*)self)->data.get());
|
||||
break;
|
||||
case PyObjectsEnum::UIGRID:
|
||||
target = (((PyUIGridObject*)self)->data.get());
|
||||
break;
|
||||
default:
|
||||
PyErr_SetString(PyExc_TypeError, "no idea how you did that; invalid UIDrawable derived instance for _set_click");
|
||||
return -1;
|
||||
}
|
||||
|
||||
if (value == Py_None)
|
||||
{
|
||||
target->click_unregister();
|
||||
} else {
|
||||
target->click_register(value);
|
||||
}
|
||||
return 0;
|
||||
}
|
||||
|
||||
void UIDrawable::click_register(PyObject* callable)
|
||||
{
|
||||
click_callable = std::make_unique<PyClickCallable>(callable);
|
||||
}
|
|
@ -0,0 +1,176 @@
|
|||
#pragma once
|
||||
#include "Common.h"
|
||||
#include "Python.h"
|
||||
#include "structmember.h"
|
||||
#include "IndexTexture.h"
|
||||
#include "Resources.h"
|
||||
#include <list>
|
||||
|
||||
#include "PyCallable.h"
|
||||
#include "PyTexture.h"
|
||||
#include "PyColor.h"
|
||||
#include "PyVector.h"
|
||||
#include "PyFont.h"
|
||||
|
||||
#include "Resources.h"
|
||||
#include "UIBase.h"
|
||||
class UIFrame; class UICaption; class UISprite; class UIEntity; class UIGrid;
|
||||
|
||||
enum PyObjectsEnum : int
|
||||
{
|
||||
UIFRAME = 1,
|
||||
UICAPTION,
|
||||
UISPRITE,
|
||||
UIGRID
|
||||
};
|
||||
|
||||
class UIDrawable
|
||||
{
|
||||
public:
|
||||
void render();
|
||||
virtual void render(sf::Vector2f) = 0;
|
||||
virtual PyObjectsEnum derived_type() = 0;
|
||||
|
||||
// Mouse input handling - callable object, methods to find event's destination
|
||||
std::unique_ptr<PyClickCallable> click_callable;
|
||||
virtual UIDrawable* click_at(sf::Vector2f point) = 0;
|
||||
void click_register(PyObject*);
|
||||
void click_unregister();
|
||||
|
||||
UIDrawable();
|
||||
|
||||
static PyObject* get_click(PyObject* self, void* closure);
|
||||
static int set_click(PyObject* self, PyObject* value, void* closure);
|
||||
};
|
||||
|
||||
typedef struct {
|
||||
PyObject_HEAD
|
||||
std::shared_ptr<std::vector<std::shared_ptr<UIDrawable>>> data;
|
||||
} PyUICollectionObject;
|
||||
|
||||
typedef struct {
|
||||
PyObject_HEAD
|
||||
std::shared_ptr<std::vector<std::shared_ptr<UIDrawable>>> data;
|
||||
int index;
|
||||
int start_size;
|
||||
} PyUICollectionIterObject;
|
||||
|
||||
namespace mcrfpydef {
|
||||
//PyObject* py_instance(std::shared_ptr<UIDrawable> source);
|
||||
// This function segfaults on tp_alloc for an unknown reason, but works inline with mcrfpydef:: methods.
|
||||
|
||||
#define RET_PY_INSTANCE(target) { \
|
||||
switch (target->derived_type()) \
|
||||
{ \
|
||||
case PyObjectsEnum::UIFRAME: \
|
||||
{ \
|
||||
PyUIFrameObject* o = (PyUIFrameObject*)((&PyUIFrameType)->tp_alloc(&PyUIFrameType, 0)); \
|
||||
if (o) \
|
||||
{ \
|
||||
auto p = std::static_pointer_cast<UIFrame>(target); \
|
||||
o->data = p; \
|
||||
auto utarget = o->data; \
|
||||
} \
|
||||
return (PyObject*)o; \
|
||||
} \
|
||||
case PyObjectsEnum::UICAPTION: \
|
||||
{ \
|
||||
PyUICaptionObject* o = (PyUICaptionObject*)((&PyUICaptionType)->tp_alloc(&PyUICaptionType, 0)); \
|
||||
if (o) \
|
||||
{ \
|
||||
auto p = std::static_pointer_cast<UICaption>(target); \
|
||||
o->data = p; \
|
||||
auto utarget = o->data; \
|
||||
} \
|
||||
return (PyObject*)o; \
|
||||
} \
|
||||
case PyObjectsEnum::UISPRITE: \
|
||||
{ \
|
||||
PyUISpriteObject* o = (PyUISpriteObject*)((&PyUISpriteType)->tp_alloc(&PyUISpriteType, 0)); \
|
||||
if (o) \
|
||||
{ \
|
||||
auto p = std::static_pointer_cast<UISprite>(target); \
|
||||
o->data = p; \
|
||||
auto utarget = o->data; \
|
||||
} \
|
||||
return (PyObject*)o; \
|
||||
} \
|
||||
case PyObjectsEnum::UIGRID: \
|
||||
{ \
|
||||
PyUIGridObject* o = (PyUIGridObject*)((&PyUIGridType)->tp_alloc(&PyUIGridType, 0)); \
|
||||
if (o) \
|
||||
{ \
|
||||
auto p = std::static_pointer_cast<UIGrid>(target); \
|
||||
o->data = p; \
|
||||
auto utarget = o->data; \
|
||||
} \
|
||||
return (PyObject*)o; \
|
||||
} \
|
||||
} \
|
||||
}
|
||||
// end macro definition
|
||||
|
||||
//TODO: add this method to class scope; move implementation to .cpp file
|
||||
/*
|
||||
static PyObject* PyUIDrawable_get_click(PyObject* self, void* closure) {
|
||||
PyObjectsEnum objtype = static_cast<PyObjectsEnum>(reinterpret_cast<long>(closure)); // trust me bro, it's an Enum
|
||||
PyObject* ptr;
|
||||
|
||||
switch (objtype)
|
||||
{
|
||||
case PyObjectsEnum::UIFRAME:
|
||||
ptr = ((PyUIFrameObject*)self)->data->click_callable->borrow();
|
||||
break;
|
||||
case PyObjectsEnum::UICAPTION:
|
||||
ptr = ((PyUICaptionObject*)self)->data->click_callable->borrow();
|
||||
break;
|
||||
case PyObjectsEnum::UISPRITE:
|
||||
ptr = ((PyUISpriteObject*)self)->data->click_callable->borrow();
|
||||
break;
|
||||
case PyObjectsEnum::UIGRID:
|
||||
ptr = ((PyUIGridObject*)self)->data->click_callable->borrow();
|
||||
break;
|
||||
default:
|
||||
PyErr_SetString(PyExc_TypeError, "no idea how you did that; invalid UIDrawable derived instance for _get_click");
|
||||
return NULL;
|
||||
}
|
||||
if (ptr && ptr != Py_None)
|
||||
return ptr;
|
||||
else
|
||||
return Py_None;
|
||||
}*/
|
||||
|
||||
//TODO: add this method to class scope; move implementation to .cpp file
|
||||
/*
|
||||
static int PyUIDrawable_set_click(PyObject* self, PyObject* value, void* closure) {
|
||||
PyObjectsEnum objtype = static_cast<PyObjectsEnum>(reinterpret_cast<long>(closure)); // trust me bro, it's an Enum
|
||||
UIDrawable* target;
|
||||
switch (objtype)
|
||||
{
|
||||
case PyObjectsEnum::UIFRAME:
|
||||
target = (((PyUIFrameObject*)self)->data.get());
|
||||
break;
|
||||
case PyObjectsEnum::UICAPTION:
|
||||
target = (((PyUICaptionObject*)self)->data.get());
|
||||
break;
|
||||
case PyObjectsEnum::UISPRITE:
|
||||
target = (((PyUISpriteObject*)self)->data.get());
|
||||
break;
|
||||
case PyObjectsEnum::UIGRID:
|
||||
target = (((PyUIGridObject*)self)->data.get());
|
||||
break;
|
||||
default:
|
||||
PyErr_SetString(PyExc_TypeError, "no idea how you did that; invalid UIDrawable derived instance for _set_click");
|
||||
return -1;
|
||||
}
|
||||
|
||||
if (value == Py_None)
|
||||
{
|
||||
target->click_unregister();
|
||||
} else {
|
||||
target->click_register(value);
|
||||
}
|
||||
return 0;
|
||||
}
|
||||
*/
|
||||
}
|
|
@ -0,0 +1,177 @@
|
|||
#include "UIEntity.h"
|
||||
#include "UIGrid.h"
|
||||
#include "McRFPy_API.h"
|
||||
|
||||
UIEntity::UIEntity() {} // this will not work lol. TODO remove default constructor by finding the shared pointer inits that use it
|
||||
|
||||
UIEntity::UIEntity(UIGrid& grid)
|
||||
: gridstate(grid.grid_x * grid.grid_y)
|
||||
{
|
||||
}
|
||||
|
||||
PyObject* UIEntity::at(PyUIEntityObject* self, PyObject* o) {
|
||||
int x, y;
|
||||
if (!PyArg_ParseTuple(o, "ii", &x, &y)) {
|
||||
PyErr_SetString(PyExc_TypeError, "UIEntity.at requires two integer arguments: (x, y)");
|
||||
return NULL;
|
||||
}
|
||||
|
||||
if (self->data->grid == NULL) {
|
||||
PyErr_SetString(PyExc_ValueError, "Entity cannot access surroundings because it is not associated with a grid");
|
||||
return NULL;
|
||||
}
|
||||
/*
|
||||
PyUIGridPointStateObject* obj = (PyUIGridPointStateObject*)((&mcrfpydef::PyUIGridPointStateType)->tp_alloc(&mcrfpydef::PyUIGridPointStateType, 0));
|
||||
*/
|
||||
auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "GridPointState");
|
||||
auto obj = (PyUIGridPointStateObject*)type->tp_alloc(type, 0);
|
||||
//auto target = std::static_pointer_cast<UIEntity>(target);
|
||||
obj->data = &(self->data->gridstate[y + self->data->grid->grid_x * x]);
|
||||
obj->grid = self->data->grid;
|
||||
obj->entity = self->data;
|
||||
return (PyObject*)obj;
|
||||
|
||||
}
|
||||
|
||||
int UIEntity::init(PyUIEntityObject* self, PyObject* args, PyObject* kwds) {
|
||||
static const char* keywords[] = { "x", "y", "texture", "sprite_index", "grid", nullptr };
|
||||
float x = 0.0f, y = 0.0f, scale = 1.0f;
|
||||
int sprite_index = -1;
|
||||
PyObject* texture = NULL;
|
||||
PyObject* grid = NULL;
|
||||
|
||||
if (!PyArg_ParseTupleAndKeywords(args, kwds, "ffOi|O",
|
||||
const_cast<char**>(keywords), &x, &y, &texture, &sprite_index, &grid))
|
||||
{
|
||||
return -1;
|
||||
}
|
||||
|
||||
// check types for texture
|
||||
//
|
||||
// Set Texture
|
||||
//
|
||||
if (texture != NULL && !PyObject_IsInstance(texture, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Texture"))){
|
||||
PyErr_SetString(PyExc_TypeError, "texture must be a mcrfpy.Texture instance");
|
||||
return -1;
|
||||
} /*else if (texture != NULL) // this section needs to go; texture isn't optional and isn't managed by the UI objects anymore
|
||||
{
|
||||
self->texture = texture;
|
||||
Py_INCREF(texture);
|
||||
} else
|
||||
{
|
||||
// default tex?
|
||||
}*/
|
||||
|
||||
if (grid != NULL && !PyObject_IsInstance(grid, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Grid"))) {
|
||||
PyErr_SetString(PyExc_TypeError, "grid must be a mcrfpy.Grid instance");
|
||||
return -1;
|
||||
}
|
||||
|
||||
auto pytexture = (PyTextureObject*)texture;
|
||||
if (grid == NULL)
|
||||
self->data = std::make_shared<UIEntity>();
|
||||
else
|
||||
self->data = std::make_shared<UIEntity>(*((PyUIGridObject*)grid)->data);
|
||||
|
||||
// TODO - PyTextureObjects and IndexTextures are a little bit of a mess with shared/unshared pointers
|
||||
self->data->sprite = UISprite(pytexture->data, sprite_index, sf::Vector2f(0,0), 1.0);
|
||||
self->data->position = sf::Vector2f(x, y);
|
||||
if (grid != NULL) {
|
||||
PyUIGridObject* pygrid = (PyUIGridObject*)grid;
|
||||
self->data->grid = pygrid->data;
|
||||
// todone - on creation of Entity with Grid assignment, also append it to the entity list
|
||||
pygrid->data->entities->push_back(self->data);
|
||||
}
|
||||
return 0;
|
||||
}
|
||||
|
||||
|
||||
|
||||
PyObject* UIEntity::get_spritenumber(PyUIEntityObject* self, void* closure) {
|
||||
return PyLong_FromDouble(self->data->sprite.getSpriteIndex());
|
||||
}
|
||||
|
||||
PyObject* sfVector2f_to_PyObject(sf::Vector2f vector) {
|
||||
return Py_BuildValue("(ff)", vector.x, vector.y);
|
||||
}
|
||||
|
||||
sf::Vector2f PyObject_to_sfVector2f(PyObject* obj) {
|
||||
float x, y;
|
||||
if (!PyArg_ParseTuple(obj, "ff", &x, &y)) {
|
||||
return sf::Vector2f(); // TODO / reconsider this default: Return default vector on parse error
|
||||
}
|
||||
return sf::Vector2f(x, y);
|
||||
}
|
||||
|
||||
// TODO - deprecate / remove this helper
|
||||
PyObject* UIGridPointState_to_PyObject(const UIGridPointState& state) {
|
||||
return PyObject_New(PyObject, (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "GridPointState"));
|
||||
}
|
||||
|
||||
PyObject* UIGridPointStateVector_to_PyList(const std::vector<UIGridPointState>& vec) {
|
||||
PyObject* list = PyList_New(vec.size());
|
||||
if (!list) return PyErr_NoMemory();
|
||||
|
||||
for (size_t i = 0; i < vec.size(); ++i) {
|
||||
PyObject* obj = UIGridPointState_to_PyObject(vec[i]);
|
||||
if (!obj) { // Cleanup on failure
|
||||
Py_DECREF(list);
|
||||
return NULL;
|
||||
}
|
||||
PyList_SET_ITEM(list, i, obj); // This steals a reference to obj
|
||||
}
|
||||
|
||||
return list;
|
||||
}
|
||||
|
||||
PyObject* UIEntity::get_position(PyUIEntityObject* self, void* closure) {
|
||||
return sfVector2f_to_PyObject(self->data->position);
|
||||
}
|
||||
|
||||
int UIEntity::set_position(PyUIEntityObject* self, PyObject* value, void* closure) {
|
||||
self->data->position = PyObject_to_sfVector2f(value);
|
||||
return 0;
|
||||
}
|
||||
|
||||
PyObject* UIEntity::get_gridstate(PyUIEntityObject* self, void* closure) {
|
||||
// Assuming a function to convert std::vector<UIGridPointState> to PyObject* list
|
||||
return UIGridPointStateVector_to_PyList(self->data->gridstate);
|
||||
}
|
||||
|
||||
int UIEntity::set_spritenumber(PyUIEntityObject* self, PyObject* value, void* closure) {
|
||||
int val;
|
||||
if (PyLong_Check(value))
|
||||
val = PyLong_AsLong(value);
|
||||
else
|
||||
{
|
||||
PyErr_SetString(PyExc_TypeError, "Value must be an integer.");
|
||||
return -1;
|
||||
}
|
||||
//self->data->sprite.sprite_index = val;
|
||||
self->data->sprite.setSpriteIndex(val); // todone - I don't like ".sprite.sprite" in this stack of UIEntity.UISprite.sf::Sprite
|
||||
return 0;
|
||||
}
|
||||
|
||||
PyMethodDef UIEntity::methods[] = {
|
||||
{"at", (PyCFunction)UIEntity::at, METH_O},
|
||||
{NULL, NULL, 0, NULL}
|
||||
};
|
||||
|
||||
PyGetSetDef UIEntity::getsetters[] = {
|
||||
{"position", (getter)UIEntity::get_position, (setter)UIEntity::set_position, "Entity position", NULL},
|
||||
{"gridstate", (getter)UIEntity::get_gridstate, NULL, "Grid point states for the entity", NULL},
|
||||
{"sprite_number", (getter)UIEntity::get_spritenumber, (setter)UIEntity::set_spritenumber, "Sprite number (index) on the texture on the display", NULL},
|
||||
{NULL} /* Sentinel */
|
||||
};
|
||||
|
||||
PyObject* UIEntity::repr(PyUIEntityObject* self) {
|
||||
std::ostringstream ss;
|
||||
if (!self->data) ss << "<Entity (invalid internal object)>";
|
||||
else {
|
||||
auto ent = self->data;
|
||||
ss << "<Entity (x=" << self->data->position.x << ", y=" << self->data->position.y << ", sprite_number=" << self->data->sprite.getSpriteIndex() <<
|
||||
")>";
|
||||
}
|
||||
std::string repr_str = ss.str();
|
||||
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
|
||||
}
|
|
@ -0,0 +1,75 @@
|
|||
#pragma once
|
||||
#include "Common.h"
|
||||
#include "Python.h"
|
||||
#include "structmember.h"
|
||||
#include "IndexTexture.h"
|
||||
#include "Resources.h"
|
||||
#include <list>
|
||||
|
||||
#include "PyCallable.h"
|
||||
#include "PyTexture.h"
|
||||
#include "PyColor.h"
|
||||
#include "PyVector.h"
|
||||
#include "PyFont.h"
|
||||
|
||||
#include "UIGridPoint.h"
|
||||
#include "UIDrawable.h"
|
||||
#include "UIBase.h"
|
||||
#include "UISprite.h"
|
||||
|
||||
class UIGrid;
|
||||
|
||||
//class UIEntity;
|
||||
//typedef struct {
|
||||
// PyObject_HEAD
|
||||
// std::shared_ptr<UIEntity> data;
|
||||
//} PyUIEntityObject;
|
||||
|
||||
// helper methods with no namespace requirement
|
||||
static PyObject* sfVector2f_to_PyObject(sf::Vector2f vector);
|
||||
static sf::Vector2f PyObject_to_sfVector2f(PyObject* obj);
|
||||
static PyObject* UIGridPointState_to_PyObject(const UIGridPointState& state);
|
||||
static PyObject* UIGridPointStateVector_to_PyList(const std::vector<UIGridPointState>& vec);
|
||||
|
||||
// TODO: make UIEntity a drawable
|
||||
class UIEntity//: public UIDrawable
|
||||
{
|
||||
public:
|
||||
//PyObject* self;
|
||||
std::shared_ptr<UIGrid> grid;
|
||||
std::vector<UIGridPointState> gridstate;
|
||||
UISprite sprite;
|
||||
sf::Vector2f position; //(x,y) in grid coordinates; float for animation
|
||||
void render(sf::Vector2f); //override final;
|
||||
|
||||
UIEntity();
|
||||
UIEntity(UIGrid&);
|
||||
|
||||
static PyObject* at(PyUIEntityObject* self, PyObject* o);
|
||||
static int init(PyUIEntityObject* self, PyObject* args, PyObject* kwds);
|
||||
|
||||
static PyObject* get_position(PyUIEntityObject* self, void* closure);
|
||||
static int set_position(PyUIEntityObject* self, PyObject* value, void* closure);
|
||||
static PyObject* get_gridstate(PyUIEntityObject* self, void* closure);
|
||||
static PyObject* get_spritenumber(PyUIEntityObject* self, void* closure);
|
||||
static int set_spritenumber(PyUIEntityObject* self, PyObject* value, void* closure);
|
||||
static PyMethodDef methods[];
|
||||
static PyGetSetDef getsetters[];
|
||||
static PyObject* repr(PyUIEntityObject* self);
|
||||
};
|
||||
|
||||
namespace mcrfpydef {
|
||||
static PyTypeObject PyUIEntityType = {
|
||||
//PyVarObject_HEAD_INIT(NULL, 0)
|
||||
.tp_name = "mcrfpy.Entity",
|
||||
.tp_basicsize = sizeof(PyUIEntityObject),
|
||||
.tp_itemsize = 0,
|
||||
.tp_repr = (reprfunc)UIEntity::repr,
|
||||
.tp_flags = Py_TPFLAGS_DEFAULT,
|
||||
.tp_doc = "UIEntity objects",
|
||||
.tp_methods = UIEntity::methods,
|
||||
.tp_getset = UIEntity::getsetters,
|
||||
.tp_init = (initproc)UIEntity::init,
|
||||
.tp_new = PyType_GenericNew,
|
||||
};
|
||||
}
|
|
@ -0,0 +1,265 @@
|
|||
#include "UIFrame.h"
|
||||
#include "UICollection.h"
|
||||
#include "GameEngine.h"
|
||||
|
||||
UIDrawable* UIFrame::click_at(sf::Vector2f point)
|
||||
{
|
||||
for (auto e: *children)
|
||||
{
|
||||
auto p = e->click_at(point + box.getPosition());
|
||||
if (p)
|
||||
return p;
|
||||
}
|
||||
if (click_callable)
|
||||
{
|
||||
float x = box.getPosition().x, y = box.getPosition().y, w = box.getSize().x, h = box.getSize().y;
|
||||
if (point.x > x && point.y > y && point.x < x+w && point.y < y+h) return this;
|
||||
}
|
||||
return NULL;
|
||||
}
|
||||
|
||||
UIFrame::UIFrame()
|
||||
: outline(0)
|
||||
{
|
||||
children = std::make_shared<std::vector<std::shared_ptr<UIDrawable>>>();
|
||||
box.setPosition(0, 0);
|
||||
box.setSize(sf::Vector2f(0, 0));
|
||||
}
|
||||
|
||||
UIFrame::UIFrame(float _x, float _y, float _w, float _h)
|
||||
: outline(0)
|
||||
{
|
||||
box.setPosition(_x, _y);
|
||||
box.setSize(sf::Vector2f(_w, _h));
|
||||
children = std::make_shared<std::vector<std::shared_ptr<UIDrawable>>>();
|
||||
}
|
||||
|
||||
UIFrame::~UIFrame()
|
||||
{
|
||||
children.reset();
|
||||
}
|
||||
|
||||
PyObjectsEnum UIFrame::derived_type()
|
||||
{
|
||||
return PyObjectsEnum::UIFRAME;
|
||||
}
|
||||
|
||||
void UIFrame::render(sf::Vector2f offset)
|
||||
{
|
||||
box.move(offset);
|
||||
Resources::game->getWindow().draw(box);
|
||||
box.move(-offset);
|
||||
|
||||
for (auto drawable : *children) {
|
||||
drawable->render(offset + box.getPosition());
|
||||
}
|
||||
}
|
||||
|
||||
PyObject* UIFrame::get_children(PyUIFrameObject* self, void* closure)
|
||||
{
|
||||
// create PyUICollection instance pointing to self->data->children
|
||||
//PyUICollectionObject* o = (PyUICollectionObject*)mcrfpydef::PyUICollectionType.tp_alloc(&mcrfpydef::PyUICollectionType, 0);
|
||||
auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "UICollection");
|
||||
auto o = (PyUICollectionObject*)type->tp_alloc(type, 0);
|
||||
if (o)
|
||||
o->data = self->data->children;
|
||||
return (PyObject*)o;
|
||||
}
|
||||
|
||||
|
||||
PyObject* UIFrame::get_float_member(PyUIFrameObject* self, void* closure)
|
||||
{
|
||||
auto member_ptr = reinterpret_cast<long>(closure);
|
||||
if (member_ptr == 0)
|
||||
return PyFloat_FromDouble(self->data->box.getPosition().x);
|
||||
else if (member_ptr == 1)
|
||||
return PyFloat_FromDouble(self->data->box.getPosition().y);
|
||||
else if (member_ptr == 2)
|
||||
return PyFloat_FromDouble(self->data->box.getSize().x);
|
||||
else if (member_ptr == 3)
|
||||
return PyFloat_FromDouble(self->data->box.getSize().y);
|
||||
else if (member_ptr == 4)
|
||||
return PyFloat_FromDouble(self->data->box.getOutlineThickness());
|
||||
else
|
||||
{
|
||||
PyErr_SetString(PyExc_AttributeError, "Invalid attribute");
|
||||
return nullptr;
|
||||
}
|
||||
}
|
||||
|
||||
int UIFrame::set_float_member(PyUIFrameObject* self, PyObject* value, void* closure)
|
||||
{
|
||||
float val;
|
||||
auto member_ptr = reinterpret_cast<long>(closure);
|
||||
if (PyFloat_Check(value))
|
||||
{
|
||||
val = PyFloat_AsDouble(value);
|
||||
}
|
||||
else if (PyLong_Check(value))
|
||||
{
|
||||
val = PyLong_AsLong(value);
|
||||
}
|
||||
else
|
||||
{
|
||||
PyErr_SetString(PyExc_TypeError, "Value must be an integer.");
|
||||
return -1;
|
||||
}
|
||||
if (member_ptr == 0) //x
|
||||
self->data->box.setPosition(val, self->data->box.getPosition().y);
|
||||
else if (member_ptr == 1) //y
|
||||
self->data->box.setPosition(self->data->box.getPosition().x, val);
|
||||
else if (member_ptr == 2) //w
|
||||
self->data->box.setSize(sf::Vector2f(val, self->data->box.getSize().y));
|
||||
else if (member_ptr == 3) //h
|
||||
self->data->box.setSize(sf::Vector2f(self->data->box.getSize().x, val));
|
||||
else if (member_ptr == 4) //outline
|
||||
self->data->box.setOutlineThickness(val);
|
||||
return 0;
|
||||
}
|
||||
|
||||
PyObject* UIFrame::get_color_member(PyUIFrameObject* self, void* closure)
|
||||
{
|
||||
// validate closure (should be impossible to be wrong, but it's thorough)
|
||||
auto member_ptr = reinterpret_cast<long>(closure);
|
||||
if (member_ptr != 0 && member_ptr != 1)
|
||||
{
|
||||
PyErr_SetString(PyExc_AttributeError, "Invalid attribute");
|
||||
return nullptr;
|
||||
}
|
||||
//PyTypeObject* colorType = &PyColorType;
|
||||
auto colorType = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "Color");
|
||||
PyObject* pyColor = colorType->tp_alloc(colorType, 0);
|
||||
if (pyColor == NULL)
|
||||
{
|
||||
std::cout << "failure to allocate mcrfpy.Color / PyColorType" << std::endl;
|
||||
return NULL;
|
||||
}
|
||||
PyColorObject* pyColorObj = reinterpret_cast<PyColorObject*>(pyColor);
|
||||
|
||||
// fetch correct member data
|
||||
sf::Color color;
|
||||
if (member_ptr == 0)
|
||||
{
|
||||
color = self->data->box.getFillColor();
|
||||
//return Py_BuildValue("(iii)", color.r, color.g, color.b);
|
||||
}
|
||||
else if (member_ptr == 1)
|
||||
{
|
||||
color = self->data->box.getOutlineColor();
|
||||
//return Py_BuildValue("(iii)", color.r, color.g, color.b);
|
||||
}
|
||||
|
||||
return PyColor(color).pyObject();
|
||||
}
|
||||
|
||||
int UIFrame::set_color_member(PyUIFrameObject* self, PyObject* value, void* closure)
|
||||
{
|
||||
//TODO: this logic of (PyColor instance OR tuple -> sf::color) should be encapsulated for reuse
|
||||
auto member_ptr = reinterpret_cast<long>(closure);
|
||||
int r, g, b, a;
|
||||
if (PyObject_IsInstance(value, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Color")))
|
||||
{
|
||||
sf::Color c = ((PyColorObject*)value)->data;
|
||||
r = c.r; g = c.g; b = c.b; a = c.a;
|
||||
}
|
||||
else if (!PyTuple_Check(value) || PyTuple_Size(value) < 3 || PyTuple_Size(value) > 4)
|
||||
{
|
||||
// reject non-Color, non-tuple value
|
||||
PyErr_SetString(PyExc_TypeError, "Value must be a tuple of 3 or 4 integers or an mcrfpy.Color object.");
|
||||
return -1;
|
||||
}
|
||||
else // get value from tuples
|
||||
{
|
||||
r = PyLong_AsLong(PyTuple_GetItem(value, 0));
|
||||
g = PyLong_AsLong(PyTuple_GetItem(value, 1));
|
||||
b = PyLong_AsLong(PyTuple_GetItem(value, 2));
|
||||
a = 255;
|
||||
|
||||
if (PyTuple_Size(value) == 4)
|
||||
{
|
||||
a = PyLong_AsLong(PyTuple_GetItem(value, 3));
|
||||
}
|
||||
}
|
||||
|
||||
if (r < 0 || r > 255 || g < 0 || g > 255 || b < 0 || b > 255 || a < 0 || a > 255)
|
||||
{
|
||||
PyErr_SetString(PyExc_ValueError, "Color values must be between 0 and 255.");
|
||||
return -1;
|
||||
}
|
||||
|
||||
if (member_ptr == 0)
|
||||
{
|
||||
self->data->box.setFillColor(sf::Color(r, g, b, a));
|
||||
}
|
||||
else if (member_ptr == 1)
|
||||
{
|
||||
self->data->box.setOutlineColor(sf::Color(r, g, b, a));
|
||||
}
|
||||
else
|
||||
{
|
||||
PyErr_SetString(PyExc_AttributeError, "Invalid attribute");
|
||||
return -1;
|
||||
}
|
||||
|
||||
return 0;
|
||||
}
|
||||
|
||||
PyGetSetDef UIFrame::getsetters[] = {
|
||||
{"x", (getter)UIFrame::get_float_member, (setter)UIFrame::set_float_member, "X coordinate of top-left corner", (void*)0},
|
||||
{"y", (getter)UIFrame::get_float_member, (setter)UIFrame::set_float_member, "Y coordinate of top-left corner", (void*)1},
|
||||
{"w", (getter)UIFrame::get_float_member, (setter)UIFrame::set_float_member, "width of the rectangle", (void*)2},
|
||||
{"h", (getter)UIFrame::get_float_member, (setter)UIFrame::set_float_member, "height of the rectangle", (void*)3},
|
||||
{"outline", (getter)UIFrame::get_float_member, (setter)UIFrame::set_float_member, "Thickness of the border", (void*)4},
|
||||
{"fill_color", (getter)UIFrame::get_color_member, (setter)UIFrame::set_color_member, "Fill color of the rectangle", (void*)0},
|
||||
{"outline_color", (getter)UIFrame::get_color_member, (setter)UIFrame::set_color_member, "Outline color of the rectangle", (void*)1},
|
||||
{"children", (getter)UIFrame::get_children, NULL, "UICollection of objects on top of this one", NULL},
|
||||
{"click", (getter)UIDrawable::get_click, (setter)UIDrawable::set_click, "Object called with (x, y, button) when clicked", (void*)PyObjectsEnum::UIFRAME},
|
||||
{NULL}
|
||||
};
|
||||
|
||||
PyObject* UIFrame::repr(PyUIFrameObject* self)
|
||||
{
|
||||
std::ostringstream ss;
|
||||
if (!self->data) ss << "<Frame (invalid internal object)>";
|
||||
else {
|
||||
auto box = self->data->box;
|
||||
auto fc = box.getFillColor();
|
||||
auto oc = box.getOutlineColor();
|
||||
ss << "<Frame (x=" << box.getPosition().x << ", y=" << box.getPosition().y << ", w=" <<
|
||||
box.getSize().x << ", w=" << box.getSize().y << ", " <<
|
||||
"outline=" << box.getOutlineThickness() << ", " <<
|
||||
"fill_color=(" << (int)fc.r << ", " << (int)fc.g << ", " << (int)fc.b << ", " << (int)fc.a <<"), " <<
|
||||
"outline_color=(" << (int)oc.r << ", " << (int)oc.g << ", " << (int)oc.b << ", " << (int)oc.a <<"), " <<
|
||||
self->data->children->size() << " child objects" <<
|
||||
")>";
|
||||
}
|
||||
std::string repr_str = ss.str();
|
||||
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
|
||||
}
|
||||
|
||||
int UIFrame::init(PyUIFrameObject* self, PyObject* args, PyObject* kwds)
|
||||
{
|
||||
//std::cout << "Init called\n";
|
||||
const char* keywords[] = { "x", "y", "w", "h", "fill_color", "outline_color", "outline", nullptr };
|
||||
float x = 0.0f, y = 0.0f, w = 0.0f, h=0.0f, outline=0.0f;
|
||||
PyObject* fill_color = 0;
|
||||
PyObject* outline_color = 0;
|
||||
|
||||
if (!PyArg_ParseTupleAndKeywords(args, kwds, "ffff|OOf", const_cast<char**>(keywords), &x, &y, &w, &h, &fill_color, &outline_color, &outline))
|
||||
{
|
||||
return -1;
|
||||
}
|
||||
|
||||
self->data->box.setPosition(sf::Vector2f(x, y));
|
||||
self->data->box.setSize(sf::Vector2f(w, h));
|
||||
self->data->box.setOutlineThickness(outline);
|
||||
// getsetter abuse because I haven't standardized Color object parsing (TODO)
|
||||
int err_val = 0;
|
||||
if (fill_color && fill_color != Py_None) err_val = UIFrame::set_color_member(self, fill_color, (void*)0);
|
||||
else self->data->box.setFillColor(sf::Color(0,0,0,255));
|
||||
if (err_val) return err_val;
|
||||
if (outline_color && outline_color != Py_None) err_val = UIFrame::set_color_member(self, outline_color, (void*)1);
|
||||
else self->data->box.setOutlineColor(sf::Color(128,128,128,255));
|
||||
if (err_val) return err_val;
|
||||
return 0;
|
||||
}
|
|
@ -0,0 +1,77 @@
|
|||
#pragma once
|
||||
#include "Common.h"
|
||||
#include "Python.h"
|
||||
#include "structmember.h"
|
||||
#include "IndexTexture.h"
|
||||
#include "Resources.h"
|
||||
#include <list>
|
||||
|
||||
#include "PyCallable.h"
|
||||
#include "PyColor.h"
|
||||
#include "PyVector.h"
|
||||
#include "UIDrawable.h"
|
||||
#include "UIBase.h"
|
||||
|
||||
//class UIFrame;
|
||||
//
|
||||
//typedef struct {
|
||||
// PyObject_HEAD
|
||||
// std::shared_ptr<UIFrame> data;
|
||||
//} PyUIFrameObject;
|
||||
|
||||
class UIFrame: public UIDrawable
|
||||
{
|
||||
public:
|
||||
UIFrame(float, float, float, float);
|
||||
UIFrame();
|
||||
~UIFrame();
|
||||
sf::RectangleShape box;
|
||||
float outline;
|
||||
std::shared_ptr<std::vector<std::shared_ptr<UIDrawable>>> children;
|
||||
void render(sf::Vector2f) override final;
|
||||
void move(sf::Vector2f);
|
||||
PyObjectsEnum derived_type() override final;
|
||||
virtual UIDrawable* click_at(sf::Vector2f point) override final;
|
||||
|
||||
static PyObject* get_children(PyUIFrameObject* self, void* closure);
|
||||
|
||||
static PyObject* get_float_member(PyUIFrameObject* self, void* closure);
|
||||
static int set_float_member(PyUIFrameObject* self, PyObject* value, void* closure);
|
||||
static PyObject* get_color_member(PyUIFrameObject* self, void* closure);
|
||||
static int set_color_member(PyUIFrameObject* self, PyObject* value, void* closure);
|
||||
static PyGetSetDef getsetters[];
|
||||
static PyObject* repr(PyUIFrameObject* self);
|
||||
static int init(PyUIFrameObject* self, PyObject* args, PyObject* kwds);
|
||||
};
|
||||
|
||||
namespace mcrfpydef {
|
||||
static PyTypeObject PyUIFrameType = {
|
||||
//PyVarObject_HEAD_INIT(NULL, 0)
|
||||
.tp_name = "mcrfpy.Frame",
|
||||
.tp_basicsize = sizeof(PyUIFrameObject),
|
||||
.tp_itemsize = 0,
|
||||
.tp_dealloc = (destructor)[](PyObject* self)
|
||||
{
|
||||
PyUIFrameObject* obj = (PyUIFrameObject*)self;
|
||||
obj->data.reset();
|
||||
Py_TYPE(self)->tp_free(self);
|
||||
},
|
||||
.tp_repr = (reprfunc)UIFrame::repr,
|
||||
//.tp_hash = NULL,
|
||||
//.tp_iter
|
||||
//.tp_iternext
|
||||
.tp_flags = Py_TPFLAGS_DEFAULT,
|
||||
.tp_doc = PyDoc_STR("docstring"),
|
||||
//.tp_methods = PyUIFrame_methods,
|
||||
//.tp_members = PyUIFrame_members,
|
||||
.tp_getset = UIFrame::getsetters,
|
||||
//.tp_base = NULL,
|
||||
.tp_init = (initproc)UIFrame::init,
|
||||
.tp_new = [](PyTypeObject* type, PyObject* args, PyObject* kwds) -> PyObject*
|
||||
{
|
||||
PyUIFrameObject* self = (PyUIFrameObject*)type->tp_alloc(type, 0);
|
||||
if (self) self->data = std::make_shared<UIFrame>();
|
||||
return (PyObject*)self;
|
||||
}
|
||||
};
|
||||
}
|
|
@ -0,0 +1,639 @@
|
|||
#include "UIGrid.h"
|
||||
#include "GameEngine.h"
|
||||
#include "McRFPy_API.h"
|
||||
|
||||
UIGrid::UIGrid() {}
|
||||
|
||||
UIGrid::UIGrid(int gx, int gy, std::shared_ptr<PyTexture> _ptex, sf::Vector2f _xy, sf::Vector2f _wh)
|
||||
: grid_x(gx), grid_y(gy),
|
||||
zoom(1.0f), center_x((gx/2) * _ptex->sprite_width), center_y((gy/2) * _ptex->sprite_height),
|
||||
ptex(_ptex), points(gx * gy)
|
||||
{
|
||||
entities = std::make_shared<std::list<std::shared_ptr<UIEntity>>>();
|
||||
|
||||
box.setSize(_wh);
|
||||
box.setPosition(_xy);
|
||||
|
||||
box.setFillColor(sf::Color(0,0,0,0));
|
||||
// create renderTexture with maximum theoretical size; sprite can resize to show whatever amount needs to be rendered
|
||||
renderTexture.create(1920, 1080); // TODO - renderTexture should be window size; above 1080p this will cause rendering errors
|
||||
|
||||
sprite = ptex->sprite(0);
|
||||
|
||||
output.setTextureRect(
|
||||
sf::IntRect(0, 0,
|
||||
box.getSize().x, box.getSize().y));
|
||||
output.setPosition(box.getPosition());
|
||||
// textures are upside-down inside renderTexture
|
||||
output.setTexture(renderTexture.getTexture());
|
||||
|
||||
}
|
||||
|
||||
void UIGrid::update() {}
|
||||
|
||||
|
||||
void UIGrid::render(sf::Vector2f)
|
||||
{
|
||||
output.setPosition(box.getPosition()); // output sprite can move; update position when drawing
|
||||
// output size can change; update size when drawing
|
||||
output.setTextureRect(
|
||||
sf::IntRect(0, 0,
|
||||
box.getSize().x, box.getSize().y));
|
||||
renderTexture.clear(sf::Color(8, 8, 8, 255)); // TODO - UIGrid needs a "background color" field
|
||||
// sprites that are visible according to zoom, center_x, center_y, and box width
|
||||
float center_x_sq = center_x / ptex->sprite_width;
|
||||
float center_y_sq = center_y / ptex->sprite_height;
|
||||
|
||||
float width_sq = box.getSize().x / (ptex->sprite_width * zoom);
|
||||
float height_sq = box.getSize().y / (ptex->sprite_height * zoom);
|
||||
float left_edge = center_x_sq - (width_sq / 2.0);
|
||||
float top_edge = center_y_sq - (height_sq / 2.0);
|
||||
|
||||
int left_spritepixels = center_x - (box.getSize().x / 2.0 / zoom);
|
||||
int top_spritepixels = center_y - (box.getSize().y / 2.0 / zoom);
|
||||
|
||||
//sprite.setScale(sf::Vector2f(zoom, zoom));
|
||||
sf::RectangleShape r; // for colors and overlays
|
||||
r.setSize(sf::Vector2f(ptex->sprite_width * zoom, ptex->sprite_height * zoom));
|
||||
r.setOutlineThickness(0);
|
||||
|
||||
int x_limit = left_edge + width_sq + 2;
|
||||
if (x_limit > grid_x) x_limit = grid_x;
|
||||
|
||||
int y_limit = top_edge + height_sq + 2;
|
||||
if (y_limit > grid_y) y_limit = grid_y;
|
||||
|
||||
// base layer - bottom color, tile sprite ("ground")
|
||||
for (int x = (left_edge - 1 >= 0 ? left_edge - 1 : 0);
|
||||
x < x_limit; //x < view_width;
|
||||
x+=1)
|
||||
{
|
||||
//for (float y = (top_edge >= 0 ? top_edge : 0);
|
||||
for (int y = (top_edge - 1 >= 0 ? top_edge - 1 : 0);
|
||||
y < y_limit; //y < view_height;
|
||||
y+=1)
|
||||
{
|
||||
auto pixel_pos = sf::Vector2f(
|
||||
(x*ptex->sprite_width - left_spritepixels) * zoom,
|
||||
(y*ptex->sprite_height - top_spritepixels) * zoom );
|
||||
|
||||
auto gridpoint = at(std::floor(x), std::floor(y));
|
||||
|
||||
//sprite.setPosition(pixel_pos);
|
||||
|
||||
r.setPosition(pixel_pos);
|
||||
r.setFillColor(gridpoint.color);
|
||||
renderTexture.draw(r);
|
||||
|
||||
// tilesprite
|
||||
// if discovered but not visible, set opacity to 90%
|
||||
// if not discovered... just don't draw it?
|
||||
if (gridpoint.tilesprite != -1) {
|
||||
sprite = ptex->sprite(gridpoint.tilesprite, pixel_pos, sf::Vector2f(zoom, zoom)); //setSprite(gridpoint.tilesprite);;
|
||||
renderTexture.draw(sprite);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// middle layer - entities
|
||||
// disabling entity rendering until I can render their UISprite inside the rendertexture (not directly to window)
|
||||
for (auto e : *entities) {
|
||||
// TODO skip out-of-bounds entities (grid square not visible at all, check for partially on visible grid squares / floating point grid position)
|
||||
//auto drawent = e->cGrid->indexsprite.drawable();
|
||||
auto& drawent = e->sprite;
|
||||
//drawent.setScale(zoom, zoom);
|
||||
drawent.setScale(sf::Vector2f(zoom, zoom));
|
||||
auto pixel_pos = sf::Vector2f(
|
||||
(e->position.x*ptex->sprite_width - left_spritepixels) * zoom,
|
||||
(e->position.y*ptex->sprite_height - top_spritepixels) * zoom );
|
||||
//drawent.setPosition(pixel_pos);
|
||||
//renderTexture.draw(drawent);
|
||||
drawent.render(pixel_pos, renderTexture);
|
||||
}
|
||||
|
||||
|
||||
// top layer - opacity for discovered / visible status (debug, basically)
|
||||
/* // Disabled until I attach a "perspective"
|
||||
for (int x = (left_edge - 1 >= 0 ? left_edge - 1 : 0);
|
||||
x < x_limit; //x < view_width;
|
||||
x+=1)
|
||||
{
|
||||
//for (float y = (top_edge >= 0 ? top_edge : 0);
|
||||
for (int y = (top_edge - 1 >= 0 ? top_edge - 1 : 0);
|
||||
y < y_limit; //y < view_height;
|
||||
y+=1)
|
||||
{
|
||||
|
||||
auto pixel_pos = sf::Vector2f(
|
||||
(x*itex->grid_size - left_spritepixels) * zoom,
|
||||
(y*itex->grid_size - top_spritepixels) * zoom );
|
||||
|
||||
auto gridpoint = at(std::floor(x), std::floor(y));
|
||||
|
||||
sprite.setPosition(pixel_pos);
|
||||
|
||||
r.setPosition(pixel_pos);
|
||||
|
||||
// visible & discovered layers for testing purposes
|
||||
if (!gridpoint.discovered) {
|
||||
r.setFillColor(sf::Color(16, 16, 20, 192)); // 255 opacity for actual blackout
|
||||
renderTexture.draw(r);
|
||||
} else if (!gridpoint.visible) {
|
||||
r.setFillColor(sf::Color(32, 32, 40, 128));
|
||||
renderTexture.draw(r);
|
||||
}
|
||||
|
||||
// overlay
|
||||
|
||||
// uisprite
|
||||
}
|
||||
}
|
||||
*/
|
||||
|
||||
// grid lines for testing & validation
|
||||
/*
|
||||
sf::Vertex line[] =
|
||||
{
|
||||
sf::Vertex(sf::Vector2f(0, 0), sf::Color::Red),
|
||||
sf::Vertex(box.getSize(), sf::Color::Red),
|
||||
|
||||
};
|
||||
|
||||
renderTexture.draw(line, 2, sf::Lines);
|
||||
sf::Vertex lineb[] =
|
||||
{
|
||||
sf::Vertex(sf::Vector2f(0, box.getSize().y), sf::Color::Blue),
|
||||
sf::Vertex(sf::Vector2f(box.getSize().x, 0), sf::Color::Blue),
|
||||
|
||||
};
|
||||
|
||||
renderTexture.draw(lineb, 2, sf::Lines);
|
||||
*/
|
||||
|
||||
// render to window
|
||||
renderTexture.display();
|
||||
Resources::game->getWindow().draw(output);
|
||||
|
||||
}
|
||||
|
||||
UIGridPoint& UIGrid::at(int x, int y)
|
||||
{
|
||||
return points[y * grid_x + x];
|
||||
}
|
||||
|
||||
PyObjectsEnum UIGrid::derived_type()
|
||||
{
|
||||
return PyObjectsEnum::UIGRID;
|
||||
}
|
||||
|
||||
std::shared_ptr<PyTexture> UIGrid::getTexture()
|
||||
{
|
||||
return ptex;
|
||||
}
|
||||
|
||||
UIDrawable* UIGrid::click_at(sf::Vector2f point)
|
||||
{
|
||||
if (click_callable)
|
||||
{
|
||||
if(box.getGlobalBounds().contains(point)) return this;
|
||||
}
|
||||
return NULL;
|
||||
}
|
||||
|
||||
|
||||
int UIGrid::init(PyUIGridObject* self, PyObject* args, PyObject* kwds) {
|
||||
int grid_x, grid_y;
|
||||
PyObject* textureObj;
|
||||
float box_x, box_y, box_w, box_h;
|
||||
|
||||
if (!PyArg_ParseTuple(args, "iiOffff", &grid_x, &grid_y, &textureObj, &box_x, &box_y, &box_w, &box_h)) {
|
||||
return -1; // If parsing fails, return an error
|
||||
}
|
||||
|
||||
// Convert PyObject texture to IndexTexture*
|
||||
// This requires the texture object to have been initialized similar to UISprite's texture handling
|
||||
|
||||
//if (!PyObject_IsInstance(textureObj, (PyObject*)&PyTextureType)) {
|
||||
if (!PyObject_IsInstance(textureObj, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Texture"))) {
|
||||
PyErr_SetString(PyExc_TypeError, "texture must be a mcrfpy.Texture instance");
|
||||
return -1;
|
||||
}
|
||||
PyTextureObject* pyTexture = reinterpret_cast<PyTextureObject*>(textureObj);
|
||||
// TODO (7DRL day 2, item 4.) use shared_ptr / PyTextureObject on UIGrid
|
||||
//IndexTexture* texture = pyTexture->data.get();
|
||||
|
||||
// Initialize UIGrid
|
||||
//self->data = new UIGrid(grid_x, grid_y, texture, sf::Vector2f(box_x, box_y), sf::Vector2f(box_w, box_h));
|
||||
self->data = std::make_shared<UIGrid>(grid_x, grid_y, pyTexture->data,
|
||||
sf::Vector2f(box_x, box_y), sf::Vector2f(box_w, box_h));
|
||||
return 0; // Success
|
||||
}
|
||||
|
||||
PyObject* UIGrid::get_grid_size(PyUIGridObject* self, void* closure) {
|
||||
return Py_BuildValue("(ii)", self->data->grid_x, self->data->grid_y);
|
||||
}
|
||||
|
||||
PyObject* UIGrid::get_position(PyUIGridObject* self, void* closure) {
|
||||
auto& box = self->data->box;
|
||||
return Py_BuildValue("(ff)", box.getPosition().x, box.getPosition().y);
|
||||
}
|
||||
|
||||
int UIGrid::set_position(PyUIGridObject* self, PyObject* value, void* closure) {
|
||||
float x, y;
|
||||
if (!PyArg_ParseTuple(value, "ff", &x, &y)) {
|
||||
PyErr_SetString(PyExc_ValueError, "Position must be a tuple of two floats");
|
||||
return -1;
|
||||
}
|
||||
self->data->box.setPosition(x, y);
|
||||
return 0;
|
||||
}
|
||||
|
||||
PyObject* UIGrid::get_size(PyUIGridObject* self, void* closure) {
|
||||
auto& box = self->data->box;
|
||||
return Py_BuildValue("(ff)", box.getSize().x, box.getSize().y);
|
||||
}
|
||||
|
||||
int UIGrid::set_size(PyUIGridObject* self, PyObject* value, void* closure) {
|
||||
float w, h;
|
||||
if (!PyArg_ParseTuple(value, "ff", &w, &h)) {
|
||||
PyErr_SetString(PyExc_ValueError, "Size must be a tuple of two floats");
|
||||
return -1;
|
||||
}
|
||||
self->data->box.setSize(sf::Vector2f(w, h));
|
||||
return 0;
|
||||
}
|
||||
|
||||
PyObject* UIGrid::get_center(PyUIGridObject* self, void* closure) {
|
||||
return Py_BuildValue("(ff)", self->data->center_x, self->data->center_y);
|
||||
}
|
||||
|
||||
int UIGrid::set_center(PyUIGridObject* self, PyObject* value, void* closure) {
|
||||
float x, y;
|
||||
if (!PyArg_ParseTuple(value, "ff", &x, &y)) {
|
||||
PyErr_SetString(PyExc_ValueError, "Size must be a tuple of two floats");
|
||||
return -1;
|
||||
}
|
||||
self->data->center_x = x;
|
||||
self->data->center_y = y;
|
||||
return 0;
|
||||
}
|
||||
|
||||
PyObject* UIGrid::get_float_member(PyUIGridObject* self, void* closure)
|
||||
{
|
||||
auto member_ptr = reinterpret_cast<long>(closure);
|
||||
if (member_ptr == 0) // x
|
||||
return PyFloat_FromDouble(self->data->box.getPosition().x);
|
||||
else if (member_ptr == 1) // y
|
||||
return PyFloat_FromDouble(self->data->box.getPosition().y);
|
||||
else if (member_ptr == 2) // w
|
||||
return PyFloat_FromDouble(self->data->box.getSize().x);
|
||||
else if (member_ptr == 3) // h
|
||||
return PyFloat_FromDouble(self->data->box.getSize().y);
|
||||
else if (member_ptr == 4) // center_x
|
||||
return PyFloat_FromDouble(self->data->center_x);
|
||||
else if (member_ptr == 5) // center_y
|
||||
return PyFloat_FromDouble(self->data->center_y);
|
||||
else if (member_ptr == 6) // zoom
|
||||
return PyFloat_FromDouble(self->data->zoom);
|
||||
else
|
||||
{
|
||||
PyErr_SetString(PyExc_AttributeError, "Invalid attribute");
|
||||
return nullptr;
|
||||
}
|
||||
}
|
||||
|
||||
int UIGrid::set_float_member(PyUIGridObject* self, PyObject* value, void* closure)
|
||||
{
|
||||
float val;
|
||||
auto member_ptr = reinterpret_cast<long>(closure);
|
||||
if (PyFloat_Check(value))
|
||||
{
|
||||
val = PyFloat_AsDouble(value);
|
||||
}
|
||||
else if (PyLong_Check(value))
|
||||
{
|
||||
val = PyLong_AsLong(value);
|
||||
}
|
||||
else
|
||||
{
|
||||
PyErr_SetString(PyExc_TypeError, "Value must be a floating point number.");
|
||||
return -1;
|
||||
}
|
||||
if (member_ptr == 0) // x
|
||||
self->data->box.setPosition(val, self->data->box.getPosition().y);
|
||||
else if (member_ptr == 1) // y
|
||||
self->data->box.setPosition(self->data->box.getPosition().x, val);
|
||||
else if (member_ptr == 2) // w
|
||||
self->data->box.setSize(sf::Vector2f(val, self->data->box.getSize().y));
|
||||
else if (member_ptr == 3) // h
|
||||
self->data->box.setSize(sf::Vector2f(self->data->box.getSize().x, val));
|
||||
else if (member_ptr == 4) // center_x
|
||||
self->data->center_x = val;
|
||||
else if (member_ptr == 5) // center_y
|
||||
self->data->center_y = val;
|
||||
else if (member_ptr == 6) // zoom
|
||||
self->data->zoom = val;
|
||||
return 0;
|
||||
}
|
||||
// TODO (7DRL Day 2, item 5.) return Texture object
|
||||
/*
|
||||
PyObject* UIGrid::get_texture(PyUIGridObject* self, void* closure) {
|
||||
Py_INCREF(self->texture);
|
||||
return self->texture;
|
||||
}
|
||||
*/
|
||||
|
||||
PyObject* UIGrid::get_texture(PyUIGridObject* self, void* closure) {
|
||||
//return self->data->getTexture()->pyObject();
|
||||
// PyObject_GetAttrString(McRFPy_API::mcrf_module, "GridPointState")
|
||||
//PyTextureObject* obj = (PyTextureObject*)((&PyTextureType)->tp_alloc(&PyTextureType, 0));
|
||||
auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "Texture");
|
||||
auto obj = (PyTextureObject*)type->tp_alloc(type, 0);
|
||||
obj->data = self->data->getTexture();
|
||||
return (PyObject*)obj;
|
||||
}
|
||||
|
||||
PyObject* UIGrid::py_at(PyUIGridObject* self, PyObject* o)
|
||||
{
|
||||
int x, y;
|
||||
if (!PyArg_ParseTuple(o, "ii", &x, &y)) {
|
||||
PyErr_SetString(PyExc_TypeError, "UIGrid.at requires two integer arguments: (x, y)");
|
||||
return NULL;
|
||||
}
|
||||
if (x < 0 || x >= self->data->grid_x) {
|
||||
PyErr_SetString(PyExc_ValueError, "x value out of range (0, Grid.grid_y)");
|
||||
return NULL;
|
||||
}
|
||||
if (y < 0 || y >= self->data->grid_y) {
|
||||
PyErr_SetString(PyExc_ValueError, "y value out of range (0, Grid.grid_y)");
|
||||
return NULL;
|
||||
}
|
||||
|
||||
//PyUIGridPointObject* obj = (PyUIGridPointObject*)((&PyUIGridPointType)->tp_alloc(&PyUIGridPointType, 0));
|
||||
auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "GridPoint");
|
||||
auto obj = (PyUIGridPointObject*)type->tp_alloc(type, 0);
|
||||
//auto target = std::static_pointer_cast<UIEntity>(target);
|
||||
obj->data = &(self->data->points[x + self->data->grid_x * y]);
|
||||
obj->grid = self->data;
|
||||
return (PyObject*)obj;
|
||||
}
|
||||
|
||||
PyMethodDef UIGrid::methods[] = {
|
||||
{"at", (PyCFunction)UIGrid::py_at, METH_O},
|
||||
{NULL, NULL, 0, NULL}
|
||||
};
|
||||
|
||||
|
||||
PyGetSetDef UIGrid::getsetters[] = {
|
||||
|
||||
// TODO - refactor into get_vector_member with field identifier values `(void*)n`
|
||||
{"grid_size", (getter)UIGrid::get_grid_size, NULL, "Grid dimensions (grid_x, grid_y)", NULL},
|
||||
{"position", (getter)UIGrid::get_position, (setter)UIGrid::set_position, "Position of the grid (x, y)", NULL},
|
||||
{"size", (getter)UIGrid::get_size, (setter)UIGrid::set_size, "Size of the grid (width, height)", NULL},
|
||||
{"center", (getter)UIGrid::get_center, (setter)UIGrid::set_center, "Grid coordinate at the center of the Grid's view (pan)", NULL},
|
||||
|
||||
{"entities", (getter)UIGrid::get_children, NULL, "EntityCollection of entities on this grid", NULL},
|
||||
|
||||
{"x", (getter)UIGrid::get_float_member, (setter)UIGrid::set_float_member, "top-left corner X-coordinate", (void*)0},
|
||||
{"y", (getter)UIGrid::get_float_member, (setter)UIGrid::set_float_member, "top-left corner Y-coordinate", (void*)1},
|
||||
{"w", (getter)UIGrid::get_float_member, (setter)UIGrid::set_float_member, "visible widget width", (void*)2},
|
||||
{"h", (getter)UIGrid::get_float_member, (setter)UIGrid::set_float_member, "visible widget height", (void*)3},
|
||||
{"center_x", (getter)UIGrid::get_float_member, (setter)UIGrid::set_float_member, "center of the view X-coordinate", (void*)4},
|
||||
{"center_y", (getter)UIGrid::get_float_member, (setter)UIGrid::set_float_member, "center of the view Y-coordinate", (void*)5},
|
||||
{"zoom", (getter)UIGrid::get_float_member, (setter)UIGrid::set_float_member, "zoom factor for displaying the Grid", (void*)6},
|
||||
|
||||
{"click", (getter)UIDrawable::get_click, (setter)UIDrawable::set_click, "Object called with (x, y, button) when clicked", (void*)PyObjectsEnum::UIGRID},
|
||||
|
||||
{"texture", (getter)UIGrid::get_texture, NULL, "Texture of the grid", NULL}, //TODO 7DRL-day2-item5
|
||||
{NULL} /* Sentinel */
|
||||
};
|
||||
|
||||
PyObject* UIGrid::get_children(PyUIGridObject* self, void* closure)
|
||||
{
|
||||
// create PyUICollection instance pointing to self->data->children
|
||||
//PyUIEntityCollectionObject* o = (PyUIEntityCollectionObject*)PyUIEntityCollectionType.tp_alloc(&PyUIEntityCollectionType, 0);
|
||||
auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "EntityCollection");
|
||||
auto o = (PyUIEntityCollectionObject*)type->tp_alloc(type, 0);
|
||||
if (o) {
|
||||
o->data = self->data->entities; // todone. / BUGFIX - entities isn't a shared pointer on UIGrid, what to do? -- I made it a sp<list<sp<UIEntity>>>
|
||||
o->grid = self->data;
|
||||
}
|
||||
return (PyObject*)o;
|
||||
}
|
||||
|
||||
PyObject* UIGrid::repr(PyUIGridObject* self)
|
||||
{
|
||||
|
||||
// if (member_ptr == 0) // x
|
||||
// self->data->box.setPosition(val, self->data->box.getPosition().y);
|
||||
// else if (member_ptr == 1) // y
|
||||
// self->data->box.setPosition(self->data->box.getPosition().x, val);
|
||||
// else if (member_ptr == 2) // w
|
||||
// self->data->box.setSize(sf::Vector2f(val, self->data->box.getSize().y));
|
||||
// else if (member_ptr == 3) // h
|
||||
// self->data->box.setSize(sf::Vector2f(self->data->box.getSize().x, val));
|
||||
// else if (member_ptr == 4) // center_x
|
||||
// self->data->center_x = val;
|
||||
// else if (member_ptr == 5) // center_y
|
||||
// self->data->center_y = val;
|
||||
// else if (member_ptr == 6) // zoom
|
||||
// self->data->zoom = val;
|
||||
|
||||
std::ostringstream ss;
|
||||
if (!self->data) ss << "<Grid (invalid internal object)>";
|
||||
else {
|
||||
auto grid = self->data;
|
||||
auto box = grid->box;
|
||||
ss << "<Grid (x=" << box.getPosition().x << ", y=" << box.getPosition().y << ", w=" << box.getSize().x << ", h=" << box.getSize().y << ", " <<
|
||||
"center=(" << grid->center_x << ", " << grid->center_y << "), zoom=" << grid->zoom <<
|
||||
")>";
|
||||
}
|
||||
std::string repr_str = ss.str();
|
||||
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
|
||||
}
|
||||
|
||||
/* // TODO standard pointer would need deleted, but I opted for a shared pointer. tp_dealloc currently not even defined in the PyTypeObject
|
||||
void PyUIGrid_dealloc(PyUIGridObject* self) {
|
||||
delete self->data; // Clean up the allocated UIGrid object
|
||||
Py_TYPE(self)->tp_free((PyObject*)self);
|
||||
}
|
||||
*/
|
||||
|
||||
int UIEntityCollectionIter::init(PyUIEntityCollectionIterObject* self, PyObject* args, PyObject* kwds)
|
||||
{
|
||||
PyErr_SetString(PyExc_TypeError, "UICollection cannot be instantiated: a C++ data source is required.");
|
||||
return -1;
|
||||
}
|
||||
|
||||
PyObject* UIEntityCollectionIter::next(PyUIEntityCollectionIterObject* self)
|
||||
{
|
||||
if (self->data->size() != self->start_size)
|
||||
{
|
||||
PyErr_SetString(PyExc_RuntimeError, "collection changed size during iteration");
|
||||
return NULL;
|
||||
}
|
||||
|
||||
if (self->index > self->start_size - 1)
|
||||
{
|
||||
PyErr_SetNone(PyExc_StopIteration);
|
||||
return NULL;
|
||||
}
|
||||
self->index++;
|
||||
auto vec = self->data.get();
|
||||
if (!vec)
|
||||
{
|
||||
PyErr_SetString(PyExc_RuntimeError, "the collection store returned a null pointer");
|
||||
return NULL;
|
||||
}
|
||||
// Advance list iterator since Entities are not stored in a vector (if this code even worked)
|
||||
// vectors only: //auto target = (*vec)[self->index-1];
|
||||
//auto l_front = (*vec).begin();
|
||||
//std::advance(l_front, self->index-1);
|
||||
|
||||
// TODO build PyObject* of the correct UIDrawable subclass to return
|
||||
//return py_instance(target);
|
||||
return NULL;
|
||||
}
|
||||
|
||||
PyObject* UIEntityCollectionIter::repr(PyUIEntityCollectionIterObject* self)
|
||||
{
|
||||
std::ostringstream ss;
|
||||
if (!self->data) ss << "<UICollectionIter (invalid internal object)>";
|
||||
else {
|
||||
ss << "<UICollectionIter (" << self->data->size() << " child objects, @ index " << self->index << ")>";
|
||||
}
|
||||
std::string repr_str = ss.str();
|
||||
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
|
||||
}
|
||||
|
||||
Py_ssize_t UIEntityCollection::len(PyUIEntityCollectionObject* self) {
|
||||
return self->data->size();
|
||||
}
|
||||
|
||||
PyObject* UIEntityCollection::getitem(PyUIEntityCollectionObject* self, Py_ssize_t index) {
|
||||
// build a Python version of item at self->data[index]
|
||||
// Copy pasted::
|
||||
auto vec = self->data.get();
|
||||
if (!vec)
|
||||
{
|
||||
PyErr_SetString(PyExc_RuntimeError, "the collection store returned a null pointer");
|
||||
return NULL;
|
||||
}
|
||||
while (index < 0) index += self->data->size();
|
||||
if (index > self->data->size() - 1)
|
||||
{
|
||||
PyErr_SetString(PyExc_IndexError, "EntityCollection index out of range");
|
||||
return NULL;
|
||||
}
|
||||
auto l_begin = (*vec).begin();
|
||||
std::advance(l_begin, index);
|
||||
auto target = *l_begin; //auto target = (*vec)[index];
|
||||
//RET_PY_INSTANCE(target);
|
||||
// construct and return an entity object that points directly into the UIGrid's entity vector
|
||||
//PyUIEntityObject* o = (PyUIEntityObject*)((&PyUIEntityType)->tp_alloc(&PyUIEntityType, 0));
|
||||
auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "Entity");
|
||||
auto o = (PyUIEntityObject*)type->tp_alloc(type, 0);
|
||||
auto p = std::static_pointer_cast<UIEntity>(target);
|
||||
o->data = p;
|
||||
return (PyObject*)o;
|
||||
return NULL;
|
||||
|
||||
|
||||
}
|
||||
|
||||
PySequenceMethods UIEntityCollection::sqmethods = {
|
||||
.sq_length = (lenfunc)UIEntityCollection::len,
|
||||
.sq_item = (ssizeargfunc)UIEntityCollection::getitem,
|
||||
//.sq_item_by_index = UIEntityCollection::getitem
|
||||
//.sq_slice - return a subset of the iterable
|
||||
//.sq_ass_item - called when `o[x] = y` is executed (x is any object type)
|
||||
//.sq_ass_slice - cool; no thanks, for now
|
||||
//.sq_contains - called when `x in o` is executed
|
||||
//.sq_ass_item_by_index - called when `o[x] = y` is executed (x is explictly an integer)
|
||||
};
|
||||
|
||||
PyObject* UIEntityCollection::append(PyUIEntityCollectionObject* self, PyObject* o)
|
||||
{
|
||||
// if not UIDrawable subclass, reject it
|
||||
// self->data->push_back( c++ object inside o );
|
||||
|
||||
// this would be a great use case for .tp_base
|
||||
//if (!PyObject_IsInstance(o, (PyObject*)&PyUIEntityType))
|
||||
if (!PyObject_IsInstance(o, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Entity")))
|
||||
{
|
||||
PyErr_SetString(PyExc_TypeError, "Only Entity objects can be added to EntityCollection");
|
||||
return NULL;
|
||||
}
|
||||
PyUIEntityObject* entity = (PyUIEntityObject*)o;
|
||||
self->data->push_back(entity->data);
|
||||
entity->data->grid = self->grid;
|
||||
|
||||
Py_INCREF(Py_None);
|
||||
return Py_None;
|
||||
}
|
||||
|
||||
PyObject* UIEntityCollection::remove(PyUIEntityCollectionObject* self, PyObject* o)
|
||||
{
|
||||
if (!PyLong_Check(o))
|
||||
{
|
||||
PyErr_SetString(PyExc_TypeError, "UICollection.remove requires an integer index to remove");
|
||||
return NULL;
|
||||
}
|
||||
long index = PyLong_AsLong(o);
|
||||
if (index >= self->data->size())
|
||||
{
|
||||
PyErr_SetString(PyExc_ValueError, "Index out of range");
|
||||
return NULL;
|
||||
}
|
||||
else if (index < 0)
|
||||
{
|
||||
PyErr_SetString(PyExc_NotImplementedError, "reverse indexing is not implemented.");
|
||||
return NULL;
|
||||
}
|
||||
|
||||
// release the shared pointer at correct part of the list
|
||||
self->data->erase(std::next(self->data->begin(), index));
|
||||
Py_INCREF(Py_None);
|
||||
return Py_None;
|
||||
}
|
||||
|
||||
PyMethodDef UIEntityCollection::methods[] = {
|
||||
{"append", (PyCFunction)UIEntityCollection::append, METH_O},
|
||||
//{"extend", (PyCFunction)UIEntityCollection::extend, METH_O}, // TODO
|
||||
{"remove", (PyCFunction)UIEntityCollection::remove, METH_O},
|
||||
{NULL, NULL, 0, NULL}
|
||||
};
|
||||
|
||||
PyObject* UIEntityCollection::repr(PyUIEntityCollectionObject* self)
|
||||
{
|
||||
std::ostringstream ss;
|
||||
if (!self->data) ss << "<UICollection (invalid internal object)>";
|
||||
else {
|
||||
ss << "<UICollection (" << self->data->size() << " child objects)>";
|
||||
}
|
||||
std::string repr_str = ss.str();
|
||||
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
|
||||
}
|
||||
|
||||
int UIEntityCollection::init(PyUIEntityCollectionObject* self, PyObject* args, PyObject* kwds)
|
||||
{
|
||||
PyErr_SetString(PyExc_TypeError, "EntityCollection cannot be instantiated: a C++ data source is required.");
|
||||
return -1;
|
||||
}
|
||||
|
||||
PyObject* UIEntityCollection::iter(PyUIEntityCollectionObject* self)
|
||||
{
|
||||
//PyUIEntityCollectionIterObject* iterObj;
|
||||
//iterObj = (PyUIEntityCollectionIterObject*)PyUIEntityCollectionIterType.tp_alloc(&PyUIEntityCollectionIterType, 0);
|
||||
auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "EntityCollectionIter");
|
||||
auto iterObj = (PyUIEntityCollectionIterObject*)type->tp_alloc(type, 0);
|
||||
if (iterObj == NULL) {
|
||||
return NULL; // Failed to allocate memory for the iterator object
|
||||
}
|
||||
|
||||
iterObj->data = self->data;
|
||||
iterObj->index = 0;
|
||||
iterObj->start_size = self->data->size();
|
||||
|
||||
return (PyObject*)iterObj;
|
||||
}
|
|
@ -0,0 +1,184 @@
|
|||
#pragma once
|
||||
#include "Common.h"
|
||||
#include "Python.h"
|
||||
#include "structmember.h"
|
||||
#include "IndexTexture.h"
|
||||
#include "Resources.h"
|
||||
#include <list>
|
||||
|
||||
#include "PyCallable.h"
|
||||
#include "PyTexture.h"
|
||||
#include "PyColor.h"
|
||||
#include "PyVector.h"
|
||||
#include "PyFont.h"
|
||||
|
||||
#include "UIGridPoint.h"
|
||||
#include "UIEntity.h"
|
||||
#include "UIDrawable.h"
|
||||
#include "UIBase.h"
|
||||
|
||||
class UIGrid: public UIDrawable
|
||||
{
|
||||
private:
|
||||
std::shared_ptr<PyTexture> ptex;
|
||||
public:
|
||||
UIGrid();
|
||||
//UIGrid(int, int, IndexTexture*, float, float, float, float);
|
||||
UIGrid(int, int, std::shared_ptr<PyTexture>, sf::Vector2f, sf::Vector2f);
|
||||
void update();
|
||||
void render(sf::Vector2f) override final;
|
||||
UIGridPoint& at(int, int);
|
||||
PyObjectsEnum derived_type() override final;
|
||||
//void setSprite(int);
|
||||
virtual UIDrawable* click_at(sf::Vector2f point) override final;
|
||||
|
||||
int grid_x, grid_y;
|
||||
//int grid_size; // grid sizes are implied by IndexTexture now
|
||||
sf::RectangleShape box;
|
||||
float center_x, center_y, zoom;
|
||||
//IndexTexture* itex;
|
||||
std::shared_ptr<PyTexture> getTexture();
|
||||
sf::Sprite sprite, output;
|
||||
sf::RenderTexture renderTexture;
|
||||
std::vector<UIGridPoint> points;
|
||||
std::shared_ptr<std::list<std::shared_ptr<UIEntity>>> entities;
|
||||
|
||||
static int init(PyUIGridObject* self, PyObject* args, PyObject* kwds);
|
||||
static PyObject* get_grid_size(PyUIGridObject* self, void* closure);
|
||||
static PyObject* get_position(PyUIGridObject* self, void* closure);
|
||||
static int set_position(PyUIGridObject* self, PyObject* value, void* closure);
|
||||
static PyObject* get_size(PyUIGridObject* self, void* closure);
|
||||
static int set_size(PyUIGridObject* self, PyObject* value, void* closure);
|
||||
static PyObject* get_center(PyUIGridObject* self, void* closure);
|
||||
static int set_center(PyUIGridObject* self, PyObject* value, void* closure);
|
||||
static PyObject* get_float_member(PyUIGridObject* self, void* closure);
|
||||
static int set_float_member(PyUIGridObject* self, PyObject* value, void* closure);
|
||||
static PyObject* get_texture(PyUIGridObject* self, void* closure);
|
||||
static PyObject* py_at(PyUIGridObject* self, PyObject* o);
|
||||
static PyMethodDef methods[];
|
||||
static PyGetSetDef getsetters[];
|
||||
static PyObject* get_children(PyUIGridObject* self, void* closure);
|
||||
static PyObject* repr(PyUIGridObject* self);
|
||||
|
||||
};
|
||||
|
||||
typedef struct {
|
||||
PyObject_HEAD
|
||||
std::shared_ptr<std::list<std::shared_ptr<UIEntity>>> data;
|
||||
std::shared_ptr<UIGrid> grid;
|
||||
} PyUIEntityCollectionObject;
|
||||
|
||||
class UIEntityCollection {
|
||||
public:
|
||||
static PySequenceMethods sqmethods;
|
||||
static PyObject* append(PyUIEntityCollectionObject* self, PyObject* o);
|
||||
static PyObject* remove(PyUIEntityCollectionObject* self, PyObject* o);
|
||||
static PyMethodDef methods[];
|
||||
static PyObject* repr(PyUIEntityCollectionObject* self);
|
||||
static int init(PyUIEntityCollectionObject* self, PyObject* args, PyObject* kwds);
|
||||
static PyObject* iter(PyUIEntityCollectionObject* self);
|
||||
static Py_ssize_t len(PyUIEntityCollectionObject* self);
|
||||
static PyObject* getitem(PyUIEntityCollectionObject* self, Py_ssize_t index);
|
||||
};
|
||||
|
||||
typedef struct {
|
||||
PyObject_HEAD
|
||||
std::shared_ptr<std::list<std::shared_ptr<UIEntity>>> data;
|
||||
int index;
|
||||
int start_size;
|
||||
} PyUIEntityCollectionIterObject;
|
||||
|
||||
class UIEntityCollectionIter {
|
||||
public:
|
||||
static int init(PyUIEntityCollectionIterObject* self, PyObject* args, PyObject* kwds);
|
||||
static PyObject* next(PyUIEntityCollectionIterObject* self);
|
||||
static PyObject* repr(PyUIEntityCollectionIterObject* self);
|
||||
static PyObject* getitem(PyUIEntityCollectionObject* self, Py_ssize_t index);
|
||||
|
||||
};
|
||||
|
||||
namespace mcrfpydef {
|
||||
static PyTypeObject PyUIGridType = {
|
||||
//PyVarObject_HEAD_INIT(NULL, 0)
|
||||
.tp_name = "mcrfpy.Grid",
|
||||
.tp_basicsize = sizeof(PyUIGridObject),
|
||||
.tp_itemsize = 0,
|
||||
//.tp_dealloc = (destructor)[](PyObject* self)
|
||||
//{
|
||||
// PyUIGridObject* obj = (PyUIGridObject*)self;
|
||||
// obj->data.reset();
|
||||
// Py_TYPE(self)->tp_free(self);
|
||||
//},
|
||||
//TODO - PyUIGrid REPR def:
|
||||
.tp_repr = (reprfunc)UIGrid::repr,
|
||||
//.tp_hash = NULL,
|
||||
//.tp_iter
|
||||
//.tp_iternext
|
||||
.tp_flags = Py_TPFLAGS_DEFAULT,
|
||||
.tp_doc = PyDoc_STR("docstring"),
|
||||
.tp_methods = UIGrid::methods,
|
||||
//.tp_members = UIGrid::members,
|
||||
.tp_getset = UIGrid::getsetters,
|
||||
//.tp_base = NULL,
|
||||
.tp_init = (initproc)UIGrid::init,
|
||||
.tp_new = [](PyTypeObject* type, PyObject* args, PyObject* kwds) -> PyObject*
|
||||
{
|
||||
PyUIGridObject* self = (PyUIGridObject*)type->tp_alloc(type, 0);
|
||||
if (self) self->data = std::make_shared<UIGrid>();
|
||||
return (PyObject*)self;
|
||||
}
|
||||
};
|
||||
|
||||
static PyTypeObject PyUIEntityCollectionIterType = {
|
||||
//PyVarObject_HEAD_INIT(NULL, 0)
|
||||
.tp_name = "mcrfpy.UICollectionIter",
|
||||
.tp_basicsize = sizeof(PyUIEntityCollectionIterObject),
|
||||
.tp_itemsize = 0,
|
||||
.tp_dealloc = (destructor)[](PyObject* self)
|
||||
{
|
||||
PyUIEntityCollectionIterObject* obj = (PyUIEntityCollectionIterObject*)self;
|
||||
obj->data.reset();
|
||||
Py_TYPE(self)->tp_free(self);
|
||||
},
|
||||
.tp_repr = (reprfunc)UIEntityCollectionIter::repr,
|
||||
.tp_flags = Py_TPFLAGS_DEFAULT,
|
||||
.tp_doc = PyDoc_STR("Iterator for a collection of UI objects"),
|
||||
.tp_iternext = (iternextfunc)UIEntityCollectionIter::next,
|
||||
//.tp_getset = UIEntityCollection::getset,
|
||||
.tp_init = (initproc)UIEntityCollectionIter::init, // just raise an exception
|
||||
.tp_new = [](PyTypeObject* type, PyObject* args, PyObject* kwds) -> PyObject*
|
||||
{
|
||||
PyErr_SetString(PyExc_TypeError, "UICollection cannot be instantiated: a C++ data source is required.");
|
||||
return NULL;
|
||||
}
|
||||
};
|
||||
|
||||
static PyTypeObject PyUIEntityCollectionType = {
|
||||
//PyVarObject_/HEAD_INIT(NULL, 0)
|
||||
.tp_name = "mcrfpy.EntityCollection",
|
||||
.tp_basicsize = sizeof(PyUIEntityCollectionObject),
|
||||
.tp_itemsize = 0,
|
||||
.tp_dealloc = (destructor)[](PyObject* self)
|
||||
{
|
||||
PyUIEntityCollectionObject* obj = (PyUIEntityCollectionObject*)self;
|
||||
obj->data.reset();
|
||||
Py_TYPE(self)->tp_free(self);
|
||||
},
|
||||
.tp_repr = (reprfunc)UIEntityCollection::repr,
|
||||
.tp_as_sequence = &UIEntityCollection::sqmethods,
|
||||
.tp_flags = Py_TPFLAGS_DEFAULT,
|
||||
.tp_doc = PyDoc_STR("Iterable, indexable collection of Entities"),
|
||||
.tp_iter = (getiterfunc)UIEntityCollection::iter,
|
||||
.tp_methods = UIEntityCollection::methods, // append, remove
|
||||
//.tp_getset = UIEntityCollection::getset,
|
||||
.tp_init = (initproc)UIEntityCollection::init, // just raise an exception
|
||||
.tp_new = [](PyTypeObject* type, PyObject* args, PyObject* kwds) -> PyObject*
|
||||
{
|
||||
// Does PyUIEntityCollectionType need __new__ if it's not supposed to be instantiable by the user?
|
||||
// Should I just raise an exception? Or is the uninitialized shared_ptr enough of a blocker?
|
||||
PyErr_SetString(PyExc_TypeError, "EntityCollection cannot be instantiated: a C++ data source is required.");
|
||||
return NULL;
|
||||
}
|
||||
};
|
||||
|
||||
}
|
|
@ -0,0 +1,158 @@
|
|||
#include "UIGridPoint.h"
|
||||
|
||||
UIGridPoint::UIGridPoint()
|
||||
: color(1.0f, 1.0f, 1.0f), color_overlay(0.0f, 0.0f, 0.0f), walkable(false), transparent(false),
|
||||
tilesprite(-1), tile_overlay(-1), uisprite(-1)
|
||||
{}
|
||||
|
||||
// Utility function to convert sf::Color to PyObject*
|
||||
PyObject* sfColor_to_PyObject(sf::Color color) {
|
||||
return Py_BuildValue("(iiii)", color.r, color.g, color.b, color.a);
|
||||
}
|
||||
|
||||
// Utility function to convert PyObject* to sf::Color
|
||||
sf::Color PyObject_to_sfColor(PyObject* obj) {
|
||||
int r, g, b, a = 255; // Default alpha to fully opaque if not specified
|
||||
if (!PyArg_ParseTuple(obj, "iii|i", &r, &g, &b, &a)) {
|
||||
return sf::Color(); // Return default color on parse error
|
||||
}
|
||||
return sf::Color(r, g, b, a);
|
||||
}
|
||||
|
||||
PyObject* UIGridPoint::get_color(PyUIGridPointObject* self, void* closure) {
|
||||
if (reinterpret_cast<long>(closure) == 0) { // color
|
||||
return sfColor_to_PyObject(self->data->color);
|
||||
} else { // color_overlay
|
||||
return sfColor_to_PyObject(self->data->color_overlay);
|
||||
}
|
||||
}
|
||||
|
||||
int UIGridPoint::set_color(PyUIGridPointObject* self, PyObject* value, void* closure) {
|
||||
sf::Color color = PyObject_to_sfColor(value);
|
||||
if (reinterpret_cast<long>(closure) == 0) { // color
|
||||
self->data->color = color;
|
||||
} else { // color_overlay
|
||||
self->data->color_overlay = color;
|
||||
}
|
||||
return 0;
|
||||
}
|
||||
|
||||
PyObject* UIGridPoint::get_bool_member(PyUIGridPointObject* self, void* closure) {
|
||||
if (reinterpret_cast<long>(closure) == 0) { // walkable
|
||||
return PyBool_FromLong(self->data->walkable);
|
||||
} else { // transparent
|
||||
return PyBool_FromLong(self->data->transparent);
|
||||
}
|
||||
}
|
||||
|
||||
int UIGridPoint::set_bool_member(PyUIGridPointObject* self, PyObject* value, void* closure) {
|
||||
if (value == Py_True) {
|
||||
if (reinterpret_cast<long>(closure) == 0) { // walkable
|
||||
self->data->walkable = true;
|
||||
} else { // transparent
|
||||
self->data->transparent = true;
|
||||
}
|
||||
} else if (value == Py_False) {
|
||||
if (reinterpret_cast<long>(closure) == 0) { // walkable
|
||||
self->data->walkable = false;
|
||||
} else { // transparent
|
||||
self->data->transparent = false;
|
||||
}
|
||||
} else {
|
||||
PyErr_SetString(PyExc_ValueError, "Expected a boolean value");
|
||||
return -1;
|
||||
}
|
||||
return 0;
|
||||
}
|
||||
|
||||
PyObject* UIGridPoint::get_int_member(PyUIGridPointObject* self, void* closure) {
|
||||
switch(reinterpret_cast<long>(closure)) {
|
||||
case 0: return PyLong_FromLong(self->data->tilesprite);
|
||||
case 1: return PyLong_FromLong(self->data->tile_overlay);
|
||||
case 2: return PyLong_FromLong(self->data->uisprite);
|
||||
default: PyErr_SetString(PyExc_RuntimeError, "Invalid closure"); return nullptr;
|
||||
}
|
||||
}
|
||||
|
||||
int UIGridPoint::set_int_member(PyUIGridPointObject* self, PyObject* value, void* closure) {
|
||||
long val = PyLong_AsLong(value);
|
||||
if (PyErr_Occurred()) return -1;
|
||||
|
||||
switch(reinterpret_cast<long>(closure)) {
|
||||
case 0: self->data->tilesprite = val; break;
|
||||
case 1: self->data->tile_overlay = val; break;
|
||||
case 2: self->data->uisprite = val; break;
|
||||
default: PyErr_SetString(PyExc_RuntimeError, "Invalid closure"); return -1;
|
||||
}
|
||||
return 0;
|
||||
}
|
||||
|
||||
PyGetSetDef UIGridPoint::getsetters[] = {
|
||||
{"color", (getter)UIGridPoint::get_color, (setter)UIGridPoint::set_color, "GridPoint color", (void*)0},
|
||||
{"color_overlay", (getter)UIGridPoint::get_color, (setter)UIGridPoint::set_color, "GridPoint color overlay", (void*)1},
|
||||
{"walkable", (getter)UIGridPoint::get_bool_member, (setter)UIGridPoint::set_bool_member, "Is the GridPoint walkable", (void*)0},
|
||||
{"transparent", (getter)UIGridPoint::get_bool_member, (setter)UIGridPoint::set_bool_member, "Is the GridPoint transparent", (void*)1},
|
||||
{"tilesprite", (getter)UIGridPoint::get_int_member, (setter)UIGridPoint::set_int_member, "Tile sprite index", (void*)0},
|
||||
{"tile_overlay", (getter)UIGridPoint::get_int_member, (setter)UIGridPoint::set_int_member, "Tile overlay sprite index", (void*)1},
|
||||
{"uisprite", (getter)UIGridPoint::get_int_member, (setter)UIGridPoint::set_int_member, "UI sprite index", (void*)2},
|
||||
{NULL} /* Sentinel */
|
||||
};
|
||||
|
||||
PyObject* UIGridPoint::repr(PyUIGridPointObject* self) {
|
||||
std::ostringstream ss;
|
||||
if (!self->data) ss << "<GridPoint (invalid internal object)>";
|
||||
else {
|
||||
auto gp = self->data;
|
||||
ss << "<GridPoint (walkable=" << (gp->walkable ? "True" : "False") << ", transparent=" << (gp->transparent ? "True" : "False") <<
|
||||
", tilesprite=" << gp->tilesprite << ", tile_overlay=" << gp->tile_overlay << ", uisprite=" << gp->uisprite <<
|
||||
")>";
|
||||
}
|
||||
std::string repr_str = ss.str();
|
||||
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
|
||||
}
|
||||
|
||||
PyObject* UIGridPointState::get_bool_member(PyUIGridPointStateObject* self, void* closure) {
|
||||
if (reinterpret_cast<long>(closure) == 0) { // visible
|
||||
return PyBool_FromLong(self->data->visible);
|
||||
} else { // discovered
|
||||
return PyBool_FromLong(self->data->discovered);
|
||||
}
|
||||
}
|
||||
|
||||
int UIGridPointState::set_bool_member(PyUIGridPointStateObject* self, PyObject* value, void* closure) {
|
||||
if (!PyBool_Check(value)) {
|
||||
PyErr_SetString(PyExc_TypeError, "Value must be a boolean");
|
||||
return -1;
|
||||
}
|
||||
|
||||
int truthValue = PyObject_IsTrue(value);
|
||||
if (truthValue < 0) {
|
||||
return -1; // PyObject_IsTrue returns -1 on error
|
||||
}
|
||||
|
||||
if (reinterpret_cast<long>(closure) == 0) { // visible
|
||||
self->data->visible = truthValue;
|
||||
} else { // discovered
|
||||
self->data->discovered = truthValue;
|
||||
}
|
||||
|
||||
return 0;
|
||||
}
|
||||
|
||||
PyGetSetDef UIGridPointState::getsetters[] = {
|
||||
{"visible", (getter)UIGridPointState::get_bool_member, (setter)UIGridPointState::set_bool_member, "Is the GridPointState visible", (void*)0},
|
||||
{"discovered", (getter)UIGridPointState::get_bool_member, (setter)UIGridPointState::set_bool_member, "Has the GridPointState been discovered", (void*)1},
|
||||
{NULL} /* Sentinel */
|
||||
};
|
||||
|
||||
PyObject* UIGridPointState::repr(PyUIGridPointStateObject* self) {
|
||||
std::ostringstream ss;
|
||||
if (!self->data) ss << "<GridPointState (invalid internal object)>";
|
||||
else {
|
||||
auto gps = self->data;
|
||||
ss << "<GridPointState (visible=" << (gps->visible ? "True" : "False") << ", discovered=" << (gps->discovered ? "True" : "False") <<
|
||||
")>";
|
||||
}
|
||||
std::string repr_str = ss.str();
|
||||
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
|
||||
}
|
|
@ -0,0 +1,92 @@
|
|||
#pragma once
|
||||
#include "Common.h"
|
||||
#include "Python.h"
|
||||
#include "structmember.h"
|
||||
#include "IndexTexture.h"
|
||||
#include "Resources.h"
|
||||
#include <list>
|
||||
|
||||
#include "PyCallable.h"
|
||||
#include "PyTexture.h"
|
||||
#include "PyColor.h"
|
||||
#include "PyVector.h"
|
||||
#include "PyFont.h"
|
||||
|
||||
static PyObject* sfColor_to_PyObject(sf::Color color);
|
||||
static sf::Color PyObject_to_sfColor(PyObject* obj);
|
||||
|
||||
class UIGrid;
|
||||
class UIEntity;
|
||||
class UIGridPoint;
|
||||
class UIGridPointState;
|
||||
|
||||
typedef struct {
|
||||
PyObject_HEAD
|
||||
UIGridPoint* data;
|
||||
std::shared_ptr<UIGrid> grid;
|
||||
} PyUIGridPointObject;
|
||||
|
||||
typedef struct {
|
||||
PyObject_HEAD
|
||||
UIGridPointState* data;
|
||||
std::shared_ptr<UIGrid> grid;
|
||||
std::shared_ptr<UIEntity> entity;
|
||||
} PyUIGridPointStateObject;
|
||||
|
||||
// UIGridPoint - revised grid data for each point
|
||||
class UIGridPoint
|
||||
{
|
||||
public:
|
||||
sf::Color color, color_overlay;
|
||||
bool walkable, transparent;
|
||||
int tilesprite, tile_overlay, uisprite;
|
||||
UIGridPoint();
|
||||
|
||||
static int set_int_member(PyUIGridPointObject* self, PyObject* value, void* closure);
|
||||
static PyGetSetDef getsetters[];
|
||||
static PyObject* get_color(PyUIGridPointObject* self, void* closure);
|
||||
static PyObject* get_int_member(PyUIGridPointObject* self, void* closure);
|
||||
static int set_bool_member(PyUIGridPointObject* self, PyObject* value, void* closure);
|
||||
static PyObject* get_bool_member(PyUIGridPointObject* self, void* closure);
|
||||
static int set_color(PyUIGridPointObject* self, PyObject* value, void* closure);
|
||||
static PyObject* repr(PyUIGridPointObject* self);
|
||||
};
|
||||
|
||||
// UIGridPointState - entity-specific info for each cell
|
||||
class UIGridPointState
|
||||
{
|
||||
public:
|
||||
bool visible, discovered;
|
||||
|
||||
static PyObject* get_bool_member(PyUIGridPointStateObject* self, void* closure);
|
||||
static int set_bool_member(PyUIGridPointStateObject* self, PyObject* value, void* closure);
|
||||
static PyGetSetDef getsetters[];
|
||||
static PyObject* repr(PyUIGridPointStateObject* self);
|
||||
};
|
||||
|
||||
namespace mcrfpydef {
|
||||
static PyTypeObject PyUIGridPointType = {
|
||||
//PyVarObject_HEAD_INIT(NULL, 0)
|
||||
.tp_name = "mcrfpy.GridPoint",
|
||||
.tp_basicsize = sizeof(PyUIGridPointObject),
|
||||
.tp_itemsize = 0,
|
||||
.tp_repr = (reprfunc)UIGridPoint::repr,
|
||||
.tp_flags = Py_TPFLAGS_DEFAULT,
|
||||
.tp_doc = "UIGridPoint object",
|
||||
.tp_getset = UIGridPoint::getsetters,
|
||||
//.tp_init = (initproc)PyUIGridPoint_init, // TODO Define the init function
|
||||
.tp_new = PyType_GenericNew,
|
||||
};
|
||||
|
||||
static PyTypeObject PyUIGridPointStateType = {
|
||||
//PyVarObject_HEAD_INIT(NULL, 0)
|
||||
.tp_name = "mcrfpy.GridPointState",
|
||||
.tp_basicsize = sizeof(PyUIGridPointStateObject),
|
||||
.tp_itemsize = 0,
|
||||
.tp_repr = (reprfunc)UIGridPointState::repr,
|
||||
.tp_flags = Py_TPFLAGS_DEFAULT,
|
||||
.tp_doc = "UIGridPointState object", // TODO: Add PyUIGridPointState tp_init
|
||||
.tp_getset = UIGridPointState::getsetters,
|
||||
.tp_new = PyType_GenericNew,
|
||||
};
|
||||
}
|
|
@ -0,0 +1,215 @@
|
|||
#include "UISprite.h"
|
||||
#include "GameEngine.h"
|
||||
|
||||
UIDrawable* UISprite::click_at(sf::Vector2f point)
|
||||
{
|
||||
if (click_callable)
|
||||
{
|
||||
if(sprite.getGlobalBounds().contains(point)) return this;
|
||||
}
|
||||
return NULL;
|
||||
}
|
||||
|
||||
UISprite::UISprite() {}
|
||||
|
||||
UISprite::UISprite(std::shared_ptr<PyTexture> _ptex, int _sprite_index, sf::Vector2f _pos, float _scale)
|
||||
: ptex(_ptex), sprite_index(_sprite_index)
|
||||
{
|
||||
sprite = ptex->sprite(sprite_index, _pos, sf::Vector2f(_scale, _scale));
|
||||
}
|
||||
|
||||
void UISprite::render(sf::Vector2f offset)
|
||||
{
|
||||
sprite.move(offset);
|
||||
Resources::game->getWindow().draw(sprite);
|
||||
sprite.move(-offset);
|
||||
}
|
||||
|
||||
void UISprite::render(sf::Vector2f offset, sf::RenderTexture& target)
|
||||
{
|
||||
sprite.move(offset);
|
||||
target.draw(sprite);
|
||||
sprite.move(-offset);
|
||||
}
|
||||
|
||||
void UISprite::setPosition(sf::Vector2f pos)
|
||||
{
|
||||
sprite.setPosition(pos);
|
||||
}
|
||||
|
||||
void UISprite::setScale(sf::Vector2f s)
|
||||
{
|
||||
sprite.setScale(s);
|
||||
}
|
||||
|
||||
void UISprite::setTexture(std::shared_ptr<PyTexture> _ptex, int _sprite_index)
|
||||
{
|
||||
ptex = _ptex;
|
||||
if (_sprite_index != -1) // if you are changing textures, there's a good chance you need a new index too
|
||||
sprite_index = _sprite_index;
|
||||
sprite = ptex->sprite(sprite_index, sprite.getPosition(), sprite.getScale());
|
||||
}
|
||||
|
||||
void UISprite::setSpriteIndex(int _sprite_index)
|
||||
{
|
||||
sprite_index = _sprite_index;
|
||||
sprite = ptex->sprite(sprite_index, sprite.getPosition(), sprite.getScale());
|
||||
}
|
||||
|
||||
sf::Vector2f UISprite::getScale()
|
||||
{
|
||||
return sprite.getScale();
|
||||
}
|
||||
|
||||
sf::Vector2f UISprite::getPosition()
|
||||
{
|
||||
return sprite.getPosition();
|
||||
}
|
||||
|
||||
std::shared_ptr<PyTexture> UISprite::getTexture()
|
||||
{
|
||||
return ptex;
|
||||
}
|
||||
|
||||
int UISprite::getSpriteIndex()
|
||||
{
|
||||
return sprite_index;
|
||||
}
|
||||
|
||||
PyObjectsEnum UISprite::derived_type()
|
||||
{
|
||||
return PyObjectsEnum::UISPRITE;
|
||||
}
|
||||
|
||||
PyObject* UISprite::get_float_member(PyUISpriteObject* self, void* closure)
|
||||
{
|
||||
auto member_ptr = reinterpret_cast<long>(closure);
|
||||
if (member_ptr == 0)
|
||||
return PyFloat_FromDouble(self->data->getPosition().x);
|
||||
else if (member_ptr == 1)
|
||||
return PyFloat_FromDouble(self->data->getPosition().y);
|
||||
else if (member_ptr == 2)
|
||||
return PyFloat_FromDouble(self->data->getScale().x); // scale X and Y are identical, presently
|
||||
else
|
||||
{
|
||||
PyErr_SetString(PyExc_AttributeError, "Invalid attribute");
|
||||
return nullptr;
|
||||
}
|
||||
}
|
||||
|
||||
int UISprite::set_float_member(PyUISpriteObject* self, PyObject* value, void* closure)
|
||||
{
|
||||
float val;
|
||||
auto member_ptr = reinterpret_cast<long>(closure);
|
||||
if (PyFloat_Check(value))
|
||||
{
|
||||
val = PyFloat_AsDouble(value);
|
||||
}
|
||||
else if (PyLong_Check(value))
|
||||
{
|
||||
val = PyLong_AsLong(value);
|
||||
}
|
||||
else
|
||||
{
|
||||
PyErr_SetString(PyExc_TypeError, "Value must be a floating point number.");
|
||||
return -1;
|
||||
}
|
||||
if (member_ptr == 0) //x
|
||||
self->data->setPosition(sf::Vector2f(val, self->data->getPosition().y));
|
||||
else if (member_ptr == 1) //y
|
||||
self->data->setPosition(sf::Vector2f(self->data->getPosition().x, val));
|
||||
else if (member_ptr == 2) // scale
|
||||
self->data->setScale(sf::Vector2f(val, val));
|
||||
return 0;
|
||||
}
|
||||
|
||||
PyObject* UISprite::get_int_member(PyUISpriteObject* self, void* closure)
|
||||
{
|
||||
auto member_ptr = reinterpret_cast<long>(closure);
|
||||
if (true) {}
|
||||
else
|
||||
{
|
||||
PyErr_SetString(PyExc_AttributeError, "Invalid attribute");
|
||||
return nullptr;
|
||||
}
|
||||
|
||||
return PyLong_FromDouble(self->data->getSpriteIndex());
|
||||
}
|
||||
|
||||
int UISprite::set_int_member(PyUISpriteObject* self, PyObject* value, void* closure)
|
||||
{
|
||||
int val;
|
||||
auto member_ptr = reinterpret_cast<long>(closure);
|
||||
if (PyLong_Check(value))
|
||||
{
|
||||
val = PyLong_AsLong(value);
|
||||
}
|
||||
else
|
||||
{
|
||||
PyErr_SetString(PyExc_TypeError, "Value must be an integer.");
|
||||
return -1;
|
||||
}
|
||||
self->data->setSpriteIndex(val);
|
||||
return 0;
|
||||
}
|
||||
|
||||
PyObject* UISprite::get_texture(PyUISpriteObject* self, void* closure)
|
||||
{
|
||||
return self->data->getTexture()->pyObject();
|
||||
}
|
||||
|
||||
int UISprite::set_texture(PyUISpriteObject* self, PyObject* value, void* closure)
|
||||
{
|
||||
return -1;
|
||||
}
|
||||
|
||||
PyGetSetDef UISprite::getsetters[] = {
|
||||
{"x", (getter)UISprite::get_float_member, (setter)UISprite::set_float_member, "X coordinate of top-left corner", (void*)0},
|
||||
{"y", (getter)UISprite::get_float_member, (setter)UISprite::set_float_member, "Y coordinate of top-left corner", (void*)1},
|
||||
{"scale", (getter)UISprite::get_float_member, (setter)UISprite::set_float_member, "Size factor", (void*)2},
|
||||
{"sprite_number", (getter)UISprite::get_int_member, (setter)UISprite::set_int_member, "Which sprite on the texture is shown", NULL},
|
||||
{"texture", (getter)UISprite::get_texture, (setter)UISprite::set_texture, "Texture object", NULL},
|
||||
{"click", (getter)UIDrawable::get_click, (setter)UIDrawable::set_click, "Object called with (x, y, button) when clicked", (void*)PyObjectsEnum::UISPRITE},
|
||||
{NULL}
|
||||
};
|
||||
|
||||
PyObject* UISprite::repr(PyUISpriteObject* self)
|
||||
{
|
||||
std::ostringstream ss;
|
||||
if (!self->data) ss << "<Sprite (invalid internal object)>";
|
||||
else {
|
||||
//auto sprite = self->data->sprite;
|
||||
ss << "<Sprite (x=" << self->data->getPosition().x << ", y=" << self->data->getPosition().y << ", " <<
|
||||
"scale=" << self->data->getScale().x << ", " <<
|
||||
"sprite_number=" << self->data->getSpriteIndex() << ")>";
|
||||
}
|
||||
std::string repr_str = ss.str();
|
||||
return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
|
||||
}
|
||||
|
||||
int UISprite::init(PyUISpriteObject* self, PyObject* args, PyObject* kwds)
|
||||
{
|
||||
//std::cout << "Init called\n";
|
||||
static const char* keywords[] = { "x", "y", "texture", "sprite_index", "scale", nullptr };
|
||||
float x = 0.0f, y = 0.0f, scale = 1.0f;
|
||||
int sprite_index;
|
||||
PyObject* texture;
|
||||
|
||||
if (!PyArg_ParseTupleAndKeywords(args, kwds, "|ffOif",
|
||||
const_cast<char**>(keywords), &x, &y, &texture, &sprite_index, &scale))
|
||||
{
|
||||
return -1;
|
||||
}
|
||||
|
||||
// check types for texture
|
||||
//if (texture != NULL && !PyObject_IsInstance(texture, (PyObject*)&PyTextureType)){
|
||||
if (texture != NULL && !PyObject_IsInstance(texture, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Texture"))){
|
||||
PyErr_SetString(PyExc_TypeError, "texture must be a mcrfpy.Texture instance");
|
||||
return -1;
|
||||
}
|
||||
auto pytexture = (PyTextureObject*)texture;
|
||||
self->data = std::make_shared<UISprite>(pytexture->data, sprite_index, sf::Vector2f(x, y), scale);
|
||||
self->data->setPosition(sf::Vector2f(x, y));
|
||||
|
||||
return 0;
|
||||
}
|
|
@ -0,0 +1,90 @@
|
|||
#pragma once
|
||||
#include "Common.h"
|
||||
#include "Python.h"
|
||||
#include "structmember.h"
|
||||
#include "IndexTexture.h"
|
||||
#include "Resources.h"
|
||||
#include <list>
|
||||
|
||||
#include "PyCallable.h"
|
||||
#include "PyTexture.h"
|
||||
#include "PyColor.h"
|
||||
#include "PyVector.h"
|
||||
#include "PyFont.h"
|
||||
#include "UIDrawable.h"
|
||||
#include "UIBase.h"
|
||||
|
||||
class UISprite: public UIDrawable
|
||||
{
|
||||
private:
|
||||
int sprite_index;
|
||||
sf::Sprite sprite;
|
||||
protected:
|
||||
std::shared_ptr<PyTexture> ptex;
|
||||
public:
|
||||
UISprite();
|
||||
UISprite(std::shared_ptr<PyTexture>, int, sf::Vector2f, float);
|
||||
void update();
|
||||
void render(sf::Vector2f) override final;
|
||||
virtual UIDrawable* click_at(sf::Vector2f point) override final;
|
||||
|
||||
void render(sf::Vector2f, sf::RenderTexture&);
|
||||
|
||||
void setPosition(sf::Vector2f);
|
||||
sf::Vector2f getPosition();
|
||||
void setScale(sf::Vector2f);
|
||||
sf::Vector2f getScale();
|
||||
void setSpriteIndex(int);
|
||||
int getSpriteIndex();
|
||||
|
||||
void setTexture(std::shared_ptr<PyTexture> _ptex, int _sprite_index=-1);
|
||||
std::shared_ptr<PyTexture> getTexture();
|
||||
|
||||
PyObjectsEnum derived_type() override final;
|
||||
|
||||
|
||||
static PyObject* get_float_member(PyUISpriteObject* self, void* closure);
|
||||
static int set_float_member(PyUISpriteObject* self, PyObject* value, void* closure);
|
||||
static PyObject* get_int_member(PyUISpriteObject* self, void* closure);
|
||||
static int set_int_member(PyUISpriteObject* self, PyObject* value, void* closure);
|
||||
static PyObject* get_texture(PyUISpriteObject* self, void* closure);
|
||||
static int set_texture(PyUISpriteObject* self, PyObject* value, void* closure);
|
||||
static PyGetSetDef getsetters[];
|
||||
static PyObject* repr(PyUISpriteObject* self);
|
||||
static int init(PyUISpriteObject* self, PyObject* args, PyObject* kwds);
|
||||
|
||||
};
|
||||
|
||||
namespace mcrfpydef {
|
||||
static PyTypeObject PyUISpriteType = {
|
||||
//PyVarObject_HEAD_INIT(NULL, 0)
|
||||
.tp_name = "mcrfpy.Sprite",
|
||||
.tp_basicsize = sizeof(PyUISpriteObject),
|
||||
.tp_itemsize = 0,
|
||||
.tp_dealloc = (destructor)[](PyObject* self)
|
||||
{
|
||||
PyUISpriteObject* obj = (PyUISpriteObject*)self;
|
||||
// release reference to font object
|
||||
//if (obj->texture) Py_DECREF(obj->texture);
|
||||
obj->data.reset();
|
||||
Py_TYPE(self)->tp_free(self);
|
||||
},
|
||||
.tp_repr = (reprfunc)UISprite::repr,
|
||||
//.tp_hash = NULL,
|
||||
//.tp_iter
|
||||
//.tp_iternext
|
||||
.tp_flags = Py_TPFLAGS_DEFAULT,
|
||||
.tp_doc = PyDoc_STR("docstring"),
|
||||
//.tp_methods = PyUIFrame_methods,
|
||||
//.tp_members = PyUIFrame_members,
|
||||
.tp_getset = UISprite::getsetters,
|
||||
//.tp_base = NULL,
|
||||
.tp_init = (initproc)UISprite::init,
|
||||
.tp_new = [](PyTypeObject* type, PyObject* args, PyObject* kwds) -> PyObject*
|
||||
{
|
||||
PyUISpriteObject* self = (PyUISpriteObject*)type->tp_alloc(type, 0);
|
||||
//if (self) self->data = std::make_shared<UICaption>();
|
||||
return (PyObject*)self;
|
||||
}
|
||||
};
|
||||
}
|
|
@ -61,15 +61,15 @@ UITestScene::UITestScene(GameEngine* g) : Scene(g)
|
|||
//ui_elements.push_back(&e1);
|
||||
//ui_elements.push_back(&e2);
|
||||
|
||||
t.loadFromFile("./assets/kenney_tinydungeon.png");
|
||||
t.setSmooth(false);
|
||||
auto* indextex = new IndexTexture(t, 16, 12, 11);
|
||||
Resources::game->textures.push_back(*indextex);
|
||||
|
||||
//t.loadFromFile("./assets/kenney_tinydungeon.png");
|
||||
//t.setSmooth(false);
|
||||
//auto* indextex = new IndexTexture(t, 16, 12, 11);
|
||||
//Resources::game->textures.push_back(*indextex);
|
||||
|
||||
auto ptex = std::make_shared<PyTexture>("./assets/kenney_tinydungeon.png", 16, 16);
|
||||
|
||||
//std::cout << Resources::game->textures.size() << " textures loaded.\n";
|
||||
auto e3 = std::make_shared<UISprite>();
|
||||
auto e3 = std::make_shared<UISprite>(ptex, 84, sf::Vector2f(10, 10), 4.0);
|
||||
|
||||
// Make UISprite more like IndexSprite: this is bad
|
||||
//e3->x = 10; e3->y = 10;
|
||||
|
@ -79,19 +79,19 @@ UITestScene::UITestScene(GameEngine* g) : Scene(g)
|
|||
//e3->update();
|
||||
|
||||
// This goes to show how inconvenient the default constructor is. It should be removed
|
||||
e3->itex = &Resources::game->textures[0];
|
||||
e3->sprite.setTexture(e3->itex->texture);
|
||||
e3->sprite_index = 84;
|
||||
e3->sprite.setTextureRect(e3->itex->spriteCoordinates(e3->sprite_index));
|
||||
e3->setPosition(10, 10);
|
||||
e3->setScale(4.0f);
|
||||
//e3->itex = &Resources::game->textures[0];
|
||||
//e3->sprite.setTexture(e3->itex->texture);
|
||||
//e3->sprite_index = 84;
|
||||
//e3->sprite.setTextureRect(e3->itex->spriteCoordinates(e3->sprite_index));
|
||||
//e3->setPosition(10, 10);
|
||||
//e3->setScale(4.0f);
|
||||
|
||||
e1aa->children->push_back(e3);
|
||||
|
||||
|
||||
|
||||
auto e4 = std::make_shared<UISprite>(
|
||||
indextex, //&Resources::game->textures[0],
|
||||
ptex, //indextex, //&Resources::game->textures[0],
|
||||
85, sf::Vector2f(90, 10), 4.0);
|
||||
e1aa->children->push_back(e4);
|
||||
//std::cout << "UISprite built: " << e4->sprite.getPosition().x << " " << e4->sprite.getPosition().y << " " << e4->sprite.getScale().x << " " <<
|
||||
|
@ -104,9 +104,9 @@ UITestScene::UITestScene(GameEngine* g) : Scene(g)
|
|||
std::cout << "pointer to ui_elements now shows size=" << ui->size() << std::endl;
|
||||
*/
|
||||
|
||||
// UIGrid test: (in grid cells) (in screen pixels)
|
||||
// constructor args: w h texture x y w h
|
||||
auto e5 = std::make_shared<UIGrid>(4, 4, indextex, 550, 150, 200, 200);
|
||||
// UIGrid test: (in grid cells) ( in screen pixels )
|
||||
// constructor args: w h texture x y w h
|
||||
auto e5 = std::make_shared<UIGrid>(4, 4, ptex, sf::Vector2f(550, 150), sf::Vector2f(200, 200));
|
||||
e5->zoom=2.0;
|
||||
e5->points[0].color = sf::Color(255, 0, 0);
|
||||
e5->points[1].tilesprite = 1;
|
||||
|
@ -125,7 +125,7 @@ UITestScene::UITestScene(GameEngine* g) : Scene(g)
|
|||
e5a->grid = e5;
|
||||
//auto e5as = UISprite(indextex, 85, sf::Vector2f(0, 0), 1.0);
|
||||
//e5a->sprite = e5as; // will copy constructor even exist for UISprite...?
|
||||
e5a->sprite = UISprite(indextex, 85, sf::Vector2f(0, 0), 1.0);
|
||||
e5a->sprite = UISprite(ptex, 85, sf::Vector2f(0, 0), 1.0);
|
||||
e5a->position = sf::Vector2f(1, 0);
|
||||
|
||||
e5->entities->push_back(e5a);
|
||||
|
@ -154,7 +154,7 @@ void UITestScene::doAction(std::string name, std::string type)
|
|||
*/
|
||||
}
|
||||
|
||||
void UITestScene::sRender()
|
||||
void UITestScene::render()
|
||||
{
|
||||
game->getWindow().clear();
|
||||
game->getWindow().draw(text);
|
||||
|
|
|
@ -18,5 +18,5 @@ public:
|
|||
UITestScene(GameEngine*);
|
||||
void update() override final;
|
||||
void doAction(std::string, std::string) override final;
|
||||
void sRender() override final;
|
||||
void render() override final;
|
||||
};
|
||||
|
|
|
@ -1,7 +1,7 @@
|
|||
import mcrfpy
|
||||
mcrfpy.createScene("play")
|
||||
ui = mcrfpy.sceneUI("play")
|
||||
t = mcrfpy.Texture("assets/kenney_tinydungeon.png", 16, 12, 11)
|
||||
t = mcrfpy.Texture("assets/kenney_tinydungeon.png", 16, 16) # 12, 11)
|
||||
font = mcrfpy.Font("assets/JetbrainsMono.ttf")
|
||||
|
||||
frame_color = (64, 64, 128)
|
||||
|
|
|
@ -1,221 +1,60 @@
|
|||
#print("Hello mcrogueface")
|
||||
import mcrfpy
|
||||
import cos_play
|
||||
# Universal stuff
|
||||
font = mcrfpy.Font("assets/JetbrainsMono.ttf")
|
||||
texture = mcrfpy.Texture("assets/kenney_tinydungeon.png", 16, 12, 11)
|
||||
texture_cold = mcrfpy.Texture("assets/kenney_ice.png", 16, 12, 11)
|
||||
texture_hot = mcrfpy.Texture("assets/kenney_lava.png", 16, 12, 11)
|
||||
texture = mcrfpy.Texture("assets/kenney_tinydungeon.png", 16, 16)
|
||||
|
||||
# Test stuff
|
||||
mcrfpy.createScene("boom")
|
||||
mcrfpy.setScene("boom")
|
||||
ui = mcrfpy.sceneUI("boom")
|
||||
box = mcrfpy.Frame(40, 60, 200, 300, fill_color=(255,128,0), outline=4.0, outline_color=(64,64,255,96))
|
||||
ui.append(box)
|
||||
print("[game.py] Default texture:")
|
||||
print(mcrfpy.default_texture)
|
||||
print(type(mcrfpy.default_texture))
|
||||
|
||||
#caption = mcrfpy.Caption(10, 10, "Clicky", font, (255, 255, 255, 255), (0, 0, 0, 255))
|
||||
#box.click = lambda x, y, btn, type: print("Hello callback: ", x, y, btn, type)
|
||||
#box.children.append(caption)
|
||||
# build test widgets
|
||||
|
||||
test_sprite_number = 86
|
||||
sprite = mcrfpy.Sprite(20, 60, texture, test_sprite_number, 4.0)
|
||||
spritecap = mcrfpy.Caption(5, 5, "60", font)
|
||||
def click_sprite(x, y, btn, action):
|
||||
global test_sprite_number
|
||||
if action != "start": return
|
||||
if btn in ("left", "wheel_up"):
|
||||
test_sprite_number -= 1
|
||||
elif btn in ("right", "wheel_down"):
|
||||
test_sprite_number += 1
|
||||
sprite.sprite_number = test_sprite_number # TODO - inconsistent naming for __init__, __repr__ and getsetter: sprite_number vs sprite_index
|
||||
spritecap.text = test_sprite_number
|
||||
mcrfpy.createScene("pytest")
|
||||
mcrfpy.setScene("pytest")
|
||||
ui = mcrfpy.sceneUI("pytest")
|
||||
|
||||
sprite.click = click_sprite # TODO - sprites don't seem to correct for screen position or scale when clicking
|
||||
box.children.append(sprite)
|
||||
box.children.append(spritecap)
|
||||
box.click = click_sprite
|
||||
# Frame
|
||||
f = mcrfpy.Frame(25, 19, 462, 346, fill_color=(255, 92, 92))
|
||||
print("Frame alive")
|
||||
# fill (LinkedColor / Color): f.fill_color
|
||||
# outline (LinkedColor / Color): f.outline_color
|
||||
# pos (LinkedVector / Vector): f.pos
|
||||
# size (LinkedVector / Vector): f.size
|
||||
|
||||
f_a = mcrfpy.Frame(250, 60, 80, 80, fill_color=(255, 92, 92))
|
||||
f_a_txt = mcrfpy.Caption(5, 5, "0", font)
|
||||
# Caption
|
||||
print("Caption attempt w/ fill_color:")
|
||||
#c = mcrfpy.Caption(512+25, 19, "Hi.", font)
|
||||
#c = mcrfpy.Caption(512+25, 19, "Hi.", font, fill_color=(255, 128, 128))
|
||||
c = mcrfpy.Caption(512+25, 19, "Hi.", font, fill_color=mcrfpy.Color(255, 128, 128), outline_color=(128, 255, 128))
|
||||
print("Caption alive")
|
||||
# fill (LinkedColor / Color): c.fill_color
|
||||
#color_val = c.fill_color
|
||||
print(c.fill_color)
|
||||
#print("Set a fill color")
|
||||
#c.fill_color = (255, 255, 255)
|
||||
print("Lol, did it segfault?")
|
||||
# outline (LinkedColor / Color): c.outline_color
|
||||
# font (Font): c.font
|
||||
# pos (LinkedVector / Vector): c.pos
|
||||
|
||||
f_b = mcrfpy.Frame(340, 60, 80, 80, fill_color=(92, 255, 92))
|
||||
f_b_txt = mcrfpy.Caption(5, 5, "0", font)
|
||||
# Sprite
|
||||
s = mcrfpy.Sprite(25, 384+19, texture, 86, 9.0)
|
||||
# pos (LinkedVector / Vector): s.pos
|
||||
# texture (Texture): s.texture
|
||||
|
||||
f_c = mcrfpy.Frame(430, 60, 80, 80, fill_color=(92, 92, 255))
|
||||
f_c_txt = mcrfpy.Caption(5, 5, "0", font)
|
||||
# Grid
|
||||
g = mcrfpy.Grid(10, 10, texture, 512+25, 384+19, 462, 346)
|
||||
# texture (Texture): g.texture
|
||||
# pos (LinkedVector / Vector): g.pos
|
||||
# size (LinkedVector / Vector): g.size
|
||||
|
||||
for _x in range(10):
|
||||
for _y in range(10):
|
||||
g.at((_x, _y)).color = (255 - _x*25, 255 - _y*25, 255)
|
||||
g.zoom = 2.0
|
||||
|
||||
ui.append(f_a)
|
||||
f_a.children.append(f_a_txt)
|
||||
ui.append(f_b)
|
||||
f_b.children.append(f_b_txt)
|
||||
ui.append(f_c)
|
||||
f_c.children.append(f_c_txt)
|
||||
[ui.append(d) for d in (f, c, s, g)]
|
||||
|
||||
import sys
|
||||
def ding(*args):
|
||||
f_a_txt.text = str(sys.getrefcount(ding)) + " refs"
|
||||
f_b_txt.text = sys.getrefcount(dong)
|
||||
f_c_txt.text = sys.getrefcount(stress_test)
|
||||
print("built!")
|
||||
|
||||
def dong(*args):
|
||||
f_a_txt.text = str(sys.getrefcount(ding)) + " refs"
|
||||
f_b_txt.text = sys.getrefcount(dong)
|
||||
f_c_txt.text = sys.getrefcount(stress_test)
|
||||
# tests
|
||||
|
||||
running = False
|
||||
timers = []
|
||||
|
||||
def add_ding():
|
||||
global timers
|
||||
n = len(timers)
|
||||
mcrfpy.setTimer(f"timer{n}", ding, 100)
|
||||
print("+1 ding:", timers)
|
||||
|
||||
def add_dong():
|
||||
global timers
|
||||
n = len(timers)
|
||||
mcrfpy.setTimer(f"timer{n}", dong, 100)
|
||||
print("+1 dong:", timers)
|
||||
|
||||
def remove_random():
|
||||
global timers
|
||||
target = random.choice(timers)
|
||||
print("-1 timer:", target)
|
||||
print("remove from list")
|
||||
timers.remove(target)
|
||||
print("delTimer")
|
||||
mcrfpy.delTimer(target)
|
||||
print("done")
|
||||
|
||||
import random
|
||||
import time
|
||||
def stress_test(*args):
|
||||
global running
|
||||
global timers
|
||||
if not running:
|
||||
print("stress test initial")
|
||||
running = True
|
||||
timers.append("recurse")
|
||||
add_ding()
|
||||
add_dong()
|
||||
mcrfpy.setTimer("recurse", stress_test, 1000)
|
||||
mcrfpy.setTimer("terminate", lambda *args: mcrfpy.delTimer("recurse"), 30000)
|
||||
ding(); dong()
|
||||
else:
|
||||
#print("stress test random activity")
|
||||
#random.choice([
|
||||
# add_ding,
|
||||
# add_dong,
|
||||
# remove_random
|
||||
# ])()
|
||||
#print(timers)
|
||||
print("Segfaultin' time")
|
||||
mcrfpy.delTimer("recurse")
|
||||
print("Does this still work?")
|
||||
time.sleep(0.5)
|
||||
print("How about now?")
|
||||
|
||||
|
||||
stress_test()
|
||||
|
||||
|
||||
# Loading Screen
|
||||
mcrfpy.createScene("loading")
|
||||
ui = mcrfpy.sceneUI("loading")
|
||||
#mcrfpy.setScene("loading")
|
||||
logo_texture = mcrfpy.Texture("assets/temp_logo.png", 1024, 1, 1)
|
||||
logo_sprite = mcrfpy.Sprite(50, 50, logo_texture, 0, 0.5)
|
||||
ui.append(logo_sprite)
|
||||
logo_sprite.click = lambda *args: mcrfpy.setScene("menu")
|
||||
logo_caption = mcrfpy.Caption(70, 600, "Click to Proceed", font, (255, 0, 0, 255), (0, 0, 0, 255))
|
||||
logo_caption.fill_color =(255, 0, 0, 255)
|
||||
ui.append(logo_caption)
|
||||
|
||||
|
||||
# menu screen
|
||||
mcrfpy.createScene("menu")
|
||||
|
||||
for e in [
|
||||
mcrfpy.Caption(10, 10, "Crypt of Sokoban", font, (255, 255, 255), (0, 0, 0)),
|
||||
mcrfpy.Caption(20, 55, "a McRogueFace demo project", font, (192, 192, 192), (0, 0, 0)),
|
||||
mcrfpy.Frame(15, 70, 150, 60, fill_color=(64, 64, 128)),
|
||||
mcrfpy.Frame(15, 145, 150, 60, fill_color=(64, 64, 128)),
|
||||
mcrfpy.Frame(15, 220, 150, 60, fill_color=(64, 64, 128)),
|
||||
mcrfpy.Frame(15, 295, 150, 60, fill_color=(64, 64, 128)),
|
||||
#mcrfpy.Frame(900, 10, 100, 100, fill_color=(255, 0, 0)),
|
||||
]:
|
||||
mcrfpy.sceneUI("menu").append(e)
|
||||
|
||||
def click_once(fn):
|
||||
def wraps(*args, **kwargs):
|
||||
#print(args)
|
||||
action = args[3]
|
||||
if action != "start": return
|
||||
return fn(*args, **kwargs)
|
||||
return wraps
|
||||
|
||||
@click_once
|
||||
def asdf(x, y, btn, action):
|
||||
print(f"clicky @({x},{y}) {action}->{btn}")
|
||||
|
||||
@click_once
|
||||
def clicked_exit(*args):
|
||||
mcrfpy.exit()
|
||||
|
||||
menu_btns = [
|
||||
("Boom", lambda *args: 1 / 0),
|
||||
("Exit", clicked_exit),
|
||||
("About", lambda *args: mcrfpy.setScene("about")),
|
||||
("Settings", lambda *args: mcrfpy.setScene("settings")),
|
||||
("Start", lambda *args: mcrfpy.setScene("play"))
|
||||
]
|
||||
for i in range(len(mcrfpy.sceneUI("menu"))):
|
||||
e = mcrfpy.sceneUI("menu")[i] # TODO - fix iterator
|
||||
#print(e, type(e))
|
||||
if type(e) is not mcrfpy.Frame: continue
|
||||
label, fn = menu_btns.pop()
|
||||
#print(label)
|
||||
e.children.append(mcrfpy.Caption(5, 5, label, font, (192, 192, 255), (0,0,0)))
|
||||
e.click = fn
|
||||
|
||||
|
||||
# settings screen
|
||||
mcrfpy.createScene("settings")
|
||||
window_scaling = 1.0
|
||||
|
||||
scale_caption = mcrfpy.Caption(180, 70, "1.0x", font, (255, 255, 255), (0, 0, 0))
|
||||
scale_caption.fill_color = (255, 255, 255) # TODO - mcrfpy.Caption.__init__ is not setting colors
|
||||
for e in [
|
||||
mcrfpy.Caption(10, 10, "Settings", font, (255, 255, 255), (0, 0, 0)),
|
||||
mcrfpy.Frame(15, 70, 150, 60, fill_color=(64, 64, 128)), # +
|
||||
mcrfpy.Frame(300, 70, 150, 60, fill_color=(64, 64, 128)), # -
|
||||
mcrfpy.Frame(15, 295, 150, 60, fill_color=(64, 64, 128)),
|
||||
scale_caption,
|
||||
]:
|
||||
mcrfpy.sceneUI("settings").append(e)
|
||||
|
||||
@click_once
|
||||
def game_scale(x, y, btn, action, delta):
|
||||
global window_scaling
|
||||
print(f"WIP - scale the window from {window_scaling:.1f} to {window_scaling+delta:.1f}")
|
||||
window_scaling += delta
|
||||
scale_caption.text = f"{window_scaling:.1f}x"
|
||||
mcrfpy.setScale(window_scaling)
|
||||
#mcrfpy.setScale(2)
|
||||
|
||||
settings_btns = [
|
||||
("back", lambda *args: mcrfpy.setScene("menu")),
|
||||
("-", lambda x, y, btn, action: game_scale(x, y, btn, action, -0.1)),
|
||||
("+", lambda x, y, btn, action: game_scale(x, y, btn, action, +0.1))
|
||||
]
|
||||
|
||||
for i in range(len(mcrfpy.sceneUI("settings"))):
|
||||
e = mcrfpy.sceneUI("settings")[i] # TODO - fix iterator
|
||||
#print(e, type(e))
|
||||
if type(e) is not mcrfpy.Frame: continue
|
||||
label, fn = settings_btns.pop()
|
||||
#print(label, fn)
|
||||
e.children.append(mcrfpy.Caption(5, 5, label, font, (192, 192, 255), (0,0,0)))
|
||||
e.click = fn
|
||||
|
|
|
@ -0,0 +1,221 @@
|
|||
#print("Hello mcrogueface")
|
||||
import mcrfpy
|
||||
import cos_play
|
||||
# Universal stuff
|
||||
font = mcrfpy.Font("assets/JetbrainsMono.ttf")
|
||||
texture = mcrfpy.Texture("assets/kenney_tinydungeon.png", 16, 16) #12, 11)
|
||||
texture_cold = mcrfpy.Texture("assets/kenney_ice.png", 16, 16) #12, 11)
|
||||
texture_hot = mcrfpy.Texture("assets/kenney_lava.png", 16, 16) #12, 11)
|
||||
|
||||
# Test stuff
|
||||
mcrfpy.createScene("boom")
|
||||
mcrfpy.setScene("boom")
|
||||
ui = mcrfpy.sceneUI("boom")
|
||||
box = mcrfpy.Frame(40, 60, 200, 300, fill_color=(255,128,0), outline=4.0, outline_color=(64,64,255,96))
|
||||
ui.append(box)
|
||||
|
||||
#caption = mcrfpy.Caption(10, 10, "Clicky", font, (255, 255, 255, 255), (0, 0, 0, 255))
|
||||
#box.click = lambda x, y, btn, type: print("Hello callback: ", x, y, btn, type)
|
||||
#box.children.append(caption)
|
||||
|
||||
test_sprite_number = 86
|
||||
sprite = mcrfpy.Sprite(20, 60, texture, test_sprite_number, 4.0)
|
||||
spritecap = mcrfpy.Caption(5, 5, "60", font)
|
||||
def click_sprite(x, y, btn, action):
|
||||
global test_sprite_number
|
||||
if action != "start": return
|
||||
if btn in ("left", "wheel_up"):
|
||||
test_sprite_number -= 1
|
||||
elif btn in ("right", "wheel_down"):
|
||||
test_sprite_number += 1
|
||||
sprite.sprite_number = test_sprite_number # TODO - inconsistent naming for __init__, __repr__ and getsetter: sprite_number vs sprite_index
|
||||
spritecap.text = test_sprite_number
|
||||
|
||||
sprite.click = click_sprite # TODO - sprites don't seem to correct for screen position or scale when clicking
|
||||
box.children.append(sprite)
|
||||
box.children.append(spritecap)
|
||||
box.click = click_sprite
|
||||
|
||||
f_a = mcrfpy.Frame(250, 60, 80, 80, fill_color=(255, 92, 92))
|
||||
f_a_txt = mcrfpy.Caption(5, 5, "0", font)
|
||||
|
||||
f_b = mcrfpy.Frame(340, 60, 80, 80, fill_color=(92, 255, 92))
|
||||
f_b_txt = mcrfpy.Caption(5, 5, "0", font)
|
||||
|
||||
f_c = mcrfpy.Frame(430, 60, 80, 80, fill_color=(92, 92, 255))
|
||||
f_c_txt = mcrfpy.Caption(5, 5, "0", font)
|
||||
|
||||
|
||||
ui.append(f_a)
|
||||
f_a.children.append(f_a_txt)
|
||||
ui.append(f_b)
|
||||
f_b.children.append(f_b_txt)
|
||||
ui.append(f_c)
|
||||
f_c.children.append(f_c_txt)
|
||||
|
||||
import sys
|
||||
def ding(*args):
|
||||
f_a_txt.text = str(sys.getrefcount(ding)) + " refs"
|
||||
f_b_txt.text = sys.getrefcount(dong)
|
||||
f_c_txt.text = sys.getrefcount(stress_test)
|
||||
|
||||
def dong(*args):
|
||||
f_a_txt.text = str(sys.getrefcount(ding)) + " refs"
|
||||
f_b_txt.text = sys.getrefcount(dong)
|
||||
f_c_txt.text = sys.getrefcount(stress_test)
|
||||
|
||||
running = False
|
||||
timers = []
|
||||
|
||||
def add_ding():
|
||||
global timers
|
||||
n = len(timers)
|
||||
mcrfpy.setTimer(f"timer{n}", ding, 100)
|
||||
print("+1 ding:", timers)
|
||||
|
||||
def add_dong():
|
||||
global timers
|
||||
n = len(timers)
|
||||
mcrfpy.setTimer(f"timer{n}", dong, 100)
|
||||
print("+1 dong:", timers)
|
||||
|
||||
def remove_random():
|
||||
global timers
|
||||
target = random.choice(timers)
|
||||
print("-1 timer:", target)
|
||||
print("remove from list")
|
||||
timers.remove(target)
|
||||
print("delTimer")
|
||||
mcrfpy.delTimer(target)
|
||||
print("done")
|
||||
|
||||
import random
|
||||
import time
|
||||
def stress_test(*args):
|
||||
global running
|
||||
global timers
|
||||
if not running:
|
||||
print("stress test initial")
|
||||
running = True
|
||||
timers.append("recurse")
|
||||
add_ding()
|
||||
add_dong()
|
||||
mcrfpy.setTimer("recurse", stress_test, 1000)
|
||||
mcrfpy.setTimer("terminate", lambda *args: mcrfpy.delTimer("recurse"), 30000)
|
||||
ding(); dong()
|
||||
else:
|
||||
#print("stress test random activity")
|
||||
#random.choice([
|
||||
# add_ding,
|
||||
# add_dong,
|
||||
# remove_random
|
||||
# ])()
|
||||
#print(timers)
|
||||
print("Segfaultin' time")
|
||||
mcrfpy.delTimer("recurse")
|
||||
print("Does this still work?")
|
||||
time.sleep(0.5)
|
||||
print("How about now?")
|
||||
|
||||
|
||||
stress_test()
|
||||
|
||||
|
||||
# Loading Screen
|
||||
mcrfpy.createScene("loading")
|
||||
ui = mcrfpy.sceneUI("loading")
|
||||
#mcrfpy.setScene("loading")
|
||||
logo_texture = mcrfpy.Texture("assets/temp_logo.png", 1024, 1024)#1, 1)
|
||||
logo_sprite = mcrfpy.Sprite(50, 50, logo_texture, 0, 0.5)
|
||||
ui.append(logo_sprite)
|
||||
logo_sprite.click = lambda *args: mcrfpy.setScene("menu")
|
||||
logo_caption = mcrfpy.Caption(70, 600, "Click to Proceed", font, (255, 0, 0, 255), (0, 0, 0, 255))
|
||||
#logo_caption.fill_color =(255, 0, 0, 255)
|
||||
ui.append(logo_caption)
|
||||
|
||||
|
||||
# menu screen
|
||||
mcrfpy.createScene("menu")
|
||||
|
||||
for e in [
|
||||
mcrfpy.Caption(10, 10, "Crypt of Sokoban", font, (255, 255, 255), (0, 0, 0)),
|
||||
mcrfpy.Caption(20, 55, "a McRogueFace demo project", font, (192, 192, 192), (0, 0, 0)),
|
||||
mcrfpy.Frame(15, 70, 150, 60, fill_color=(64, 64, 128)),
|
||||
mcrfpy.Frame(15, 145, 150, 60, fill_color=(64, 64, 128)),
|
||||
mcrfpy.Frame(15, 220, 150, 60, fill_color=(64, 64, 128)),
|
||||
mcrfpy.Frame(15, 295, 150, 60, fill_color=(64, 64, 128)),
|
||||
#mcrfpy.Frame(900, 10, 100, 100, fill_color=(255, 0, 0)),
|
||||
]:
|
||||
mcrfpy.sceneUI("menu").append(e)
|
||||
|
||||
def click_once(fn):
|
||||
def wraps(*args, **kwargs):
|
||||
#print(args)
|
||||
action = args[3]
|
||||
if action != "start": return
|
||||
return fn(*args, **kwargs)
|
||||
return wraps
|
||||
|
||||
@click_once
|
||||
def asdf(x, y, btn, action):
|
||||
print(f"clicky @({x},{y}) {action}->{btn}")
|
||||
|
||||
@click_once
|
||||
def clicked_exit(*args):
|
||||
mcrfpy.exit()
|
||||
|
||||
menu_btns = [
|
||||
("Boom", lambda *args: 1 / 0),
|
||||
("Exit", clicked_exit),
|
||||
("About", lambda *args: mcrfpy.setScene("about")),
|
||||
("Settings", lambda *args: mcrfpy.setScene("settings")),
|
||||
("Start", lambda *args: mcrfpy.setScene("play"))
|
||||
]
|
||||
for i in range(len(mcrfpy.sceneUI("menu"))):
|
||||
e = mcrfpy.sceneUI("menu")[i] # TODO - fix iterator
|
||||
#print(e, type(e))
|
||||
if type(e) is not mcrfpy.Frame: continue
|
||||
label, fn = menu_btns.pop()
|
||||
#print(label)
|
||||
e.children.append(mcrfpy.Caption(5, 5, label, font, (192, 192, 255), (0,0,0)))
|
||||
e.click = fn
|
||||
|
||||
|
||||
# settings screen
|
||||
mcrfpy.createScene("settings")
|
||||
window_scaling = 1.0
|
||||
|
||||
scale_caption = mcrfpy.Caption(180, 70, "1.0x", font, (255, 255, 255), (0, 0, 0))
|
||||
#scale_caption.fill_color = (255, 255, 255) # TODO - mcrfpy.Caption.__init__ is not setting colors
|
||||
for e in [
|
||||
mcrfpy.Caption(10, 10, "Settings", font, (255, 255, 255), (0, 0, 0)),
|
||||
mcrfpy.Frame(15, 70, 150, 60, fill_color=(64, 64, 128)), # +
|
||||
mcrfpy.Frame(300, 70, 150, 60, fill_color=(64, 64, 128)), # -
|
||||
mcrfpy.Frame(15, 295, 150, 60, fill_color=(64, 64, 128)),
|
||||
scale_caption,
|
||||
]:
|
||||
mcrfpy.sceneUI("settings").append(e)
|
||||
|
||||
@click_once
|
||||
def game_scale(x, y, btn, action, delta):
|
||||
global window_scaling
|
||||
print(f"WIP - scale the window from {window_scaling:.1f} to {window_scaling+delta:.1f}")
|
||||
window_scaling += delta
|
||||
scale_caption.text = f"{window_scaling:.1f}x"
|
||||
mcrfpy.setScale(window_scaling)
|
||||
#mcrfpy.setScale(2)
|
||||
|
||||
settings_btns = [
|
||||
("back", lambda *args: mcrfpy.setScene("menu")),
|
||||
("-", lambda x, y, btn, action: game_scale(x, y, btn, action, -0.1)),
|
||||
("+", lambda x, y, btn, action: game_scale(x, y, btn, action, +0.1))
|
||||
]
|
||||
|
||||
for i in range(len(mcrfpy.sceneUI("settings"))):
|
||||
e = mcrfpy.sceneUI("settings")[i] # TODO - fix iterator
|
||||
#print(e, type(e))
|
||||
if type(e) is not mcrfpy.Frame: continue
|
||||
label, fn = settings_btns.pop()
|
||||
#print(label, fn)
|
||||
e.children.append(mcrfpy.Caption(5, 5, label, font, (192, 192, 255), (0,0,0)))
|
||||
e.click = fn
|
|
@ -0,0 +1,168 @@
|
|||
Red #ED0A3F
|
||||
Maroon #C32148
|
||||
Scarlet #FD0E35
|
||||
Brick Red #C62D42
|
||||
English Vermilion #CC474B
|
||||
Madder Lake #CC3336
|
||||
Permanent Geranium Lake #E12C2C
|
||||
Maximum Red #D92121
|
||||
Chestnut #B94E48
|
||||
Orange-Red #FF5349
|
||||
Sunset Orange #FE4C40
|
||||
Bittersweet #FE6F5E
|
||||
Dark Venetian Red #B33B24
|
||||
Venetian Red #CC553D
|
||||
Light Venetian Red #E6735C
|
||||
Vivid Tangerine #FF9980
|
||||
Middle Red #E58E73
|
||||
Burnt Orange #FF7034
|
||||
Red-Orange #FF3F34
|
||||
Orange #FF8833
|
||||
Macaroni and Cheese #FFB97B
|
||||
Middle Yellow Red #ECAC76
|
||||
Mango Tango #E77200
|
||||
Yellow-Orange #FFAE42
|
||||
Maximum Yellow Red #F2BA49
|
||||
Banana Mania #FBE7B2
|
||||
Maize #F2C649
|
||||
Orange-Yellow #F8D568
|
||||
Goldenrod #FCD667
|
||||
Dandelion #FED85D
|
||||
Yellow #FBE870
|
||||
Green-Yellow #F1E788
|
||||
Middle Yellow #FFEB00
|
||||
Olive Green #B5B35C
|
||||
Spring Green #ECEBBD
|
||||
Maximum Yellow #FAFA37
|
||||
Canary #FFFF99
|
||||
Lemon Yellow #FFFF9F
|
||||
Maximum Green Yellow #D9E650
|
||||
Middle Green Yellow #ACBF60
|
||||
Inchworm #B0E313
|
||||
Light Chrome Green #BEE64B
|
||||
Yellow-Green #C5E17A
|
||||
Maximum Green #5E8C31
|
||||
Asparagus #7BA05B
|
||||
Granny Smith Apple #9DE093
|
||||
Fern #63B76C
|
||||
Middle Green #4D8C57
|
||||
Green #01A638
|
||||
Medium Chrome Green #6CA67C
|
||||
Forest Green #5FA777
|
||||
Sea Green #93DFB8
|
||||
Shamrock #33CC99
|
||||
Mountain Meadow #1AB385
|
||||
Jungle Green #29AB87
|
||||
Caribbean Green #00CC99
|
||||
Tropical Rain Forest #00755E
|
||||
Middle Blue Green #8DD9CC
|
||||
Pine Green #01796F
|
||||
Maximum Blue Green #30BFBF
|
||||
Robin's Egg Blue #00CCCC
|
||||
Teal Blue #008080
|
||||
Light Blue #8FD8D8
|
||||
Aquamarine #458B74
|
||||
Turquoise Blue #6CDAE7
|
||||
Outer Space #2D383A
|
||||
Sky Blue #76D7EA
|
||||
Middle Blue #7ED4E6
|
||||
Blue-Green #0095B7
|
||||
Pacific Blue #009DC4
|
||||
Cerulean #02A4D3
|
||||
Maximum Blue #47ABCC
|
||||
Blue (I) #2EB4E6
|
||||
Cerulean Blue #339ACC
|
||||
Cornflower #93CCEA
|
||||
Green-Blue #2887C8
|
||||
Midnight Blue #003366
|
||||
Navy Blue #0066CC
|
||||
Denim #1560BD
|
||||
Blue (III) #0066FF
|
||||
Cadet Blue #A9B2C3
|
||||
Periwinkle #C3CDE6
|
||||
Blue (II) #4570E6
|
||||
Bluetiful #3C69E7
|
||||
Wild Blue Yonder #7A89B8
|
||||
Indigo #4F69C6
|
||||
Manatee #8D90A1
|
||||
Cobalt Blue #8C90C8
|
||||
Celestial Blue #7070CC
|
||||
Blue Bell #9999CC
|
||||
Maximum Blue Purple #ACACE6
|
||||
Violet-Blue #766EC8
|
||||
Blue-Violet #6456B7
|
||||
Ultramarine Blue #3F26BF
|
||||
Middle Blue Purple #8B72BE
|
||||
Purple Heart #652DC1
|
||||
Royal Purple #6B3FA0
|
||||
Violet (II) #8359A3
|
||||
Medium Violet #8F47B3
|
||||
Wisteria #C9A0DC
|
||||
Lavender (I) #BF8FCC
|
||||
Vivid Violet #803790
|
||||
Maximum Purple #733380
|
||||
Purple Mountains' Majesty #D6AEDD
|
||||
Fuchsia #C154C1
|
||||
Pink Flamingo #F2583E
|
||||
Violet (I) #732E6C
|
||||
Brilliant Rose #E667CE
|
||||
Orchid #E29CD2
|
||||
Plum #843179
|
||||
Medium Rose #D96CBE
|
||||
Thistle #D8BFD8
|
||||
Mulberry #C8509B
|
||||
Red-Violet #BB3385
|
||||
Middle Purple #D982B5
|
||||
Maximum Red Purple #A63A79
|
||||
Jazzberry Jam #A50B5E
|
||||
Eggplant #614051
|
||||
Magenta #F653A6
|
||||
Cerise #DA3287
|
||||
Wild Strawberry #FF3399
|
||||
Lavender (II) #FBAED2
|
||||
Cotton Candy #FFB7D5
|
||||
Carnation Pink #FFA6C9
|
||||
Violet-Red #F7468A
|
||||
Razzmatazz #E30B5C
|
||||
Piggy Pink #FDD7E4
|
||||
Carmine #E62E6B
|
||||
Blush #DB5079
|
||||
Tickle Me Pink #FC80A5
|
||||
Mauvelous #F091A9
|
||||
Salmon #FF91A4
|
||||
Middle Red Purple #A55353
|
||||
Mahogany #CA3435
|
||||
Melon #FEBAAD
|
||||
Pink Sherbert #F7A38E
|
||||
Burnt Sienna #E97451
|
||||
Brown #AF593E
|
||||
Sepia #9E5B40
|
||||
Fuzzy Wuzzy #87421F
|
||||
Beaver #926F5B
|
||||
Tumbleweed #DEA681
|
||||
Raw Sienna #D27D46
|
||||
Van Dyke Brown #664228
|
||||
Tan #FA9D5A
|
||||
Desert Sand #EDC9AF
|
||||
Peach #FFCBA4
|
||||
Burnt Umber #805533
|
||||
Apricot #FDD5B1
|
||||
Almond #EED9C4
|
||||
Raw Umber #665233
|
||||
Shadow #837050
|
||||
Raw Sienna (I) #E6BC5C
|
||||
Gold (I) #92926E
|
||||
Gold (II) #E6BE8A
|
||||
Silver #C9C0BB
|
||||
Copper #DA8A67
|
||||
Antique Brass #C88A65
|
||||
Black #000000
|
||||
Charcoal Gray #736A62
|
||||
Gray #8B8680
|
||||
Blue-Gray #C8C8CD
|
||||
Timberwolf #D9D6CF
|
||||
White #FFFFFF
|
||||
Crayellow #F1D651[6]
|
||||
Cool Mint #DDEBEC[6]
|
||||
Oatmeal #D9DAD2[6]
|
||||
Powder Blue #C0D5F0[6]
|
|
@ -0,0 +1,949 @@
|
|||
cloudy blue #acc2d9
|
||||
dark pastel green #56ae57
|
||||
dust #b2996e
|
||||
electric lime #a8ff04
|
||||
fresh green #69d84f
|
||||
light eggplant #894585
|
||||
nasty green #70b23f
|
||||
really light blue #d4ffff
|
||||
tea #65ab7c
|
||||
warm purple #952e8f
|
||||
yellowish tan #fcfc81
|
||||
cement #a5a391
|
||||
dark grass green #388004
|
||||
dusty teal #4c9085
|
||||
grey teal #5e9b8a
|
||||
macaroni and cheese #efb435
|
||||
pinkish tan #d99b82
|
||||
spruce #0a5f38
|
||||
strong blue #0c06f7
|
||||
toxic green #61de2a
|
||||
windows blue #3778bf
|
||||
blue blue #2242c7
|
||||
blue with a hint of purple #533cc6
|
||||
booger #9bb53c
|
||||
bright sea green #05ffa6
|
||||
dark green blue #1f6357
|
||||
deep turquoise #017374
|
||||
green teal #0cb577
|
||||
strong pink #ff0789
|
||||
bland #afa88b
|
||||
deep aqua #08787f
|
||||
lavender pink #dd85d7
|
||||
light moss green #a6c875
|
||||
light seafoam green #a7ffb5
|
||||
olive yellow #c2b709
|
||||
pig pink #e78ea5
|
||||
deep lilac #966ebd
|
||||
desert #ccad60
|
||||
dusty lavender #ac86a8
|
||||
purpley grey #947e94
|
||||
purply #983fb2
|
||||
candy pink #ff63e9
|
||||
light pastel green #b2fba5
|
||||
boring green #63b365
|
||||
kiwi green #8ee53f
|
||||
light grey green #b7e1a1
|
||||
orange pink #ff6f52
|
||||
tea green #bdf8a3
|
||||
very light brown #d3b683
|
||||
egg shell #fffcc4
|
||||
eggplant purple #430541
|
||||
powder pink #ffb2d0
|
||||
reddish grey #997570
|
||||
baby shit brown #ad900d
|
||||
liliac #c48efd
|
||||
stormy blue #507b9c
|
||||
ugly brown #7d7103
|
||||
custard #fffd78
|
||||
darkish pink #da467d
|
||||
deep brown #410200
|
||||
greenish beige #c9d179
|
||||
manilla #fffa86
|
||||
off blue #5684ae
|
||||
battleship grey #6b7c85
|
||||
browny green #6f6c0a
|
||||
bruise #7e4071
|
||||
kelley green #009337
|
||||
sickly yellow #d0e429
|
||||
sunny yellow #fff917
|
||||
azul #1d5dec
|
||||
darkgreen #054907
|
||||
green/yellow #b5ce08
|
||||
lichen #8fb67b
|
||||
light light green #c8ffb0
|
||||
pale gold #fdde6c
|
||||
sun yellow #ffdf22
|
||||
tan green #a9be70
|
||||
burple #6832e3
|
||||
butterscotch #fdb147
|
||||
toupe #c7ac7d
|
||||
dark cream #fff39a
|
||||
indian red #850e04
|
||||
light lavendar #efc0fe
|
||||
poison green #40fd14
|
||||
baby puke green #b6c406
|
||||
bright yellow green #9dff00
|
||||
charcoal grey #3c4142
|
||||
squash #f2ab15
|
||||
cinnamon #ac4f06
|
||||
light pea green #c4fe82
|
||||
radioactive green #2cfa1f
|
||||
raw sienna #9a6200
|
||||
baby purple #ca9bf7
|
||||
cocoa #875f42
|
||||
light royal blue #3a2efe
|
||||
orangeish #fd8d49
|
||||
rust brown #8b3103
|
||||
sand brown #cba560
|
||||
swamp #698339
|
||||
tealish green #0cdc73
|
||||
burnt siena #b75203
|
||||
camo #7f8f4e
|
||||
dusk blue #26538d
|
||||
fern #63a950
|
||||
old rose #c87f89
|
||||
pale light green #b1fc99
|
||||
peachy pink #ff9a8a
|
||||
rosy pink #f6688e
|
||||
light bluish green #76fda8
|
||||
light bright green #53fe5c
|
||||
light neon green #4efd54
|
||||
light seafoam #a0febf
|
||||
tiffany blue #7bf2da
|
||||
washed out green #bcf5a6
|
||||
browny orange #ca6b02
|
||||
nice blue #107ab0
|
||||
sapphire #2138ab
|
||||
greyish teal #719f91
|
||||
orangey yellow #fdb915
|
||||
parchment #fefcaf
|
||||
straw #fcf679
|
||||
very dark brown #1d0200
|
||||
terracota #cb6843
|
||||
ugly blue #31668a
|
||||
clear blue #247afd
|
||||
creme #ffffb6
|
||||
foam green #90fda9
|
||||
grey/green #86a17d
|
||||
light gold #fddc5c
|
||||
seafoam blue #78d1b6
|
||||
topaz #13bbaf
|
||||
violet pink #fb5ffc
|
||||
wintergreen #20f986
|
||||
yellow tan #ffe36e
|
||||
dark fuchsia #9d0759
|
||||
indigo blue #3a18b1
|
||||
light yellowish green #c2ff89
|
||||
pale magenta #d767ad
|
||||
rich purple #720058
|
||||
sunflower yellow #ffda03
|
||||
green/blue #01c08d
|
||||
leather #ac7434
|
||||
racing green #014600
|
||||
vivid purple #9900fa
|
||||
dark royal blue #02066f
|
||||
hazel #8e7618
|
||||
muted pink #d1768f
|
||||
booger green #96b403
|
||||
canary #fdff63
|
||||
cool grey #95a3a6
|
||||
dark taupe #7f684e
|
||||
darkish purple #751973
|
||||
true green #089404
|
||||
coral pink #ff6163
|
||||
dark sage #598556
|
||||
dark slate blue #214761
|
||||
flat blue #3c73a8
|
||||
mushroom #ba9e88
|
||||
rich blue #021bf9
|
||||
dirty purple #734a65
|
||||
greenblue #23c48b
|
||||
icky green #8fae22
|
||||
light khaki #e6f2a2
|
||||
warm blue #4b57db
|
||||
dark hot pink #d90166
|
||||
deep sea blue #015482
|
||||
carmine #9d0216
|
||||
dark yellow green #728f02
|
||||
pale peach #ffe5ad
|
||||
plum purple #4e0550
|
||||
golden rod #f9bc08
|
||||
neon red #ff073a
|
||||
old pink #c77986
|
||||
very pale blue #d6fffe
|
||||
blood orange #fe4b03
|
||||
grapefruit #fd5956
|
||||
sand yellow #fce166
|
||||
clay brown #b2713d
|
||||
dark blue grey #1f3b4d
|
||||
flat green #699d4c
|
||||
light green blue #56fca2
|
||||
warm pink #fb5581
|
||||
dodger blue #3e82fc
|
||||
gross green #a0bf16
|
||||
ice #d6fffa
|
||||
metallic blue #4f738e
|
||||
pale salmon #ffb19a
|
||||
sap green #5c8b15
|
||||
algae #54ac68
|
||||
bluey grey #89a0b0
|
||||
greeny grey #7ea07a
|
||||
highlighter green #1bfc06
|
||||
light light blue #cafffb
|
||||
light mint #b6ffbb
|
||||
raw umber #a75e09
|
||||
vivid blue #152eff
|
||||
deep lavender #8d5eb7
|
||||
dull teal #5f9e8f
|
||||
light greenish blue #63f7b4
|
||||
mud green #606602
|
||||
pinky #fc86aa
|
||||
red wine #8c0034
|
||||
shit green #758000
|
||||
tan brown #ab7e4c
|
||||
darkblue #030764
|
||||
rosa #fe86a4
|
||||
lipstick #d5174e
|
||||
pale mauve #fed0fc
|
||||
claret #680018
|
||||
dandelion #fedf08
|
||||
orangered #fe420f
|
||||
poop green #6f7c00
|
||||
ruby #ca0147
|
||||
dark #1b2431
|
||||
greenish turquoise #00fbb0
|
||||
pastel red #db5856
|
||||
piss yellow #ddd618
|
||||
bright cyan #41fdfe
|
||||
dark coral #cf524e
|
||||
algae green #21c36f
|
||||
darkish red #a90308
|
||||
reddy brown #6e1005
|
||||
blush pink #fe828c
|
||||
camouflage green #4b6113
|
||||
lawn green #4da409
|
||||
putty #beae8a
|
||||
vibrant blue #0339f8
|
||||
dark sand #a88f59
|
||||
purple/blue #5d21d0
|
||||
saffron #feb209
|
||||
twilight #4e518b
|
||||
warm brown #964e02
|
||||
bluegrey #85a3b2
|
||||
bubble gum pink #ff69af
|
||||
duck egg blue #c3fbf4
|
||||
greenish cyan #2afeb7
|
||||
petrol #005f6a
|
||||
royal #0c1793
|
||||
butter #ffff81
|
||||
dusty orange #f0833a
|
||||
off yellow #f1f33f
|
||||
pale olive green #b1d27b
|
||||
orangish #fc824a
|
||||
leaf #71aa34
|
||||
light blue grey #b7c9e2
|
||||
dried blood #4b0101
|
||||
lightish purple #a552e6
|
||||
rusty red #af2f0d
|
||||
lavender blue #8b88f8
|
||||
light grass green #9af764
|
||||
light mint green #a6fbb2
|
||||
sunflower #ffc512
|
||||
velvet #750851
|
||||
brick orange #c14a09
|
||||
lightish red #fe2f4a
|
||||
pure blue #0203e2
|
||||
twilight blue #0a437a
|
||||
violet red #a50055
|
||||
yellowy brown #ae8b0c
|
||||
carnation #fd798f
|
||||
muddy yellow #bfac05
|
||||
dark seafoam green #3eaf76
|
||||
deep rose #c74767
|
||||
dusty red #b9484e
|
||||
grey/blue #647d8e
|
||||
lemon lime #bffe28
|
||||
purple/pink #d725de
|
||||
brown yellow #b29705
|
||||
purple brown #673a3f
|
||||
wisteria #a87dc2
|
||||
banana yellow #fafe4b
|
||||
lipstick red #c0022f
|
||||
water blue #0e87cc
|
||||
brown grey #8d8468
|
||||
vibrant purple #ad03de
|
||||
baby green #8cff9e
|
||||
barf green #94ac02
|
||||
eggshell blue #c4fff7
|
||||
sandy yellow #fdee73
|
||||
cool green #33b864
|
||||
pale #fff9d0
|
||||
blue/grey #758da3
|
||||
hot magenta #f504c9
|
||||
greyblue #77a1b5
|
||||
purpley #8756e4
|
||||
baby shit green #889717
|
||||
brownish pink #c27e79
|
||||
dark aquamarine #017371
|
||||
diarrhea #9f8303
|
||||
light mustard #f7d560
|
||||
pale sky blue #bdf6fe
|
||||
turtle green #75b84f
|
||||
bright olive #9cbb04
|
||||
dark grey blue #29465b
|
||||
greeny brown #696006
|
||||
lemon green #adf802
|
||||
light periwinkle #c1c6fc
|
||||
seaweed green #35ad6b
|
||||
sunshine yellow #fffd37
|
||||
ugly purple #a442a0
|
||||
medium pink #f36196
|
||||
puke brown #947706
|
||||
very light pink #fff4f2
|
||||
viridian #1e9167
|
||||
bile #b5c306
|
||||
faded yellow #feff7f
|
||||
very pale green #cffdbc
|
||||
vibrant green #0add08
|
||||
bright lime #87fd05
|
||||
spearmint #1ef876
|
||||
light aquamarine #7bfdc7
|
||||
light sage #bcecac
|
||||
yellowgreen #bbf90f
|
||||
baby poo #ab9004
|
||||
dark seafoam #1fb57a
|
||||
deep teal #00555a
|
||||
heather #a484ac
|
||||
rust orange #c45508
|
||||
dirty blue #3f829d
|
||||
fern green #548d44
|
||||
bright lilac #c95efb
|
||||
weird green #3ae57f
|
||||
peacock blue #016795
|
||||
avocado green #87a922
|
||||
faded orange #f0944d
|
||||
grape purple #5d1451
|
||||
hot green #25ff29
|
||||
lime yellow #d0fe1d
|
||||
mango #ffa62b
|
||||
shamrock #01b44c
|
||||
bubblegum #ff6cb5
|
||||
purplish brown #6b4247
|
||||
vomit yellow #c7c10c
|
||||
pale cyan #b7fffa
|
||||
key lime #aeff6e
|
||||
tomato red #ec2d01
|
||||
lightgreen #76ff7b
|
||||
merlot #730039
|
||||
night blue #040348
|
||||
purpleish pink #df4ec8
|
||||
apple #6ecb3c
|
||||
baby poop green #8f9805
|
||||
green apple #5edc1f
|
||||
heliotrope #d94ff5
|
||||
yellow/green #c8fd3d
|
||||
almost black #070d0d
|
||||
cool blue #4984b8
|
||||
leafy green #51b73b
|
||||
mustard brown #ac7e04
|
||||
dusk #4e5481
|
||||
dull brown #876e4b
|
||||
frog green #58bc08
|
||||
vivid green #2fef10
|
||||
bright light green #2dfe54
|
||||
fluro green #0aff02
|
||||
kiwi #9cef43
|
||||
seaweed #18d17b
|
||||
navy green #35530a
|
||||
ultramarine blue #1805db
|
||||
iris #6258c4
|
||||
pastel orange #ff964f
|
||||
yellowish orange #ffab0f
|
||||
perrywinkle #8f8ce7
|
||||
tealish #24bca8
|
||||
dark plum #3f012c
|
||||
pear #cbf85f
|
||||
pinkish orange #ff724c
|
||||
midnight purple #280137
|
||||
light urple #b36ff6
|
||||
dark mint #48c072
|
||||
greenish tan #bccb7a
|
||||
light burgundy #a8415b
|
||||
turquoise blue #06b1c4
|
||||
ugly pink #cd7584
|
||||
sandy #f1da7a
|
||||
electric pink #ff0490
|
||||
muted purple #805b87
|
||||
mid green #50a747
|
||||
greyish #a8a495
|
||||
neon yellow #cfff04
|
||||
banana #ffff7e
|
||||
carnation pink #ff7fa7
|
||||
tomato #ef4026
|
||||
sea #3c9992
|
||||
muddy brown #886806
|
||||
turquoise green #04f489
|
||||
buff #fef69e
|
||||
fawn #cfaf7b
|
||||
muted blue #3b719f
|
||||
pale rose #fdc1c5
|
||||
dark mint green #20c073
|
||||
amethyst #9b5fc0
|
||||
blue/green #0f9b8e
|
||||
chestnut #742802
|
||||
sick green #9db92c
|
||||
pea #a4bf20
|
||||
rusty orange #cd5909
|
||||
stone #ada587
|
||||
rose red #be013c
|
||||
pale aqua #b8ffeb
|
||||
deep orange #dc4d01
|
||||
earth #a2653e
|
||||
mossy green #638b27
|
||||
grassy green #419c03
|
||||
pale lime green #b1ff65
|
||||
light grey blue #9dbcd4
|
||||
pale grey #fdfdfe
|
||||
asparagus #77ab56
|
||||
blueberry #464196
|
||||
purple red #990147
|
||||
pale lime #befd73
|
||||
greenish teal #32bf84
|
||||
caramel #af6f09
|
||||
deep magenta #a0025c
|
||||
light peach #ffd8b1
|
||||
milk chocolate #7f4e1e
|
||||
ocher #bf9b0c
|
||||
off green #6ba353
|
||||
purply pink #f075e6
|
||||
lightblue #7bc8f6
|
||||
dusky blue #475f94
|
||||
golden #f5bf03
|
||||
light beige #fffeb6
|
||||
butter yellow #fffd74
|
||||
dusky purple #895b7b
|
||||
french blue #436bad
|
||||
ugly yellow #d0c101
|
||||
greeny yellow #c6f808
|
||||
orangish red #f43605
|
||||
shamrock green #02c14d
|
||||
orangish brown #b25f03
|
||||
tree green #2a7e19
|
||||
deep violet #490648
|
||||
gunmetal #536267
|
||||
blue/purple #5a06ef
|
||||
cherry #cf0234
|
||||
sandy brown #c4a661
|
||||
warm grey #978a84
|
||||
dark indigo #1f0954
|
||||
midnight #03012d
|
||||
bluey green #2bb179
|
||||
grey pink #c3909b
|
||||
soft purple #a66fb5
|
||||
blood #770001
|
||||
brown red #922b05
|
||||
medium grey #7d7f7c
|
||||
berry #990f4b
|
||||
poo #8f7303
|
||||
purpley pink #c83cb9
|
||||
light salmon #fea993
|
||||
snot #acbb0d
|
||||
easter purple #c071fe
|
||||
light yellow green #ccfd7f
|
||||
dark navy blue #00022e
|
||||
drab #828344
|
||||
light rose #ffc5cb
|
||||
rouge #ab1239
|
||||
purplish red #b0054b
|
||||
slime green #99cc04
|
||||
baby poop #937c00
|
||||
irish green #019529
|
||||
pink/purple #ef1de7
|
||||
dark navy #000435
|
||||
greeny blue #42b395
|
||||
light plum #9d5783
|
||||
pinkish grey #c8aca9
|
||||
dirty orange #c87606
|
||||
rust red #aa2704
|
||||
pale lilac #e4cbff
|
||||
orangey red #fa4224
|
||||
primary blue #0804f9
|
||||
kermit green #5cb200
|
||||
brownish purple #76424e
|
||||
murky green #6c7a0e
|
||||
wheat #fbdd7e
|
||||
very dark purple #2a0134
|
||||
bottle green #044a05
|
||||
watermelon #fd4659
|
||||
deep sky blue #0d75f8
|
||||
fire engine red #fe0002
|
||||
yellow ochre #cb9d06
|
||||
pumpkin orange #fb7d07
|
||||
pale olive #b9cc81
|
||||
light lilac #edc8ff
|
||||
lightish green #61e160
|
||||
carolina blue #8ab8fe
|
||||
mulberry #920a4e
|
||||
shocking pink #fe02a2
|
||||
auburn #9a3001
|
||||
bright lime green #65fe08
|
||||
celadon #befdb7
|
||||
pinkish brown #b17261
|
||||
poo brown #885f01
|
||||
bright sky blue #02ccfe
|
||||
celery #c1fd95
|
||||
dirt brown #836539
|
||||
strawberry #fb2943
|
||||
dark lime #84b701
|
||||
copper #b66325
|
||||
medium brown #7f5112
|
||||
muted green #5fa052
|
||||
robin's egg #6dedfd
|
||||
bright aqua #0bf9ea
|
||||
bright lavender #c760ff
|
||||
ivory #ffffcb
|
||||
very light purple #f6cefc
|
||||
light navy #155084
|
||||
pink red #f5054f
|
||||
olive brown #645403
|
||||
poop brown #7a5901
|
||||
mustard green #a8b504
|
||||
ocean green #3d9973
|
||||
very dark blue #000133
|
||||
dusty green #76a973
|
||||
light navy blue #2e5a88
|
||||
minty green #0bf77d
|
||||
adobe #bd6c48
|
||||
barney #ac1db8
|
||||
jade green #2baf6a
|
||||
bright light blue #26f7fd
|
||||
light lime #aefd6c
|
||||
dark khaki #9b8f55
|
||||
orange yellow #ffad01
|
||||
ocre #c69c04
|
||||
maize #f4d054
|
||||
faded pink #de9dac
|
||||
british racing green #05480d
|
||||
sandstone #c9ae74
|
||||
mud brown #60460f
|
||||
light sea green #98f6b0
|
||||
robin egg blue #8af1fe
|
||||
aqua marine #2ee8bb
|
||||
dark sea green #11875d
|
||||
soft pink #fdb0c0
|
||||
orangey brown #b16002
|
||||
cherry red #f7022a
|
||||
burnt yellow #d5ab09
|
||||
brownish grey #86775f
|
||||
camel #c69f59
|
||||
purplish grey #7a687f
|
||||
marine #042e60
|
||||
greyish pink #c88d94
|
||||
pale turquoise #a5fbd5
|
||||
pastel yellow #fffe71
|
||||
bluey purple #6241c7
|
||||
canary yellow #fffe40
|
||||
faded red #d3494e
|
||||
sepia #985e2b
|
||||
coffee #a6814c
|
||||
bright magenta #ff08e8
|
||||
mocha #9d7651
|
||||
ecru #feffca
|
||||
purpleish #98568d
|
||||
cranberry #9e003a
|
||||
darkish green #287c37
|
||||
brown orange #b96902
|
||||
dusky rose #ba6873
|
||||
melon #ff7855
|
||||
sickly green #94b21c
|
||||
silver #c5c9c7
|
||||
purply blue #661aee
|
||||
purpleish blue #6140ef
|
||||
hospital green #9be5aa
|
||||
shit brown #7b5804
|
||||
mid blue #276ab3
|
||||
amber #feb308
|
||||
easter green #8cfd7e
|
||||
soft blue #6488ea
|
||||
cerulean blue #056eee
|
||||
golden brown #b27a01
|
||||
bright turquoise #0ffef9
|
||||
red pink #fa2a55
|
||||
red purple #820747
|
||||
greyish brown #7a6a4f
|
||||
vermillion #f4320c
|
||||
russet #a13905
|
||||
steel grey #6f828a
|
||||
lighter purple #a55af4
|
||||
bright violet #ad0afd
|
||||
prussian blue #004577
|
||||
slate green #658d6d
|
||||
dirty pink #ca7b80
|
||||
dark blue green #005249
|
||||
pine #2b5d34
|
||||
yellowy green #bff128
|
||||
dark gold #b59410
|
||||
bluish #2976bb
|
||||
darkish blue #014182
|
||||
dull red #bb3f3f
|
||||
pinky red #fc2647
|
||||
bronze #a87900
|
||||
pale teal #82cbb2
|
||||
military green #667c3e
|
||||
barbie pink #fe46a5
|
||||
bubblegum pink #fe83cc
|
||||
pea soup green #94a617
|
||||
dark mustard #a88905
|
||||
shit #7f5f00
|
||||
medium purple #9e43a2
|
||||
very dark green #062e03
|
||||
dirt #8a6e45
|
||||
dusky pink #cc7a8b
|
||||
red violet #9e0168
|
||||
lemon yellow #fdff38
|
||||
pistachio #c0fa8b
|
||||
dull yellow #eedc5b
|
||||
dark lime green #7ebd01
|
||||
denim blue #3b5b92
|
||||
teal blue #01889f
|
||||
lightish blue #3d7afd
|
||||
purpley blue #5f34e7
|
||||
light indigo #6d5acf
|
||||
swamp green #748500
|
||||
brown green #706c11
|
||||
dark maroon #3c0008
|
||||
hot purple #cb00f5
|
||||
dark forest green #002d04
|
||||
faded blue #658cbb
|
||||
drab green #749551
|
||||
light lime green #b9ff66
|
||||
snot green #9dc100
|
||||
yellowish #faee66
|
||||
light blue green #7efbb3
|
||||
bordeaux #7b002c
|
||||
light mauve #c292a1
|
||||
ocean #017b92
|
||||
marigold #fcc006
|
||||
muddy green #657432
|
||||
dull orange #d8863b
|
||||
steel #738595
|
||||
electric purple #aa23ff
|
||||
fluorescent green #08ff08
|
||||
yellowish brown #9b7a01
|
||||
blush #f29e8e
|
||||
soft green #6fc276
|
||||
bright orange #ff5b00
|
||||
lemon #fdff52
|
||||
purple grey #866f85
|
||||
acid green #8ffe09
|
||||
pale lavender #eecffe
|
||||
violet blue #510ac9
|
||||
light forest green #4f9153
|
||||
burnt red #9f2305
|
||||
khaki green #728639
|
||||
cerise #de0c62
|
||||
faded purple #916e99
|
||||
apricot #ffb16d
|
||||
dark olive green #3c4d03
|
||||
grey brown #7f7053
|
||||
green grey #77926f
|
||||
true blue #010fcc
|
||||
pale violet #ceaefa
|
||||
periwinkle blue #8f99fb
|
||||
light sky blue #c6fcff
|
||||
blurple #5539cc
|
||||
green brown #544e03
|
||||
bluegreen #017a79
|
||||
bright teal #01f9c6
|
||||
brownish yellow #c9b003
|
||||
pea soup #929901
|
||||
forest #0b5509
|
||||
barney purple #a00498
|
||||
ultramarine #2000b1
|
||||
purplish #94568c
|
||||
puke yellow #c2be0e
|
||||
bluish grey #748b97
|
||||
dark periwinkle #665fd1
|
||||
dark lilac #9c6da5
|
||||
reddish #c44240
|
||||
light maroon #a24857
|
||||
dusty purple #825f87
|
||||
terra cotta #c9643b
|
||||
avocado #90b134
|
||||
marine blue #01386a
|
||||
teal green #25a36f
|
||||
slate grey #59656d
|
||||
lighter green #75fd63
|
||||
electric green #21fc0d
|
||||
dusty blue #5a86ad
|
||||
golden yellow #fec615
|
||||
bright yellow #fffd01
|
||||
light lavender #dfc5fe
|
||||
umber #b26400
|
||||
poop #7f5e00
|
||||
dark peach #de7e5d
|
||||
jungle green #048243
|
||||
eggshell #ffffd4
|
||||
denim #3b638c
|
||||
yellow brown #b79400
|
||||
dull purple #84597e
|
||||
chocolate brown #411900
|
||||
wine red #7b0323
|
||||
neon blue #04d9ff
|
||||
dirty green #667e2c
|
||||
light tan #fbeeac
|
||||
ice blue #d7fffe
|
||||
cadet blue #4e7496
|
||||
dark mauve #874c62
|
||||
very light blue #d5ffff
|
||||
grey purple #826d8c
|
||||
pastel pink #ffbacd
|
||||
very light green #d1ffbd
|
||||
dark sky blue #448ee4
|
||||
evergreen #05472a
|
||||
dull pink #d5869d
|
||||
aubergine #3d0734
|
||||
mahogany #4a0100
|
||||
reddish orange #f8481c
|
||||
deep green #02590f
|
||||
vomit green #89a203
|
||||
purple pink #e03fd8
|
||||
dusty pink #d58a94
|
||||
faded green #7bb274
|
||||
camo green #526525
|
||||
pinky purple #c94cbe
|
||||
pink purple #db4bda
|
||||
brownish red #9e3623
|
||||
dark rose #b5485d
|
||||
mud #735c12
|
||||
brownish #9c6d57
|
||||
emerald green #028f1e
|
||||
pale brown #b1916e
|
||||
dull blue #49759c
|
||||
burnt umber #a0450e
|
||||
medium green #39ad48
|
||||
clay #b66a50
|
||||
light aqua #8cffdb
|
||||
light olive green #a4be5c
|
||||
brownish orange #cb7723
|
||||
dark aqua #05696b
|
||||
purplish pink #ce5dae
|
||||
dark salmon #c85a53
|
||||
greenish grey #96ae8d
|
||||
jade #1fa774
|
||||
ugly green #7a9703
|
||||
dark beige #ac9362
|
||||
emerald #01a049
|
||||
pale red #d9544d
|
||||
light magenta #fa5ff7
|
||||
sky #82cafc
|
||||
light cyan #acfffc
|
||||
yellow orange #fcb001
|
||||
reddish purple #910951
|
||||
reddish pink #fe2c54
|
||||
orchid #c875c4
|
||||
dirty yellow #cdc50a
|
||||
orange red #fd411e
|
||||
deep red #9a0200
|
||||
orange brown #be6400
|
||||
cobalt blue #030aa7
|
||||
neon pink #fe019a
|
||||
rose pink #f7879a
|
||||
greyish purple #887191
|
||||
raspberry #b00149
|
||||
aqua green #12e193
|
||||
salmon pink #fe7b7c
|
||||
tangerine #ff9408
|
||||
brownish green #6a6e09
|
||||
red brown #8b2e16
|
||||
greenish brown #696112
|
||||
pumpkin #e17701
|
||||
pine green #0a481e
|
||||
charcoal #343837
|
||||
baby pink #ffb7ce
|
||||
cornflower #6a79f7
|
||||
blue violet #5d06e9
|
||||
chocolate #3d1c02
|
||||
greyish green #82a67d
|
||||
scarlet #be0119
|
||||
green yellow #c9ff27
|
||||
dark olive #373e02
|
||||
sienna #a9561e
|
||||
pastel purple #caa0ff
|
||||
terracotta #ca6641
|
||||
aqua blue #02d8e9
|
||||
sage green #88b378
|
||||
blood red #980002
|
||||
deep pink #cb0162
|
||||
grass #5cac2d
|
||||
moss #769958
|
||||
pastel blue #a2bffe
|
||||
bluish green #10a674
|
||||
green blue #06b48b
|
||||
dark tan #af884a
|
||||
greenish blue #0b8b87
|
||||
pale orange #ffa756
|
||||
vomit #a2a415
|
||||
forrest green #154406
|
||||
dark lavender #856798
|
||||
dark violet #34013f
|
||||
purple blue #632de9
|
||||
dark cyan #0a888a
|
||||
olive drab #6f7632
|
||||
pinkish #d46a7e
|
||||
cobalt #1e488f
|
||||
neon purple #bc13fe
|
||||
light turquoise #7ef4cc
|
||||
apple green #76cd26
|
||||
dull green #74a662
|
||||
wine #80013f
|
||||
powder blue #b1d1fc
|
||||
off white #ffffe4
|
||||
electric blue #0652ff
|
||||
dark turquoise #045c5a
|
||||
blue purple #5729ce
|
||||
azure #069af3
|
||||
bright red #ff000d
|
||||
pinkish red #f10c45
|
||||
cornflower blue #5170d7
|
||||
light olive #acbf69
|
||||
grape #6c3461
|
||||
greyish blue #5e819d
|
||||
purplish blue #601ef9
|
||||
yellowish green #b0dd16
|
||||
greenish yellow #cdfd02
|
||||
medium blue #2c6fbb
|
||||
dusty rose #c0737a
|
||||
light violet #d6b4fc
|
||||
midnight blue #020035
|
||||
bluish purple #703be7
|
||||
red orange #fd3c06
|
||||
dark magenta #960056
|
||||
greenish #40a368
|
||||
ocean blue #03719c
|
||||
coral #fc5a50
|
||||
cream #ffffc2
|
||||
reddish brown #7f2b0a
|
||||
burnt sienna #b04e0f
|
||||
brick #a03623
|
||||
sage #87ae73
|
||||
grey green #789b73
|
||||
white #ffffff
|
||||
robin's egg blue #98eff9
|
||||
moss green #658b38
|
||||
steel blue #5a7d9a
|
||||
eggplant #380835
|
||||
light yellow #fffe7a
|
||||
leaf green #5ca904
|
||||
light grey #d8dcd6
|
||||
puke #a5a502
|
||||
pinkish purple #d648d7
|
||||
sea blue #047495
|
||||
pale purple #b790d4
|
||||
slate blue #5b7c99
|
||||
blue grey #607c8e
|
||||
hunter green #0b4008
|
||||
fuchsia #ed0dd9
|
||||
crimson #8c000f
|
||||
pale yellow #ffff84
|
||||
ochre #bf9005
|
||||
mustard yellow #d2bd0a
|
||||
light red #ff474c
|
||||
cerulean #0485d1
|
||||
pale pink #ffcfdc
|
||||
deep blue #040273
|
||||
rust #a83c09
|
||||
light teal #90e4c1
|
||||
slate #516572
|
||||
goldenrod #fac205
|
||||
dark yellow #d5b60a
|
||||
dark grey #363737
|
||||
army green #4b5d16
|
||||
grey blue #6b8ba4
|
||||
seafoam #80f9ad
|
||||
puce #a57e52
|
||||
spring green #a9f971
|
||||
dark orange #c65102
|
||||
sand #e2ca76
|
||||
pastel green #b0ff9d
|
||||
mint #9ffeb0
|
||||
light orange #fdaa48
|
||||
bright pink #fe01b1
|
||||
chartreuse #c1f80a
|
||||
deep purple #36013f
|
||||
dark brown #341c02
|
||||
taupe #b9a281
|
||||
pea green #8eab12
|
||||
puke green #9aae07
|
||||
kelly green #02ab2e
|
||||
seafoam green #7af9ab
|
||||
blue green #137e6d
|
||||
khaki #aaa662
|
||||
burgundy #610023
|
||||
dark teal #014d4e
|
||||
brick red #8f1402
|
||||
royal purple #4b006e
|
||||
plum #580f41
|
||||
mint green #8fff9f
|
||||
gold #dbb40c
|
||||
baby blue #a2cffe
|
||||
yellow green #c0fb2d
|
||||
bright purple #be03fd
|
||||
dark red #840000
|
||||
pale blue #d0fefe
|
||||
grass green #3f9b0b
|
||||
navy #01153e
|
||||
aquamarine #04d8b2
|
||||
burnt orange #c04e01
|
||||
neon green #0cff0c
|
||||
bright blue #0165fc
|
||||
rose #cf6275
|
||||
light pink #ffd1df
|
||||
mustard #ceb301
|
||||
indigo #380282
|
||||
lime #aaff32
|
||||
sea green #53fca1
|
||||
periwinkle #8e82fe
|
||||
dark pink #cb416b
|
||||
olive green #677a04
|
||||
peach #ffb07c
|
||||
pale green #c7fdb5
|
||||
light brown #ad8150
|
||||
hot pink #ff028d
|
||||
black #000000
|
||||
lilac #cea2fd
|
||||
navy blue #001146
|
||||
royal blue #0504aa
|
||||
beige #e6daa6
|
||||
salmon #ff796c
|
||||
olive #6e750e
|
||||
maroon #650021
|
||||
bright green #01ff07
|
||||
dark purple #35063e
|
||||
mauve #ae7181
|
||||
forest green #06470c
|
||||
aqua #13eac9
|
||||
cyan #00ffff
|
||||
tan #d1b26f
|
||||
dark blue #00035b
|
||||
lavender #c79fef
|
||||
turquoise #06c2ac
|
||||
dark green #033500
|
||||
violet #9a0eea
|
||||
light purple #bf77f6
|
||||
lime green #89fe05
|
||||
grey #929591
|
||||
sky blue #75bbfd
|
||||
yellow #ffff14
|
||||
magenta #c20078
|
||||
light green #96f97b
|
||||
orange #f97306
|
||||
teal #029386
|
||||
light blue #95d0fc
|
||||
red #e50000
|
||||
brown #653700
|
||||
pink #ff81c0
|
||||
blue #0343df
|
||||
green #15b01a
|
||||
purple #7e1e9c
|
Loading…
Reference in New Issue