Squashed commit of the following: [reprs_and_member_names]

Closes #22
Closes #23
Closes #24
Closes #25
Closes #31
Closes #56

commit 43fac8f4f3
Author: John McCardle <mccardle.john@gmail.com>
Date:   Sat Apr 20 18:32:52 2024 -0400

    Typo in UIFrame repr

commit 3fd5ad93e2
Author: John McCardle <mccardle.john@gmail.com>
Date:   Sat Apr 20 18:32:30 2024 -0400

    Add UIGridPoint and UIGridPointState repr

commit 03376897b8
Author: John McCardle <mccardle.john@gmail.com>
Date:   Sat Apr 20 18:32:17 2024 -0400

    Add UIGrid repr

commit 48af072a33
Author: John McCardle <mccardle.john@gmail.com>
Date:   Sat Apr 20 18:32:05 2024 -0400

    Add UIEntity repr

css_colors.txt

@@ -0,0 +1,157 @@
+aqua 	#00FFFF 
+black 	#000000 
+blue 	#0000FF 
+fuchsia 	#FF00FF 
+gray 	#808080 
+green 	#008000 
+lime 	#00FF00 
+maroon 	#800000 
+navy 	#000080 
+olive 	#808000 
+purple 	#800080 
+red 	#FF0000 
+silver 	#C0C0C0 
+teal 	#008080 
+white 	#FFFFFF 
+yellow 	#FFFF00 
+aliceblue 	#F0F8FF 
+antiquewhite 	#FAEBD7 
+aqua 	#00FFFF 
+aquamarine 	#7FFFD4 
+azure 	#F0FFFF 
+beige 	#F5F5DC 
+bisque 	#FFE4C4 
+black 	#000000 
+blanchedalmond 	#FFEBCD 
+blue 	#0000FF 
+blueviolet 	#8A2BE2 
+brown 	#A52A2A 
+burlywood 	#DEB887 
+cadetblue 	#5F9EA0 
+chartreuse 	#7FFF00 
+chocolate 	#D2691E 
+coral 	#FF7F50 
+cornflowerblue 	#6495ED 
+cornsilk 	#FFF8DC 
+crimson 	#DC143C 
+cyan 	#00FFFF 
+darkblue 	#00008B 
+darkcyan 	#008B8B 
+darkgoldenrod 	#B8860B 
+darkgray 	#A9A9A9 
+darkgreen 	#006400 
+darkkhaki 	#BDB76B 
+darkmagenta 	#8B008B 
+darkolivegreen 	#556B2F 
+darkorange 	#FF8C00 
+darkorchid 	#9932CC 
+darkred 	#8B0000 
+darksalmon 	#E9967A 
+darkseagreen 	#8FBC8F 
+darkslateblue 	#483D8B 
+darkslategray 	#2F4F4F 
+darkturquoise 	#00CED1 
+darkviolet 	#9400D3 
+deeppink 	#FF1493 
+deepskyblue 	#00BFFF 
+dimgray 	#696969 
+dodgerblue 	#1E90FF 
+firebrick 	#B22222 
+floralwhite 	#FFFAF0 
+forestgreen 	#228B22 
+fuchsia 	#FF00FF 
+gainsboro 	#DCDCDC 
+ghostwhite 	#F8F8FF 
+gold 	#FFD700 
+goldenrod 	#DAA520 
+gray 	#7F7F7F 
+green 	#008000 
+greenyellow 	#ADFF2F 
+honeydew 	#F0FFF0 
+hotpink 	#FF69B4 
+indianred 	#CD5C5C 
+indigo 	#4B0082 
+ivory 	#FFFFF0 
+khaki 	#F0E68C 
+lavender 	#E6E6FA 
+lavenderblush 	#FFF0F5 
+lawngreen 	#7CFC00 
+lemonchiffon 	#FFFACD 
+lightblue 	#ADD8E6 
+lightcoral 	#F08080 
+lightcyan 	#E0FFFF 
+lightgoldenrodyellow 	#FAFAD2 
+lightgreen 	#90EE90 
+lightgrey 	#D3D3D3 
+lightpink 	#FFB6C1 
+lightsalmon 	#FFA07A 
+lightseagreen 	#20B2AA 
+lightskyblue 	#87CEFA 
+lightslategray 	#778899 
+lightsteelblue 	#B0C4DE 
+lightyellow 	#FFFFE0 
+lime 	#00FF00 
+limegreen 	#32CD32 
+linen 	#FAF0E6 
+magenta 	#FF00FF 
+maroon 	#800000 
+mediumaquamarine 	#66CDAA 
+mediumblue 	#0000CD 
+mediumorchid 	#BA55D3 
+mediumpurple 	#9370DB 
+mediumseagreen 	#3CB371 
+mediumslateblue 	#7B68EE 
+mediumspringgreen 	#00FA9A 
+mediumturquoise 	#48D1CC 
+mediumvioletred 	#C71585 
+midnightblue 	#191970 
+mintcream 	#F5FFFA 
+mistyrose 	#FFE4E1 
+moccasin 	#FFE4B5 
+navajowhite 	#FFDEAD 
+navy 	#000080 
+navyblue 	#9FAFDF 
+oldlace 	#FDF5E6 
+olive 	#808000 
+olivedrab 	#6B8E23 
+orange 	#FFA500 
+orangered 	#FF4500 
+orchid 	#DA70D6 
+palegoldenrod 	#EEE8AA 
+palegreen 	#98FB98 
+paleturquoise 	#AFEEEE 
+palevioletred 	#DB7093 
+papayawhip 	#FFEFD5 
+peachpuff 	#FFDAB9 
+peru 	#CD853F 
+pink 	#FFC0CB 
+plum 	#DDA0DD 
+powderblue 	#B0E0E6 
+purple 	#800080 
+red 	#FF0000 
+rosybrown 	#BC8F8F 
+royalblue 	#4169E1 
+saddlebrown 	#8B4513 
+salmon 	#FA8072 
+sandybrown 	#FA8072 
+seagreen 	#2E8B57 
+seashell 	#FFF5EE 
+sienna 	#A0522D 
+silver 	#C0C0C0 
+skyblue 	#87CEEB 
+slateblue 	#6A5ACD 
+slategray 	#708090 
+snow 	#FFFAFA 
+springgreen 	#00FF7F 
+steelblue 	#4682B4 
+tan 	#D2B48C 
+teal 	#008080 
+thistle 	#D8BFD8 
+tomato 	#FF6347 
+turquoise 	#40E0D0 
+violet 	#EE82EE 
+wheat 	#F5DEB3 
+white 	#FFFFFF 
+whitesmoke 	#F5F5F5 
+yellow 	#FFFF00 
+yellowgreen 	#9ACD32 

generate_color_table.py

@@ -0,0 +1,111 @@
+# data sources: CSS docs, jennyscrayoncollection 2017 article on Crayola colors, XKCD color survey
+
+# target: Single C++ header file to provide a struct of color RGB codes and names.
+# This file pre-computes the nearest neighbor of every color.
+# if an RGB code being searched for is closer than the nearest neighbor, it's the closest color name.
+
+def hex_to_rgb(txt):
+    if '#' in txt: txt = txt.replace('#', '')
+    r = txt[0:2]
+    g = txt[2:4]
+    b = txt[4:6]
+    return tuple([int(s, 16) for s in (r,g,b)])
+
+class palette:
+    def __init__(self, name, filename, priority):
+        self.name = name
+        self.priority = priority
+        with open(filename, "r") as f:
+            print(f"scanning {filename}")
+            self.colors = {}
+            for line in f.read().split('\n'):
+                if len(line.split('\t')) < 2: continue
+                name, code = line.split('\t')
+                #print(name, code)
+                self.colors[name] = hex_to_rgb(code)
+                
+    def __repr__(self):
+        return f"<Palette '{self.name}' - {len(self.colors)} colors, priority = {self.priority}>"
+    
+palettes = [
+    #palette("jenny", "jenny_colors.txt", 3), # I should probably use wikipedia as a source for copyright reasons
+    palette("crayon", "wikicrayons_colors.txt", 2),
+    palette("xkcd", "xkcd_colors.txt", 1),
+    palette("css", "css_colors.txt", 0),
+    #palette("matplotlib", "matplotlib_colors.txt", 2) # there's like 10 colors total, I think we'll survive without them
+    ]
+
+all_colors = []
+
+from math import sqrt
+def rgbdist(c1, c2):
+    return sqrt((c1.r - c2.r)**2 + (c1.g - c2.g)**2 + (c1.b - c2.b)**2)
+
+class Color:
+    def __init__(self, r, g, b, name, prefix, priority):
+        self.r = r
+        self.g = g
+        self.b = b
+        self.name = name
+        self.prefix = prefix
+        self.priority = priority
+        self.nearest_neighbor = None
+        
+    def __repr__(self):
+        return f"<Color ({self.r}, {self.g}, {self.b}) - '{self.prefix}:{self.name}', priority = {self.priority}, nearest_neighbor={self.nearest_neighbor.name if self.nearest_neighbor is not None else None}>"
+    
+    def nn(self, colors):
+        nearest = None
+        nearest_dist = 999999
+        for c in colors:
+            dist = rgbdist(self, c)
+            if dist == 0: continue
+            if dist < nearest_dist:
+                nearest = c
+                nearest_dist = dist
+        self.nearest_neighbor = nearest
+        
+for p in palettes:
+    prefix = p.name
+    priority = p.priority
+    for name, rgb in p.colors.items():
+        all_colors.append(Color(*rgb, name, prefix, priority))
+    print(f"{prefix}->{len(all_colors)}")
+        
+for c in all_colors:
+    c.nn(all_colors)
+
+smallest_dist = 9999999999999
+largest_dist = 0
+for c in all_colors:
+    dist = rgbdist(c, c.nearest_neighbor)
+    if dist > largest_dist: largest_dist = dist
+    if dist < smallest_dist: smallest_dist = dist
+    #print(f"{c.prefix}:{c.name} -> {c.nearest_neighbor.prefix}:{c.nearest_neighbor.name}\t{rgbdist(c, c.nearest_neighbor):.2f}")
+# questions -
+
+# are there any colors where their nearest neighbor's nearest neighbor isn't them? (There should be)
+nonnear_pairs = 0
+for c in all_colors:
+    neighbor = c.nearest_neighbor
+    their_neighbor = neighbor.nearest_neighbor
+    if c is not their_neighbor:
+        #print(f"{c.prefix}:{c.name} -> {neighbor.prefix}:{neighbor.name} -> {their_neighbor.prefix}:{their_neighbor.name}")
+        nonnear_pairs += 1
+print("Non-near pairs:", nonnear_pairs)
+    #print(f"{c.prefix}:{c.name} -> {c.nearest_neighbor.prefix}:{c.nearest_neighbor.name}\t{rgbdist(c, c.nearest_neighbor):.2f}")
+
+# Are there duplicates? They should be removed from the palette that won't be used
+dupes = 0
+for c in all_colors:
+    for c2 in all_colors:
+        if c is c2: continue
+        if c.r == c2.r and c.g == c2.g and c.b == c2.b:
+            dupes += 1
+print("dupes:", dupes, "this many will need to be removed:", dupes / 2)
+
+# What order to put them in? Do we want large radiuses first, or some sort of "common color" table?
+
+# does manhattan distance change any answers over the 16.7M RGB values?
+
+# What's the worst case lookup? (Checking all 1200 colors to find the name?)

src/GameEngine.cpp

@@ -59,7 +59,7 @@ void GameEngine::run()
         if (!paused)
         {
         }
-        currentScene()->sRender();
+        currentScene()->render();
         currentFrame++;
         frameTime = clock.restart().asSeconds();
         fps = 1 / frameTime;
@@ -69,14 +69,14 @@ void GameEngine::run()
 
 void GameEngine::manageTimer(std::string name, PyObject* target, int interval)
 {
-    //std::cout << "Manage timer called. " << name << " " << interval << std::endl;
     auto it = timers.find(name);
     if (it != timers.end()) // overwrite existing
     {
-        if (target == NULL || target == Py_None) // delete
+        if (target == NULL || target == Py_None)
         {
-            Py_DECREF(timers[name].target);
+            // Delete: Overwrite existing timer with one that calls None. This will be deleted in the next timer check
-            timers.erase(it);
+            // see gitea issue #4: this allows for a timer to be deleted during its own call to itself
+            timers[name] = std::make_shared<PyTimerCallable>(Py_None, 1000, runtime.getElapsedTime().asMilliseconds());
             return;
         }
     }
@@ -85,16 +85,23 @@ void GameEngine::manageTimer(std::string name, PyObject* target, int interval)
         std::cout << "Refusing to initialize timer to None. It's not an error, it's just pointless." << std::endl;
         return;
     }
-    timers[name] = Timer(target, interval, runtime.getElapsedTime().asMilliseconds());
+    timers[name] = std::make_shared<PyTimerCallable>(target, interval, runtime.getElapsedTime().asMilliseconds());
-    Py_INCREF(target);
 }
 
 void GameEngine::testTimers()
 {
     int now = runtime.getElapsedTime().asMilliseconds();
-    for (auto& [name, timer]: timers)
+    auto it = timers.begin();
+    while (it != timers.end())
     {
-        timer.test(now);
+        it->second->test(now);
+        
+        if (it->second->isNone())
+        {
+            it = timers.erase(it);
+        }
+        else
+            it++;
     }
 }
 
@@ -157,8 +164,10 @@ void GameEngine::sUserInput()
             std::string name = currentScene()->action(actionCode);
             currentScene()->doAction(name, actionType);
         }
-        else if (currentScene()->key_callable != NULL && currentScene()->key_callable != Py_None)
+        else if (currentScene()->key_callable)
         {
+            currentScene()->key_callable->call(ActionCode::key_str(event.key.code), actionType);
+            /*
             PyObject* args = Py_BuildValue("(ss)", ActionCode::key_str(event.key.code).c_str(), actionType.c_str());
             PyObject* retval = PyObject_Call(currentScene()->key_callable, args, NULL);
             if (!retval)
@@ -170,6 +179,7 @@ void GameEngine::sUserInput()
             {   
                 std::cout << "key_callable returned a non-None value. It's not an error, it's just not being saved or used." << std::endl;
             }
+            */
         }
         else
         {

src/GameEngine.h

@@ -5,6 +5,7 @@
 #include "McRFPy_API.h"
 #include "IndexTexture.h"
 #include "Timer.h"
+#include "PyCallable.h"
 
 class GameEngine
 {
@@ -20,7 +21,8 @@ class GameEngine
     std::string window_title;
 
     sf::Clock runtime;
-    std::map<std::string, Timer> timers;
+    //std::map<std::string, Timer> timers;
+    std::map<std::string, std::shared_ptr<PyTimerCallable>> timers;
     void testTimers();
 
 public:

src/McRFPy_API.cpp

@@ -9,6 +9,11 @@ std::vector<sf::SoundBuffer> McRFPy_API::soundbuffers;
 sf::Music McRFPy_API::music;
 sf::Sound McRFPy_API::sfx;
 
+std::shared_ptr<PyFont> McRFPy_API::default_font;
+std::shared_ptr<PyTexture> McRFPy_API::default_texture;
+PyObject* McRFPy_API::mcrf_module;
+
+
 static PyMethodDef mcrfpyMethods[] = {
     {"registerPyAction", McRFPy_API::_registerPyAction, METH_VARARGS,
         "Register a callable Python object to correspond to an action string. (actionstr, callable)"},
@@ -39,8 +44,15 @@ static PyMethodDef mcrfpyMethods[] = {
 };
 
 static PyModuleDef mcrfpyModule = {
-    PyModuleDef_HEAD_INIT, "mcrfpy", NULL, -1, mcrfpyMethods,
+    PyModuleDef_HEAD_INIT, /* m_base - Always initialize this member to PyModuleDef_HEAD_INIT. */
-    NULL, NULL, NULL, NULL
+    "mcrfpy",              /* m_name */
+    NULL,                  /* m_doc - Docstring for the module; usually a docstring variable created with PyDoc_STRVAR is used. */
+    -1,                    /* m_size - Setting m_size to -1 means that the module does not support sub-interpreters, because it has global state. */
+    mcrfpyMethods,         /* m_methods */
+    NULL,                  /* m_slots - An array of slot definitions ...  When using single-phase initialization, m_slots must be NULL. */
+    NULL,                  /* traverseproc m_traverse - A traversal function to call during GC traversal of the module object */
+    NULL,                  /* inquiry m_clear - A clear function to call during GC clearing of the module object */
+    NULL                   /* freefunc m_free - A function to call during deallocation of the module object */
 };
 
 // Module initializer fn, passed to PyImport_AppendInittab
@@ -53,34 +65,38 @@ PyObject* PyInit_mcrfpy()
         return NULL;
     }
     
-    // This code runs, but Python segfaults when accessing the UIFrame type.
+    using namespace mcrfpydef;
-    //std::cout << "Adding UIFrame object to module\n";
+    PyTypeObject* pytypes[] = {
-    PyModule_AddType(m, &mcrfpydef::PyColorType);
+        /*SFML exposed types*/
-    PyModule_AddType(m, &mcrfpydef::PyFontType);
+        &PyColorType, /*&PyLinkedColorType,*/ &PyFontType, &PyTextureType, &PyVectorType,
-    PyModule_AddType(m, &mcrfpydef::PyUICaptionType);
-    PyModule_AddType(m, &mcrfpydef::PyTextureType);
-    PyModule_AddType(m, &mcrfpydef::PyUISpriteType);
 
-    if (PyModule_AddType(m, &mcrfpydef::PyUIFrameType) < 0)
+        /*UI widgets*/
+        &PyUICaptionType, &PyUISpriteType, &PyUIFrameType, &PyUIEntityType, &PyUIGridType,
+
+        /*game map & perspective data*/
+        &PyUIGridPointType, &PyUIGridPointStateType,
+
+        /*collections & iterators*/
+        &PyUICollectionType, &PyUICollectionIterType,
+        &PyUIEntityCollectionType, &PyUIEntityCollectionIterType,
+        nullptr};
+    int i = 0;
+    auto t = pytypes[i];
+    while (t != nullptr)
     {
-        std::cout << "Error adding UIFrame type to module; aborting" << std::endl;
+        /*std::cout << */ PyType_Ready(t); /*<< std::endl; */
-        Py_DECREF(&mcrfpydef::PyUIFrameType);
+        PyModule_AddType(m, t);
-        return NULL;
+        t = pytypes[i++];
     }
-    PyModule_AddType(m, &mcrfpydef::PyUICollectionType);
-    PyModule_AddType(m, &mcrfpydef::PyUICollectionIterType);
-
-    PyModule_AddType(m, &mcrfpydef::PyUIGridPointType);
-    PyModule_AddType(m, &mcrfpydef::PyUIGridPointStateType);
-    PyModule_AddType(m, &mcrfpydef::PyUIEntityType);
-
-    PyModule_AddType(m, &mcrfpydef::PyUIEntityCollectionIterType);
-    PyModule_AddType(m, &mcrfpydef::PyUIEntityCollectionType);
-
-    PyModule_AddType(m, &mcrfpydef::PyUIGridType);
-
-    
 
+    // Add default_font and default_texture to module
+    McRFPy_API::default_font = std::make_shared<PyFont>("assets/JetbrainsMono.ttf");
+    McRFPy_API::default_texture = std::make_shared<PyTexture>("assets/kenney_tinydungeon.png", 16, 16);
+    //PyModule_AddObject(m, "default_font", McRFPy_API::default_font->pyObject());
+    //PyModule_AddObject(m, "default_texture", McRFPy_API::default_texture->pyObject());
+    PyModule_AddObject(m, "default_font", Py_None);
+    PyModule_AddObject(m, "default_texture", Py_None);
+    //McRFPy_API::mcrf_module = m;
     return m;
 }
 
@@ -132,9 +148,13 @@ PyStatus init_python(const char *program_name)
 #endif
 
     status = Py_InitializeFromConfig(&config);
+
+    PyConfig_Clear(&config);
+
     return status;
 }
 
+/*
 void McRFPy_API::setSpriteTexture(int ti)
 {
     int tx = ti % texture_width, ty = ti / texture_width;
@@ -143,6 +163,7 @@ void McRFPy_API::setSpriteTexture(int ti)
                 ty * texture_size,
                 texture_size, texture_size));
 }
+*/
 
 // functionality
 //void McRFPy_API::
@@ -159,6 +180,15 @@ void McRFPy_API::api_init() {
     //texture_sprite_count = texture_width * texture_height;
     //texture.setSmooth(false);
 
+    // Add default_font and default_texture to module
+    McRFPy_API::mcrf_module = PyImport_ImportModule("mcrfpy");
+    std::cout << PyUnicode_AsUTF8(PyObject_Repr(McRFPy_API::mcrf_module)) << std::endl;
+
+    //PyModule_AddObject(McRFPy_API::mcrf_module, "default_font", McRFPy_API::default_font->pyObject());
+    PyObject_SetAttrString(McRFPy_API::mcrf_module, "default_font", McRFPy_API::default_font->pyObject());
+    //PyModule_AddObject(McRFPy_API::mcrf_module, "default_texture", McRFPy_API::default_texture->pyObject());
+    PyObject_SetAttrString(McRFPy_API::mcrf_module, "default_texture", McRFPy_API::default_texture->pyObject());
+
     //sprite.setTexture(texture);
     //sprite.setScale(sf::Vector2f(4.0f, 4.0f));
     //setSpriteTexture(0);
@@ -453,6 +483,7 @@ PyObject* McRFPy_API::_createScene(PyObject* self, PyObject* args) {
 PyObject* McRFPy_API::_keypressScene(PyObject* self, PyObject* args) {
     PyObject* callable;
 	if (!PyArg_ParseTuple(args, "O", &callable)) return NULL;
+    /*
     if (game->currentScene()->key_callable != NULL and game->currentScene()->key_callable != Py_None)
     {
         Py_DECREF(game->currentScene()->key_callable);
@@ -460,6 +491,8 @@ PyObject* McRFPy_API::_keypressScene(PyObject* self, PyObject* args) {
     Py_INCREF(callable);
     game->currentScene()->key_callable = callable;
     Py_INCREF(Py_None);
+    */
+    game->currentScene()->key_callable = std::make_unique<PyKeyCallable>(callable);
     return Py_None;		
 }
 

src/McRFPy_API.h

@@ -3,6 +3,9 @@
 #include "Python.h"
 #include <list>
 
+#include "PyFont.h"
+#include "PyTexture.h"
+
 class GameEngine; // forward declared (circular members)
 
 class McRFPy_API
@@ -12,18 +15,16 @@ private:
         texture_width = 12, texture_height = 11, // w & h sprite/frame count
         texture_sprite_count = 11 * 12; // t_width * t_height, minus blanks?
 
-    // TODO: this is wrong, load resources @ GameEngineSprite sprite;
-    // sf::Texture texture;
-
-    //std::vector<PyMethodDef> mcrfpyMethodsVector;
-    //static PyObject* PyInit_mcrfpy();
-
     McRFPy_API();
 
+
 public:
-    inline static sf::Sprite sprite;
+    static PyObject* mcrf_module;
-    inline static sf::Texture texture;
+    static std::shared_ptr<PyFont> default_font;
-    static void setSpriteTexture(int);
+    static std::shared_ptr<PyTexture> default_texture;
+    //inline static sf::Sprite sprite;
+    //inline static sf::Texture texture;
+    //static void setSpriteTexture(int);
     inline static GameEngine* game;
     static void api_init();
     static void api_shutdown();

src/PyCallable.cpp

@@ -0,0 +1,114 @@
+#include "PyCallable.h"
+
+PyCallable::PyCallable(PyObject* _target)
+{
+    target = Py_XNewRef(_target);
+}
+
+PyCallable::~PyCallable()
+{
+    if (target)
+        Py_DECREF(target);
+}
+
+PyObject* PyCallable::call(PyObject* args, PyObject* kwargs)
+{
+    return PyObject_Call(target, args, kwargs);
+}
+
+bool PyCallable::isNone()
+{
+    return (target == Py_None || target == NULL);
+}
+
+PyTimerCallable::PyTimerCallable(PyObject* _target, int _interval, int now)
+: PyCallable(_target), interval(_interval), last_ran(now)
+{}
+
+PyTimerCallable::PyTimerCallable()
+: PyCallable(Py_None), interval(0), last_ran(0)
+{}
+
+bool PyTimerCallable::hasElapsed(int now)
+{
+    return now >= last_ran + interval;
+}
+
+void PyTimerCallable::call(int now)
+{
+    PyObject* args = Py_BuildValue("(i)", now);
+    PyObject* retval = PyCallable::call(args, NULL);
+    if (!retval)
+    {
+        PyErr_Print();
+        PyErr_Clear();
+    } else if (retval != Py_None)
+    {
+        std::cout << "timer returned a non-None value. It's not an error, it's just not being saved or used." << std::endl;
+        std::cout << PyUnicode_AsUTF8(PyObject_Repr(retval)) << std::endl;
+    }
+}
+
+bool PyTimerCallable::test(int now)
+{
+    if(hasElapsed(now))
+    {
+        call(now);
+        last_ran = now;
+        return true;
+    }
+    return false;
+}
+
+PyClickCallable::PyClickCallable(PyObject* _target)
+: PyCallable(_target)
+{}
+
+PyClickCallable::PyClickCallable()
+: PyCallable(Py_None)
+{}
+
+void PyClickCallable::call(sf::Vector2f mousepos, std::string button, std::string action)
+{
+    PyObject* args = Py_BuildValue("(iiss)", (int)mousepos.x, (int)mousepos.y, button.c_str(), action.c_str());
+    PyObject* retval = PyCallable::call(args, NULL);
+    if (!retval)
+    {
+        std::cout << "ClickCallable has raised an exception. It's going to STDERR and being dropped:" << std::endl;
+        PyErr_Print();
+        PyErr_Clear();
+    } else if (retval != Py_None)
+    {
+        std::cout << "ClickCallable returned a non-None value. It's not an error, it's just not being saved or used." << std::endl;
+        std::cout << PyUnicode_AsUTF8(PyObject_Repr(retval)) << std::endl;
+    }
+}
+
+PyObject* PyClickCallable::borrow()
+{
+    return target;
+}
+
+PyKeyCallable::PyKeyCallable(PyObject* _target)
+: PyCallable(_target)
+{}
+
+PyKeyCallable::PyKeyCallable()
+: PyCallable(Py_None)
+{}
+
+void PyKeyCallable::call(std::string key, std::string action)
+{
+    if (target == Py_None || target == NULL) return;
+    PyObject* args = Py_BuildValue("(ss)", key.c_str(), action.c_str());
+    PyObject* retval = PyCallable::call(args, NULL);
+    if (!retval)
+    {
+        std::cout << "KeyCallable has raised an exception. It's going to STDERR and being dropped:" << std::endl;
+        PyErr_Print();
+        PyErr_Clear();
+    } else if (retval != Py_None)
+    {
+        std::cout << "KeyCallable returned a non-None value. It's not an error, it's just not being saved or used." << std::endl;
+    }
+}

src/PyCallable.h

@@ -0,0 +1,45 @@
+#pragma once
+#include "Common.h"
+#include "Python.h"
+
+class PyCallable
+{
+protected:
+    PyObject* target;
+    PyCallable(PyObject*);
+    ~PyCallable();
+    PyObject* call(PyObject*, PyObject*);
+public:
+    bool isNone();
+};
+
+class PyTimerCallable: public PyCallable
+{
+private:
+    int interval;
+    int last_ran;
+    void call(int);
+public:
+    bool hasElapsed(int);
+    bool test(int);
+    PyTimerCallable(PyObject*, int, int);
+    PyTimerCallable();
+};
+
+class PyClickCallable: public PyCallable
+{
+public:
+    void call(sf::Vector2f, std::string, std::string);
+    PyObject* borrow();
+    PyClickCallable(PyObject*);
+    PyClickCallable();
+};
+
+class PyKeyCallable: public PyCallable
+{
+public:
+    void call(std::string, std::string);
+    //PyObject* borrow(); // not yet implemented
+    PyKeyCallable(PyObject*);
+    PyKeyCallable();
+};

src/PyColor.cpp

@@ -0,0 +1,150 @@
+#include "PyColor.h"
+#include "McRFPy_API.h"
+
+PyGetSetDef PyColor::getsetters[] = {
+    {"r", (getter)PyColor::get_member, (setter)PyColor::set_member, "Red component",   (void*)0},
+    {"g", (getter)PyColor::get_member, (setter)PyColor::set_member, "Green component", (void*)1},
+    {"b", (getter)PyColor::get_member, (setter)PyColor::set_member, "Blue component",  (void*)2},
+    {"a", (getter)PyColor::get_member, (setter)PyColor::set_member, "Alpha component", (void*)3},
+    {NULL}
+};
+
+PyColor::PyColor(sf::Color target)
+:data(target) {}
+
+PyObject* PyColor::pyObject()
+{
+    PyObject* obj = PyType_GenericAlloc(&mcrfpydef::PyColorType, 0);
+    Py_INCREF(obj);
+    PyColorObject* self = (PyColorObject*)obj;
+    self->data = data;
+    return obj;
+}
+
+sf::Color PyColor::fromPy(PyObject* obj)
+{
+    PyColorObject* self = (PyColorObject*)obj;
+    return self->data;
+}
+
+sf::Color PyColor::fromPy(PyColorObject* self)
+{
+    return self->data;
+}
+
+void PyColor::set(sf::Color color)
+{
+    data = color;
+}
+
+sf::Color PyColor::get()
+{
+    return data;
+}
+
+Py_hash_t PyColor::hash(PyObject* obj)
+{
+    auto self = (PyColorObject*)obj;
+    Py_hash_t value = 0;
+    value += self->data.r;
+    value << 8; value += self->data.g; 
+    value << 8; value += self->data.b; 
+    value << 8; value += self->data.a;
+
+    return value;
+}
+
+PyObject* PyColor::repr(PyObject* obj)
+{
+    PyColorObject* self = (PyColorObject*)obj;
+    std::ostringstream ss;
+    sf::Color c = self->data;
+    ss << "<Color (" << int(c.r) << ", " << int(c.g) << ", " << int(c.b) << ", " << int(c.a) << ")>";
+
+    std::string repr_str = ss.str();
+    return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
+}
+
+
+int PyColor::init(PyColorObject* self, PyObject* args, PyObject* kwds) {
+    //using namespace mcrfpydef;
+    static const char* keywords[] = { "r", "g", "b", "a", nullptr };
+    PyObject* leader;
+    int r = -1, g = -1, b = -1, a = 255;
+
+    if (!PyArg_ParseTupleAndKeywords(args, kwds, "O|iii", const_cast<char**>(keywords), &leader, &g, &b, &a)) {
+        PyErr_SetString(PyExc_TypeError, "mcrfpy.Color requires a 3-tuple, 4-tuple, color name, or integer values within 0-255 (r, g, b, optionally a)");
+        return -1;
+    }
+
+    //std::cout << "Arg parsing succeeded. Values: " << r << " " << g << " " << b << " " << a <<std::endl;
+    //std::cout << PyUnicode_AsUTF8(PyObject_Repr(leader)) << std::endl;
+    // Tuple cases
+    if (PyTuple_Check(leader)) {
+        Py_ssize_t tupleSize = PyTuple_Size(leader);
+        if (tupleSize < 3 || tupleSize > 4) {
+            PyErr_SetString(PyExc_TypeError, "Invalid tuple length: mcrfpy.Color requires a 3-tuple, 4-tuple, color name, or integer values within 0-255 (r, g, b, optionally a)");
+            return -1;
+        }
+        r = PyLong_AsLong(PyTuple_GetItem(leader, 0));
+        g = PyLong_AsLong(PyTuple_GetItem(leader, 1));
+        b = PyLong_AsLong(PyTuple_GetItem(leader, 2));
+        if (tupleSize == 4) {
+            a = PyLong_AsLong(PyTuple_GetItem(leader, 3));
+        }
+    }
+    // Color name (not implemented yet)
+    else if (PyUnicode_Check(leader)) {
+        PyErr_SetString(PyExc_NotImplementedError, "Color names aren't ready yet");
+        return -1;
+    }
+    // Check if the leader is actually an integer for the r value
+    else if (PyLong_Check(leader)) {
+        r = PyLong_AsLong(leader);
+        // Additional validation not shown; g, b are required to be parsed
+    } else {
+        PyErr_SetString(PyExc_TypeError, "mcrfpy.Color requires a 3-tuple, 4-tuple, color name, or integer values within 0-255 (r, g, b, optionally a)");
+        return -1;
+    }
+
+    // Validate color values
+    if (r < 0 || r > 255 || g < 0 || g > 255 || b < 0 || b > 255 || a < 0 || a > 255) {
+        PyErr_SetString(PyExc_ValueError, "Color values must be between 0 and 255.");
+        return -1;
+    }
+
+    self->data = sf::Color(r, g, b, a);
+    return 0;
+}
+
+PyObject* PyColor::pynew(PyTypeObject* type, PyObject* args, PyObject* kwds)
+{
+    auto obj = (PyObject*)type->tp_alloc(type, 0);
+    //Py_INCREF(obj);
+    return obj;
+}
+
+PyObject* PyColor::get_member(PyObject* obj, void* closure)
+{
+    // TODO
+    return Py_None;
+}
+
+int PyColor::set_member(PyObject* obj, PyObject* value, void* closure)
+{
+    // TODO
+    return 0;
+}
+
+PyColorObject* PyColor::from_arg(PyObject* args)
+{
+    auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "Color");
+    if (PyObject_IsInstance(args, (PyObject*)type)) return (PyColorObject*)args;
+    auto obj = (PyColorObject*)type->tp_alloc(type, 0);
+    int err = init(obj, args, NULL);
+    if (err) {
+        Py_DECREF(obj);
+        return NULL;
+    }
+    return obj;
+}

src/PyColor.h

@@ -0,0 +1,48 @@
+#pragma once
+#include "Common.h"
+#include "Python.h"
+
+class PyColor;
+class UIDrawable; // forward declare for pointer
+
+typedef struct {
+    PyObject_HEAD
+    sf::Color data;
+} PyColorObject;
+
+class PyColor
+{
+private:
+public:
+    sf::Color data;
+    PyColor(sf::Color);
+    void set(sf::Color);
+    sf::Color get();
+    PyObject* pyObject();
+    static sf::Color fromPy(PyObject*);
+    static sf::Color fromPy(PyColorObject*);
+    static PyObject* repr(PyObject*);
+    static Py_hash_t hash(PyObject*);
+    static int init(PyColorObject*, PyObject*, PyObject*);
+    static PyObject* pynew(PyTypeObject* type, PyObject* args=NULL, PyObject* kwds=NULL);
+    static PyObject* get_member(PyObject*, void*);
+    static int set_member(PyObject*, PyObject*, void*);
+    
+    static PyGetSetDef getsetters[];
+    static PyColorObject* from_arg(PyObject*);
+};
+
+namespace mcrfpydef {
+    static PyTypeObject PyColorType = {
+        .tp_name = "mcrfpy.Color",
+        .tp_basicsize = sizeof(PyColorObject),
+        .tp_itemsize = 0,
+        .tp_repr = PyColor::repr,
+        .tp_hash = PyColor::hash,
+        .tp_flags = Py_TPFLAGS_DEFAULT,
+        .tp_doc = PyDoc_STR("SFML Color Object"),
+        .tp_getset = PyColor::getsetters,
+        .tp_init = (initproc)PyColor::init,
+        .tp_new = PyColor::pynew,
+    };
+}

src/PyFont.cpp

@@ -0,0 +1,63 @@
+#include "PyFont.h"
+#include "McRFPy_API.h"
+
+
+PyFont::PyFont(std::string filename)
+: source(filename)
+{
+    font = sf::Font();
+    font.loadFromFile(source);
+}
+
+PyObject* PyFont::pyObject()
+{
+    auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "Font");
+    //PyObject* obj = PyType_GenericAlloc(&mcrfpydef::PyFontType, 0);
+    PyObject* obj = PyFont::pynew(type, Py_None, Py_None);
+    try {
+        ((PyFontObject*)obj)->data = shared_from_this();
+    }
+    catch (std::bad_weak_ptr& e)
+    {
+        std::cout << "Bad weak ptr: shared_from_this() failed in PyFont::pyObject(); did you create a PyFont outside of std::make_shared? enjoy your segfault, soon!" << std::endl;
+    }
+    // TODO - shared_from_this will raise an exception if the object does not have a shared pointer. Constructor should be made private; write a factory function
+    return obj;
+}
+
+PyObject* PyFont::repr(PyObject* obj)
+{
+    PyFontObject* self = (PyFontObject*)obj;
+    std::ostringstream ss;
+    if (!self->data)
+    {
+        ss << "<Font [invalid internal object]>";
+        std::string repr_str = ss.str();
+        return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
+    }
+    auto& pfont = *(self->data);
+    ss << "<Font (family=" << pfont.font.getInfo().family << ") source=`" << pfont.source << "`>";
+    std::string repr_str = ss.str();
+    return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
+}
+
+Py_hash_t PyFont::hash(PyObject* obj)
+{
+    auto self = (PyFontObject*)obj;
+    return reinterpret_cast<Py_hash_t>(self->data.get());
+}
+
+int PyFont::init(PyFontObject* self, PyObject* args, PyObject* kwds)
+{
+    static const char* keywords[] = { "filename", nullptr };
+    char* filename;
+    if (!PyArg_ParseTupleAndKeywords(args, kwds, "s", const_cast<char**>(keywords), &filename))
+        return -1;
+    self->data = std::make_shared<PyFont>(filename);
+    return 0;
+}
+
+PyObject* PyFont::pynew(PyTypeObject* type, PyObject* args, PyObject* kwds)
+{
+    return (PyObject*)type->tp_alloc(type, 0);
+}

src/PyFont.h

@@ -0,0 +1,39 @@
+#pragma once
+#include "Common.h"
+#include "Python.h"
+
+class PyFont;
+
+typedef struct {
+    PyObject_HEAD
+    std::shared_ptr<PyFont> data;
+} PyFontObject;
+
+class PyFont : public std::enable_shared_from_this<PyFont>
+{
+private:
+    std::string source;
+public:
+    PyFont(std::string filename);
+    sf::Font font;
+    PyObject* pyObject();
+    static PyObject* repr(PyObject*);
+    static Py_hash_t hash(PyObject*);
+    static int init(PyFontObject*, PyObject*, PyObject*);
+    static PyObject* pynew(PyTypeObject* type, PyObject* args=NULL, PyObject* kwds=NULL);
+};
+
+namespace mcrfpydef {
+    static PyTypeObject PyFontType = {
+        .tp_name = "mcrfpy.Font",
+        .tp_basicsize = sizeof(PyFontObject),
+        .tp_itemsize = 0,
+        .tp_repr = PyFont::repr,
+        //.tp_hash = PyFont::hash,
+        .tp_flags = Py_TPFLAGS_DEFAULT,
+        .tp_doc = PyDoc_STR("SFML Font Object"),
+        //.tp_base = &PyBaseObject_Type,
+        .tp_init = (initproc)PyFont::init,
+        .tp_new = PyType_GenericNew, //PyFont::pynew,
+    };
+}

src/PyScene.cpp

@@ -1,6 +1,7 @@
 #include "PyScene.h"
 #include "ActionCode.h"
 #include "Resources.h"
+#include "PyCallable.h"
 
 PyScene::PyScene(GameEngine* g) : Scene(g)
 {
@@ -27,6 +28,7 @@ void PyScene::do_mouse_input(std::string button, std::string type)
         target = d->click_at(sf::Vector2f(mousepos));
         if (target)
         {
+            /*
             PyObject* args = Py_BuildValue("(iiss)", (int)mousepos.x, (int)mousepos.y, button.c_str(), type.c_str());
             PyObject* retval = PyObject_Call(target->click_callable, args, NULL);
             if (!retval)
@@ -38,6 +40,8 @@ void PyScene::do_mouse_input(std::string button, std::string type)
             {   
                 std::cout << "click_callable returned a non-None value. It's not an error, it's just not being saved or used." << std::endl;
             }
+            */
+            target->click_callable->call(mousepos, button, type);
         }
     }
 }
@@ -55,7 +59,7 @@ void PyScene::doAction(std::string name, std::string type)
     }
 }
 
-void PyScene::sRender()
+void PyScene::render()
 {
     game->getWindow().clear();
     

src/PyScene.h

@@ -11,7 +11,7 @@ public:
     PyScene(GameEngine*);
     void update() override final;
     void doAction(std::string, std::string) override final;
-    void sRender() override final;
+    void render() override final;
 
     void do_mouse_input(std::string, std::string);
 };

src/PyTexture.cpp

@@ -0,0 +1,82 @@
+#include "PyTexture.h"
+#include "McRFPy_API.h"
+
+PyTexture::PyTexture(std::string filename, int sprite_w, int sprite_h)
+: source(filename), sprite_width(sprite_w), sprite_height(sprite_h)
+{
+    texture = sf::Texture();
+    texture.loadFromFile(source);
+    auto size = texture.getSize();
+    sheet_width = (size.x / sprite_width);
+    sheet_height = (size.y / sprite_height);
+    if (size.x % sprite_width != 0 || size.y % sprite_height != 0)
+    {
+        std::cout << "Warning: Texture `" << source << "` is not an even number of sprite widths or heights across." << std::endl 
+            << "Sprite size given was " << sprite_w << "x" << sprite_h << "px but the file has a resolution of " << sheet_width << "x" << sheet_height << "px." << std::endl;
+    }
+}
+
+sf::Sprite PyTexture::sprite(int index, sf::Vector2f pos,  sf::Vector2f s)
+{
+    int tx = index % sheet_width, ty = index / sheet_width;
+    auto ir = sf::IntRect(tx * sprite_width, ty * sprite_height, sprite_width, sprite_height);
+    auto sprite = sf::Sprite(texture, ir);
+    sprite.setPosition(pos);
+    sprite.setScale(s);
+    return sprite;
+}
+
+PyObject* PyTexture::pyObject()
+{
+    std::cout << "Find type" << std::endl;
+    auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "Texture");
+    PyObject* obj = PyTexture::pynew(type, Py_None, Py_None);
+
+    try {
+        ((PyTextureObject*)obj)->data = shared_from_this();
+    }
+    catch (std::bad_weak_ptr& e)
+    {
+        std::cout << "Bad weak ptr: shared_from_this() failed in PyTexture::pyObject(); did you create a PyTexture outside of std::make_shared? enjoy your segfault, soon!" << std::endl;
+    }
+    // TODO - shared_from_this will raise an exception if the object does not have a shared pointer. Constructor should be made private; write a factory function
+    return obj;
+}
+
+PyObject* PyTexture::repr(PyObject* obj)
+{
+    PyTextureObject* self = (PyTextureObject*)obj;
+    std::ostringstream ss;
+    if (!self->data)
+    {
+        ss << "<Texture [invalid internal object]>";
+        std::string repr_str = ss.str();
+        return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
+    }
+    auto& ptex = *(self->data);
+    ss << "<Texture " << ptex.sheet_height << " rows, " << ptex.sheet_width << " columns; " << ptex.sprite_width << "x" << ptex.sprite_height << "px sprites. source='" << ptex.source << "'>";
+    std::string repr_str = ss.str();
+    return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
+}
+
+Py_hash_t PyTexture::hash(PyObject* obj)
+{
+    auto self = (PyTextureObject*)obj;
+    return reinterpret_cast<Py_hash_t>(self->data.get());
+}
+
+int PyTexture::init(PyTextureObject* self, PyObject* args, PyObject* kwds)
+{
+    static const char* keywords[] = { "filename", "sprite_width", "sprite_height", nullptr };
+    char* filename;
+    int sprite_width, sprite_height;
+    if (!PyArg_ParseTupleAndKeywords(args, kwds, "sii", const_cast<char**>(keywords), &filename, &sprite_width, &sprite_height))
+        return -1;
+    self->data = std::make_shared<PyTexture>(filename, sprite_width, sprite_height);
+    return 0;
+}
+
+PyObject* PyTexture::pynew(PyTypeObject* type, PyObject* args, PyObject* kwds)
+{
+    return (PyObject*)type->tp_alloc(type, 0);
+}

src/PyTexture.h

@@ -0,0 +1,43 @@
+#pragma once
+#include "Common.h"
+#include "Python.h"
+
+class PyTexture;
+
+typedef struct {
+    PyObject_HEAD
+        std::shared_ptr<PyTexture> data;
+} PyTextureObject;
+
+class PyTexture : public std::enable_shared_from_this<PyTexture>
+{
+private:
+    sf::Texture texture;
+    std::string source;
+    int sheet_width, sheet_height;
+public:
+    int sprite_width, sprite_height; // just use them read only, OK?
+    PyTexture(std::string filename, int sprite_w, int sprite_h);
+    sf::Sprite sprite(int index, sf::Vector2f pos = sf::Vector2f(0, 0), sf::Vector2f s = sf::Vector2f(1.0, 1.0));
+
+    PyObject* pyObject();
+    static PyObject* repr(PyObject*);
+    static Py_hash_t hash(PyObject*);
+    static int init(PyTextureObject*, PyObject*, PyObject*);
+    static PyObject* pynew(PyTypeObject* type, PyObject* args=NULL, PyObject* kwds=NULL);
+};
+
+namespace mcrfpydef {
+    static PyTypeObject PyTextureType = {
+        .tp_name = "mcrfpy.Texture",
+        .tp_basicsize = sizeof(PyTextureObject),
+        .tp_itemsize = 0,
+        .tp_repr = PyTexture::repr,
+        .tp_hash = PyTexture::hash,
+        .tp_flags = Py_TPFLAGS_DEFAULT,
+        .tp_doc = PyDoc_STR("SFML Texture Object"),
+        //.tp_base = &PyBaseObject_Type,
+        .tp_init = (initproc)PyTexture::init,
+        .tp_new = PyType_GenericNew, //PyTexture::pynew,
+    };
+}

src/PyVector.cpp

@@ -0,0 +1,111 @@
+#include "PyVector.h"
+
+PyGetSetDef PyVector::getsetters[] = {
+    {"x", (getter)PyVector::get_member, (setter)PyVector::set_member, "X/horizontal component",   (void*)0},
+    {"y", (getter)PyVector::get_member, (setter)PyVector::set_member, "Y/vertical component",     (void*)1},
+    {NULL}
+};
+
+PyVector::PyVector(sf::Vector2f target)
+:data(target) {}
+
+PyObject* PyVector::pyObject()
+{
+    PyObject* obj = PyType_GenericAlloc(&mcrfpydef::PyVectorType, 0);
+    Py_INCREF(obj);
+    PyVectorObject* self = (PyVectorObject*)obj;
+    self->data = data;
+    return obj;
+}
+
+sf::Vector2f PyVector::fromPy(PyObject* obj)
+{
+    PyVectorObject* self = (PyVectorObject*)obj;
+    return self->data;
+}
+
+sf::Vector2f PyVector::fromPy(PyVectorObject* self)
+{
+    return self->data;
+}
+
+Py_hash_t PyVector::hash(PyObject* obj)
+{
+    auto self = (PyVectorObject*)obj;
+    Py_hash_t value = 0;
+    value += self->data.x;
+    value << 8; value += self->data.y; 
+
+    return value;
+}
+
+PyObject* PyVector::repr(PyObject* obj)
+{
+    PyVectorObject* self = (PyVectorObject*)obj;
+    std::ostringstream ss;
+    sf::Vector2f v = self->data;
+    ss << "<Vector (" << v.x << ", " << v.y << ")>";
+
+    std::string repr_str = ss.str();
+    return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
+}
+
+
+int PyVector::init(PyVectorObject* self, PyObject* args, PyObject* kwds)
+{
+    using namespace mcrfpydef;
+    static const char* keywords[] = { "x", "y", nullptr };
+    PyObject* leader = NULL;
+    float x=0, y=0;
+    if (!PyArg_ParseTupleAndKeywords(args, kwds, "|Of", const_cast<char**>(keywords), &leader, &y))
+    {
+        //PyErr_SetString(PyExc_TypeError, "mcrfpy.Vector requires a 2-tuple or two numeric values");
+        return -1;
+    }
+    if (leader == NULL || leader == Py_None)
+    {
+        self->data = sf::Vector2f();
+        return 0;
+    } 
+
+    if (PyTuple_Check(leader))
+    {
+        if (PyTuple_Size(leader) != 2)
+        {
+            PyErr_SetString(PyExc_TypeError, "Invalid tuple length: mcrfpy.Vector requires a 2-tuple");
+            return -1;
+        }
+        x = PyFloat_AsDouble(PyTuple_GetItem(leader, 0));
+        y = PyFloat_AsDouble(PyTuple_GetItem(leader, 1));
+
+        self->data = sf::Vector2f(x, y);
+        return 0;
+    }
+    // else - 
+    else if (!PyFloat_Check(leader) && !(PyLong_Check(leader)))
+    {
+        PyErr_SetString(PyExc_TypeError, "mcrfpy.Vector requires a 2-tuple or two numeric values");
+        return -1;
+    }
+    if (PyFloat_Check(leader)) x = PyFloat_AsDouble(leader);
+    else x = PyLong_AsDouble(leader);
+    self->data = sf::Vector2f(x, y);
+    return 0;
+}
+
+PyObject* PyVector::pynew(PyTypeObject* type, PyObject* args, PyObject* kwds)
+{
+    return (PyObject*)type->tp_alloc(type, 0);
+}
+
+PyObject* PyVector::get_member(PyObject* obj, void* closure)
+{
+    // TODO
+    return Py_None;
+}
+
+int PyVector::set_member(PyObject* obj, PyObject* value, void* closure)
+{
+    // TODO
+    return 0;
+}

src/PyVector.h

@@ -0,0 +1,42 @@
+#pragma once
+#include "Common.h"
+#include "Python.h"
+
+typedef struct {
+    PyObject_HEAD
+    sf::Vector2f data;
+} PyVectorObject;
+
+class PyVector
+{
+public:
+    sf::Vector2f data;
+    PyVector(sf::Vector2f);
+    PyVector();
+    PyObject* pyObject();
+    static sf::Vector2f fromPy(PyObject*);
+    static sf::Vector2f fromPy(PyVectorObject*);
+    static PyObject* repr(PyObject*);
+    static Py_hash_t hash(PyObject*);
+    static int init(PyVectorObject*, PyObject*, PyObject*);
+    static PyObject* pynew(PyTypeObject* type, PyObject* args=NULL, PyObject* kwds=NULL);
+    static PyObject* get_member(PyObject*, void*);
+    static int set_member(PyObject*, PyObject*, void*);
+    
+    static PyGetSetDef getsetters[];
+};
+
+namespace mcrfpydef {
+    static PyTypeObject PyVectorType = {
+        .tp_name = "mcrfpy.Vector",
+        .tp_basicsize = sizeof(PyVectorObject),
+        .tp_itemsize = 0,
+        .tp_repr = PyVector::repr,
+        .tp_hash = PyVector::hash,
+        .tp_flags = Py_TPFLAGS_DEFAULT,
+        .tp_doc = PyDoc_STR("SFML Vector Object"),
+        .tp_getset = PyVector::getsetters,
+        .tp_init = (initproc)PyVector::init,
+        .tp_new = PyVector::pynew,
+    };
+}

src/Scene.cpp

@@ -4,7 +4,7 @@
 //Scene::Scene() { game = 0; std::cout << "WARN: default Scene constructor called. (game = " << game << ")" << std::endl;};
 Scene::Scene(GameEngine* g)
 {
-    key_callable = Py_None;
+    key_callable = std::make_unique<PyKeyCallable>();
     game = g; 
     ui_elements = std::make_shared<std::vector<std::shared_ptr<UIDrawable>>>();
 }
@@ -43,6 +43,7 @@ bool Scene::unregisterActionInjected(int code, std::string name)
 
 void Scene::key_register(PyObject* callable)
 {
+    /*
     if (key_callable)
     {
         // decrement reference before overwriting
@@ -50,11 +51,16 @@ void Scene::key_register(PyObject* callable)
     }
     key_callable = callable;
     Py_INCREF(key_callable);
+    */
+    key_callable = std::make_unique<PyKeyCallable>(callable);
 }
 
 void Scene::key_unregister()
 {
+    /*
     if (key_callable == NULL) return;
     Py_DECREF(key_callable);
     key_callable = NULL;
+    */
+    key_callable.reset();
 }

src/Scene.h

@@ -9,6 +9,7 @@
 #include "Common.h"
 #include <list>
 #include "UI.h"
+#include "PyCallable.h"
 //#include "GameEngine.h"
 
 class GameEngine; // forward declare
@@ -30,7 +31,7 @@ public:
     //Scene();
     Scene(GameEngine*);
     virtual void update() = 0;
-    virtual void sRender() = 0;
+    virtual void render() = 0;
     virtual void doAction(std::string, std::string) = 0;
     bool hasAction(std::string);
     bool hasAction(int);
@@ -41,7 +42,8 @@ public:
     
     std::shared_ptr<std::vector<std::shared_ptr<UIDrawable>>> ui_elements;
 
-    PyObject* key_callable;
+    //PyObject* key_callable;
+    std::unique_ptr<PyKeyCallable> key_callable;
     void key_register(PyObject*);
     void key_unregister();
 };

src/UI.cpp

@@ -1,465 +0,0 @@
-#include "UI.h"
-#include "Resources.h"
-#include "GameEngine.h"
-
-/* //callability fields & methods
-    PyObject* click_callable;
-    virtual UIDrawable* click_at(sf::Vector2f point);
-    void click_register(PyObject*);
-    void click_unregister();
-*/
-
-UIDrawable::UIDrawable() { click_callable = NULL;  }
-
-UIDrawable* UIFrame::click_at(sf::Vector2f point)
-{
-    for (auto e: *children)
-    {
-        auto p = e->click_at(point + box.getPosition());
-        if (p)
-            return p;
-    }
-    if (click_callable)
-    {
-        float x = box.getPosition().x, y = box.getPosition().y, w = box.getSize().x, h = box.getSize().y;
-        if (point.x > x && point.y > y && point.x < x+w && point.y < y+h) return this;
-    }
-    return NULL;
-}
-
-UIDrawable* UICaption::click_at(sf::Vector2f point)
-{
-    if (click_callable)
-    {
-        if (text.getGlobalBounds().contains(point)) return this;
-    }
-    return NULL;
-}
-
-UIDrawable* UISprite::click_at(sf::Vector2f point)
-{
-    if (click_callable)
-    {
-        if(sprite.getGlobalBounds().contains(point)) return this;
-    }
-    return NULL;
-}
-
-UIDrawable* UIGrid::click_at(sf::Vector2f point)
-{
-    if (click_callable)
-    {
-        if(box.getGlobalBounds().contains(point)) return this;
-    }
-    return NULL;
-}
-
-void UIDrawable::click_register(PyObject* callable)
-{
-    if (click_callable)
-    {
-        // decrement reference before overwriting
-        Py_DECREF(click_callable);
-    }
-    click_callable = callable;
-    Py_INCREF(click_callable);
-}
-
-void UIDrawable::click_unregister()
-{
-    if (click_callable == NULL) return;
-    Py_DECREF(click_callable);
-    click_callable = NULL;
-}
-
-void UIDrawable::render()
-{
-    //std::cout << "Rendering base UIDrawable\n";
-    render(sf::Vector2f());
-}
-UIFrame::UIFrame():
-//x(0), y(0), w(0), h(0), 
-outline(0)
-{
-    children = std::make_shared<std::vector<std::shared_ptr<UIDrawable>>>();
-    box.setPosition(0, 0);
-    box.setSize(sf::Vector2f(0, 0));
-    /*
-    pyOutlineColor = NULL;
-    pyFillColor = NULL;
-    _outlineColor = NULL;
-    _fillColor = NULL;
-    */
-}
-
-UIFrame::UIFrame(float _x, float _y, float _w, float _h):
-//x(_x), y(_y), w(_w), h(_h),
-outline(0)
-{
-    box.setPosition(_x, _y);
-    box.setSize(sf::Vector2f(_w, _h));
-    children = std::make_shared<std::vector<std::shared_ptr<UIDrawable>>>();
-    /*
-    pyOutlineColor = NULL;
-    pyFillColor = NULL;
-    _outlineColor = NULL;
-    _fillColor = NULL;
-    */
-}
-
-UIFrame::~UIFrame()
-{
-    children.reset();
-    /*
-    if (pyOutlineColor) Py_DECREF(pyOutlineColor);
-    else if (_outlineColor) delete _outlineColor;
-    if (pyFillColor) Py_DECREF(pyFillColor);
-    else if (_fillColor) delete _fillColor;
-    */
-}
-
-/*
-    sf::Color& fillColor(); // getter
-    void fillColor(sf::Color c); // C++ setter
-    void fillColor(PyObject* pyColor); // Python setter
-    
-    sf::Color& outlineColor(); // getter
-    void outlineColor(sf::Color c); // C++ setter
-    void outlineColor(PyObject* pyColor); // Python setter
-*/
-
-
-PyObjectsEnum UIFrame::derived_type()
-{
-    return PyObjectsEnum::UIFRAME;
-}
-
-void UIFrame::render(sf::Vector2f offset)
-{
-    //std::cout << "Rendering UIFrame w/ offset " << offset.x << ", " << offset.y << "\n";
-    //std::cout << "position = " << x << ", " << y << "\n";
-    box.move(offset);
-    Resources::game->getWindow().draw(box);
-    box.move(-offset);
-    //sf::RectangleShape box = sf::RectangleShape(sf::Vector2f(w,h));
-    //sf::Vector2f pos = sf::Vector2f(x, y);
-    //box.setPosition(offset + pos);
-    //if (_fillColor) { box.setFillColor(fillColor()); }
-    //if (_outlineColor) { box.setOutlineColor(outlineColor()); }
-    //box.setOutlineThickness(outline);
-    //Resources::game->getWindow().draw(box);
-    for (auto drawable : *children) {
-        drawable->render(offset + box.getPosition());
-    }
-}
-
-void UICaption::render(sf::Vector2f offset)
-{
-    //std::cout << "Rendering Caption with offset\n";
-    text.move(offset);
-    Resources::game->getWindow().draw(text);
-    text.move(-offset);
-}
-
-UISprite::UISprite() {}
-
-UISprite::UISprite(IndexTexture* _itex, int _sprite_index, float x = 0.0, float y = 0.0, float s = 1.0)
-: itex(_itex), sprite_index(_sprite_index)
-{
-    sprite.setTexture(_itex->texture);
-    sprite.setTextureRect(_itex->spriteCoordinates(_sprite_index));
-    sprite.setPosition(sf::Vector2f(x, y));
-    sprite.setScale(sf::Vector2f(s, s));
-}
-
-UISprite::UISprite(IndexTexture* _itex, int _sprite_index, sf::Vector2f pos, float s = 1.0)
-: itex(_itex), sprite_index(_sprite_index)
-{
-    sprite.setTexture(_itex->texture);
-    sprite.setTextureRect(_itex->spriteCoordinates(_sprite_index));
-    sprite.setPosition(pos);
-    sprite.setScale(sf::Vector2f(s, s));
-}
-
-//void UISprite::update()
-//{
-    //auto& tex = Resources::game->textures[texture_index];
-    //sprite.setTexture(tex.texture);
-    //sprite.setScale(sf::Vector2f(scale, scale));
-    //sprite.setPosition(sf::Vector2f(x, y));
-    //std::cout << "Drawable position: " << x << ", " << y << " -> " << s.getPosition().x << ", " << s.getPosition().y << std::endl;
-    //sprite.setTextureRect(tex.spriteCoordinates(sprite_index));
-//}
-
-void UISprite::render(sf::Vector2f offset)
-{
-    sprite.move(offset);
-    Resources::game->getWindow().draw(sprite);
-    sprite.move(-offset);
-}
-
-// 7DRL hack; needed to draw entities to UIGrid. TODO, apply this technique to all UIDrawables
-void UISprite::render(sf::Vector2f offset, sf::RenderTexture& target)
-{
-    sprite.move(offset);
-    target.draw(sprite);
-    sprite.move(-offset);
-}
-
-void UISprite::setPosition(float x, float y)
-{
-    setPosition(sf::Vector2f(x, y));
-}
-
-void UISprite::setPosition(sf::Vector2f pos)
-{
-    sprite.setPosition(pos);
-}
-
-void UISprite::setScale(float s)
-{
-    sprite.setScale(sf::Vector2f(s, s));
-}
-
-PyObjectsEnum UICaption::derived_type()
-{
-    return PyObjectsEnum::UICAPTION;
-}
-
-PyObjectsEnum UISprite::derived_type()
-{
-    return PyObjectsEnum::UISPRITE;
-}
-
-// UIGrid support classes' methods
-
-UIGridPoint::UIGridPoint()
-:color(1.0f, 1.0f, 1.0f), color_overlay(0.0f, 0.0f, 0.0f), walkable(false), transparent(false),
- tilesprite(-1), tile_overlay(-1), uisprite(-1)
-{
-}
-
-UIEntity::UIEntity() {} // this will not work lol. TODO remove default constructor by finding the shared pointer inits that use it
-
-UIEntity::UIEntity(UIGrid& grid)
-: gridstate(grid.grid_x * grid.grid_y)
-{
-}
-
-// UIGrid methods
-
-UIGrid::UIGrid()
-{
-}
-
-UIGrid::UIGrid(int gx, int gy, IndexTexture* _itex, float _x, float _y, float _w, float _h)
-: grid_x(gx), grid_y(gy),
-  zoom(1.0f), center_x((gx/2) * _itex->grid_size), center_y((gy/2) * _itex->grid_size),
-  itex(_itex), points(gx * gy)
-{
-    // set up blank list of entities
-    entities = std::make_shared<std::list<std::shared_ptr<UIEntity>>>();
-
-    box.setSize(sf::Vector2f(_w, _h));
-    box.setPosition(sf::Vector2f(_x, _y));
-
-    box.setFillColor(sf::Color(0,0,0,0));
-    renderTexture.create(_w, _h);
-    sprite.setTexture(_itex->texture);
-    output.setTextureRect(
-         sf::IntRect(0, 0,
-         box.getSize().x, box.getSize().y));
-     output.setPosition(box.getPosition());
-     // textures are upside-down inside renderTexture
-     output.setTexture(renderTexture.getTexture());
-}
-
-UIGrid::UIGrid(int gx, int gy, IndexTexture* _itex, sf::Vector2f _xy, sf::Vector2f _wh)
-: grid_x(gx), grid_y(gy),
-  zoom(1.0f), center_x((gx/2) * _itex->grid_size), center_y((gy/2) * _itex->grid_size),
-  itex(_itex), points(gx * gy)
-{
-    // set up blank list of entities
-    entities = std::make_shared<std::list<std::shared_ptr<UIEntity>>>();
-
-    box.setSize(_wh);
-    box.setPosition(_xy); 
-
-    box.setFillColor(sf::Color(0,0,0,0));
-    //renderTexture.create(_wh.x, _wh.y);
-    // create renderTexture with maximum theoretical size; sprite can resize to show whatever amount needs to be rendered
-    renderTexture.create(1920, 1080); // TODO - renderTexture should be window size; above 1080p this will cause rendering errors
-    
-    sprite.setTexture(_itex->texture);
-    output.setTextureRect(
-         sf::IntRect(0, 0,
-         box.getSize().x, box.getSize().y));
-     output.setPosition(box.getPosition());
-     // textures are upside-down inside renderTexture
-     output.setTexture(renderTexture.getTexture());
-
-}
-
-void UIGrid::update()
-{
-}
-
-void UIGrid::setSprite(int ti)
-{
-        int tx = ti % itex->grid_width, ty = ti / itex->grid_width;
-            sprite.setTextureRect(sf::IntRect(tx * itex->grid_size, ty * itex->grid_size, itex->grid_size, itex->grid_size));
-}
-
-void UIGrid::render(sf::Vector2f)
-{
-    output.setPosition(box.getPosition()); // output sprite can move; update position when drawing
-    // output size can change; update size when drawing
-    output.setTextureRect(
-         sf::IntRect(0, 0,
-         box.getSize().x, box.getSize().y));
-    renderTexture.clear(sf::Color(8, 8, 8, 255)); // TODO - UIGrid needs a "background color" field
-    // sprites that are visible according to zoom, center_x, center_y, and box width
-    float center_x_sq = center_x / itex->grid_size;
-    float center_y_sq = center_y / itex->grid_size;
-
-    float width_sq = box.getSize().x / (itex->grid_size * zoom);
-    float height_sq = box.getSize().y / (itex->grid_size * zoom);
-    float left_edge = center_x_sq - (width_sq / 2.0);
-    float top_edge = center_y_sq - (height_sq / 2.0);
-
-    int left_spritepixels = center_x - (box.getSize().x / 2.0 / zoom);
-    int top_spritepixels = center_y - (box.getSize().y / 2.0 / zoom);
-
-    sprite.setScale(sf::Vector2f(zoom, zoom));
-    sf::RectangleShape r; // for colors and overlays
-    r.setSize(sf::Vector2f(itex->grid_size * zoom, itex->grid_size * zoom));
-    r.setOutlineThickness(0);
-
-    int x_limit = left_edge + width_sq + 2;
-    if (x_limit > grid_x) x_limit = grid_x;
-
-    int y_limit = top_edge + height_sq + 2;
-    if (y_limit > grid_y) y_limit = grid_y;
-
-    // base layer - bottom color, tile sprite ("ground")
-    for (int x = (left_edge - 1 >= 0 ? left_edge - 1 : 0);
-        x < x_limit; //x < view_width; 
-        x+=1)
-    {
-        //for (float y = (top_edge >= 0 ? top_edge : 0); 
-        for (int y = (top_edge - 1 >= 0 ? top_edge - 1 : 0);
-            y < y_limit; //y < view_height;
-            y+=1)
-        {
-            auto pixel_pos = sf::Vector2f(
-                    (x*itex->grid_size - left_spritepixels) * zoom,
-                    (y*itex->grid_size - top_spritepixels) * zoom );
-
-            auto gridpoint = at(std::floor(x), std::floor(y));
-
-            sprite.setPosition(pixel_pos);
-
-            r.setPosition(pixel_pos);
-            r.setFillColor(gridpoint.color);
-            renderTexture.draw(r);
-
-            // tilesprite
-            // if discovered but not visible, set opacity to 90%
-            // if not discovered... just don't draw it?
-            if (gridpoint.tilesprite != -1) {
-                setSprite(gridpoint.tilesprite);
-                renderTexture.draw(sprite);
-            }
-        }
-    }
-
-    // middle layer - entities
-    // disabling entity rendering until I can render their UISprite inside the rendertexture (not directly to window)
-    for (auto e : *entities) {
-        // TODO skip out-of-bounds entities (grid square not visible at all, check for partially on visible grid squares / floating point grid position)
-        //auto drawent = e->cGrid->indexsprite.drawable();
-        auto drawent = e->sprite;
-        //drawent.setScale(zoom, zoom);
-        drawent.setScale(zoom);
-        auto pixel_pos = sf::Vector2f(
-            (e->position.x*itex->grid_size - left_spritepixels) * zoom,
-            (e->position.y*itex->grid_size - top_spritepixels) * zoom );
-        //drawent.setPosition(pixel_pos);
-        //renderTexture.draw(drawent);
-        drawent.render(pixel_pos, renderTexture);
-    }
-    
-
-    // top layer - opacity for discovered / visible status (debug, basically)
-    /* // Disabled until I attach a "perspective"
-    for (int x = (left_edge - 1 >= 0 ? left_edge - 1 : 0);
-        x < x_limit; //x < view_width; 
-        x+=1)
-    {
-        //for (float y = (top_edge >= 0 ? top_edge : 0); 
-        for (int y = (top_edge - 1 >= 0 ? top_edge - 1 : 0);
-            y < y_limit; //y < view_height;
-            y+=1)
-        {
-
-            auto pixel_pos = sf::Vector2f(
-                    (x*itex->grid_size - left_spritepixels) * zoom,
-                    (y*itex->grid_size - top_spritepixels) * zoom );
-
-            auto gridpoint = at(std::floor(x), std::floor(y));
-
-            sprite.setPosition(pixel_pos);
-
-            r.setPosition(pixel_pos);
-
-            // visible & discovered layers for testing purposes
-            if (!gridpoint.discovered) {
-                r.setFillColor(sf::Color(16, 16, 20, 192)); // 255 opacity for actual blackout
-                renderTexture.draw(r);
-            } else if (!gridpoint.visible) {
-                r.setFillColor(sf::Color(32, 32, 40, 128));
-                renderTexture.draw(r);
-            }
-
-            // overlay
-
-            // uisprite
-        }
-    }
-    */
-
-    // grid lines for testing & validation
-    /*
-    sf::Vertex line[] =
-    {
-        sf::Vertex(sf::Vector2f(0, 0), sf::Color::Red),
-        sf::Vertex(box.getSize(), sf::Color::Red),
-
-    };
-
-    renderTexture.draw(line, 2, sf::Lines);
-    sf::Vertex lineb[] =
-    {
-        sf::Vertex(sf::Vector2f(0, box.getSize().y), sf::Color::Blue),
-        sf::Vertex(sf::Vector2f(box.getSize().x, 0), sf::Color::Blue),
-
-    };
-
-    renderTexture.draw(lineb, 2, sf::Lines);
-    */
-
-    // render to window
-    renderTexture.display();
-    Resources::game->getWindow().draw(output);
-
-}
-
-UIGridPoint& UIGrid::at(int x, int y)
-{
-    return points[y * grid_x + x];
-}
-
-PyObjectsEnum UIGrid::derived_type()
-{
-    return PyObjectsEnum::UIGRID;
-}

src/UIBase.h

@@ -0,0 +1,32 @@
+#pragma once
+
+class UIEntity;
+typedef struct {
+    PyObject_HEAD
+    std::shared_ptr<UIEntity> data;
+} PyUIEntityObject;
+
+class UIFrame;
+typedef struct {
+    PyObject_HEAD
+    std::shared_ptr<UIFrame> data;
+} PyUIFrameObject;
+
+class UICaption;
+typedef struct {
+    PyObject_HEAD
+    std::shared_ptr<UICaption> data;
+    PyObject* font;
+} PyUICaptionObject;
+
+class UIGrid;
+typedef struct {
+    PyObject_HEAD
+    std::shared_ptr<UIGrid> data;
+} PyUIGridObject;
+
+class UISprite;
+typedef struct {
+    PyObject_HEAD
+    std::shared_ptr<UISprite> data;
+} PyUISpriteObject;

src/UICaption.cpp

@@ -0,0 +1,283 @@
+#include "UICaption.h"
+#include "GameEngine.h"
+#include "PyColor.h"
+#include "PyVector.h"
+#include "PyFont.h"
+
+UIDrawable* UICaption::click_at(sf::Vector2f point)
+{
+    if (click_callable)
+    {
+        if (text.getGlobalBounds().contains(point)) return this;
+    }
+    return NULL;
+}
+
+void UICaption::render(sf::Vector2f offset)
+{
+    text.move(offset);
+    Resources::game->getWindow().draw(text);
+    text.move(-offset);
+}
+
+PyObjectsEnum UICaption::derived_type()
+{
+    return PyObjectsEnum::UICAPTION;
+}
+
+PyObject* UICaption::get_float_member(PyUICaptionObject* self, void* closure)
+{
+    auto member_ptr = reinterpret_cast<long>(closure);
+    if (member_ptr == 0)
+        return PyFloat_FromDouble(self->data->text.getPosition().x);
+    else if (member_ptr == 1)
+        return PyFloat_FromDouble(self->data->text.getPosition().y);
+    else if (member_ptr == 4)
+        return PyFloat_FromDouble(self->data->text.getOutlineThickness());
+    else if (member_ptr == 5)
+        return PyLong_FromLong(self->data->text.getCharacterSize());
+    else
+    {
+        PyErr_SetString(PyExc_AttributeError, "Invalid attribute");
+        return nullptr;
+    }
+}
+
+int UICaption::set_float_member(PyUICaptionObject* self, PyObject* value, void* closure)
+{
+    float val;
+    auto member_ptr = reinterpret_cast<long>(closure);
+    if (PyFloat_Check(value))
+    {
+        val = PyFloat_AsDouble(value);
+    }
+    else if (PyLong_Check(value))
+    {
+        val = PyLong_AsLong(value);
+    }
+    else
+    {
+        PyErr_SetString(PyExc_TypeError, "Value must be an integer.");
+        return -1;
+    }
+    if (member_ptr == 0) //x
+        self->data->text.setPosition(val, self->data->text.getPosition().y);
+    else if (member_ptr == 1) //y
+        self->data->text.setPosition(self->data->text.getPosition().x, val);
+    else if (member_ptr == 4) //outline
+        self->data->text.setOutlineThickness(val);
+    else if (member_ptr == 5) // character size
+        self->data->text.setCharacterSize(val);
+    return 0;
+}
+
+PyObject* UICaption::get_vec_member(PyUICaptionObject* self, void* closure)
+{
+    return PyVector(self->data->text.getPosition()).pyObject();
+}
+
+int UICaption::set_vec_member(PyUICaptionObject* self, PyObject* value, void* closure)
+{
+    self->data->text.setPosition(PyVector::fromPy(value));
+    return 0;
+}
+
+PyObject* UICaption::get_color_member(PyUICaptionObject* self, void* closure)
+{
+    // TODO: migrate this code to a switch statement - validate closure & return values in one tighter, more extensible structure
+
+    // validate closure (should be impossible to be wrong, but it's thorough)
+    auto member_ptr = reinterpret_cast<long>(closure);
+    if (member_ptr != 0 && member_ptr != 1)
+    {
+        PyErr_SetString(PyExc_AttributeError, "Invalid attribute");
+        return nullptr;
+    }
+
+    // TODO: manually calling tp_alloc to create a PyColorObject seems like an antipattern
+    // fetch correct member data
+    sf::Color color;
+
+    if (member_ptr == 0)
+    {
+        color = self->data->text.getFillColor();
+    }
+    else if (member_ptr == 1)
+    {
+        color = self->data->text.getOutlineColor();
+    }
+
+    return PyColor(color).pyObject();
+}
+
+int UICaption::set_color_member(PyUICaptionObject* self, PyObject* value, void* closure)
+{
+    auto member_ptr = reinterpret_cast<long>(closure);
+    //TODO: this logic of (PyColor instance OR tuple -> sf::color) should be encapsulated for reuse
+    int r, g, b, a;
+    if (PyObject_IsInstance(value, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Color")  /*(PyObject*)&mcrfpydef::PyColorType)*/))
+    {
+        // get value from mcrfpy.Color instance
+        auto c = ((PyColorObject*)value)->data;
+        r = c.r; g = c.g; b = c.b; a = c.a;
+        std::cout << "got " << int(r) << ", " << int(g) << ", " << int(b) << ", " << int(a) << std::endl;
+    }
+    else if (!PyTuple_Check(value) || PyTuple_Size(value) < 3 || PyTuple_Size(value) > 4)
+    {
+        // reject non-Color, non-tuple value
+        PyErr_SetString(PyExc_TypeError, "Value must be a tuple of 3 or 4 integers or an mcrfpy.Color object.");
+        return -1;
+    }
+    else // get value from tuples
+    {
+        r = PyLong_AsLong(PyTuple_GetItem(value, 0));
+        g = PyLong_AsLong(PyTuple_GetItem(value, 1));
+        b = PyLong_AsLong(PyTuple_GetItem(value, 2));
+        a = 255;
+
+        if (PyTuple_Size(value) == 4)
+        {
+            a = PyLong_AsLong(PyTuple_GetItem(value, 3));
+        }
+    }
+
+    if (r < 0 || r > 255 || g < 0 || g > 255 || b < 0 || b > 255 || a < 0 || a > 255)
+    {
+        PyErr_SetString(PyExc_ValueError, "Color values must be between 0 and 255.");
+        return -1;
+    }
+
+    if (member_ptr == 0)
+    {
+        self->data->text.setFillColor(sf::Color(r, g, b, a));
+    }
+    else if (member_ptr == 1)
+    {
+        self->data->text.setOutlineColor(sf::Color(r, g, b, a));
+    }
+    else
+    {
+        PyErr_SetString(PyExc_AttributeError, "Invalid attribute");
+        return -1;
+    }
+
+    return 0;
+}
+
+
+//TODO: evaluate use of Resources::caption_buffer... can't I do this with a std::string?
+PyObject* UICaption::get_text(PyUICaptionObject* self, void* closure)
+{
+    Resources::caption_buffer = self->data->text.getString();
+    return PyUnicode_FromString(Resources::caption_buffer.c_str());
+}
+
+int UICaption::set_text(PyUICaptionObject* self, PyObject* value, void* closure)
+{
+    PyObject* s = PyObject_Str(value);
+    PyObject * temp_bytes = PyUnicode_AsEncodedString(s, "UTF-8", "strict"); // Owned reference
+    if (temp_bytes != NULL) {
+        Resources::caption_buffer = PyBytes_AS_STRING(temp_bytes); // Borrowed pointer
+        Py_DECREF(temp_bytes);
+    }
+    self->data->text.setString(Resources::caption_buffer);
+    return 0;
+}
+
+PyGetSetDef UICaption::getsetters[] = {
+    {"x", (getter)UICaption::get_float_member, (setter)UICaption::set_float_member, "X coordinate of top-left corner",   (void*)0},
+    {"y", (getter)UICaption::get_float_member, (setter)UICaption::set_float_member, "Y coordinate of top-left corner",   (void*)1},
+    {"pos", (getter)UICaption::get_vec_member, (setter)UICaption::set_vec_member, "(x, y) vector", (void*)0},
+    //{"w", (getter)PyUIFrame_get_float_member, (setter)PyUIFrame_set_float_member, "width of the rectangle",   (void*)2},
+    //{"h", (getter)PyUIFrame_get_float_member, (setter)PyUIFrame_set_float_member, "height of the rectangle",   (void*)3},
+    {"outline", (getter)UICaption::get_float_member, (setter)UICaption::set_float_member, "Thickness of the border",   (void*)4},
+    {"fill_color", (getter)UICaption::get_color_member, (setter)UICaption::set_color_member, "Fill color of the text", (void*)0},
+    {"outline_color", (getter)UICaption::get_color_member, (setter)UICaption::set_color_member, "Outline color of the text", (void*)1},
+    //{"children", (getter)PyUIFrame_get_children, NULL, "UICollection of objects on top of this one", NULL},
+    {"text", (getter)UICaption::get_text, (setter)UICaption::set_text, "The text displayed", NULL},
+    {"size", (getter)UICaption::get_float_member, (setter)UICaption::set_float_member, "Text size (integer) in points", (void*)5},
+    {"click", (getter)UIDrawable::get_click, (setter)UIDrawable::set_click, "Object called with (x, y, button) when clicked", (void*)PyObjectsEnum::UICAPTION},
+    {NULL}
+};
+
+PyObject* UICaption::repr(PyUICaptionObject* self)
+{
+    std::ostringstream ss;
+    if (!self->data) ss << "<Caption (invalid internal object)>";
+    else {
+        auto text = self->data->text;
+        auto fc = text.getFillColor();
+        auto oc = text.getOutlineColor();
+        ss << "<Caption (x=" << text.getPosition().x << ", y=" << text.getPosition().y << ", " <<
+            "text='" << (std::string)text.getString() << "', " <<
+            "outline=" << text.getOutlineThickness() << ", " <<
+            "fill_color=(" << (int)fc.r << ", " << (int)fc.g << ", " << (int)fc.b << ", " << (int)fc.a <<"), " <<
+            "outline_color=(" << (int)oc.r << ", " << (int)oc.g << ", " << (int)oc.b << ", " << (int)oc.a <<"), " <<
+            ")>";
+    }
+    std::string repr_str = ss.str();
+    return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
+}
+
+int UICaption::init(PyUICaptionObject* self, PyObject* args, PyObject* kwds)
+{
+    using namespace mcrfpydef;
+    static const char* keywords[] = { "x", "y", "text", "font", "fill_color", "outline_color", "outline", nullptr };
+    float x = 0.0f, y = 0.0f, outline = 0.0f;
+    char* text;
+    PyObject* font=NULL, *fill_color=NULL, *outline_color=NULL;
+
+    if (!PyArg_ParseTupleAndKeywords(args, kwds, "|ffzOOOf",
+        const_cast<char**>(keywords), &x, &y, &text, &font, &fill_color, &outline_color, &outline))
+    {
+        return -1;
+    }
+
+    // check types for font, fill_color, outline_color
+
+    std::cout << PyUnicode_AsUTF8(PyObject_Repr(font)) << std::endl;
+    if (font != NULL && !PyObject_IsInstance(font, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Font")/*(PyObject*)&PyFontType)*/)){
+        PyErr_SetString(PyExc_TypeError, "font must be a mcrfpy.Font instance");
+        return -1;
+    } else if (font != NULL)
+    {
+        auto font_obj = (PyFontObject*)font;
+        self->data->text.setFont(font_obj->data->font);
+        self->font = font;
+        Py_INCREF(font);
+    } else
+    {
+        // default font
+        //self->data->text.setFont(Resources::game->getFont());
+    }
+
+    self->data->text.setPosition(sf::Vector2f(x, y));
+    self->data->text.setString((std::string)text);
+    self->data->text.setOutlineThickness(outline);
+    if (fill_color) {
+        auto fc = PyColor::from_arg(fill_color);
+        if (!fc) {
+            PyErr_SetString(PyExc_TypeError, "fill_color must be mcrfpy.Color or arguments to mcrfpy.Color.__init__");
+            return -1;
+        }
+        self->data->text.setFillColor(PyColor::fromPy(fc));
+        //Py_DECREF(fc);
+    } else {
+        self->data->text.setFillColor(sf::Color(0,0,0,255));
+    }
+
+    if (outline_color) {
+        auto oc = PyColor::from_arg(outline_color);
+        if (!oc) {
+            PyErr_SetString(PyExc_TypeError, "outline_color must be mcrfpy.Color or arguments to mcrfpy.Color.__init__");
+            return -1;
+        }
+        self->data->text.setOutlineColor(PyColor::fromPy(oc));
+        //Py_DECREF(oc);
+    } else {
+        self->data->text.setOutlineColor(sf::Color(128,128,128,255));
+    }
+
+    return 0;
+}
+

src/UICaption.h

@@ -0,0 +1,62 @@
+#pragma once
+#include "Common.h"
+#include "Python.h"
+#include "UIDrawable.h"
+
+class UICaption: public UIDrawable
+{
+public:
+    sf::Text text;
+    void render(sf::Vector2f) override final;
+    PyObjectsEnum derived_type() override final;
+    virtual UIDrawable* click_at(sf::Vector2f point) override final;
+
+    static PyObject* get_float_member(PyUICaptionObject* self, void* closure);
+    static int set_float_member(PyUICaptionObject* self, PyObject* value, void* closure);
+    static PyObject* get_vec_member(PyUICaptionObject* self, void* closure);
+    static int set_vec_member(PyUICaptionObject* self, PyObject* value, void* closure);
+    static PyObject* get_color_member(PyUICaptionObject* self, void* closure);
+    static int set_color_member(PyUICaptionObject* self, PyObject* value, void* closure);
+    static PyObject* get_text(PyUICaptionObject* self, void* closure);
+    static int set_text(PyUICaptionObject* self, PyObject* value, void* closure);
+    static PyGetSetDef getsetters[];
+    static PyObject* repr(PyUICaptionObject* self);
+    static int init(PyUICaptionObject* self, PyObject* args, PyObject* kwds);
+
+};
+
+namespace mcrfpydef {
+    static PyTypeObject PyUICaptionType = {
+        .tp_name = "mcrfpy.Caption",
+        .tp_basicsize = sizeof(PyUICaptionObject),
+        .tp_itemsize = 0,
+        // TODO - move tp_dealloc to .cpp file as static function (UICaption::dealloc)
+        .tp_dealloc = (destructor)[](PyObject* self)
+        {
+            PyUICaptionObject* obj = (PyUICaptionObject*)self;
+            // TODO - reevaluate with PyFont usage; UICaption does not own the font
+            // release reference to font object
+            if (obj->font) Py_DECREF(obj->font);
+            obj->data.reset();
+            Py_TYPE(self)->tp_free(self);
+        },
+        .tp_repr = (reprfunc)UICaption::repr,
+        //.tp_hash = NULL,
+        //.tp_iter
+        //.tp_iternext
+        .tp_flags = Py_TPFLAGS_DEFAULT,
+        .tp_doc = PyDoc_STR("docstring"),
+        //.tp_methods = PyUIFrame_methods,
+        //.tp_members = PyUIFrame_members,
+        .tp_getset = UICaption::getsetters,
+        //.tp_base = NULL,
+        .tp_init = (initproc)UICaption::init,
+        // TODO - move tp_new to .cpp file as a static function (UICaption::new)
+        .tp_new = [](PyTypeObject* type, PyObject* args, PyObject* kwds) -> PyObject*
+        {
+            PyUICaptionObject* self = (PyUICaptionObject*)type->tp_alloc(type, 0);
+            if (self) self->data = std::make_shared<UICaption>();
+            return (PyObject*)self;
+        }
+    };
+}

src/UICollection.cpp

@@ -0,0 +1,203 @@
+#include "UICollection.h"
+
+#include "UIFrame.h"
+#include "UICaption.h"
+#include "UISprite.h"
+#include "UIGrid.h"
+#include "McRFPy_API.h"
+
+using namespace mcrfpydef;
+
+int UICollectionIter::init(PyUICollectionIterObject* self, PyObject* args, PyObject* kwds)
+{
+    PyErr_SetString(PyExc_TypeError, "UICollection cannot be instantiated: a C++ data source is required.");
+    return -1;
+}
+
+PyObject* UICollectionIter::next(PyUICollectionIterObject* self)
+{
+    if (self->data->size() != self->start_size)
+    {
+        PyErr_SetString(PyExc_RuntimeError, "collection changed size during iteration");
+        return NULL;
+    }
+
+    if (self->index > self->start_size - 1)
+    {
+        PyErr_SetNone(PyExc_StopIteration);
+        return NULL;
+    }
+	self->index++;
+    auto vec = self->data.get();
+    if (!vec)
+    {
+        PyErr_SetString(PyExc_RuntimeError, "the collection store returned a null pointer");
+        return NULL;
+    }
+    auto target = (*vec)[self->index-1];
+    // TODO build PyObject* of the correct UIDrawable subclass to return
+    //return py_instance(target);
+    return NULL;
+}
+
+PyObject* UICollectionIter::repr(PyUICollectionIterObject* self)
+{
+	std::ostringstream ss;
+	if (!self->data) ss << "<UICollectionIter (invalid internal object)>";
+	else {
+	    ss << "<UICollectionIter (" << self->data->size() << " child objects, @ index " << self->index  << ")>";
+	}
+	std::string repr_str = ss.str();
+	return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
+}
+
+Py_ssize_t UICollection::len(PyUICollectionObject* self) {
+	return self->data->size();
+}
+
+PyObject* UICollection::getitem(PyUICollectionObject* self, Py_ssize_t index) {
+	// build a Python version of item at self->data[index]
+    //  Copy pasted::
+    auto vec = self->data.get();
+    if (!vec)
+    {
+        PyErr_SetString(PyExc_RuntimeError, "the collection store returned a null pointer");
+        return NULL;
+    }
+    while (index < 0) index += self->data->size();
+    if (index > self->data->size() - 1)
+    {
+        PyErr_SetString(PyExc_IndexError, "UICollection index out of range");
+        return NULL;
+    }
+    auto target = (*vec)[index];
+    RET_PY_INSTANCE(target);
+return NULL;
+
+
+}
+
+PySequenceMethods UICollection::sqmethods = {
+	.sq_length = (lenfunc)UICollection::len,
+	.sq_item = (ssizeargfunc)UICollection::getitem,
+	//.sq_item_by_index = PyUICollection_getitem
+	//.sq_slice - return a subset of the iterable
+	//.sq_ass_item - called when `o[x] = y` is executed (x is any object type)
+	//.sq_ass_slice - cool; no thanks, for now
+	//.sq_contains - called when `x in o` is executed
+	//.sq_ass_item_by_index - called when `o[x] = y` is executed (x is explictly an integer)
+};
+
+/* Idiomatic way to fetch complete types from the API rather than referencing their PyTypeObject struct
+
+auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "Texture");
+
+I never identified why `using namespace mcrfpydef;` doesn't solve the segfault issue.
+The horrible macro in UIDrawable was originally a workaround for this, but as I interact with the types outside of the monster UI.h, a more general (and less icky) solution is required.
+
+*/
+
+PyObject* UICollection::append(PyUICollectionObject* self, PyObject* o)
+{
+	// if not UIDrawable subclass, reject it
+	// self->data->push_back( c++ object inside o );
+
+    // this would be a great use case for .tp_base
+    if (!PyObject_IsInstance(o, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Frame")) &&
+        !PyObject_IsInstance(o, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Sprite")) &&
+        !PyObject_IsInstance(o, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Caption")) &&
+        !PyObject_IsInstance(o, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Grid"))
+        )
+    {
+        PyErr_SetString(PyExc_TypeError, "Only Frame, Caption, Sprite, and Grid objects can be added to UICollection");
+        return NULL;
+    }
+
+    if (PyObject_IsInstance(o, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Frame")))
+    {
+        PyUIFrameObject* frame = (PyUIFrameObject*)o;
+        self->data->push_back(frame->data);
+    }
+    if (PyObject_IsInstance(o, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Caption")))
+    {
+        PyUICaptionObject* caption = (PyUICaptionObject*)o;
+        self->data->push_back(caption->data);
+    }
+    if (PyObject_IsInstance(o, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Sprite")))
+    {
+        PyUISpriteObject* sprite = (PyUISpriteObject*)o;
+        self->data->push_back(sprite->data);
+    }
+    if (PyObject_IsInstance(o, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Grid")))
+    {
+        PyUIGridObject* grid = (PyUIGridObject*)o;
+        self->data->push_back(grid->data);
+    }
+
+    Py_INCREF(Py_None);
+    return Py_None;
+}
+
+PyObject* UICollection::remove(PyUICollectionObject* self, PyObject* o)
+{
+	if (!PyLong_Check(o))
+    {
+        PyErr_SetString(PyExc_TypeError, "UICollection.remove requires an integer index to remove");
+        return NULL;
+    }
+	long index = PyLong_AsLong(o);
+	if (index >= self->data->size())
+    {
+        PyErr_SetString(PyExc_ValueError, "Index out of range");
+        return NULL;
+    }
+    else if (index < 0)
+    {
+        PyErr_SetString(PyExc_NotImplementedError, "reverse indexing is not implemented.");
+        return NULL;
+    }
+
+	// release the shared pointer at self->data[index];
+    self->data->erase(self->data->begin() + index);
+    Py_INCREF(Py_None);
+    return Py_None;
+}
+
+PyMethodDef UICollection::methods[] = {
+	{"append", (PyCFunction)UICollection::append, METH_O},
+    //{"extend", (PyCFunction)PyUICollection_extend, METH_O}, // TODO
+	{"remove", (PyCFunction)UICollection::remove, METH_O},
+	{NULL, NULL, 0, NULL}
+};
+
+PyObject* UICollection::repr(PyUICollectionObject* self)
+{
+	std::ostringstream ss;
+	if (!self->data) ss << "<UICollection (invalid internal object)>";
+	else {
+	    ss << "<UICollection (" << self->data->size() << " child objects)>";
+	}
+	std::string repr_str = ss.str();
+	return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
+}
+
+int UICollection::init(PyUICollectionObject* self, PyObject* args, PyObject* kwds)
+{
+    PyErr_SetString(PyExc_TypeError, "UICollection cannot be instantiated: a C++ data source is required.");
+    return -1;
+}
+
+PyObject* UICollection::iter(PyUICollectionObject* self)
+{
+    PyUICollectionIterObject* iterObj;
+    iterObj = (PyUICollectionIterObject*)PyUICollectionIterType.tp_alloc(&PyUICollectionIterType, 0);
+    if (iterObj == NULL) {
+        return NULL;  // Failed to allocate memory for the iterator object
+    }
+
+    iterObj->data = self->data;
+    iterObj->index = 0;
+    iterObj->start_size = self->data->size();
+
+    return (PyObject*)iterObj;
+}

src/UICollection.h

@@ -0,0 +1,88 @@
+#pragma once
+#include "Common.h"
+#include "Python.h"
+
+#include "UIDrawable.h"
+
+class UICollectionIter
+{
+    // really more of a namespace: all the members are public and static. But being consistent with other UI objects
+public:
+    static int init(PyUICollectionIterObject* self, PyObject* args, PyObject* kwds);
+    static PyObject* next(PyUICollectionIterObject* self);
+    static PyObject* repr(PyUICollectionIterObject* self);
+};
+
+class UICollection
+{
+    // really more of a namespace: all the members are public and static. But being consistent with other UI objects
+public:
+    static Py_ssize_t len(PyUICollectionObject* self);
+	static PyObject* getitem(PyUICollectionObject* self, Py_ssize_t index);
+	static PySequenceMethods sqmethods;
+	static PyObject* append(PyUICollectionObject* self, PyObject* o);
+	static PyObject* remove(PyUICollectionObject* self, PyObject* o);
+	static PyMethodDef methods[];
+	static PyObject* repr(PyUICollectionObject* self);
+    static int init(PyUICollectionObject* self, PyObject* args, PyObject* kwds);
+    static PyObject* iter(PyUICollectionObject* self);
+};
+
+namespace mcrfpydef {
+    static PyTypeObject PyUICollectionIterType = {
+        //PyVarObject_HEAD_INIT(NULL, 0)
+        .tp_name = "mcrfpy.UICollectionIter",
+        .tp_basicsize = sizeof(PyUICollectionIterObject),
+        .tp_itemsize = 0,
+        //TODO - as static method, not inline lambda def, please
+        .tp_dealloc = (destructor)[](PyObject* self)
+        {
+            PyUICollectionIterObject* obj = (PyUICollectionIterObject*)self;
+            obj->data.reset();
+            Py_TYPE(self)->tp_free(self);
+        },
+        .tp_repr = (reprfunc)UICollectionIter::repr,
+        .tp_flags = Py_TPFLAGS_DEFAULT,
+        .tp_doc = PyDoc_STR("Iterator for a collection of UI objects"),
+        .tp_iternext = (iternextfunc)UICollectionIter::next,
+        //.tp_getset = PyUICollection_getset,
+        .tp_init = (initproc)UICollectionIter::init, // just raise an exception
+        //TODO - as static method, not inline lambda def, please
+        .tp_new = [](PyTypeObject* type, PyObject* args, PyObject* kwds) -> PyObject*
+        {
+            PyErr_SetString(PyExc_TypeError, "UICollection cannot be instantiated: a C++ data source is required.");
+            return NULL;
+        }
+    };
+
+	static PyTypeObject PyUICollectionType = {
+		//PyVarObject_/HEAD_INIT(NULL, 0)
+		.tp_name = "mcrfpy.UICollection",
+		.tp_basicsize = sizeof(PyUICollectionObject),
+		.tp_itemsize = 0,
+        //TODO - as static method, not inline lambda def, please
+		.tp_dealloc = (destructor)[](PyObject* self)
+		{
+		    PyUICollectionObject* obj = (PyUICollectionObject*)self;
+		    obj->data.reset();
+		    Py_TYPE(self)->tp_free(self);
+		},
+		.tp_repr = (reprfunc)UICollection::repr,
+		.tp_as_sequence = &UICollection::sqmethods,
+		.tp_flags = Py_TPFLAGS_DEFAULT,
+		.tp_doc = PyDoc_STR("Iterable, indexable collection of UI objects"),
+        .tp_iter = (getiterfunc)UICollection::iter,
+		.tp_methods = UICollection::methods, // append, remove
+        //.tp_getset = PyUICollection_getset,
+		.tp_init = (initproc)UICollection::init, // just raise an exception
+        //TODO - as static method, not inline lambda def, please
+		.tp_new = [](PyTypeObject* type, PyObject* args, PyObject* kwds) -> PyObject*
+		{
+            // Does PyUICollectionType need __new__ if it's not supposed to be instantiable by the user? 
+            // Should I just raise an exception? Or is the uninitialized shared_ptr enough of a blocker?
+            PyErr_SetString(PyExc_TypeError, "UICollection cannot be instantiated: a C++ data source is required.");
+		    return NULL;
+		}
+	};
+
+}

src/UIDrawable.cpp

@@ -0,0 +1,81 @@
+#include "UIDrawable.h"
+#include "UIFrame.h"
+#include "UICaption.h"
+#include "UISprite.h"
+#include "UIGrid.h"
+
+UIDrawable::UIDrawable() { click_callable = NULL;  }
+
+void UIDrawable::click_unregister()
+{
+    click_callable.reset();
+}
+
+void UIDrawable::render()
+{
+    render(sf::Vector2f());
+}
+
+PyObject* UIDrawable::get_click(PyObject* self, void* closure) {
+    PyObjectsEnum objtype = static_cast<PyObjectsEnum>(reinterpret_cast<long>(closure)); // trust me bro, it's an Enum
+    PyObject* ptr;
+
+    switch (objtype)
+    {
+        case PyObjectsEnum::UIFRAME:
+            ptr = ((PyUIFrameObject*)self)->data->click_callable->borrow();
+            break;
+        case PyObjectsEnum::UICAPTION:
+            ptr = ((PyUICaptionObject*)self)->data->click_callable->borrow();
+            break;
+        case PyObjectsEnum::UISPRITE:
+            ptr = ((PyUISpriteObject*)self)->data->click_callable->borrow();
+            break;
+        case PyObjectsEnum::UIGRID:
+            ptr = ((PyUIGridObject*)self)->data->click_callable->borrow();
+            break;
+        default:
+            PyErr_SetString(PyExc_TypeError, "no idea how you did that; invalid UIDrawable derived instance for _get_click");
+            return NULL;
+    }
+    if (ptr && ptr != Py_None)
+        return ptr;
+    else
+        return Py_None;
+}
+
+int UIDrawable::set_click(PyObject* self, PyObject* value, void* closure) {
+    PyObjectsEnum objtype = static_cast<PyObjectsEnum>(reinterpret_cast<long>(closure)); // trust me bro, it's an Enum
+    UIDrawable* target;
+    switch (objtype)
+    {
+        case PyObjectsEnum::UIFRAME:
+            target = (((PyUIFrameObject*)self)->data.get());
+            break;
+        case PyObjectsEnum::UICAPTION:
+            target = (((PyUICaptionObject*)self)->data.get());
+            break;
+        case PyObjectsEnum::UISPRITE:
+            target = (((PyUISpriteObject*)self)->data.get());
+            break;
+        case PyObjectsEnum::UIGRID:
+            target = (((PyUIGridObject*)self)->data.get());
+            break;
+        default:
+            PyErr_SetString(PyExc_TypeError, "no idea how you did that; invalid UIDrawable derived instance for _set_click");
+            return -1;
+    }
+
+    if (value == Py_None)
+    {
+        target->click_unregister();
+    } else {
+        target->click_register(value);
+    }
+    return 0;
+}
+
+void UIDrawable::click_register(PyObject* callable)
+{
+    click_callable = std::make_unique<PyClickCallable>(callable);
+}

src/UIDrawable.h

@@ -0,0 +1,176 @@
+#pragma once
+#include "Common.h"
+#include "Python.h"
+#include "structmember.h"
+#include "IndexTexture.h"
+#include "Resources.h"
+#include <list>
+
+#include "PyCallable.h"
+#include "PyTexture.h"
+#include "PyColor.h"
+#include "PyVector.h"
+#include "PyFont.h"
+
+#include "Resources.h"
+#include "UIBase.h"
+class UIFrame; class UICaption; class UISprite; class UIEntity; class UIGrid;
+
+enum PyObjectsEnum : int
+{
+    UIFRAME = 1,
+    UICAPTION,
+    UISPRITE,
+    UIGRID
+};
+
+class UIDrawable
+{
+public:
+    void render();
+    virtual void render(sf::Vector2f) = 0;
+    virtual PyObjectsEnum derived_type() = 0;
+
+    // Mouse input handling - callable object, methods to find event's destination
+    std::unique_ptr<PyClickCallable> click_callable;
+    virtual UIDrawable* click_at(sf::Vector2f point) = 0;
+    void click_register(PyObject*);
+    void click_unregister();
+
+    UIDrawable();
+
+    static PyObject* get_click(PyObject* self, void* closure);
+    static int set_click(PyObject* self, PyObject* value, void* closure);
+};
+
+typedef struct {
+    PyObject_HEAD
+    std::shared_ptr<std::vector<std::shared_ptr<UIDrawable>>> data;
+} PyUICollectionObject;
+
+typedef struct {
+    PyObject_HEAD
+    std::shared_ptr<std::vector<std::shared_ptr<UIDrawable>>> data;
+    int index;
+    int start_size;
+} PyUICollectionIterObject;
+
+namespace mcrfpydef {
+    //PyObject* py_instance(std::shared_ptr<UIDrawable> source);
+    // This function segfaults on tp_alloc for an unknown reason, but works inline with mcrfpydef:: methods.
+
+#define RET_PY_INSTANCE(target) {                       \
+switch (target->derived_type())                         \
+{                                                       \
+    case PyObjectsEnum::UIFRAME:                        \
+    {                                                   \
+        PyUIFrameObject* o = (PyUIFrameObject*)((&PyUIFrameType)->tp_alloc(&PyUIFrameType, 0)); \
+        if (o)                                          \
+        {                                               \
+            auto p = std::static_pointer_cast<UIFrame>(target); \
+            o->data = p;                                \
+            auto utarget = o->data;                     \
+        }                                               \
+        return (PyObject*)o;                            \
+    }                                                   \
+    case PyObjectsEnum::UICAPTION:                        \
+    {                                                   \
+        PyUICaptionObject* o = (PyUICaptionObject*)((&PyUICaptionType)->tp_alloc(&PyUICaptionType, 0)); \
+        if (o)                                          \
+        {                                               \
+            auto p = std::static_pointer_cast<UICaption>(target); \
+            o->data = p;                                \
+            auto utarget = o->data;                     \
+        }                                               \
+        return (PyObject*)o;                            \
+    }                                                   \
+    case PyObjectsEnum::UISPRITE:                        \
+    {                                                   \
+        PyUISpriteObject* o = (PyUISpriteObject*)((&PyUISpriteType)->tp_alloc(&PyUISpriteType, 0)); \
+        if (o)                                          \
+        {                                               \
+            auto p = std::static_pointer_cast<UISprite>(target); \
+            o->data = p;                                \
+            auto utarget = o->data;                     \
+        }                                               \
+        return (PyObject*)o;                            \
+    }                                                   \
+    case PyObjectsEnum::UIGRID:                        \
+    {                                                   \
+        PyUIGridObject* o = (PyUIGridObject*)((&PyUIGridType)->tp_alloc(&PyUIGridType, 0)); \
+        if (o)                                          \
+        {                                               \
+            auto p = std::static_pointer_cast<UIGrid>(target); \
+            o->data = p;                                \
+            auto utarget = o->data;                     \
+        }                                               \
+        return (PyObject*)o;                            \
+    }                                                   \
+}                                                       \
+}
+// end macro definition
+
+//TODO: add this method to class scope; move implementation to .cpp file
+/*
+static PyObject* PyUIDrawable_get_click(PyObject* self, void* closure) {
+    PyObjectsEnum objtype = static_cast<PyObjectsEnum>(reinterpret_cast<long>(closure)); // trust me bro, it's an Enum
+    PyObject* ptr;
+
+    switch (objtype)
+    {
+        case PyObjectsEnum::UIFRAME:
+            ptr = ((PyUIFrameObject*)self)->data->click_callable->borrow();
+            break;
+        case PyObjectsEnum::UICAPTION:
+            ptr = ((PyUICaptionObject*)self)->data->click_callable->borrow();
+            break;
+        case PyObjectsEnum::UISPRITE:
+            ptr = ((PyUISpriteObject*)self)->data->click_callable->borrow();
+            break;
+        case PyObjectsEnum::UIGRID:
+            ptr = ((PyUIGridObject*)self)->data->click_callable->borrow();
+            break;
+        default:
+            PyErr_SetString(PyExc_TypeError, "no idea how you did that; invalid UIDrawable derived instance for _get_click");
+            return NULL;
+    }
+    if (ptr && ptr != Py_None)
+        return ptr;
+    else
+        return Py_None;
+}*/
+
+//TODO: add this method to class scope; move implementation to .cpp file
+/*
+static int PyUIDrawable_set_click(PyObject* self, PyObject* value, void* closure) {
+    PyObjectsEnum objtype = static_cast<PyObjectsEnum>(reinterpret_cast<long>(closure)); // trust me bro, it's an Enum
+    UIDrawable* target;
+    switch (objtype)
+    {
+        case PyObjectsEnum::UIFRAME:
+            target = (((PyUIFrameObject*)self)->data.get());
+            break;
+        case PyObjectsEnum::UICAPTION:
+            target = (((PyUICaptionObject*)self)->data.get());
+            break;
+        case PyObjectsEnum::UISPRITE:
+            target = (((PyUISpriteObject*)self)->data.get());
+            break;
+        case PyObjectsEnum::UIGRID:
+            target = (((PyUIGridObject*)self)->data.get());
+            break;
+        default:
+            PyErr_SetString(PyExc_TypeError, "no idea how you did that; invalid UIDrawable derived instance for _set_click");
+            return -1;
+    }
+
+	if (value == Py_None)
+	{
+		target->click_unregister();
+	} else {
+	    target->click_register(value);
+	}
+    return 0;
+}
+*/
+}

src/UIEntity.cpp

@@ -0,0 +1,177 @@
+#include "UIEntity.h"
+#include "UIGrid.h"
+#include "McRFPy_API.h"
+
+UIEntity::UIEntity() {} // this will not work lol. TODO remove default constructor by finding the shared pointer inits that use it
+
+UIEntity::UIEntity(UIGrid& grid)
+: gridstate(grid.grid_x * grid.grid_y)
+{
+}
+
+PyObject* UIEntity::at(PyUIEntityObject* self, PyObject* o) {
+    int x, y;
+    if (!PyArg_ParseTuple(o, "ii", &x, &y)) {
+        PyErr_SetString(PyExc_TypeError, "UIEntity.at requires two integer arguments: (x, y)");
+        return NULL;
+    }
+    
+    if (self->data->grid == NULL) {
+        PyErr_SetString(PyExc_ValueError, "Entity cannot access surroundings because it is not associated with a grid");
+        return NULL;
+    }
+    /*
+    PyUIGridPointStateObject* obj = (PyUIGridPointStateObject*)((&mcrfpydef::PyUIGridPointStateType)->tp_alloc(&mcrfpydef::PyUIGridPointStateType, 0));
+    */
+    auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "GridPointState");
+    auto obj = (PyUIGridPointStateObject*)type->tp_alloc(type, 0);
+    //auto target = std::static_pointer_cast<UIEntity>(target);
+    obj->data = &(self->data->gridstate[y + self->data->grid->grid_x * x]);
+    obj->grid = self->data->grid;
+    obj->entity = self->data;
+    return (PyObject*)obj;
+
+}
+
+int UIEntity::init(PyUIEntityObject* self, PyObject* args, PyObject* kwds) {
+    static const char* keywords[] = { "x", "y", "texture", "sprite_index", "grid", nullptr };
+    float x = 0.0f, y = 0.0f, scale = 1.0f;
+    int sprite_index = -1;
+    PyObject* texture = NULL;
+    PyObject* grid = NULL;
+
+    if (!PyArg_ParseTupleAndKeywords(args, kwds, "ffOi|O",
+        const_cast<char**>(keywords), &x, &y, &texture, &sprite_index, &grid))
+    {
+        return -1;
+    }
+
+    // check types for texture
+    //
+    // Set Texture
+    //
+    if (texture != NULL && !PyObject_IsInstance(texture, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Texture"))){
+        PyErr_SetString(PyExc_TypeError, "texture must be a mcrfpy.Texture instance");
+        return -1;
+    } /*else if (texture != NULL) // this section needs to go; texture isn't optional and isn't managed by the UI objects anymore
+    {
+        self->texture = texture;
+        Py_INCREF(texture);
+    } else
+    {
+        // default tex?
+    }*/
+
+    if (grid != NULL && !PyObject_IsInstance(grid, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Grid"))) {
+        PyErr_SetString(PyExc_TypeError, "grid must be a mcrfpy.Grid instance");
+        return -1;
+    }
+
+    auto pytexture = (PyTextureObject*)texture;
+    if (grid == NULL)
+        self->data = std::make_shared<UIEntity>();
+    else
+        self->data = std::make_shared<UIEntity>(*((PyUIGridObject*)grid)->data);
+
+    // TODO - PyTextureObjects and IndexTextures are a little bit of a mess with shared/unshared pointers
+    self->data->sprite = UISprite(pytexture->data, sprite_index, sf::Vector2f(0,0), 1.0);
+    self->data->position = sf::Vector2f(x, y);
+    if (grid != NULL) {
+        PyUIGridObject* pygrid = (PyUIGridObject*)grid;
+        self->data->grid = pygrid->data;
+        // todone - on creation of Entity with Grid assignment, also append it to the entity list
+        pygrid->data->entities->push_back(self->data);
+    }
+    return 0;
+}
+
+
+
+PyObject* UIEntity::get_spritenumber(PyUIEntityObject* self, void* closure) {
+    return PyLong_FromDouble(self->data->sprite.getSpriteIndex());
+}
+
+PyObject* sfVector2f_to_PyObject(sf::Vector2f vector) {
+    return Py_BuildValue("(ff)", vector.x, vector.y);
+}
+
+sf::Vector2f PyObject_to_sfVector2f(PyObject* obj) {
+    float x, y;
+    if (!PyArg_ParseTuple(obj, "ff", &x, &y)) {
+        return sf::Vector2f(); // TODO / reconsider this default: Return default vector on parse error
+    }
+    return sf::Vector2f(x, y);
+}
+
+// TODO - deprecate / remove this helper
+PyObject* UIGridPointState_to_PyObject(const UIGridPointState& state) {
+    return PyObject_New(PyObject, (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "GridPointState"));
+}
+
+PyObject* UIGridPointStateVector_to_PyList(const std::vector<UIGridPointState>& vec) {
+    PyObject* list = PyList_New(vec.size());
+    if (!list) return PyErr_NoMemory();
+
+    for (size_t i = 0; i < vec.size(); ++i) {
+        PyObject* obj = UIGridPointState_to_PyObject(vec[i]);
+        if (!obj) { // Cleanup on failure
+            Py_DECREF(list);
+            return NULL;
+        }
+        PyList_SET_ITEM(list, i, obj); // This steals a reference to obj
+    }
+
+    return list;
+}
+
+PyObject* UIEntity::get_position(PyUIEntityObject* self, void* closure) {
+    return sfVector2f_to_PyObject(self->data->position);
+}
+
+int UIEntity::set_position(PyUIEntityObject* self, PyObject* value, void* closure) {
+    self->data->position = PyObject_to_sfVector2f(value);
+    return 0;
+}
+
+PyObject* UIEntity::get_gridstate(PyUIEntityObject* self, void* closure) {
+    // Assuming a function to convert std::vector<UIGridPointState> to PyObject* list
+    return UIGridPointStateVector_to_PyList(self->data->gridstate);
+}
+
+int UIEntity::set_spritenumber(PyUIEntityObject* self, PyObject* value, void* closure) {
+    int val;
+    if (PyLong_Check(value))
+        val = PyLong_AsLong(value);
+    else
+    {
+        PyErr_SetString(PyExc_TypeError, "Value must be an integer.");
+        return -1;
+    }
+    //self->data->sprite.sprite_index = val;
+    self->data->sprite.setSpriteIndex(val); // todone - I don't like ".sprite.sprite" in this stack of UIEntity.UISprite.sf::Sprite
+    return 0;
+}
+
+PyMethodDef UIEntity::methods[] = {
+    {"at", (PyCFunction)UIEntity::at, METH_O},
+    {NULL, NULL, 0, NULL}
+};
+
+PyGetSetDef UIEntity::getsetters[] = {
+    {"position", (getter)UIEntity::get_position, (setter)UIEntity::set_position, "Entity position", NULL},
+    {"gridstate", (getter)UIEntity::get_gridstate, NULL, "Grid point states for the entity", NULL},
+    {"sprite_number", (getter)UIEntity::get_spritenumber, (setter)UIEntity::set_spritenumber, "Sprite number (index) on the texture on the display", NULL},
+    {NULL}  /* Sentinel */
+};
+
+PyObject* UIEntity::repr(PyUIEntityObject* self) {
+    std::ostringstream ss;
+    if (!self->data) ss << "<Entity (invalid internal object)>";
+    else {
+        auto ent = self->data;
+        ss << "<Entity (x=" << self->data->position.x << ", y=" << self->data->position.y << ", sprite_number=" << self->data->sprite.getSpriteIndex() <<
+         ")>";
+    }
+    std::string repr_str = ss.str();
+    return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
+}

src/UIEntity.h

@@ -0,0 +1,75 @@
+#pragma once
+#include "Common.h"
+#include "Python.h"
+#include "structmember.h"
+#include "IndexTexture.h"
+#include "Resources.h"
+#include <list>
+
+#include "PyCallable.h"
+#include "PyTexture.h"
+#include "PyColor.h"
+#include "PyVector.h"
+#include "PyFont.h"
+
+#include "UIGridPoint.h"
+#include "UIDrawable.h"
+#include "UIBase.h"
+#include "UISprite.h"
+
+class UIGrid;
+
+//class UIEntity;
+//typedef struct {
+//    PyObject_HEAD
+//    std::shared_ptr<UIEntity> data;
+//} PyUIEntityObject;
+
+// helper methods with no namespace requirement
+static PyObject* sfVector2f_to_PyObject(sf::Vector2f vector);
+static sf::Vector2f PyObject_to_sfVector2f(PyObject* obj);
+static PyObject* UIGridPointState_to_PyObject(const UIGridPointState& state);
+static PyObject* UIGridPointStateVector_to_PyList(const std::vector<UIGridPointState>& vec);
+
+// TODO: make UIEntity a drawable
+class UIEntity//: public UIDrawable
+{
+public:
+    //PyObject* self;
+    std::shared_ptr<UIGrid> grid;
+    std::vector<UIGridPointState> gridstate;
+    UISprite sprite;
+    sf::Vector2f position; //(x,y) in grid coordinates; float for animation
+    void render(sf::Vector2f); //override final;
+
+    UIEntity();
+    UIEntity(UIGrid&);
+    
+    static PyObject* at(PyUIEntityObject* self, PyObject* o);
+    static int init(PyUIEntityObject* self, PyObject* args, PyObject* kwds);
+
+    static PyObject* get_position(PyUIEntityObject* self, void* closure);
+    static int set_position(PyUIEntityObject* self, PyObject* value, void* closure);
+    static PyObject* get_gridstate(PyUIEntityObject* self, void* closure);
+    static PyObject* get_spritenumber(PyUIEntityObject* self, void* closure);
+    static int set_spritenumber(PyUIEntityObject* self, PyObject* value, void* closure);
+    static PyMethodDef methods[];
+    static PyGetSetDef getsetters[];
+    static PyObject* repr(PyUIEntityObject* self);
+};
+
+namespace mcrfpydef {
+    static PyTypeObject PyUIEntityType = {
+        //PyVarObject_HEAD_INIT(NULL, 0)
+        .tp_name = "mcrfpy.Entity",
+        .tp_basicsize = sizeof(PyUIEntityObject),
+        .tp_itemsize = 0,
+        .tp_repr = (reprfunc)UIEntity::repr,
+        .tp_flags = Py_TPFLAGS_DEFAULT,
+        .tp_doc = "UIEntity objects",
+        .tp_methods = UIEntity::methods,
+        .tp_getset = UIEntity::getsetters,
+        .tp_init = (initproc)UIEntity::init,
+        .tp_new = PyType_GenericNew,
+    };
+}

src/UIFrame.cpp

@@ -0,0 +1,265 @@
+#include "UIFrame.h"
+#include "UICollection.h"
+#include "GameEngine.h"
+
+UIDrawable* UIFrame::click_at(sf::Vector2f point)
+{
+    for (auto e: *children)
+    {
+        auto p = e->click_at(point + box.getPosition());
+        if (p)
+            return p;
+    }
+    if (click_callable)
+    {
+        float x = box.getPosition().x, y = box.getPosition().y, w = box.getSize().x, h = box.getSize().y;
+        if (point.x > x && point.y > y && point.x < x+w && point.y < y+h) return this;
+    }
+    return NULL;
+}
+
+UIFrame::UIFrame()
+: outline(0)
+{
+    children = std::make_shared<std::vector<std::shared_ptr<UIDrawable>>>();
+    box.setPosition(0, 0);
+    box.setSize(sf::Vector2f(0, 0));
+}
+
+UIFrame::UIFrame(float _x, float _y, float _w, float _h)
+: outline(0)
+{
+    box.setPosition(_x, _y);
+    box.setSize(sf::Vector2f(_w, _h));
+    children = std::make_shared<std::vector<std::shared_ptr<UIDrawable>>>();
+}
+
+UIFrame::~UIFrame()
+{
+    children.reset();
+}
+
+PyObjectsEnum UIFrame::derived_type()
+{
+    return PyObjectsEnum::UIFRAME;
+}
+
+void UIFrame::render(sf::Vector2f offset)
+{
+    box.move(offset);
+    Resources::game->getWindow().draw(box);
+    box.move(-offset);
+
+    for (auto drawable : *children) {
+        drawable->render(offset + box.getPosition());
+    }
+}
+
+PyObject* UIFrame::get_children(PyUIFrameObject* self, void* closure)
+{
+    // create PyUICollection instance pointing to self->data->children
+    //PyUICollectionObject* o = (PyUICollectionObject*)mcrfpydef::PyUICollectionType.tp_alloc(&mcrfpydef::PyUICollectionType, 0);
+    auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "UICollection");
+    auto o = (PyUICollectionObject*)type->tp_alloc(type, 0);
+    if (o)
+        o->data = self->data->children;
+    return (PyObject*)o;
+}
+
+
+PyObject* UIFrame::get_float_member(PyUIFrameObject* self, void* closure)
+{
+    auto member_ptr = reinterpret_cast<long>(closure);
+    if (member_ptr == 0)
+        return PyFloat_FromDouble(self->data->box.getPosition().x);
+    else if (member_ptr == 1)
+        return PyFloat_FromDouble(self->data->box.getPosition().y);
+    else if (member_ptr == 2)
+        return PyFloat_FromDouble(self->data->box.getSize().x);
+    else if (member_ptr == 3)
+        return PyFloat_FromDouble(self->data->box.getSize().y);
+    else if (member_ptr == 4)
+        return PyFloat_FromDouble(self->data->box.getOutlineThickness());
+    else
+    {
+        PyErr_SetString(PyExc_AttributeError, "Invalid attribute");
+        return nullptr;
+    }
+}
+
+int UIFrame::set_float_member(PyUIFrameObject* self, PyObject* value, void* closure)
+{
+    float val;
+    auto member_ptr = reinterpret_cast<long>(closure);
+    if (PyFloat_Check(value))
+    {
+        val = PyFloat_AsDouble(value);
+    }
+    else if (PyLong_Check(value))
+    {
+        val = PyLong_AsLong(value);
+    }
+    else
+    {
+        PyErr_SetString(PyExc_TypeError, "Value must be an integer.");
+        return -1;
+    }
+    if (member_ptr == 0) //x
+        self->data->box.setPosition(val, self->data->box.getPosition().y);
+    else if (member_ptr == 1) //y
+        self->data->box.setPosition(self->data->box.getPosition().x, val);
+    else if (member_ptr == 2) //w
+        self->data->box.setSize(sf::Vector2f(val, self->data->box.getSize().y));
+    else if (member_ptr == 3) //h
+        self->data->box.setSize(sf::Vector2f(self->data->box.getSize().x, val));
+    else if (member_ptr == 4) //outline
+        self->data->box.setOutlineThickness(val);
+    return 0;
+}
+
+PyObject* UIFrame::get_color_member(PyUIFrameObject* self, void* closure)
+{
+    // validate closure (should be impossible to be wrong, but it's thorough)
+    auto member_ptr = reinterpret_cast<long>(closure);
+    if (member_ptr != 0 && member_ptr != 1)
+    {
+        PyErr_SetString(PyExc_AttributeError, "Invalid attribute");
+        return nullptr;
+    }
+    //PyTypeObject* colorType = &PyColorType;
+    auto colorType = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "Color");
+    PyObject* pyColor = colorType->tp_alloc(colorType, 0);
+    if (pyColor == NULL)
+    {
+        std::cout << "failure to allocate mcrfpy.Color / PyColorType" << std::endl;
+        return NULL;
+    }
+    PyColorObject* pyColorObj = reinterpret_cast<PyColorObject*>(pyColor);
+
+    // fetch correct member data
+    sf::Color color;
+    if (member_ptr == 0)
+    {
+        color = self->data->box.getFillColor();
+        //return Py_BuildValue("(iii)", color.r, color.g, color.b);
+    }
+    else if (member_ptr == 1)
+    {
+        color = self->data->box.getOutlineColor();
+        //return Py_BuildValue("(iii)", color.r, color.g, color.b);
+    }
+    
+    return PyColor(color).pyObject();
+}
+
+int UIFrame::set_color_member(PyUIFrameObject* self, PyObject* value, void* closure)
+{
+    //TODO: this logic of (PyColor instance OR tuple -> sf::color) should be encapsulated for reuse
+    auto member_ptr = reinterpret_cast<long>(closure);
+    int r, g, b, a;
+    if (PyObject_IsInstance(value, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Color")))
+    {
+        sf::Color c = ((PyColorObject*)value)->data;
+        r = c.r; g = c.g; b = c.b; a = c.a;
+    }
+    else if (!PyTuple_Check(value) || PyTuple_Size(value) < 3 || PyTuple_Size(value) > 4)
+    {
+        // reject non-Color, non-tuple value
+        PyErr_SetString(PyExc_TypeError, "Value must be a tuple of 3 or 4 integers or an mcrfpy.Color object.");
+        return -1;
+    }
+    else // get value from tuples
+    {
+        r = PyLong_AsLong(PyTuple_GetItem(value, 0));
+        g = PyLong_AsLong(PyTuple_GetItem(value, 1));
+        b = PyLong_AsLong(PyTuple_GetItem(value, 2));
+        a = 255;
+
+        if (PyTuple_Size(value) == 4)
+        {
+            a = PyLong_AsLong(PyTuple_GetItem(value, 3));
+        }
+    }
+
+    if (r < 0 || r > 255 || g < 0 || g > 255 || b < 0 || b > 255 || a < 0 || a > 255)
+    {
+        PyErr_SetString(PyExc_ValueError, "Color values must be between 0 and 255.");
+        return -1;
+    }
+
+    if (member_ptr == 0)
+    {
+        self->data->box.setFillColor(sf::Color(r, g, b, a));
+    }
+    else if (member_ptr == 1)
+    {
+        self->data->box.setOutlineColor(sf::Color(r, g, b, a));
+    }
+    else
+    {
+        PyErr_SetString(PyExc_AttributeError, "Invalid attribute");
+        return -1;
+    }
+
+    return 0;
+}
+
+PyGetSetDef UIFrame::getsetters[] = {
+    {"x", (getter)UIFrame::get_float_member, (setter)UIFrame::set_float_member, "X coordinate of top-left corner",   (void*)0},
+    {"y", (getter)UIFrame::get_float_member, (setter)UIFrame::set_float_member, "Y coordinate of top-left corner",   (void*)1},
+    {"w", (getter)UIFrame::get_float_member, (setter)UIFrame::set_float_member, "width of the rectangle",   (void*)2},
+    {"h", (getter)UIFrame::get_float_member, (setter)UIFrame::set_float_member, "height of the rectangle",   (void*)3},
+    {"outline", (getter)UIFrame::get_float_member, (setter)UIFrame::set_float_member, "Thickness of the border",   (void*)4},
+    {"fill_color", (getter)UIFrame::get_color_member, (setter)UIFrame::set_color_member, "Fill color of the rectangle", (void*)0},
+    {"outline_color", (getter)UIFrame::get_color_member, (setter)UIFrame::set_color_member, "Outline color of the rectangle", (void*)1},
+    {"children", (getter)UIFrame::get_children, NULL, "UICollection of objects on top of this one", NULL},
+    {"click", (getter)UIDrawable::get_click, (setter)UIDrawable::set_click, "Object called with (x, y, button) when clicked", (void*)PyObjectsEnum::UIFRAME},
+    {NULL}
+};
+
+PyObject* UIFrame::repr(PyUIFrameObject* self)
+{
+    std::ostringstream ss;
+    if (!self->data) ss << "<Frame (invalid internal object)>";
+    else {
+        auto box = self->data->box;
+        auto fc = box.getFillColor();
+        auto oc = box.getOutlineColor();
+        ss << "<Frame (x=" << box.getPosition().x << ", y=" << box.getPosition().y << ", w=" << 
+            box.getSize().x << ", w=" << box.getSize().y << ", " <<
+            "outline=" << box.getOutlineThickness() << ", " << 
+            "fill_color=(" << (int)fc.r << ", " << (int)fc.g << ", " << (int)fc.b << ", " << (int)fc.a <<"), " <<
+            "outline_color=(" << (int)oc.r << ", " << (int)oc.g << ", " << (int)oc.b << ", " << (int)oc.a <<"), " <<
+            self->data->children->size() << " child objects" <<
+            ")>";
+    }
+    std::string repr_str = ss.str();
+    return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
+}
+
+int UIFrame::init(PyUIFrameObject* self, PyObject* args, PyObject* kwds)
+{
+    //std::cout << "Init called\n";
+    const char* keywords[] = { "x", "y", "w", "h", "fill_color", "outline_color", "outline", nullptr }; 
+    float x = 0.0f, y = 0.0f, w = 0.0f, h=0.0f, outline=0.0f;
+    PyObject* fill_color = 0;
+    PyObject* outline_color = 0;
+
+    if (!PyArg_ParseTupleAndKeywords(args, kwds, "ffff|OOf", const_cast<char**>(keywords), &x, &y, &w, &h, &fill_color, &outline_color, &outline))
+    {
+        return -1;
+    }
+
+    self->data->box.setPosition(sf::Vector2f(x, y));
+    self->data->box.setSize(sf::Vector2f(w, h));
+    self->data->box.setOutlineThickness(outline);
+    // getsetter abuse because I haven't standardized Color object parsing (TODO)
+    int err_val = 0;
+    if (fill_color && fill_color != Py_None) err_val = UIFrame::set_color_member(self, fill_color, (void*)0);
+    else self->data->box.setFillColor(sf::Color(0,0,0,255));
+    if (err_val) return err_val;
+    if (outline_color && outline_color != Py_None) err_val = UIFrame::set_color_member(self, outline_color, (void*)1);
+    else self->data->box.setOutlineColor(sf::Color(128,128,128,255));
+    if (err_val) return err_val;
+    return 0;
+}

src/UIFrame.h

@@ -0,0 +1,77 @@
+#pragma once
+#include "Common.h"
+#include "Python.h"
+#include "structmember.h"
+#include "IndexTexture.h"
+#include "Resources.h"
+#include <list>
+
+#include "PyCallable.h"
+#include "PyColor.h"
+#include "PyVector.h"
+#include "UIDrawable.h"
+#include "UIBase.h"
+
+//class UIFrame;
+//
+//typedef struct {
+//    PyObject_HEAD
+//    std::shared_ptr<UIFrame> data;
+//} PyUIFrameObject;
+
+class UIFrame: public UIDrawable
+{
+public:
+    UIFrame(float, float, float, float);
+    UIFrame();
+    ~UIFrame();
+    sf::RectangleShape box;
+    float outline;
+    std::shared_ptr<std::vector<std::shared_ptr<UIDrawable>>> children;
+    void render(sf::Vector2f) override final;
+    void move(sf::Vector2f);
+    PyObjectsEnum derived_type() override final;
+    virtual UIDrawable* click_at(sf::Vector2f point) override final;
+
+    static PyObject* get_children(PyUIFrameObject* self, void* closure);
+
+    static PyObject* get_float_member(PyUIFrameObject* self, void* closure);
+    static int set_float_member(PyUIFrameObject* self, PyObject* value, void* closure);
+    static PyObject* get_color_member(PyUIFrameObject* self, void* closure);
+    static int set_color_member(PyUIFrameObject* self, PyObject* value, void* closure);
+    static PyGetSetDef getsetters[];
+    static PyObject* repr(PyUIFrameObject* self);
+    static int init(PyUIFrameObject* self, PyObject* args, PyObject* kwds);
+};
+
+namespace mcrfpydef {
+    static PyTypeObject PyUIFrameType = {
+        //PyVarObject_HEAD_INIT(NULL, 0)
+        .tp_name = "mcrfpy.Frame",
+        .tp_basicsize = sizeof(PyUIFrameObject),
+        .tp_itemsize = 0,
+        .tp_dealloc = (destructor)[](PyObject* self)
+        {
+            PyUIFrameObject* obj = (PyUIFrameObject*)self;
+            obj->data.reset();
+            Py_TYPE(self)->tp_free(self);
+        },
+        .tp_repr = (reprfunc)UIFrame::repr,
+        //.tp_hash = NULL,
+        //.tp_iter
+        //.tp_iternext
+        .tp_flags = Py_TPFLAGS_DEFAULT,
+        .tp_doc = PyDoc_STR("docstring"),
+        //.tp_methods = PyUIFrame_methods,
+        //.tp_members = PyUIFrame_members,
+        .tp_getset = UIFrame::getsetters,
+        //.tp_base = NULL,
+        .tp_init = (initproc)UIFrame::init,
+        .tp_new = [](PyTypeObject* type, PyObject* args, PyObject* kwds) -> PyObject*
+        {
+            PyUIFrameObject* self = (PyUIFrameObject*)type->tp_alloc(type, 0);
+            if (self) self->data = std::make_shared<UIFrame>();
+            return (PyObject*)self;
+        }
+    };
+}

src/UIGrid.cpp

@@ -0,0 +1,639 @@
+#include "UIGrid.h"
+#include "GameEngine.h"
+#include "McRFPy_API.h"
+
+UIGrid::UIGrid() {}
+
+UIGrid::UIGrid(int gx, int gy, std::shared_ptr<PyTexture> _ptex, sf::Vector2f _xy, sf::Vector2f _wh)
+: grid_x(gx), grid_y(gy),
+  zoom(1.0f), center_x((gx/2) * _ptex->sprite_width), center_y((gy/2) * _ptex->sprite_height),
+  ptex(_ptex), points(gx * gy)
+{
+    entities = std::make_shared<std::list<std::shared_ptr<UIEntity>>>();
+
+    box.setSize(_wh);
+    box.setPosition(_xy); 
+
+    box.setFillColor(sf::Color(0,0,0,0));
+    // create renderTexture with maximum theoretical size; sprite can resize to show whatever amount needs to be rendered
+    renderTexture.create(1920, 1080); // TODO - renderTexture should be window size; above 1080p this will cause rendering errors
+    
+    sprite = ptex->sprite(0);
+
+    output.setTextureRect(
+         sf::IntRect(0, 0,
+         box.getSize().x, box.getSize().y));
+     output.setPosition(box.getPosition());
+     // textures are upside-down inside renderTexture
+     output.setTexture(renderTexture.getTexture());
+
+}
+
+void UIGrid::update() {}
+
+
+void UIGrid::render(sf::Vector2f)
+{
+    output.setPosition(box.getPosition()); // output sprite can move; update position when drawing
+    // output size can change; update size when drawing
+    output.setTextureRect(
+         sf::IntRect(0, 0,
+         box.getSize().x, box.getSize().y));
+    renderTexture.clear(sf::Color(8, 8, 8, 255)); // TODO - UIGrid needs a "background color" field
+    // sprites that are visible according to zoom, center_x, center_y, and box width
+    float center_x_sq = center_x / ptex->sprite_width;
+    float center_y_sq = center_y / ptex->sprite_height;
+
+    float width_sq = box.getSize().x / (ptex->sprite_width * zoom);
+    float height_sq = box.getSize().y / (ptex->sprite_height * zoom);
+    float left_edge = center_x_sq - (width_sq / 2.0);
+    float top_edge = center_y_sq - (height_sq / 2.0);
+
+    int left_spritepixels = center_x - (box.getSize().x / 2.0 / zoom);
+    int top_spritepixels = center_y - (box.getSize().y / 2.0 / zoom);
+
+    //sprite.setScale(sf::Vector2f(zoom, zoom));
+    sf::RectangleShape r; // for colors and overlays
+    r.setSize(sf::Vector2f(ptex->sprite_width * zoom, ptex->sprite_height * zoom));
+    r.setOutlineThickness(0);
+
+    int x_limit = left_edge + width_sq + 2;
+    if (x_limit > grid_x) x_limit = grid_x;
+
+    int y_limit = top_edge + height_sq + 2;
+    if (y_limit > grid_y) y_limit = grid_y;
+
+    // base layer - bottom color, tile sprite ("ground")
+    for (int x = (left_edge - 1 >= 0 ? left_edge - 1 : 0);
+        x < x_limit; //x < view_width; 
+        x+=1)
+    {
+        //for (float y = (top_edge >= 0 ? top_edge : 0); 
+        for (int y = (top_edge - 1 >= 0 ? top_edge - 1 : 0);
+            y < y_limit; //y < view_height;
+            y+=1)
+        {
+            auto pixel_pos = sf::Vector2f(
+                    (x*ptex->sprite_width - left_spritepixels) * zoom,
+                    (y*ptex->sprite_height - top_spritepixels) * zoom );
+
+            auto gridpoint = at(std::floor(x), std::floor(y));
+
+            //sprite.setPosition(pixel_pos);
+
+            r.setPosition(pixel_pos);
+            r.setFillColor(gridpoint.color);
+            renderTexture.draw(r);
+
+            // tilesprite
+            // if discovered but not visible, set opacity to 90%
+            // if not discovered... just don't draw it?
+            if (gridpoint.tilesprite != -1) {
+                sprite = ptex->sprite(gridpoint.tilesprite, pixel_pos, sf::Vector2f(zoom, zoom)); //setSprite(gridpoint.tilesprite);;
+                renderTexture.draw(sprite);
+            }
+        }
+    }
+
+    // middle layer - entities
+    // disabling entity rendering until I can render their UISprite inside the rendertexture (not directly to window)
+    for (auto e : *entities) {
+        // TODO skip out-of-bounds entities (grid square not visible at all, check for partially on visible grid squares / floating point grid position)
+        //auto drawent = e->cGrid->indexsprite.drawable();
+        auto& drawent = e->sprite;
+        //drawent.setScale(zoom, zoom);
+        drawent.setScale(sf::Vector2f(zoom, zoom));
+        auto pixel_pos = sf::Vector2f(
+            (e->position.x*ptex->sprite_width - left_spritepixels) * zoom,
+            (e->position.y*ptex->sprite_height - top_spritepixels) * zoom );
+        //drawent.setPosition(pixel_pos);
+        //renderTexture.draw(drawent);
+        drawent.render(pixel_pos, renderTexture);
+    }
+    
+
+    // top layer - opacity for discovered / visible status (debug, basically)
+    /* // Disabled until I attach a "perspective"
+    for (int x = (left_edge - 1 >= 0 ? left_edge - 1 : 0);
+        x < x_limit; //x < view_width; 
+        x+=1)
+    {
+        //for (float y = (top_edge >= 0 ? top_edge : 0); 
+        for (int y = (top_edge - 1 >= 0 ? top_edge - 1 : 0);
+            y < y_limit; //y < view_height;
+            y+=1)
+        {
+
+            auto pixel_pos = sf::Vector2f(
+                    (x*itex->grid_size - left_spritepixels) * zoom,
+                    (y*itex->grid_size - top_spritepixels) * zoom );
+
+            auto gridpoint = at(std::floor(x), std::floor(y));
+
+            sprite.setPosition(pixel_pos);
+
+            r.setPosition(pixel_pos);
+
+            // visible & discovered layers for testing purposes
+            if (!gridpoint.discovered) {
+                r.setFillColor(sf::Color(16, 16, 20, 192)); // 255 opacity for actual blackout
+                renderTexture.draw(r);
+            } else if (!gridpoint.visible) {
+                r.setFillColor(sf::Color(32, 32, 40, 128));
+                renderTexture.draw(r);
+            }
+
+            // overlay
+
+            // uisprite
+        }
+    }
+    */
+
+    // grid lines for testing & validation
+    /*
+    sf::Vertex line[] =
+    {
+        sf::Vertex(sf::Vector2f(0, 0), sf::Color::Red),
+        sf::Vertex(box.getSize(), sf::Color::Red),
+
+    };
+
+    renderTexture.draw(line, 2, sf::Lines);
+    sf::Vertex lineb[] =
+    {
+        sf::Vertex(sf::Vector2f(0, box.getSize().y), sf::Color::Blue),
+        sf::Vertex(sf::Vector2f(box.getSize().x, 0), sf::Color::Blue),
+
+    };
+
+    renderTexture.draw(lineb, 2, sf::Lines);
+    */
+
+    // render to window
+    renderTexture.display();
+    Resources::game->getWindow().draw(output);
+
+}
+
+UIGridPoint& UIGrid::at(int x, int y)
+{
+    return points[y * grid_x + x];
+}
+
+PyObjectsEnum UIGrid::derived_type()
+{
+    return PyObjectsEnum::UIGRID;
+}
+
+std::shared_ptr<PyTexture> UIGrid::getTexture()
+{
+    return ptex;
+}
+
+UIDrawable* UIGrid::click_at(sf::Vector2f point)
+{
+    if (click_callable)
+    {
+        if(box.getGlobalBounds().contains(point)) return this;
+    }
+    return NULL;
+}
+
+
+int UIGrid::init(PyUIGridObject* self, PyObject* args, PyObject* kwds) {
+    int grid_x, grid_y;
+    PyObject* textureObj;
+    float box_x, box_y, box_w, box_h;
+
+    if (!PyArg_ParseTuple(args, "iiOffff", &grid_x, &grid_y, &textureObj, &box_x, &box_y, &box_w, &box_h)) {
+        return -1; // If parsing fails, return an error
+    }
+
+    // Convert PyObject texture to IndexTexture*
+    // This requires the texture object to have been initialized similar to UISprite's texture handling
+
+    //if (!PyObject_IsInstance(textureObj, (PyObject*)&PyTextureType)) {
+    if (!PyObject_IsInstance(textureObj, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Texture"))) {
+        PyErr_SetString(PyExc_TypeError, "texture must be a mcrfpy.Texture instance");
+        return -1;
+    }
+    PyTextureObject* pyTexture = reinterpret_cast<PyTextureObject*>(textureObj);
+    // TODO (7DRL day 2, item 4.) use shared_ptr / PyTextureObject on UIGrid
+    //IndexTexture* texture = pyTexture->data.get();
+    
+    // Initialize UIGrid
+    //self->data = new UIGrid(grid_x, grid_y, texture, sf::Vector2f(box_x, box_y), sf::Vector2f(box_w, box_h));
+    self->data = std::make_shared<UIGrid>(grid_x, grid_y, pyTexture->data, 
+            sf::Vector2f(box_x, box_y), sf::Vector2f(box_w, box_h));
+    return 0; // Success
+}
+
+PyObject* UIGrid::get_grid_size(PyUIGridObject* self, void* closure) {
+    return Py_BuildValue("(ii)", self->data->grid_x, self->data->grid_y);
+}
+
+PyObject* UIGrid::get_position(PyUIGridObject* self, void* closure) {
+    auto& box = self->data->box;
+    return Py_BuildValue("(ff)", box.getPosition().x, box.getPosition().y);
+}
+
+int UIGrid::set_position(PyUIGridObject* self, PyObject* value, void* closure) {
+    float x, y;
+    if (!PyArg_ParseTuple(value, "ff", &x, &y)) {
+        PyErr_SetString(PyExc_ValueError, "Position must be a tuple of two floats");
+        return -1;
+    }
+    self->data->box.setPosition(x, y);
+    return 0;
+}
+
+PyObject* UIGrid::get_size(PyUIGridObject* self, void* closure) {
+    auto& box = self->data->box;
+    return Py_BuildValue("(ff)", box.getSize().x, box.getSize().y);
+}
+
+int UIGrid::set_size(PyUIGridObject* self, PyObject* value, void* closure) {
+    float w, h;
+    if (!PyArg_ParseTuple(value, "ff", &w, &h)) {
+        PyErr_SetString(PyExc_ValueError, "Size must be a tuple of two floats");
+        return -1;
+    }
+    self->data->box.setSize(sf::Vector2f(w, h));
+    return 0;
+}
+
+PyObject* UIGrid::get_center(PyUIGridObject* self, void* closure) {
+    return Py_BuildValue("(ff)", self->data->center_x, self->data->center_y);
+}
+
+int UIGrid::set_center(PyUIGridObject* self, PyObject* value, void* closure) {
+    float x, y;
+    if (!PyArg_ParseTuple(value, "ff", &x, &y)) {
+        PyErr_SetString(PyExc_ValueError, "Size must be a tuple of two floats");
+        return -1;
+    }
+    self->data->center_x = x;
+    self->data->center_y = y;
+    return 0;
+}
+
+PyObject* UIGrid::get_float_member(PyUIGridObject* self, void* closure)
+{
+    auto member_ptr = reinterpret_cast<long>(closure);
+    if (member_ptr == 0) // x
+        return PyFloat_FromDouble(self->data->box.getPosition().x);
+    else if (member_ptr == 1) // y
+        return PyFloat_FromDouble(self->data->box.getPosition().y);
+    else if (member_ptr == 2) // w
+        return PyFloat_FromDouble(self->data->box.getSize().x);
+    else if (member_ptr == 3) // h
+        return PyFloat_FromDouble(self->data->box.getSize().y);
+    else if (member_ptr == 4) // center_x
+        return PyFloat_FromDouble(self->data->center_x);
+    else if (member_ptr == 5) // center_y
+        return PyFloat_FromDouble(self->data->center_y);
+    else if (member_ptr == 6) // zoom
+        return PyFloat_FromDouble(self->data->zoom);
+    else
+    {
+        PyErr_SetString(PyExc_AttributeError, "Invalid attribute");
+        return nullptr;
+    }
+}
+
+int UIGrid::set_float_member(PyUIGridObject* self, PyObject* value, void* closure)
+{
+    float val;
+    auto member_ptr = reinterpret_cast<long>(closure);
+    if (PyFloat_Check(value))
+    {
+        val = PyFloat_AsDouble(value);
+    }
+    else if (PyLong_Check(value))
+    {
+        val = PyLong_AsLong(value);
+    }
+    else
+    {
+        PyErr_SetString(PyExc_TypeError, "Value must be a floating point number.");
+        return -1;
+    }
+    if (member_ptr == 0) // x
+        self->data->box.setPosition(val, self->data->box.getPosition().y);
+    else if (member_ptr == 1) // y
+        self->data->box.setPosition(self->data->box.getPosition().x, val);
+    else if (member_ptr == 2) // w
+        self->data->box.setSize(sf::Vector2f(val, self->data->box.getSize().y));
+    else if (member_ptr == 3) // h
+        self->data->box.setSize(sf::Vector2f(self->data->box.getSize().x, val));
+    else if (member_ptr == 4) // center_x
+        self->data->center_x = val;
+    else if (member_ptr == 5) // center_y
+        self->data->center_y = val;
+    else if (member_ptr == 6) // zoom
+        self->data->zoom = val;
+    return 0;
+}
+// TODO (7DRL Day 2, item 5.) return Texture object
+/*
+PyObject* UIGrid::get_texture(PyUIGridObject* self, void* closure) {
+    Py_INCREF(self->texture);
+    return self->texture;
+}
+*/
+
+PyObject* UIGrid::get_texture(PyUIGridObject* self, void* closure) {
+        //return self->data->getTexture()->pyObject();
+        // PyObject_GetAttrString(McRFPy_API::mcrf_module, "GridPointState")
+        //PyTextureObject* obj = (PyTextureObject*)((&PyTextureType)->tp_alloc(&PyTextureType, 0));
+        auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "Texture");
+        auto obj = (PyTextureObject*)type->tp_alloc(type, 0);
+        obj->data = self->data->getTexture();
+        return (PyObject*)obj;
+}
+
+PyObject* UIGrid::py_at(PyUIGridObject* self, PyObject* o)
+{
+    int x, y;
+    if (!PyArg_ParseTuple(o, "ii", &x, &y)) {
+        PyErr_SetString(PyExc_TypeError, "UIGrid.at requires two integer arguments: (x, y)");
+        return NULL;
+    }
+    if (x < 0 || x >= self->data->grid_x) {
+        PyErr_SetString(PyExc_ValueError, "x value out of range (0, Grid.grid_y)");
+        return NULL;
+    }
+    if (y < 0 || y >= self->data->grid_y) {
+        PyErr_SetString(PyExc_ValueError, "y value out of range (0, Grid.grid_y)");
+        return NULL;
+    }
+
+    //PyUIGridPointObject* obj = (PyUIGridPointObject*)((&PyUIGridPointType)->tp_alloc(&PyUIGridPointType, 0));
+    auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "GridPoint");
+    auto obj = (PyUIGridPointObject*)type->tp_alloc(type, 0);
+    //auto target = std::static_pointer_cast<UIEntity>(target);
+    obj->data = &(self->data->points[x + self->data->grid_x * y]);
+    obj->grid = self->data;
+    return (PyObject*)obj;
+}
+
+PyMethodDef UIGrid::methods[] = {
+    {"at", (PyCFunction)UIGrid::py_at, METH_O},
+    {NULL, NULL, 0, NULL}
+};
+
+
+PyGetSetDef UIGrid::getsetters[] = {
+
+    // TODO - refactor into get_vector_member with field identifier values `(void*)n`
+    {"grid_size", (getter)UIGrid::get_grid_size, NULL, "Grid dimensions (grid_x, grid_y)", NULL},
+    {"position", (getter)UIGrid::get_position, (setter)UIGrid::set_position, "Position of the grid (x, y)", NULL},
+    {"size", (getter)UIGrid::get_size, (setter)UIGrid::set_size, "Size of the grid (width, height)", NULL},
+    {"center", (getter)UIGrid::get_center, (setter)UIGrid::set_center, "Grid coordinate at the center of the Grid's view (pan)", NULL},
+
+    {"entities", (getter)UIGrid::get_children, NULL, "EntityCollection of entities on this grid", NULL},
+
+    {"x", (getter)UIGrid::get_float_member, (setter)UIGrid::set_float_member, "top-left corner X-coordinate", (void*)0},
+    {"y", (getter)UIGrid::get_float_member, (setter)UIGrid::set_float_member, "top-left corner Y-coordinate", (void*)1},
+    {"w", (getter)UIGrid::get_float_member, (setter)UIGrid::set_float_member, "visible widget width", (void*)2},
+    {"h", (getter)UIGrid::get_float_member, (setter)UIGrid::set_float_member, "visible widget height", (void*)3},
+    {"center_x", (getter)UIGrid::get_float_member, (setter)UIGrid::set_float_member, "center of the view X-coordinate", (void*)4},
+    {"center_y", (getter)UIGrid::get_float_member, (setter)UIGrid::set_float_member, "center of the view Y-coordinate", (void*)5},
+    {"zoom", (getter)UIGrid::get_float_member, (setter)UIGrid::set_float_member, "zoom factor for displaying the Grid", (void*)6},
+
+    {"click", (getter)UIDrawable::get_click, (setter)UIDrawable::set_click, "Object called with (x, y, button) when clicked", (void*)PyObjectsEnum::UIGRID},
+
+    {"texture", (getter)UIGrid::get_texture, NULL, "Texture of the grid", NULL}, //TODO 7DRL-day2-item5
+    {NULL}  /* Sentinel */
+};
+
+PyObject* UIGrid::get_children(PyUIGridObject* self, void* closure)
+{
+    // create PyUICollection instance pointing to self->data->children
+    //PyUIEntityCollectionObject* o = (PyUIEntityCollectionObject*)PyUIEntityCollectionType.tp_alloc(&PyUIEntityCollectionType, 0);
+    auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "EntityCollection");
+    auto o = (PyUIEntityCollectionObject*)type->tp_alloc(type, 0);
+    if (o) {
+        o->data = self->data->entities; // todone. / BUGFIX - entities isn't a shared pointer on UIGrid, what to do? -- I made it a sp<list<sp<UIEntity>>>
+        o->grid = self->data;
+    }
+    return (PyObject*)o;
+}
+
+PyObject* UIGrid::repr(PyUIGridObject* self)
+{
+
+//    if (member_ptr == 0) // x
+//        self->data->box.setPosition(val, self->data->box.getPosition().y);
+//    else if (member_ptr == 1) // y
+//        self->data->box.setPosition(self->data->box.getPosition().x, val);
+//    else if (member_ptr == 2) // w
+//        self->data->box.setSize(sf::Vector2f(val, self->data->box.getSize().y));
+//    else if (member_ptr == 3) // h
+//        self->data->box.setSize(sf::Vector2f(self->data->box.getSize().x, val));
+//    else if (member_ptr == 4) // center_x
+//        self->data->center_x = val;
+//    else if (member_ptr == 5) // center_y
+//        self->data->center_y = val;
+//    else if (member_ptr == 6) // zoom
+//        self->data->zoom = val;
+
+    std::ostringstream ss;
+    if (!self->data) ss << "<Grid (invalid internal object)>";
+    else {
+        auto grid = self->data;
+        auto box = grid->box;
+        ss << "<Grid (x=" << box.getPosition().x << ", y=" << box.getPosition().y << ", w=" << box.getSize().x << ", h=" << box.getSize().y << ", " <<
+            "center=(" << grid->center_x << ", " << grid->center_y << "), zoom=" << grid->zoom <<
+            ")>";
+    }
+    std::string repr_str = ss.str();
+    return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
+}
+
+/* // TODO standard pointer would need deleted, but I opted for a shared pointer. tp_dealloc currently not even defined in the PyTypeObject
+void PyUIGrid_dealloc(PyUIGridObject* self) {
+    delete self->data; // Clean up the allocated UIGrid object
+    Py_TYPE(self)->tp_free((PyObject*)self);
+}
+*/
+
+int UIEntityCollectionIter::init(PyUIEntityCollectionIterObject* self, PyObject* args, PyObject* kwds)
+{
+    PyErr_SetString(PyExc_TypeError, "UICollection cannot be instantiated: a C++ data source is required.");
+    return -1;
+}
+
+PyObject* UIEntityCollectionIter::next(PyUIEntityCollectionIterObject* self)
+{
+    if (self->data->size() != self->start_size)
+    {
+        PyErr_SetString(PyExc_RuntimeError, "collection changed size during iteration");
+        return NULL;
+    }
+
+    if (self->index > self->start_size - 1)
+    {
+        PyErr_SetNone(PyExc_StopIteration);
+        return NULL;
+    }
+    self->index++;
+    auto vec = self->data.get();
+    if (!vec)
+    {
+        PyErr_SetString(PyExc_RuntimeError, "the collection store returned a null pointer");
+        return NULL;
+    }
+    // Advance list iterator since Entities are not stored in a vector (if this code even worked)
+    // vectors only: //auto target = (*vec)[self->index-1];
+    //auto l_front = (*vec).begin();
+    //std::advance(l_front, self->index-1);
+
+    // TODO build PyObject* of the correct UIDrawable subclass to return
+    //return py_instance(target);
+    return NULL;
+}
+
+PyObject* UIEntityCollectionIter::repr(PyUIEntityCollectionIterObject* self)
+{
+    std::ostringstream ss;
+    if (!self->data) ss << "<UICollectionIter (invalid internal object)>";
+    else {
+        ss << "<UICollectionIter (" << self->data->size() << " child objects, @ index " << self->index  << ")>";
+    }
+    std::string repr_str = ss.str();
+    return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
+}
+
+Py_ssize_t UIEntityCollection::len(PyUIEntityCollectionObject* self) {
+    return self->data->size();
+}
+
+PyObject* UIEntityCollection::getitem(PyUIEntityCollectionObject* self, Py_ssize_t index) {
+    // build a Python version of item at self->data[index]
+    //  Copy pasted::
+    auto vec = self->data.get();
+    if (!vec)
+    {
+        PyErr_SetString(PyExc_RuntimeError, "the collection store returned a null pointer");
+        return NULL;
+    }
+    while (index < 0) index += self->data->size();
+    if (index > self->data->size() - 1)
+    {
+        PyErr_SetString(PyExc_IndexError, "EntityCollection index out of range");
+        return NULL;
+    }
+    auto l_begin = (*vec).begin();
+    std::advance(l_begin, index);
+    auto target = *l_begin; //auto target = (*vec)[index];
+    //RET_PY_INSTANCE(target);
+    // construct and return an entity object that points directly into the UIGrid's entity vector
+    //PyUIEntityObject* o = (PyUIEntityObject*)((&PyUIEntityType)->tp_alloc(&PyUIEntityType, 0));
+    auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "Entity");
+    auto o = (PyUIEntityObject*)type->tp_alloc(type, 0);
+    auto p = std::static_pointer_cast<UIEntity>(target);
+    o->data = p;
+    return (PyObject*)o;
+return NULL;
+
+
+}
+
+PySequenceMethods UIEntityCollection::sqmethods = {
+    .sq_length = (lenfunc)UIEntityCollection::len,
+    .sq_item = (ssizeargfunc)UIEntityCollection::getitem,
+    //.sq_item_by_index = UIEntityCollection::getitem
+    //.sq_slice - return a subset of the iterable
+    //.sq_ass_item - called when `o[x] = y` is executed (x is any object type)
+    //.sq_ass_slice - cool; no thanks, for now
+    //.sq_contains - called when `x in o` is executed
+    //.sq_ass_item_by_index - called when `o[x] = y` is executed (x is explictly an integer)
+};
+
+PyObject* UIEntityCollection::append(PyUIEntityCollectionObject* self, PyObject* o)
+{
+    // if not UIDrawable subclass, reject it
+    // self->data->push_back( c++ object inside o );
+
+    // this would be a great use case for .tp_base
+    //if (!PyObject_IsInstance(o, (PyObject*)&PyUIEntityType))
+    if (!PyObject_IsInstance(o, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Entity")))
+    {
+        PyErr_SetString(PyExc_TypeError, "Only Entity objects can be added to EntityCollection");
+        return NULL;
+    }
+    PyUIEntityObject* entity = (PyUIEntityObject*)o;
+    self->data->push_back(entity->data);
+    entity->data->grid = self->grid;
+
+    Py_INCREF(Py_None);
+    return Py_None;
+}
+
+PyObject* UIEntityCollection::remove(PyUIEntityCollectionObject* self, PyObject* o)
+{
+    if (!PyLong_Check(o))
+    {
+        PyErr_SetString(PyExc_TypeError, "UICollection.remove requires an integer index to remove");
+        return NULL;
+    }
+    long index = PyLong_AsLong(o);
+    if (index >= self->data->size())
+    {
+        PyErr_SetString(PyExc_ValueError, "Index out of range");
+        return NULL;
+    }
+    else if (index < 0)
+    {
+        PyErr_SetString(PyExc_NotImplementedError, "reverse indexing is not implemented.");
+        return NULL;
+    }
+
+    // release the shared pointer at correct part of the list
+    self->data->erase(std::next(self->data->begin(), index));
+    Py_INCREF(Py_None);
+    return Py_None;
+}
+
+PyMethodDef UIEntityCollection::methods[] = {
+    {"append", (PyCFunction)UIEntityCollection::append, METH_O},
+    //{"extend", (PyCFunction)UIEntityCollection::extend, METH_O}, // TODO
+    {"remove", (PyCFunction)UIEntityCollection::remove, METH_O},
+    {NULL, NULL, 0, NULL}
+};
+
+PyObject* UIEntityCollection::repr(PyUIEntityCollectionObject* self)
+{
+    std::ostringstream ss;
+    if (!self->data) ss << "<UICollection (invalid internal object)>";
+    else {
+        ss << "<UICollection (" << self->data->size() << " child objects)>";
+    }
+    std::string repr_str = ss.str();
+    return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
+}
+
+int UIEntityCollection::init(PyUIEntityCollectionObject* self, PyObject* args, PyObject* kwds)
+{
+    PyErr_SetString(PyExc_TypeError, "EntityCollection cannot be instantiated: a C++ data source is required.");
+    return -1;
+}
+
+PyObject* UIEntityCollection::iter(PyUIEntityCollectionObject* self)
+{
+    //PyUIEntityCollectionIterObject* iterObj;
+    //iterObj = (PyUIEntityCollectionIterObject*)PyUIEntityCollectionIterType.tp_alloc(&PyUIEntityCollectionIterType, 0);
+    auto type = (PyTypeObject*)PyObject_GetAttrString(McRFPy_API::mcrf_module, "EntityCollectionIter");
+    auto iterObj = (PyUIEntityCollectionIterObject*)type->tp_alloc(type, 0);
+    if (iterObj == NULL) {
+        return NULL;  // Failed to allocate memory for the iterator object
+    }
+
+    iterObj->data = self->data;
+    iterObj->index = 0;
+    iterObj->start_size = self->data->size();
+
+    return (PyObject*)iterObj;
+}

src/UIGrid.h

@@ -0,0 +1,184 @@
+#pragma once
+#include "Common.h"
+#include "Python.h"
+#include "structmember.h"
+#include "IndexTexture.h"
+#include "Resources.h"
+#include <list>
+
+#include "PyCallable.h"
+#include "PyTexture.h"
+#include "PyColor.h"
+#include "PyVector.h"
+#include "PyFont.h"
+
+#include "UIGridPoint.h"
+#include "UIEntity.h"
+#include "UIDrawable.h"
+#include "UIBase.h"
+
+class UIGrid: public UIDrawable
+{
+private:
+    std::shared_ptr<PyTexture> ptex;
+public:
+    UIGrid();
+    //UIGrid(int, int, IndexTexture*, float, float, float, float);
+    UIGrid(int, int, std::shared_ptr<PyTexture>, sf::Vector2f, sf::Vector2f);
+    void update();
+    void render(sf::Vector2f) override final;
+    UIGridPoint& at(int, int);
+    PyObjectsEnum derived_type() override final;
+    //void setSprite(int);
+    virtual UIDrawable* click_at(sf::Vector2f point) override final;
+
+    int grid_x, grid_y;
+    //int grid_size; // grid sizes are implied by IndexTexture now
+    sf::RectangleShape box;
+    float center_x, center_y, zoom;
+    //IndexTexture* itex;
+    std::shared_ptr<PyTexture> getTexture();
+    sf::Sprite sprite, output;
+    sf::RenderTexture renderTexture;
+    std::vector<UIGridPoint> points;
+    std::shared_ptr<std::list<std::shared_ptr<UIEntity>>> entities;
+
+    static int init(PyUIGridObject* self, PyObject* args, PyObject* kwds);
+    static PyObject* get_grid_size(PyUIGridObject* self, void* closure);
+    static PyObject* get_position(PyUIGridObject* self, void* closure);
+    static int set_position(PyUIGridObject* self, PyObject* value, void* closure);
+    static PyObject* get_size(PyUIGridObject* self, void* closure);
+    static int set_size(PyUIGridObject* self, PyObject* value, void* closure);
+    static PyObject* get_center(PyUIGridObject* self, void* closure);
+    static int set_center(PyUIGridObject* self, PyObject* value, void* closure);
+    static PyObject* get_float_member(PyUIGridObject* self, void* closure);
+    static int set_float_member(PyUIGridObject* self, PyObject* value, void* closure);
+    static PyObject* get_texture(PyUIGridObject* self, void* closure);
+    static PyObject* py_at(PyUIGridObject* self, PyObject* o);
+    static PyMethodDef methods[];
+    static PyGetSetDef getsetters[];
+    static PyObject* get_children(PyUIGridObject* self, void* closure);
+    static PyObject* repr(PyUIGridObject* self);
+    
+};
+
+typedef struct {
+    PyObject_HEAD
+    std::shared_ptr<std::list<std::shared_ptr<UIEntity>>> data;
+    std::shared_ptr<UIGrid> grid;
+} PyUIEntityCollectionObject;
+
+class UIEntityCollection {
+public:
+    static PySequenceMethods sqmethods;
+    static PyObject* append(PyUIEntityCollectionObject* self, PyObject* o);
+    static PyObject* remove(PyUIEntityCollectionObject* self, PyObject* o);
+    static PyMethodDef methods[];
+    static PyObject* repr(PyUIEntityCollectionObject* self);
+    static int init(PyUIEntityCollectionObject* self, PyObject* args, PyObject* kwds);
+    static PyObject* iter(PyUIEntityCollectionObject* self);
+    static Py_ssize_t len(PyUIEntityCollectionObject* self);
+    static PyObject* getitem(PyUIEntityCollectionObject* self, Py_ssize_t index);
+};
+
+typedef struct {
+    PyObject_HEAD
+    std::shared_ptr<std::list<std::shared_ptr<UIEntity>>> data;
+    int index;
+    int start_size;
+} PyUIEntityCollectionIterObject;
+
+class UIEntityCollectionIter {
+public:
+    static int init(PyUIEntityCollectionIterObject* self, PyObject* args, PyObject* kwds);
+    static PyObject* next(PyUIEntityCollectionIterObject* self);
+    static PyObject* repr(PyUIEntityCollectionIterObject* self);
+    static PyObject* getitem(PyUIEntityCollectionObject* self, Py_ssize_t index);
+    
+};
+
+namespace mcrfpydef {
+    static PyTypeObject PyUIGridType = {
+        //PyVarObject_HEAD_INIT(NULL, 0)
+        .tp_name = "mcrfpy.Grid",
+        .tp_basicsize = sizeof(PyUIGridObject),
+        .tp_itemsize = 0,
+        //.tp_dealloc = (destructor)[](PyObject* self)
+        //{
+        //    PyUIGridObject* obj = (PyUIGridObject*)self;
+        //    obj->data.reset();
+        //    Py_TYPE(self)->tp_free(self);
+        //},
+        //TODO - PyUIGrid REPR def:
+        .tp_repr = (reprfunc)UIGrid::repr,
+        //.tp_hash = NULL,
+        //.tp_iter
+        //.tp_iternext
+        .tp_flags = Py_TPFLAGS_DEFAULT,
+        .tp_doc = PyDoc_STR("docstring"),
+        .tp_methods = UIGrid::methods,
+        //.tp_members = UIGrid::members,
+        .tp_getset = UIGrid::getsetters,
+        //.tp_base = NULL,
+        .tp_init = (initproc)UIGrid::init,
+        .tp_new = [](PyTypeObject* type, PyObject* args, PyObject* kwds) -> PyObject*
+        {
+            PyUIGridObject* self = (PyUIGridObject*)type->tp_alloc(type, 0);
+            if (self) self->data = std::make_shared<UIGrid>();
+            return (PyObject*)self;
+        }
+    };
+
+    static PyTypeObject PyUIEntityCollectionIterType = {
+        //PyVarObject_HEAD_INIT(NULL, 0)
+        .tp_name = "mcrfpy.UICollectionIter",
+        .tp_basicsize = sizeof(PyUIEntityCollectionIterObject),
+        .tp_itemsize = 0,
+        .tp_dealloc = (destructor)[](PyObject* self)
+        {
+            PyUIEntityCollectionIterObject* obj = (PyUIEntityCollectionIterObject*)self;
+            obj->data.reset();
+            Py_TYPE(self)->tp_free(self);
+        },
+        .tp_repr = (reprfunc)UIEntityCollectionIter::repr,
+        .tp_flags = Py_TPFLAGS_DEFAULT,
+        .tp_doc = PyDoc_STR("Iterator for a collection of UI objects"),
+        .tp_iternext = (iternextfunc)UIEntityCollectionIter::next,
+        //.tp_getset = UIEntityCollection::getset,
+        .tp_init = (initproc)UIEntityCollectionIter::init, // just raise an exception
+        .tp_new = [](PyTypeObject* type, PyObject* args, PyObject* kwds) -> PyObject*
+        {
+            PyErr_SetString(PyExc_TypeError, "UICollection cannot be instantiated: a C++ data source is required.");
+            return NULL;
+        }
+    };
+
+    static PyTypeObject PyUIEntityCollectionType = {
+        //PyVarObject_/HEAD_INIT(NULL, 0)
+        .tp_name = "mcrfpy.EntityCollection",
+        .tp_basicsize = sizeof(PyUIEntityCollectionObject),
+        .tp_itemsize = 0,
+        .tp_dealloc = (destructor)[](PyObject* self)
+        {
+            PyUIEntityCollectionObject* obj = (PyUIEntityCollectionObject*)self;
+            obj->data.reset();
+            Py_TYPE(self)->tp_free(self);
+        },
+        .tp_repr = (reprfunc)UIEntityCollection::repr,
+        .tp_as_sequence = &UIEntityCollection::sqmethods,
+        .tp_flags = Py_TPFLAGS_DEFAULT,
+        .tp_doc = PyDoc_STR("Iterable, indexable collection of Entities"),
+        .tp_iter = (getiterfunc)UIEntityCollection::iter,
+        .tp_methods = UIEntityCollection::methods, // append, remove
+        //.tp_getset = UIEntityCollection::getset,
+        .tp_init = (initproc)UIEntityCollection::init, // just raise an exception
+        .tp_new = [](PyTypeObject* type, PyObject* args, PyObject* kwds) -> PyObject*
+        {
+            // Does PyUIEntityCollectionType need __new__ if it's not supposed to be instantiable by the user?
+            // Should I just raise an exception? Or is the uninitialized shared_ptr enough of a blocker?
+            PyErr_SetString(PyExc_TypeError, "EntityCollection cannot be instantiated: a C++ data source is required.");
+            return NULL;
+        }
+    };
+
+}

src/UIGridPoint.cpp

@@ -0,0 +1,158 @@
+#include "UIGridPoint.h"
+
+UIGridPoint::UIGridPoint()
+: color(1.0f, 1.0f, 1.0f), color_overlay(0.0f, 0.0f, 0.0f), walkable(false), transparent(false),
+ tilesprite(-1), tile_overlay(-1), uisprite(-1)
+{}
+
+// Utility function to convert sf::Color to PyObject*
+PyObject* sfColor_to_PyObject(sf::Color color) {
+    return Py_BuildValue("(iiii)", color.r, color.g, color.b, color.a);
+}
+
+// Utility function to convert PyObject* to sf::Color
+sf::Color PyObject_to_sfColor(PyObject* obj) {
+    int r, g, b, a = 255; // Default alpha to fully opaque if not specified
+    if (!PyArg_ParseTuple(obj, "iii|i", &r, &g, &b, &a)) {
+        return sf::Color(); // Return default color on parse error
+    }
+    return sf::Color(r, g, b, a);
+}
+
+PyObject* UIGridPoint::get_color(PyUIGridPointObject* self, void* closure) {
+    if (reinterpret_cast<long>(closure) == 0) { // color
+        return sfColor_to_PyObject(self->data->color);
+    } else { // color_overlay
+        return sfColor_to_PyObject(self->data->color_overlay);
+    }
+}
+
+int UIGridPoint::set_color(PyUIGridPointObject* self, PyObject* value, void* closure) {
+    sf::Color color = PyObject_to_sfColor(value);
+    if (reinterpret_cast<long>(closure) == 0) { // color
+        self->data->color = color;
+    } else { // color_overlay
+        self->data->color_overlay = color;
+    }
+    return 0;
+}
+
+PyObject* UIGridPoint::get_bool_member(PyUIGridPointObject* self, void* closure) {
+    if (reinterpret_cast<long>(closure) == 0) { // walkable
+        return PyBool_FromLong(self->data->walkable);
+    } else { // transparent
+        return PyBool_FromLong(self->data->transparent);
+    }
+}
+
+int UIGridPoint::set_bool_member(PyUIGridPointObject* self, PyObject* value, void* closure) {
+    if (value == Py_True) {
+        if (reinterpret_cast<long>(closure) == 0) { // walkable
+            self->data->walkable = true;
+        } else { // transparent
+            self->data->transparent = true;
+        }
+    } else if (value == Py_False) {
+        if (reinterpret_cast<long>(closure) == 0) { // walkable
+            self->data->walkable = false;
+        } else { // transparent
+            self->data->transparent = false;
+        }
+    } else {
+        PyErr_SetString(PyExc_ValueError, "Expected a boolean value");
+        return -1;
+    }
+    return 0;
+}
+
+PyObject* UIGridPoint::get_int_member(PyUIGridPointObject* self, void* closure) {
+    switch(reinterpret_cast<long>(closure)) {
+        case 0: return PyLong_FromLong(self->data->tilesprite);
+        case 1: return PyLong_FromLong(self->data->tile_overlay);
+        case 2: return PyLong_FromLong(self->data->uisprite);
+        default: PyErr_SetString(PyExc_RuntimeError, "Invalid closure"); return nullptr;
+    }
+}
+
+int UIGridPoint::set_int_member(PyUIGridPointObject* self, PyObject* value, void* closure) {
+    long val = PyLong_AsLong(value);
+    if (PyErr_Occurred()) return -1;
+
+    switch(reinterpret_cast<long>(closure)) {
+        case 0: self->data->tilesprite = val; break;
+        case 1: self->data->tile_overlay = val; break;
+        case 2: self->data->uisprite = val; break;
+        default: PyErr_SetString(PyExc_RuntimeError, "Invalid closure"); return -1;
+    }
+    return 0;
+}
+
+PyGetSetDef UIGridPoint::getsetters[] = {
+    {"color", (getter)UIGridPoint::get_color, (setter)UIGridPoint::set_color, "GridPoint color", (void*)0},
+    {"color_overlay", (getter)UIGridPoint::get_color, (setter)UIGridPoint::set_color, "GridPoint color overlay", (void*)1},
+    {"walkable", (getter)UIGridPoint::get_bool_member, (setter)UIGridPoint::set_bool_member, "Is the GridPoint walkable", (void*)0},
+    {"transparent", (getter)UIGridPoint::get_bool_member, (setter)UIGridPoint::set_bool_member, "Is the GridPoint transparent", (void*)1},
+    {"tilesprite", (getter)UIGridPoint::get_int_member, (setter)UIGridPoint::set_int_member, "Tile sprite index", (void*)0},
+    {"tile_overlay", (getter)UIGridPoint::get_int_member, (setter)UIGridPoint::set_int_member, "Tile overlay sprite index", (void*)1},
+    {"uisprite", (getter)UIGridPoint::get_int_member, (setter)UIGridPoint::set_int_member, "UI sprite index", (void*)2},
+    {NULL}  /* Sentinel */
+};
+
+PyObject* UIGridPoint::repr(PyUIGridPointObject* self) {
+    std::ostringstream ss;
+    if (!self->data) ss << "<GridPoint (invalid internal object)>";
+    else {
+        auto gp = self->data;
+        ss << "<GridPoint (walkable=" << (gp->walkable ? "True" : "False") << ", transparent=" << (gp->transparent ? "True" : "False") << 
+              ", tilesprite=" << gp->tilesprite << ", tile_overlay=" << gp->tile_overlay << ", uisprite=" << gp->uisprite <<
+        ")>";
+    }
+    std::string repr_str = ss.str();
+    return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
+}
+
+PyObject* UIGridPointState::get_bool_member(PyUIGridPointStateObject* self, void* closure) {
+    if (reinterpret_cast<long>(closure) == 0) { // visible
+        return PyBool_FromLong(self->data->visible);
+    } else { // discovered
+        return PyBool_FromLong(self->data->discovered);
+    }
+}
+
+int UIGridPointState::set_bool_member(PyUIGridPointStateObject* self, PyObject* value, void* closure) {
+    if (!PyBool_Check(value)) {
+        PyErr_SetString(PyExc_TypeError, "Value must be a boolean");
+        return -1;
+    }
+
+    int truthValue = PyObject_IsTrue(value);
+    if (truthValue < 0) {
+        return -1; // PyObject_IsTrue returns -1 on error
+    }
+
+    if (reinterpret_cast<long>(closure) == 0) { // visible
+        self->data->visible = truthValue;
+    } else { // discovered
+        self->data->discovered = truthValue;
+    }
+
+    return 0;
+}
+
+PyGetSetDef UIGridPointState::getsetters[] = {
+    {"visible", (getter)UIGridPointState::get_bool_member, (setter)UIGridPointState::set_bool_member, "Is the GridPointState visible", (void*)0},
+    {"discovered", (getter)UIGridPointState::get_bool_member, (setter)UIGridPointState::set_bool_member, "Has the GridPointState been discovered", (void*)1},
+    {NULL}  /* Sentinel */
+};
+
+PyObject* UIGridPointState::repr(PyUIGridPointStateObject* self) {
+    std::ostringstream ss;
+    if (!self->data) ss << "<GridPointState (invalid internal object)>";
+    else {
+        auto gps = self->data;
+        ss << "<GridPointState (visible=" << (gps->visible ? "True" : "False") << ", discovered=" << (gps->discovered ? "True" : "False") << 
+        ")>";
+    }
+    std::string repr_str = ss.str();
+    return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
+}

src/UIGridPoint.h

@@ -0,0 +1,92 @@
+#pragma once
+#include "Common.h"
+#include "Python.h"
+#include "structmember.h"
+#include "IndexTexture.h"
+#include "Resources.h"
+#include <list>
+
+#include "PyCallable.h"
+#include "PyTexture.h"
+#include "PyColor.h"
+#include "PyVector.h"
+#include "PyFont.h"
+
+static PyObject* sfColor_to_PyObject(sf::Color color);
+static sf::Color PyObject_to_sfColor(PyObject* obj);
+
+class UIGrid;
+class UIEntity;
+class UIGridPoint;
+class UIGridPointState;
+
+typedef struct {
+    PyObject_HEAD
+    UIGridPoint* data;
+    std::shared_ptr<UIGrid> grid;
+} PyUIGridPointObject;
+
+typedef struct {
+    PyObject_HEAD
+    UIGridPointState* data;
+    std::shared_ptr<UIGrid> grid;
+    std::shared_ptr<UIEntity> entity;
+} PyUIGridPointStateObject;
+
+// UIGridPoint - revised grid data for each point
+class UIGridPoint
+{
+public:
+    sf::Color color, color_overlay;
+    bool walkable, transparent;
+    int tilesprite, tile_overlay, uisprite;
+    UIGridPoint();
+
+    static int set_int_member(PyUIGridPointObject* self, PyObject* value, void* closure);
+    static PyGetSetDef getsetters[];
+    static PyObject* get_color(PyUIGridPointObject* self, void* closure);
+    static PyObject* get_int_member(PyUIGridPointObject* self, void* closure);
+    static int set_bool_member(PyUIGridPointObject* self, PyObject* value, void* closure);
+    static PyObject* get_bool_member(PyUIGridPointObject* self, void* closure);
+    static int set_color(PyUIGridPointObject* self, PyObject* value, void* closure);
+    static PyObject* repr(PyUIGridPointObject* self);
+};
+
+// UIGridPointState - entity-specific info for each cell
+class UIGridPointState
+{
+public:
+    bool visible, discovered;
+
+    static PyObject* get_bool_member(PyUIGridPointStateObject* self, void* closure);
+    static int set_bool_member(PyUIGridPointStateObject* self, PyObject* value, void* closure);
+    static PyGetSetDef getsetters[];
+    static PyObject* repr(PyUIGridPointStateObject* self);
+};
+
+namespace mcrfpydef {
+    static PyTypeObject PyUIGridPointType = {
+        //PyVarObject_HEAD_INIT(NULL, 0)
+        .tp_name = "mcrfpy.GridPoint",
+        .tp_basicsize = sizeof(PyUIGridPointObject),
+        .tp_itemsize = 0,
+        .tp_repr = (reprfunc)UIGridPoint::repr,
+        .tp_flags = Py_TPFLAGS_DEFAULT,
+        .tp_doc = "UIGridPoint object",
+        .tp_getset = UIGridPoint::getsetters,
+        //.tp_init = (initproc)PyUIGridPoint_init, // TODO Define the init function
+        .tp_new = PyType_GenericNew,
+    };
+
+    static PyTypeObject PyUIGridPointStateType = {
+        //PyVarObject_HEAD_INIT(NULL, 0)
+        .tp_name = "mcrfpy.GridPointState",
+        .tp_basicsize = sizeof(PyUIGridPointStateObject),
+        .tp_itemsize = 0,
+        .tp_repr = (reprfunc)UIGridPointState::repr,
+        .tp_flags = Py_TPFLAGS_DEFAULT,
+        .tp_doc = "UIGridPointState object", // TODO: Add PyUIGridPointState tp_init
+        .tp_getset = UIGridPointState::getsetters,
+        .tp_new = PyType_GenericNew,
+    };
+}

src/UISprite.cpp

@@ -0,0 +1,215 @@
+#include "UISprite.h"
+#include "GameEngine.h"
+
+UIDrawable* UISprite::click_at(sf::Vector2f point)
+{
+    if (click_callable)
+    {
+        if(sprite.getGlobalBounds().contains(point)) return this;
+    }
+    return NULL;
+}
+
+UISprite::UISprite() {}
+
+UISprite::UISprite(std::shared_ptr<PyTexture> _ptex, int _sprite_index, sf::Vector2f _pos, float _scale)
+: ptex(_ptex), sprite_index(_sprite_index)
+{
+    sprite = ptex->sprite(sprite_index, _pos, sf::Vector2f(_scale, _scale));
+}
+
+void UISprite::render(sf::Vector2f offset)
+{
+    sprite.move(offset);
+    Resources::game->getWindow().draw(sprite);
+    sprite.move(-offset);
+}
+
+void UISprite::render(sf::Vector2f offset, sf::RenderTexture& target)
+{
+    sprite.move(offset);
+    target.draw(sprite);
+    sprite.move(-offset);
+}
+
+void UISprite::setPosition(sf::Vector2f pos)
+{
+    sprite.setPosition(pos);
+}
+
+void UISprite::setScale(sf::Vector2f s)
+{
+    sprite.setScale(s);
+}
+
+void UISprite::setTexture(std::shared_ptr<PyTexture> _ptex, int _sprite_index)
+{
+    ptex = _ptex;
+    if (_sprite_index != -1) // if you are changing textures, there's a good chance you need a new index too
+        sprite_index = _sprite_index;
+    sprite = ptex->sprite(sprite_index, sprite.getPosition(), sprite.getScale());
+}
+
+void UISprite::setSpriteIndex(int _sprite_index)
+{
+    sprite_index = _sprite_index;
+    sprite = ptex->sprite(sprite_index, sprite.getPosition(), sprite.getScale());
+}
+
+sf::Vector2f UISprite::getScale()
+{
+    return sprite.getScale();
+}
+
+sf::Vector2f UISprite::getPosition()
+{
+    return sprite.getPosition();
+}
+
+std::shared_ptr<PyTexture> UISprite::getTexture()
+{
+    return ptex;
+}
+
+int UISprite::getSpriteIndex()
+{
+    return sprite_index;
+}
+
+PyObjectsEnum UISprite::derived_type()
+{
+    return PyObjectsEnum::UISPRITE;
+}
+
+PyObject* UISprite::get_float_member(PyUISpriteObject* self, void* closure)
+{
+    auto member_ptr = reinterpret_cast<long>(closure);
+    if (member_ptr == 0)
+        return PyFloat_FromDouble(self->data->getPosition().x);
+    else if (member_ptr == 1)
+        return PyFloat_FromDouble(self->data->getPosition().y);
+    else if (member_ptr == 2)
+        return PyFloat_FromDouble(self->data->getScale().x); // scale X and Y are identical, presently
+    else
+    {
+        PyErr_SetString(PyExc_AttributeError, "Invalid attribute");
+        return nullptr;
+    }
+}
+
+int UISprite::set_float_member(PyUISpriteObject* self, PyObject* value, void* closure)
+{
+    float val;
+    auto member_ptr = reinterpret_cast<long>(closure);
+    if (PyFloat_Check(value))
+    {
+        val = PyFloat_AsDouble(value);
+    }
+    else if (PyLong_Check(value))
+    {
+        val = PyLong_AsLong(value);
+    }
+    else
+    {
+        PyErr_SetString(PyExc_TypeError, "Value must be a floating point number.");
+        return -1;
+    }
+    if (member_ptr == 0) //x
+        self->data->setPosition(sf::Vector2f(val, self->data->getPosition().y));
+    else if (member_ptr == 1) //y
+        self->data->setPosition(sf::Vector2f(self->data->getPosition().x, val));
+    else if (member_ptr == 2) // scale
+        self->data->setScale(sf::Vector2f(val, val));
+    return 0;
+}
+
+PyObject* UISprite::get_int_member(PyUISpriteObject* self, void* closure)
+{
+    auto member_ptr = reinterpret_cast<long>(closure);
+    if (true) {}
+    else
+    {
+        PyErr_SetString(PyExc_AttributeError, "Invalid attribute");
+        return nullptr;
+    }
+    
+    return PyLong_FromDouble(self->data->getSpriteIndex());
+}
+
+int UISprite::set_int_member(PyUISpriteObject* self, PyObject* value, void* closure)
+{
+    int val;
+    auto member_ptr = reinterpret_cast<long>(closure);
+    if (PyLong_Check(value))
+    {
+        val = PyLong_AsLong(value);
+    }
+    else
+    {
+        PyErr_SetString(PyExc_TypeError, "Value must be an integer.");
+        return -1;
+    }
+    self->data->setSpriteIndex(val);
+    return 0;
+}
+
+PyObject* UISprite::get_texture(PyUISpriteObject* self, void* closure)
+{
+    return self->data->getTexture()->pyObject();
+}
+
+int UISprite::set_texture(PyUISpriteObject* self, PyObject* value, void* closure)
+{
+    return -1;
+}
+
+PyGetSetDef UISprite::getsetters[] = {
+    {"x", (getter)UISprite::get_float_member, (setter)UISprite::set_float_member, "X coordinate of top-left corner",   (void*)0},
+    {"y", (getter)UISprite::get_float_member, (setter)UISprite::set_float_member, "Y coordinate of top-left corner",   (void*)1},
+    {"scale", (getter)UISprite::get_float_member, (setter)UISprite::set_float_member, "Size factor",                   (void*)2},
+    {"sprite_number", (getter)UISprite::get_int_member, (setter)UISprite::set_int_member, "Which sprite on the texture is shown", NULL},
+    {"texture", (getter)UISprite::get_texture, (setter)UISprite::set_texture,     "Texture object",                    NULL},
+    {"click", (getter)UIDrawable::get_click, (setter)UIDrawable::set_click, "Object called with (x, y, button) when clicked", (void*)PyObjectsEnum::UISPRITE},
+    {NULL}
+};
+
+PyObject* UISprite::repr(PyUISpriteObject* self)
+{
+    std::ostringstream ss;
+    if (!self->data) ss << "<Sprite (invalid internal object)>";
+    else {
+        //auto sprite = self->data->sprite;
+        ss << "<Sprite (x=" << self->data->getPosition().x << ", y=" << self->data->getPosition().y << ", " <<
+            "scale=" << self->data->getScale().x << ", " <<
+            "sprite_number=" << self->data->getSpriteIndex() << ")>";
+    }
+    std::string repr_str = ss.str();
+    return PyUnicode_DecodeUTF8(repr_str.c_str(), repr_str.size(), "replace");
+}
+
+int UISprite::init(PyUISpriteObject* self, PyObject* args, PyObject* kwds)
+{
+    //std::cout << "Init called\n";
+    static const char* keywords[] = { "x", "y", "texture", "sprite_index", "scale", nullptr };
+    float x = 0.0f, y = 0.0f, scale = 1.0f;
+    int sprite_index;
+    PyObject* texture;
+
+    if (!PyArg_ParseTupleAndKeywords(args, kwds, "|ffOif",
+        const_cast<char**>(keywords), &x, &y, &texture, &sprite_index, &scale))
+    {
+        return -1;
+    }
+
+    // check types for texture
+    //if (texture != NULL && !PyObject_IsInstance(texture, (PyObject*)&PyTextureType)){
+    if (texture != NULL && !PyObject_IsInstance(texture, PyObject_GetAttrString(McRFPy_API::mcrf_module, "Texture"))){
+        PyErr_SetString(PyExc_TypeError, "texture must be a mcrfpy.Texture instance");
+        return -1;
+    }
+    auto pytexture = (PyTextureObject*)texture;
+    self->data = std::make_shared<UISprite>(pytexture->data, sprite_index, sf::Vector2f(x, y), scale);
+    self->data->setPosition(sf::Vector2f(x, y));
+
+    return 0;
+}

src/UISprite.h

@@ -0,0 +1,90 @@
+#pragma once
+#include "Common.h"
+#include "Python.h"
+#include "structmember.h"
+#include "IndexTexture.h"
+#include "Resources.h"
+#include <list>
+
+#include "PyCallable.h"
+#include "PyTexture.h"
+#include "PyColor.h"
+#include "PyVector.h"
+#include "PyFont.h"
+#include "UIDrawable.h"
+#include "UIBase.h"
+
+class UISprite: public UIDrawable
+{
+private:
+    int sprite_index;
+    sf::Sprite sprite;
+protected:
+    std::shared_ptr<PyTexture> ptex;
+public:
+    UISprite();
+    UISprite(std::shared_ptr<PyTexture>, int, sf::Vector2f, float);
+    void update();
+    void render(sf::Vector2f) override final;
+    virtual UIDrawable* click_at(sf::Vector2f point) override final;
+    
+    void render(sf::Vector2f, sf::RenderTexture&);
+
+    void setPosition(sf::Vector2f);
+    sf::Vector2f getPosition();
+    void setScale(sf::Vector2f);
+    sf::Vector2f getScale();
+    void setSpriteIndex(int);
+    int getSpriteIndex();
+
+    void setTexture(std::shared_ptr<PyTexture> _ptex, int _sprite_index=-1);
+    std::shared_ptr<PyTexture> getTexture();
+
+    PyObjectsEnum derived_type() override final;
+
+
+    static PyObject* get_float_member(PyUISpriteObject* self, void* closure);
+    static int set_float_member(PyUISpriteObject* self, PyObject* value, void* closure);
+    static PyObject* get_int_member(PyUISpriteObject* self, void* closure);
+    static int set_int_member(PyUISpriteObject* self, PyObject* value, void* closure);
+    static PyObject* get_texture(PyUISpriteObject* self, void* closure);
+    static int set_texture(PyUISpriteObject* self, PyObject* value, void* closure);
+    static PyGetSetDef getsetters[];
+    static PyObject* repr(PyUISpriteObject* self);
+    static int init(PyUISpriteObject* self, PyObject* args, PyObject* kwds);
+    
+};
+
+namespace mcrfpydef {
+    static PyTypeObject PyUISpriteType = {
+        //PyVarObject_HEAD_INIT(NULL, 0)
+        .tp_name = "mcrfpy.Sprite",
+        .tp_basicsize = sizeof(PyUISpriteObject),
+        .tp_itemsize = 0,
+        .tp_dealloc = (destructor)[](PyObject* self)
+        {
+            PyUISpriteObject* obj = (PyUISpriteObject*)self;
+            // release reference to font object
+            //if (obj->texture) Py_DECREF(obj->texture);
+            obj->data.reset();
+            Py_TYPE(self)->tp_free(self);
+        },
+        .tp_repr = (reprfunc)UISprite::repr,
+        //.tp_hash = NULL,
+        //.tp_iter
+        //.tp_iternext
+        .tp_flags = Py_TPFLAGS_DEFAULT,
+        .tp_doc = PyDoc_STR("docstring"),
+        //.tp_methods = PyUIFrame_methods,
+        //.tp_members = PyUIFrame_members,
+        .tp_getset = UISprite::getsetters,
+        //.tp_base = NULL,
+        .tp_init = (initproc)UISprite::init,
+        .tp_new = [](PyTypeObject* type, PyObject* args, PyObject* kwds) -> PyObject*
+        {
+            PyUISpriteObject* self = (PyUISpriteObject*)type->tp_alloc(type, 0);
+            //if (self) self->data = std::make_shared<UICaption>();
+            return (PyObject*)self;
+        }
+    }; 
+}

src/UITestScene.cpp

@@ -61,15 +61,15 @@ UITestScene::UITestScene(GameEngine* g) : Scene(g)
     //ui_elements.push_back(&e1);
     //ui_elements.push_back(&e2);
 
-    t.loadFromFile("./assets/kenney_tinydungeon.png");
+    //t.loadFromFile("./assets/kenney_tinydungeon.png");
-    t.setSmooth(false);
+    //t.setSmooth(false);
-    auto* indextex = new IndexTexture(t, 16, 12, 11);
+    //auto* indextex = new IndexTexture(t, 16, 12, 11);
-    Resources::game->textures.push_back(*indextex);
+    //Resources::game->textures.push_back(*indextex);
-
 
+    auto ptex = std::make_shared<PyTexture>("./assets/kenney_tinydungeon.png", 16, 16);
 
     //std::cout << Resources::game->textures.size() << " textures loaded.\n";
-    auto e3 = std::make_shared<UISprite>();
+    auto e3 = std::make_shared<UISprite>(ptex, 84, sf::Vector2f(10, 10), 4.0);
 
     // Make UISprite more like IndexSprite: this is bad
     //e3->x = 10; e3->y = 10;
@@ -79,19 +79,19 @@ UITestScene::UITestScene(GameEngine* g) : Scene(g)
     //e3->update();
 
     // This goes to show how inconvenient the default constructor is. It should be removed
-    e3->itex = &Resources::game->textures[0];
+    //e3->itex = &Resources::game->textures[0];
-    e3->sprite.setTexture(e3->itex->texture);
+    //e3->sprite.setTexture(e3->itex->texture);
-    e3->sprite_index = 84;
+    //e3->sprite_index = 84;
-    e3->sprite.setTextureRect(e3->itex->spriteCoordinates(e3->sprite_index));
+    //e3->sprite.setTextureRect(e3->itex->spriteCoordinates(e3->sprite_index));
-    e3->setPosition(10, 10);
+    //e3->setPosition(10, 10);
-    e3->setScale(4.0f);
+    //e3->setScale(4.0f);
 
     e1aa->children->push_back(e3);
 
 
 
     auto e4 = std::make_shared<UISprite>(
-            indextex, //&Resources::game->textures[0],
+            ptex, //indextex, //&Resources::game->textures[0],
             85, sf::Vector2f(90, 10), 4.0);
     e1aa->children->push_back(e4);
     //std::cout << "UISprite built: " << e4->sprite.getPosition().x << " " << e4->sprite.getPosition().y << " " << e4->sprite.getScale().x << " " <<
@@ -104,9 +104,9 @@ UITestScene::UITestScene(GameEngine* g) : Scene(g)
     std::cout << "pointer to ui_elements now shows size=" << ui->size() << std::endl;
     */
 
-    // UIGrid test:               (in grid cells)      (in screen pixels)
+    // UIGrid test:                (in grid cells)         (          in screen pixels            )
-    //              constructor args:  w  h  texture    x    y    w    h   
+    //              constructor args:  w  h  texture             x    y                  w    h   
-    auto e5 = std::make_shared<UIGrid>(4, 4, indextex, 550, 150, 200, 200);
+    auto e5 = std::make_shared<UIGrid>(4, 4, ptex, sf::Vector2f(550, 150), sf::Vector2f(200, 200));
     e5->zoom=2.0;
     e5->points[0].color =  sf::Color(255, 0, 0);
     e5->points[1].tilesprite = 1;
@@ -123,8 +123,9 @@ UITestScene::UITestScene(GameEngine* g) : Scene(g)
     // TODO - reimplement UISprite style rendering within UIEntity class. Entities don't have a screen pixel position, they have a grid position, and grid sets zoom when rendering them.
     auto e5a = std::make_shared<UIEntity>(*e5); // this basic constructor sucks: sprite position + zoom are irrelevant for UIEntity.
     e5a->grid = e5;
-    auto e5as = UISprite(indextex, 85, sf::Vector2f(0, 0), 1.0);
+    //auto e5as = UISprite(indextex, 85, sf::Vector2f(0, 0), 1.0);
-    e5a->sprite = e5as; // will copy constructor even exist for UISprite...?
+    //e5a->sprite = e5as; // will copy constructor even exist for UISprite...?
+    e5a->sprite = UISprite(ptex, 85, sf::Vector2f(0, 0), 1.0);
     e5a->position = sf::Vector2f(1, 0);
 
     e5->entities->push_back(e5a);
@@ -153,7 +154,7 @@ void UITestScene::doAction(std::string name, std::string type)
     */
 }
 
-void UITestScene::sRender()
+void UITestScene::render()
 {
     game->getWindow().clear();
     game->getWindow().draw(text);

src/UITestScene.h

@@ -18,5 +18,5 @@ public:
     UITestScene(GameEngine*);
     void update() override final;
     void doAction(std::string, std::string) override final;
-    void sRender() override final;
+    void render() override final;
 };

src/scripts/cos_play.py

@@ -1,7 +1,7 @@
 import mcrfpy
 mcrfpy.createScene("play")
 ui = mcrfpy.sceneUI("play")
-t = mcrfpy.Texture("assets/kenney_tinydungeon.png", 16, 12, 11)
+t = mcrfpy.Texture("assets/kenney_tinydungeon.png", 16, 16) # 12, 11)
 font = mcrfpy.Font("assets/JetbrainsMono.ttf")
 
 frame_color = (64, 64, 128)

src/scripts/game.py

@@ -1,136 +1,60 @@
-#print("Hello mcrogueface")
 import mcrfpy
-import cos_play
-# Universal stuff
 font = mcrfpy.Font("assets/JetbrainsMono.ttf")
-texture = mcrfpy.Texture("assets/kenney_tinydungeon.png", 16, 12, 11)
+texture = mcrfpy.Texture("assets/kenney_tinydungeon.png", 16, 16)
-texture_cold = mcrfpy.Texture("assets/kenney_ice.png", 16, 12, 11)
-texture_hot = mcrfpy.Texture("assets/kenney_lava.png", 16, 12, 11)
 
-# Test stuff
+print("[game.py] Default texture:")
-mcrfpy.createScene("boom")
+print(mcrfpy.default_texture)
-#mcrfpy.setScene("boom")
+print(type(mcrfpy.default_texture))
-ui = mcrfpy.sceneUI("boom")
-box = mcrfpy.Frame(40, 60, 200, 300, fill_color=(255,128,0), outline=4.0, outline_color=(64,64,255,96))
-ui.append(box)
 
-#caption = mcrfpy.Caption(10, 10, "Clicky", font, (255, 255, 255, 255), (0, 0, 0, 255))
+# build test widgets
-#box.click = lambda x, y, btn, type: print("Hello callback: ", x, y, btn, type)
-#box.children.append(caption)
 
-test_sprite_number = 86 
+mcrfpy.createScene("pytest")
-sprite = mcrfpy.Sprite(20, 60, texture, test_sprite_number, 4.0)
+mcrfpy.setScene("pytest")
-spritecap = mcrfpy.Caption(5, 5, "60", font)
+ui = mcrfpy.sceneUI("pytest")
-def click_sprite(x, y, btn, action):
-    global test_sprite_number
-    if action != "start": return
-    if btn in ("left", "wheel_up"):
-        test_sprite_number -= 1
-    elif btn in ("right", "wheel_down"):
-        test_sprite_number += 1
-    sprite.sprite_number = test_sprite_number # TODO - inconsistent naming for __init__, __repr__ and getsetter: sprite_number vs sprite_index
-    spritecap.text = test_sprite_number
 
-sprite.click = click_sprite # TODO - sprites don't seem to correct for screen position or scale when clicking
+# Frame
-box.children.append(sprite)
+f = mcrfpy.Frame(25, 19, 462, 346, fill_color=(255, 92, 92))
-box.children.append(spritecap)
+print("Frame alive")
-box.click = click_sprite
+# fill (LinkedColor / Color):    f.fill_color
+# outline (LinkedColor / Color): f.outline_color
+# pos (LinkedVector / Vector):   f.pos
+# size (LinkedVector / Vector):  f.size
 
-# Loading Screen
+# Caption
-mcrfpy.createScene("loading")
+print("Caption attempt w/ fill_color:")
-ui = mcrfpy.sceneUI("loading")
+#c = mcrfpy.Caption(512+25, 19, "Hi.", font)
-mcrfpy.setScene("loading")
+#c = mcrfpy.Caption(512+25, 19, "Hi.", font, fill_color=(255, 128, 128))
-logo_texture = mcrfpy.Texture("assets/temp_logo.png", 1024, 1, 1)
+c = mcrfpy.Caption(512+25, 19, "Hi.", font, fill_color=mcrfpy.Color(255, 128, 128), outline_color=(128, 255, 128))
-logo_sprite = mcrfpy.Sprite(50, 50, logo_texture, 0, 0.5)
+print("Caption alive")
-ui.append(logo_sprite)
+# fill (LinkedColor / Color):    c.fill_color
-logo_sprite.click = lambda *args: mcrfpy.setScene("menu")
+#color_val = c.fill_color
-logo_caption = mcrfpy.Caption(70, 600, "Click to Proceed", font, (255, 0, 0, 255), (0, 0, 0, 255))
+print(c.fill_color)
-logo_caption.fill_color =(255, 0, 0, 255)
+#print("Set a fill color")
-ui.append(logo_caption)
+#c.fill_color = (255, 255, 255)
+print("Lol, did it segfault?")
+# outline (LinkedColor / Color): c.outline_color
+# font (Font):                   c.font
+# pos (LinkedVector / Vector):   c.pos
 
+# Sprite
+s = mcrfpy.Sprite(25, 384+19, texture, 86, 9.0)
+# pos (LinkedVector / Vector):   s.pos
+# texture (Texture):             s.texture
 
-# menu screen
+# Grid
-mcrfpy.createScene("menu")
+g = mcrfpy.Grid(10, 10, texture, 512+25, 384+19, 462, 346)
+# texture (Texture):             g.texture
+# pos (LinkedVector / Vector):   g.pos
+# size (LinkedVector / Vector):  g.size
 
-for e in [
+for _x in range(10):
-    mcrfpy.Caption(10, 10, "Crypt of Sokoban", font, (255, 255, 255), (0, 0, 0)),
+    for _y in range(10):
-    mcrfpy.Caption(20, 55, "a McRogueFace demo project", font, (192, 192, 192), (0, 0, 0)),
+        g.at((_x, _y)).color = (255 - _x*25, 255 - _y*25, 255)
-    mcrfpy.Frame(15, 70, 150, 60, fill_color=(64, 64, 128)),
+g.zoom = 2.0
-    mcrfpy.Frame(15, 145, 150, 60, fill_color=(64, 64, 128)),
-    mcrfpy.Frame(15, 220, 150, 60, fill_color=(64, 64, 128)),
-    mcrfpy.Frame(15, 295, 150, 60, fill_color=(64, 64, 128)),
-    #mcrfpy.Frame(900, 10, 100, 100, fill_color=(255, 0, 0)),
-    ]:
-    mcrfpy.sceneUI("menu").append(e)
 
-def click_once(fn):
+[ui.append(d) for d in (f, c, s, g)]
-    def wraps(*args, **kwargs):
-        #print(args)
-        action = args[3]
-        if action != "start": return
-        return fn(*args, **kwargs)
-    return wraps
 
-@click_once
+print("built!")
-def asdf(x, y, btn, action):
-    print(f"clicky @({x},{y}) {action}->{btn}")
 
-@click_once
+# tests
-def clicked_exit(*args):
-    mcrfpy.exit()
 
-menu_btns = [
-    ("Boom", lambda *args: 1 / 0),
-    ("Exit", clicked_exit), 
-    ("About", lambda *args: mcrfpy.setScene("about")), 
-    ("Settings", lambda *args: mcrfpy.setScene("settings")), 
-    ("Start", lambda *args: mcrfpy.setScene("play"))
-    ]
-for i in range(len(mcrfpy.sceneUI("menu"))):
-    e = mcrfpy.sceneUI("menu")[i] # TODO - fix iterator
-    #print(e, type(e))
-    if type(e) is not mcrfpy.Frame: continue
-    label, fn = menu_btns.pop()
-    #print(label)
-    e.children.append(mcrfpy.Caption(5, 5, label, font, (192, 192, 255), (0,0,0)))
-    e.click = fn
-
-
-# settings screen
-mcrfpy.createScene("settings")
-window_scaling = 1.0
-
-scale_caption = mcrfpy.Caption(180, 70, "1.0x", font, (255, 255, 255), (0, 0, 0))
-scale_caption.fill_color = (255, 255, 255) # TODO - mcrfpy.Caption.__init__ is not setting colors
-for e in [
-    mcrfpy.Caption(10, 10, "Settings", font, (255, 255, 255), (0, 0, 0)),
-    mcrfpy.Frame(15, 70, 150, 60, fill_color=(64, 64, 128)), # +
-    mcrfpy.Frame(300, 70, 150, 60, fill_color=(64, 64, 128)), # -
-    mcrfpy.Frame(15, 295, 150, 60, fill_color=(64, 64, 128)),
-    scale_caption,
-    ]:
-    mcrfpy.sceneUI("settings").append(e)
-
-@click_once
-def game_scale(x, y, btn, action, delta):
-    global window_scaling
-    print(f"WIP - scale the window from {window_scaling:.1f} to {window_scaling+delta:.1f}")
-    window_scaling += delta
-    scale_caption.text = f"{window_scaling:.1f}x"
-    mcrfpy.setScale(window_scaling)
-    #mcrfpy.setScale(2)
-
-settings_btns = [
-    ("back", lambda *args: mcrfpy.setScene("menu")),
-    ("-", lambda x, y, btn, action: game_scale(x, y, btn, action, -0.1)),
-    ("+", lambda x, y, btn, action: game_scale(x, y, btn, action, +0.1))
-    ]
-
-for i in range(len(mcrfpy.sceneUI("settings"))):
-    e = mcrfpy.sceneUI("settings")[i] # TODO - fix iterator
-    #print(e, type(e))
-    if type(e) is not mcrfpy.Frame: continue
-    label, fn = settings_btns.pop()
-    #print(label, fn)
-    e.children.append(mcrfpy.Caption(5, 5, label, font, (192, 192, 255), (0,0,0)))
-    e.click = fn

src/scripts/game_old.py

@@ -0,0 +1,221 @@
+#print("Hello mcrogueface")
+import mcrfpy
+import cos_play
+# Universal stuff
+font = mcrfpy.Font("assets/JetbrainsMono.ttf")
+texture = mcrfpy.Texture("assets/kenney_tinydungeon.png", 16, 16) #12, 11)
+texture_cold = mcrfpy.Texture("assets/kenney_ice.png", 16, 16) #12, 11)
+texture_hot = mcrfpy.Texture("assets/kenney_lava.png", 16, 16) #12, 11)
+
+# Test stuff
+mcrfpy.createScene("boom")
+mcrfpy.setScene("boom")
+ui = mcrfpy.sceneUI("boom")
+box = mcrfpy.Frame(40, 60, 200, 300, fill_color=(255,128,0), outline=4.0, outline_color=(64,64,255,96))
+ui.append(box)
+
+#caption = mcrfpy.Caption(10, 10, "Clicky", font, (255, 255, 255, 255), (0, 0, 0, 255))
+#box.click = lambda x, y, btn, type: print("Hello callback: ", x, y, btn, type)
+#box.children.append(caption)
+
+test_sprite_number = 86 
+sprite = mcrfpy.Sprite(20, 60, texture, test_sprite_number, 4.0)
+spritecap = mcrfpy.Caption(5, 5, "60", font)
+def click_sprite(x, y, btn, action):
+    global test_sprite_number
+    if action != "start": return
+    if btn in ("left", "wheel_up"):
+        test_sprite_number -= 1
+    elif btn in ("right", "wheel_down"):
+        test_sprite_number += 1
+    sprite.sprite_number = test_sprite_number # TODO - inconsistent naming for __init__, __repr__ and getsetter: sprite_number vs sprite_index
+    spritecap.text = test_sprite_number
+
+sprite.click = click_sprite # TODO - sprites don't seem to correct for screen position or scale when clicking
+box.children.append(sprite)
+box.children.append(spritecap)
+box.click = click_sprite
+
+f_a = mcrfpy.Frame(250, 60, 80, 80, fill_color=(255, 92, 92))
+f_a_txt = mcrfpy.Caption(5, 5, "0", font)
+
+f_b = mcrfpy.Frame(340, 60, 80, 80, fill_color=(92, 255, 92))
+f_b_txt = mcrfpy.Caption(5, 5, "0", font)
+
+f_c = mcrfpy.Frame(430, 60, 80, 80, fill_color=(92, 92, 255))
+f_c_txt = mcrfpy.Caption(5, 5, "0", font)
+
+
+ui.append(f_a)
+f_a.children.append(f_a_txt)
+ui.append(f_b)
+f_b.children.append(f_b_txt)
+ui.append(f_c)
+f_c.children.append(f_c_txt)
+
+import sys
+def ding(*args):
+    f_a_txt.text = str(sys.getrefcount(ding)) + " refs"
+    f_b_txt.text = sys.getrefcount(dong)
+    f_c_txt.text = sys.getrefcount(stress_test)
+
+def dong(*args):
+    f_a_txt.text = str(sys.getrefcount(ding)) + " refs"
+    f_b_txt.text = sys.getrefcount(dong)
+    f_c_txt.text = sys.getrefcount(stress_test)
+
+running = False
+timers = []
+
+def add_ding():
+    global timers
+    n = len(timers)
+    mcrfpy.setTimer(f"timer{n}", ding, 100)
+    print("+1 ding:", timers)
+
+def add_dong():
+    global timers
+    n = len(timers)
+    mcrfpy.setTimer(f"timer{n}", dong, 100)
+    print("+1 dong:", timers)
+
+def remove_random():
+    global timers
+    target = random.choice(timers)
+    print("-1 timer:", target)
+    print("remove from list")
+    timers.remove(target)
+    print("delTimer")
+    mcrfpy.delTimer(target)
+    print("done")
+
+import random
+import time
+def stress_test(*args):
+    global running
+    global timers
+    if not running:
+        print("stress test initial")
+        running = True
+        timers.append("recurse")
+        add_ding()
+        add_dong()
+        mcrfpy.setTimer("recurse", stress_test, 1000)
+        mcrfpy.setTimer("terminate", lambda *args: mcrfpy.delTimer("recurse"), 30000)
+        ding(); dong()
+    else:
+        #print("stress test random activity")
+        #random.choice([
+        #    add_ding,
+        #    add_dong,
+        #    remove_random
+        #    ])()
+        #print(timers)
+        print("Segfaultin' time")
+        mcrfpy.delTimer("recurse")
+        print("Does this still work?")
+        time.sleep(0.5)
+        print("How about now?")
+
+
+stress_test()
+
+
+# Loading Screen
+mcrfpy.createScene("loading")
+ui = mcrfpy.sceneUI("loading")
+#mcrfpy.setScene("loading")
+logo_texture = mcrfpy.Texture("assets/temp_logo.png", 1024, 1024)#1, 1)
+logo_sprite = mcrfpy.Sprite(50, 50, logo_texture, 0, 0.5)
+ui.append(logo_sprite)
+logo_sprite.click = lambda *args: mcrfpy.setScene("menu")
+logo_caption = mcrfpy.Caption(70, 600, "Click to Proceed", font, (255, 0, 0, 255), (0, 0, 0, 255))
+#logo_caption.fill_color =(255, 0, 0, 255)
+ui.append(logo_caption)
+
+
+# menu screen
+mcrfpy.createScene("menu")
+
+for e in [
+    mcrfpy.Caption(10, 10, "Crypt of Sokoban", font, (255, 255, 255), (0, 0, 0)),
+    mcrfpy.Caption(20, 55, "a McRogueFace demo project", font, (192, 192, 192), (0, 0, 0)),
+    mcrfpy.Frame(15, 70, 150, 60, fill_color=(64, 64, 128)),
+    mcrfpy.Frame(15, 145, 150, 60, fill_color=(64, 64, 128)),
+    mcrfpy.Frame(15, 220, 150, 60, fill_color=(64, 64, 128)),
+    mcrfpy.Frame(15, 295, 150, 60, fill_color=(64, 64, 128)),
+    #mcrfpy.Frame(900, 10, 100, 100, fill_color=(255, 0, 0)),
+    ]:
+    mcrfpy.sceneUI("menu").append(e)
+
+def click_once(fn):
+    def wraps(*args, **kwargs):
+        #print(args)
+        action = args[3]
+        if action != "start": return
+        return fn(*args, **kwargs)
+    return wraps
+
+@click_once
+def asdf(x, y, btn, action):
+    print(f"clicky @({x},{y}) {action}->{btn}")
+
+@click_once
+def clicked_exit(*args):
+    mcrfpy.exit()
+
+menu_btns = [
+    ("Boom", lambda *args: 1 / 0),
+    ("Exit", clicked_exit), 
+    ("About", lambda *args: mcrfpy.setScene("about")), 
+    ("Settings", lambda *args: mcrfpy.setScene("settings")), 
+    ("Start", lambda *args: mcrfpy.setScene("play"))
+    ]
+for i in range(len(mcrfpy.sceneUI("menu"))):
+    e = mcrfpy.sceneUI("menu")[i] # TODO - fix iterator
+    #print(e, type(e))
+    if type(e) is not mcrfpy.Frame: continue
+    label, fn = menu_btns.pop()
+    #print(label)
+    e.children.append(mcrfpy.Caption(5, 5, label, font, (192, 192, 255), (0,0,0)))
+    e.click = fn
+
+
+# settings screen
+mcrfpy.createScene("settings")
+window_scaling = 1.0
+
+scale_caption = mcrfpy.Caption(180, 70, "1.0x", font, (255, 255, 255), (0, 0, 0))
+#scale_caption.fill_color = (255, 255, 255) # TODO - mcrfpy.Caption.__init__ is not setting colors
+for e in [
+    mcrfpy.Caption(10, 10, "Settings", font, (255, 255, 255), (0, 0, 0)),
+    mcrfpy.Frame(15, 70, 150, 60, fill_color=(64, 64, 128)), # +
+    mcrfpy.Frame(300, 70, 150, 60, fill_color=(64, 64, 128)), # -
+    mcrfpy.Frame(15, 295, 150, 60, fill_color=(64, 64, 128)),
+    scale_caption,
+    ]:
+    mcrfpy.sceneUI("settings").append(e)
+
+@click_once
+def game_scale(x, y, btn, action, delta):
+    global window_scaling
+    print(f"WIP - scale the window from {window_scaling:.1f} to {window_scaling+delta:.1f}")
+    window_scaling += delta
+    scale_caption.text = f"{window_scaling:.1f}x"
+    mcrfpy.setScale(window_scaling)
+    #mcrfpy.setScale(2)
+
+settings_btns = [
+    ("back", lambda *args: mcrfpy.setScene("menu")),
+    ("-", lambda x, y, btn, action: game_scale(x, y, btn, action, -0.1)),
+    ("+", lambda x, y, btn, action: game_scale(x, y, btn, action, +0.1))
+    ]
+
+for i in range(len(mcrfpy.sceneUI("settings"))):
+    e = mcrfpy.sceneUI("settings")[i] # TODO - fix iterator
+    #print(e, type(e))
+    if type(e) is not mcrfpy.Frame: continue
+    label, fn = settings_btns.pop()
+    #print(label, fn)
+    e.children.append(mcrfpy.Caption(5, 5, label, font, (192, 192, 255), (0,0,0)))
+    e.click = fn

wikicrayons_colors.txt

@@ -0,0 +1,168 @@
+Red	#ED0A3F
+Maroon	#C32148
+Scarlet	#FD0E35
+Brick Red	#C62D42
+English Vermilion	#CC474B
+Madder Lake	#CC3336
+Permanent Geranium Lake	#E12C2C
+Maximum Red	#D92121
+Chestnut	#B94E48
+Orange-Red	#FF5349
+Sunset Orange	#FE4C40
+Bittersweet	#FE6F5E
+Dark Venetian Red	#B33B24
+Venetian Red	#CC553D
+Light Venetian Red	#E6735C
+Vivid Tangerine	#FF9980
+Middle Red	#E58E73
+Burnt Orange	#FF7034
+Red-Orange	#FF3F34
+Orange	#FF8833
+Macaroni and Cheese	#FFB97B
+Middle Yellow Red	#ECAC76
+Mango Tango	#E77200
+Yellow-Orange	#FFAE42
+Maximum Yellow Red	#F2BA49
+Banana Mania	#FBE7B2
+Maize	#F2C649
+Orange-Yellow	#F8D568
+Goldenrod	#FCD667
+Dandelion	#FED85D
+Yellow	#FBE870
+Green-Yellow	#F1E788
+Middle Yellow	#FFEB00
+Olive Green	#B5B35C
+Spring Green	#ECEBBD
+Maximum Yellow	#FAFA37
+Canary	#FFFF99
+Lemon Yellow	#FFFF9F
+Maximum Green Yellow	#D9E650
+Middle Green Yellow	#ACBF60
+Inchworm	#B0E313
+Light Chrome Green	#BEE64B
+Yellow-Green	#C5E17A
+Maximum Green	#5E8C31
+Asparagus	#7BA05B
+Granny Smith Apple	#9DE093
+Fern	#63B76C
+Middle Green	#4D8C57
+Green	#01A638
+Medium Chrome Green	#6CA67C
+Forest Green	#5FA777
+Sea Green	#93DFB8
+Shamrock	#33CC99
+Mountain Meadow	#1AB385
+Jungle Green	#29AB87
+Caribbean Green	#00CC99
+Tropical Rain Forest	#00755E
+Middle Blue Green	#8DD9CC
+Pine Green	#01796F
+Maximum Blue Green	#30BFBF
+Robin's Egg Blue	#00CCCC
+Teal Blue	#008080
+Light Blue	#8FD8D8
+Aquamarine	#458B74
+Turquoise Blue	#6CDAE7
+Outer Space	#2D383A
+Sky Blue	#76D7EA
+Middle Blue	#7ED4E6
+Blue-Green	#0095B7
+Pacific Blue	#009DC4
+Cerulean	#02A4D3
+Maximum Blue	#47ABCC
+Blue (I)	#2EB4E6
+Cerulean Blue	#339ACC
+Cornflower	#93CCEA
+Green-Blue	#2887C8
+Midnight Blue	#003366
+Navy Blue	#0066CC
+Denim	#1560BD
+Blue (III)	#0066FF
+Cadet Blue	#A9B2C3
+Periwinkle	#C3CDE6
+Blue (II)	#4570E6
+Bluetiful	#3C69E7
+Wild Blue Yonder	#7A89B8
+Indigo	#4F69C6
+Manatee	#8D90A1
+Cobalt Blue	#8C90C8
+Celestial Blue	#7070CC
+Blue Bell	#9999CC
+Maximum Blue Purple	#ACACE6
+Violet-Blue	#766EC8
+Blue-Violet	#6456B7
+Ultramarine Blue	#3F26BF
+Middle Blue Purple	#8B72BE
+Purple Heart	#652DC1
+Royal Purple	#6B3FA0
+Violet (II)	#8359A3
+Medium Violet	#8F47B3
+Wisteria	#C9A0DC
+Lavender (I)	#BF8FCC
+Vivid Violet	#803790
+Maximum Purple	#733380
+Purple Mountains' Majesty	#D6AEDD
+Fuchsia	#C154C1
+Pink Flamingo	#F2583E
+Violet (I)	#732E6C
+Brilliant Rose	#E667CE
+Orchid	#E29CD2
+Plum	#843179
+Medium Rose	#D96CBE
+Thistle	#D8BFD8
+Mulberry	#C8509B
+Red-Violet	#BB3385
+Middle Purple	#D982B5
+Maximum Red Purple	#A63A79
+Jazzberry Jam	#A50B5E
+Eggplant	#614051
+Magenta	#F653A6
+Cerise	#DA3287
+Wild Strawberry	#FF3399
+Lavender (II)	#FBAED2
+Cotton Candy	#FFB7D5
+Carnation Pink	#FFA6C9
+Violet-Red	#F7468A
+Razzmatazz	#E30B5C
+Piggy Pink	#FDD7E4
+Carmine	#E62E6B
+Blush	#DB5079
+Tickle Me Pink	#FC80A5
+Mauvelous	#F091A9
+Salmon	#FF91A4
+Middle Red Purple	#A55353
+Mahogany	#CA3435
+Melon	#FEBAAD
+Pink Sherbert	#F7A38E
+Burnt Sienna	#E97451
+Brown	#AF593E
+Sepia	#9E5B40
+Fuzzy Wuzzy	#87421F
+Beaver	#926F5B
+Tumbleweed	#DEA681
+Raw Sienna	#D27D46
+Van Dyke Brown	#664228
+Tan	#FA9D5A
+Desert Sand	#EDC9AF
+Peach	#FFCBA4
+Burnt Umber	#805533
+Apricot	#FDD5B1
+Almond	#EED9C4
+Raw Umber	#665233
+Shadow	#837050
+Raw Sienna (I)	#E6BC5C
+Gold (I)	#92926E
+Gold (II)	#E6BE8A
+Silver	#C9C0BB
+Copper	#DA8A67
+Antique Brass	#C88A65
+Black	#000000
+Charcoal Gray	#736A62
+Gray	#8B8680
+Blue-Gray	#C8C8CD
+Timberwolf	#D9D6CF
+White	#FFFFFF
+Crayellow	#F1D651[6]
+Cool Mint	#DDEBEC[6]
+Oatmeal	#D9DAD2[6]
+Powder Blue	#C0D5F0[6]

xkcd_colors.txt

@@ -0,0 +1,949 @@
+cloudy blue	#acc2d9
+dark pastel green	#56ae57
+dust	#b2996e
+electric lime	#a8ff04
+fresh green	#69d84f
+light eggplant	#894585
+nasty green	#70b23f
+really light blue	#d4ffff
+tea	#65ab7c
+warm purple	#952e8f
+yellowish tan	#fcfc81
+cement	#a5a391
+dark grass green	#388004
+dusty teal	#4c9085
+grey teal	#5e9b8a
+macaroni and cheese	#efb435
+pinkish tan	#d99b82
+spruce	#0a5f38
+strong blue	#0c06f7
+toxic green	#61de2a
+windows blue	#3778bf
+blue blue	#2242c7
+blue with a hint of purple	#533cc6
+booger	#9bb53c
+bright sea green	#05ffa6
+dark green blue	#1f6357
+deep turquoise	#017374
+green teal	#0cb577
+strong pink	#ff0789
+bland	#afa88b
+deep aqua	#08787f
+lavender pink	#dd85d7
+light moss green	#a6c875
+light seafoam green	#a7ffb5
+olive yellow	#c2b709
+pig pink	#e78ea5
+deep lilac	#966ebd
+desert	#ccad60
+dusty lavender	#ac86a8
+purpley grey	#947e94
+purply	#983fb2
+candy pink	#ff63e9
+light pastel green	#b2fba5
+boring green	#63b365
+kiwi green	#8ee53f
+light grey green	#b7e1a1
+orange pink	#ff6f52
+tea green	#bdf8a3
+very light brown	#d3b683
+egg shell	#fffcc4
+eggplant purple	#430541
+powder pink	#ffb2d0
+reddish grey	#997570
+baby shit brown	#ad900d
+liliac	#c48efd
+stormy blue	#507b9c
+ugly brown	#7d7103
+custard	#fffd78
+darkish pink	#da467d
+deep brown	#410200
+greenish beige	#c9d179
+manilla	#fffa86
+off blue	#5684ae
+battleship grey	#6b7c85
+browny green	#6f6c0a
+bruise	#7e4071
+kelley green	#009337
+sickly yellow	#d0e429
+sunny yellow	#fff917
+azul	#1d5dec
+darkgreen	#054907
+green/yellow	#b5ce08
+lichen	#8fb67b
+light light green	#c8ffb0
+pale gold	#fdde6c
+sun yellow	#ffdf22
+tan green	#a9be70
+burple	#6832e3
+butterscotch	#fdb147
+toupe	#c7ac7d
+dark cream	#fff39a
+indian red	#850e04
+light lavendar	#efc0fe
+poison green	#40fd14
+baby puke green	#b6c406
+bright yellow green	#9dff00
+charcoal grey	#3c4142
+squash	#f2ab15
+cinnamon	#ac4f06
+light pea green	#c4fe82
+radioactive green	#2cfa1f
+raw sienna	#9a6200
+baby purple	#ca9bf7
+cocoa	#875f42
+light royal blue	#3a2efe
+orangeish	#fd8d49
+rust brown	#8b3103
+sand brown	#cba560
+swamp	#698339
+tealish green	#0cdc73
+burnt siena	#b75203
+camo	#7f8f4e
+dusk blue	#26538d
+fern	#63a950
+old rose	#c87f89
+pale light green	#b1fc99
+peachy pink	#ff9a8a
+rosy pink	#f6688e
+light bluish green	#76fda8
+light bright green	#53fe5c
+light neon green	#4efd54
+light seafoam	#a0febf
+tiffany blue	#7bf2da
+washed out green	#bcf5a6
+browny orange	#ca6b02
+nice blue	#107ab0
+sapphire	#2138ab
+greyish teal	#719f91
+orangey yellow	#fdb915
+parchment	#fefcaf
+straw	#fcf679
+very dark brown	#1d0200
+terracota	#cb6843
+ugly blue	#31668a
+clear blue	#247afd
+creme	#ffffb6
+foam green	#90fda9
+grey/green	#86a17d
+light gold	#fddc5c
+seafoam blue	#78d1b6
+topaz	#13bbaf
+violet pink	#fb5ffc
+wintergreen	#20f986
+yellow tan	#ffe36e
+dark fuchsia	#9d0759
+indigo blue	#3a18b1
+light yellowish green	#c2ff89
+pale magenta	#d767ad
+rich purple	#720058
+sunflower yellow	#ffda03
+green/blue	#01c08d
+leather	#ac7434
+racing green	#014600
+vivid purple	#9900fa
+dark royal blue	#02066f
+hazel	#8e7618
+muted pink	#d1768f
+booger green	#96b403
+canary	#fdff63
+cool grey	#95a3a6
+dark taupe	#7f684e
+darkish purple	#751973
+true green	#089404
+coral pink	#ff6163
+dark sage	#598556
+dark slate blue	#214761
+flat blue	#3c73a8
+mushroom	#ba9e88
+rich blue	#021bf9
+dirty purple	#734a65
+greenblue	#23c48b
+icky green	#8fae22
+light khaki	#e6f2a2
+warm blue	#4b57db
+dark hot pink	#d90166
+deep sea blue	#015482
+carmine	#9d0216
+dark yellow green	#728f02
+pale peach	#ffe5ad
+plum purple	#4e0550
+golden rod	#f9bc08
+neon red	#ff073a
+old pink	#c77986
+very pale blue	#d6fffe
+blood orange	#fe4b03
+grapefruit	#fd5956
+sand yellow	#fce166
+clay brown	#b2713d
+dark blue grey	#1f3b4d
+flat green	#699d4c
+light green blue	#56fca2
+warm pink	#fb5581
+dodger blue	#3e82fc
+gross green	#a0bf16
+ice	#d6fffa
+metallic blue	#4f738e
+pale salmon	#ffb19a
+sap green	#5c8b15
+algae	#54ac68
+bluey grey	#89a0b0
+greeny grey	#7ea07a
+highlighter green	#1bfc06
+light light blue	#cafffb
+light mint	#b6ffbb
+raw umber	#a75e09
+vivid blue	#152eff
+deep lavender	#8d5eb7
+dull teal	#5f9e8f
+light greenish blue	#63f7b4
+mud green	#606602
+pinky	#fc86aa
+red wine	#8c0034
+shit green	#758000
+tan brown	#ab7e4c
+darkblue	#030764
+rosa	#fe86a4
+lipstick	#d5174e
+pale mauve	#fed0fc
+claret	#680018
+dandelion	#fedf08
+orangered	#fe420f
+poop green	#6f7c00
+ruby	#ca0147
+dark	#1b2431
+greenish turquoise	#00fbb0
+pastel red	#db5856
+piss yellow	#ddd618
+bright cyan	#41fdfe
+dark coral	#cf524e
+algae green	#21c36f
+darkish red	#a90308
+reddy brown	#6e1005
+blush pink	#fe828c
+camouflage green	#4b6113
+lawn green	#4da409
+putty	#beae8a
+vibrant blue	#0339f8
+dark sand	#a88f59
+purple/blue	#5d21d0
+saffron	#feb209
+twilight	#4e518b
+warm brown	#964e02
+bluegrey	#85a3b2
+bubble gum pink	#ff69af
+duck egg blue	#c3fbf4
+greenish cyan	#2afeb7
+petrol	#005f6a
+royal	#0c1793
+butter	#ffff81
+dusty orange	#f0833a
+off yellow	#f1f33f
+pale olive green	#b1d27b
+orangish	#fc824a
+leaf	#71aa34
+light blue grey	#b7c9e2
+dried blood	#4b0101
+lightish purple	#a552e6
+rusty red	#af2f0d
+lavender blue	#8b88f8
+light grass green	#9af764
+light mint green	#a6fbb2
+sunflower	#ffc512
+velvet	#750851
+brick orange	#c14a09
+lightish red	#fe2f4a
+pure blue	#0203e2
+twilight blue	#0a437a
+violet red	#a50055
+yellowy brown	#ae8b0c
+carnation	#fd798f
+muddy yellow	#bfac05
+dark seafoam green	#3eaf76
+deep rose	#c74767
+dusty red	#b9484e
+grey/blue	#647d8e
+lemon lime	#bffe28
+purple/pink	#d725de
+brown yellow	#b29705
+purple brown	#673a3f
+wisteria	#a87dc2
+banana yellow	#fafe4b
+lipstick red	#c0022f
+water blue	#0e87cc
+brown grey	#8d8468
+vibrant purple	#ad03de
+baby green	#8cff9e
+barf green	#94ac02
+eggshell blue	#c4fff7
+sandy yellow	#fdee73
+cool green	#33b864
+pale	#fff9d0
+blue/grey	#758da3
+hot magenta	#f504c9
+greyblue	#77a1b5
+purpley	#8756e4
+baby shit green	#889717
+brownish pink	#c27e79
+dark aquamarine	#017371
+diarrhea	#9f8303
+light mustard	#f7d560
+pale sky blue	#bdf6fe
+turtle green	#75b84f
+bright olive	#9cbb04
+dark grey blue	#29465b
+greeny brown	#696006
+lemon green	#adf802
+light periwinkle	#c1c6fc
+seaweed green	#35ad6b
+sunshine yellow	#fffd37
+ugly purple	#a442a0
+medium pink	#f36196
+puke brown	#947706
+very light pink	#fff4f2
+viridian	#1e9167
+bile	#b5c306
+faded yellow	#feff7f
+very pale green	#cffdbc
+vibrant green	#0add08
+bright lime	#87fd05
+spearmint	#1ef876
+light aquamarine	#7bfdc7
+light sage	#bcecac
+yellowgreen	#bbf90f
+baby poo	#ab9004
+dark seafoam	#1fb57a
+deep teal	#00555a
+heather	#a484ac
+rust orange	#c45508
+dirty blue	#3f829d
+fern green	#548d44
+bright lilac	#c95efb
+weird green	#3ae57f
+peacock blue	#016795
+avocado green	#87a922
+faded orange	#f0944d
+grape purple	#5d1451
+hot green	#25ff29
+lime yellow	#d0fe1d
+mango	#ffa62b
+shamrock	#01b44c
+bubblegum	#ff6cb5
+purplish brown	#6b4247
+vomit yellow	#c7c10c
+pale cyan	#b7fffa
+key lime	#aeff6e
+tomato red	#ec2d01
+lightgreen	#76ff7b
+merlot	#730039
+night blue	#040348
+purpleish pink	#df4ec8
+apple	#6ecb3c
+baby poop green	#8f9805
+green apple	#5edc1f
+heliotrope	#d94ff5
+yellow/green	#c8fd3d
+almost black	#070d0d
+cool blue	#4984b8
+leafy green	#51b73b
+mustard brown	#ac7e04
+dusk	#4e5481
+dull brown	#876e4b
+frog green	#58bc08
+vivid green	#2fef10
+bright light green	#2dfe54
+fluro green	#0aff02
+kiwi	#9cef43
+seaweed	#18d17b
+navy green	#35530a
+ultramarine blue	#1805db
+iris	#6258c4
+pastel orange	#ff964f
+yellowish orange	#ffab0f
+perrywinkle	#8f8ce7
+tealish	#24bca8
+dark plum	#3f012c
+pear	#cbf85f
+pinkish orange	#ff724c
+midnight purple	#280137
+light urple	#b36ff6
+dark mint	#48c072
+greenish tan	#bccb7a
+light burgundy	#a8415b
+turquoise blue	#06b1c4
+ugly pink	#cd7584
+sandy	#f1da7a
+electric pink	#ff0490
+muted purple	#805b87
+mid green	#50a747
+greyish	#a8a495
+neon yellow	#cfff04
+banana	#ffff7e
+carnation pink	#ff7fa7
+tomato	#ef4026
+sea	#3c9992
+muddy brown	#886806
+turquoise green	#04f489
+buff	#fef69e
+fawn	#cfaf7b
+muted blue	#3b719f
+pale rose	#fdc1c5
+dark mint green	#20c073
+amethyst	#9b5fc0
+blue/green	#0f9b8e
+chestnut	#742802
+sick green	#9db92c
+pea	#a4bf20
+rusty orange	#cd5909
+stone	#ada587
+rose red	#be013c
+pale aqua	#b8ffeb
+deep orange	#dc4d01
+earth	#a2653e
+mossy green	#638b27
+grassy green	#419c03
+pale lime green	#b1ff65
+light grey blue	#9dbcd4
+pale grey	#fdfdfe
+asparagus	#77ab56
+blueberry	#464196
+purple red	#990147
+pale lime	#befd73
+greenish teal	#32bf84
+caramel	#af6f09
+deep magenta	#a0025c
+light peach	#ffd8b1
+milk chocolate	#7f4e1e
+ocher	#bf9b0c
+off green	#6ba353
+purply pink	#f075e6
+lightblue	#7bc8f6
+dusky blue	#475f94
+golden	#f5bf03
+light beige	#fffeb6
+butter yellow	#fffd74
+dusky purple	#895b7b
+french blue	#436bad
+ugly yellow	#d0c101
+greeny yellow	#c6f808
+orangish red	#f43605
+shamrock green	#02c14d
+orangish brown	#b25f03
+tree green	#2a7e19
+deep violet	#490648
+gunmetal	#536267
+blue/purple	#5a06ef
+cherry	#cf0234
+sandy brown	#c4a661
+warm grey	#978a84
+dark indigo	#1f0954
+midnight	#03012d
+bluey green	#2bb179
+grey pink	#c3909b
+soft purple	#a66fb5
+blood	#770001
+brown red	#922b05
+medium grey	#7d7f7c
+berry	#990f4b
+poo	#8f7303
+purpley pink	#c83cb9
+light salmon	#fea993
+snot	#acbb0d
+easter purple	#c071fe
+light yellow green	#ccfd7f
+dark navy blue	#00022e
+drab	#828344
+light rose	#ffc5cb
+rouge	#ab1239
+purplish red	#b0054b
+slime green	#99cc04
+baby poop	#937c00
+irish green	#019529
+pink/purple	#ef1de7
+dark navy	#000435
+greeny blue	#42b395
+light plum	#9d5783
+pinkish grey	#c8aca9
+dirty orange	#c87606
+rust red	#aa2704
+pale lilac	#e4cbff
+orangey red	#fa4224
+primary blue	#0804f9
+kermit green	#5cb200
+brownish purple	#76424e
+murky green	#6c7a0e
+wheat	#fbdd7e
+very dark purple	#2a0134
+bottle green	#044a05
+watermelon	#fd4659
+deep sky blue	#0d75f8
+fire engine red	#fe0002
+yellow ochre	#cb9d06
+pumpkin orange	#fb7d07
+pale olive	#b9cc81
+light lilac	#edc8ff
+lightish green	#61e160
+carolina blue	#8ab8fe
+mulberry	#920a4e
+shocking pink	#fe02a2
+auburn	#9a3001
+bright lime green	#65fe08
+celadon	#befdb7
+pinkish brown	#b17261
+poo brown	#885f01
+bright sky blue	#02ccfe
+celery	#c1fd95
+dirt brown	#836539
+strawberry	#fb2943
+dark lime	#84b701
+copper	#b66325
+medium brown	#7f5112
+muted green	#5fa052
+robin's egg	#6dedfd
+bright aqua	#0bf9ea
+bright lavender	#c760ff
+ivory	#ffffcb
+very light purple	#f6cefc
+light navy	#155084
+pink red	#f5054f
+olive brown	#645403
+poop brown	#7a5901
+mustard green	#a8b504
+ocean green	#3d9973
+very dark blue	#000133
+dusty green	#76a973
+light navy blue	#2e5a88
+minty green	#0bf77d
+adobe	#bd6c48
+barney	#ac1db8
+jade green	#2baf6a
+bright light blue	#26f7fd
+light lime	#aefd6c
+dark khaki	#9b8f55
+orange yellow	#ffad01
+ocre	#c69c04
+maize	#f4d054
+faded pink	#de9dac
+british racing green	#05480d
+sandstone	#c9ae74
+mud brown	#60460f
+light sea green	#98f6b0
+robin egg blue	#8af1fe
+aqua marine	#2ee8bb
+dark sea green	#11875d
+soft pink	#fdb0c0
+orangey brown	#b16002
+cherry red	#f7022a
+burnt yellow	#d5ab09
+brownish grey	#86775f
+camel	#c69f59
+purplish grey	#7a687f
+marine	#042e60
+greyish pink	#c88d94
+pale turquoise	#a5fbd5
+pastel yellow	#fffe71
+bluey purple	#6241c7
+canary yellow	#fffe40
+faded red	#d3494e
+sepia	#985e2b
+coffee	#a6814c
+bright magenta	#ff08e8
+mocha	#9d7651
+ecru	#feffca
+purpleish	#98568d
+cranberry	#9e003a
+darkish green	#287c37
+brown orange	#b96902
+dusky rose	#ba6873
+melon	#ff7855
+sickly green	#94b21c
+silver	#c5c9c7
+purply blue	#661aee
+purpleish blue	#6140ef
+hospital green	#9be5aa
+shit brown	#7b5804
+mid blue	#276ab3
+amber	#feb308
+easter green	#8cfd7e
+soft blue	#6488ea
+cerulean blue	#056eee
+golden brown	#b27a01
+bright turquoise	#0ffef9
+red pink	#fa2a55
+red purple	#820747
+greyish brown	#7a6a4f
+vermillion	#f4320c
+russet	#a13905
+steel grey	#6f828a
+lighter purple	#a55af4
+bright violet	#ad0afd
+prussian blue	#004577
+slate green	#658d6d
+dirty pink	#ca7b80
+dark blue green	#005249
+pine	#2b5d34
+yellowy green	#bff128
+dark gold	#b59410
+bluish	#2976bb
+darkish blue	#014182
+dull red	#bb3f3f
+pinky red	#fc2647
+bronze	#a87900
+pale teal	#82cbb2
+military green	#667c3e
+barbie pink	#fe46a5
+bubblegum pink	#fe83cc
+pea soup green	#94a617
+dark mustard	#a88905
+shit	#7f5f00
+medium purple	#9e43a2
+very dark green	#062e03
+dirt	#8a6e45
+dusky pink	#cc7a8b
+red violet	#9e0168
+lemon yellow	#fdff38
+pistachio	#c0fa8b
+dull yellow	#eedc5b
+dark lime green	#7ebd01
+denim blue	#3b5b92
+teal blue	#01889f
+lightish blue	#3d7afd
+purpley blue	#5f34e7
+light indigo	#6d5acf
+swamp green	#748500
+brown green	#706c11
+dark maroon	#3c0008
+hot purple	#cb00f5
+dark forest green	#002d04
+faded blue	#658cbb
+drab green	#749551
+light lime green	#b9ff66
+snot green	#9dc100
+yellowish	#faee66
+light blue green	#7efbb3
+bordeaux	#7b002c
+light mauve	#c292a1
+ocean	#017b92
+marigold	#fcc006
+muddy green	#657432
+dull orange	#d8863b
+steel	#738595
+electric purple	#aa23ff
+fluorescent green	#08ff08
+yellowish brown	#9b7a01
+blush	#f29e8e
+soft green	#6fc276
+bright orange	#ff5b00
+lemon	#fdff52
+purple grey	#866f85
+acid green	#8ffe09
+pale lavender	#eecffe
+violet blue	#510ac9
+light forest green	#4f9153
+burnt red	#9f2305
+khaki green	#728639
+cerise	#de0c62
+faded purple	#916e99
+apricot	#ffb16d
+dark olive green	#3c4d03
+grey brown	#7f7053
+green grey	#77926f
+true blue	#010fcc
+pale violet	#ceaefa
+periwinkle blue	#8f99fb
+light sky blue	#c6fcff
+blurple	#5539cc
+green brown	#544e03
+bluegreen	#017a79
+bright teal	#01f9c6
+brownish yellow	#c9b003
+pea soup	#929901
+forest	#0b5509
+barney purple	#a00498
+ultramarine	#2000b1
+purplish	#94568c
+puke yellow	#c2be0e
+bluish grey	#748b97
+dark periwinkle	#665fd1
+dark lilac	#9c6da5
+reddish	#c44240
+light maroon	#a24857
+dusty purple	#825f87
+terra cotta	#c9643b
+avocado	#90b134
+marine blue	#01386a
+teal green	#25a36f
+slate grey	#59656d
+lighter green	#75fd63
+electric green	#21fc0d
+dusty blue	#5a86ad
+golden yellow	#fec615
+bright yellow	#fffd01
+light lavender	#dfc5fe
+umber	#b26400
+poop	#7f5e00
+dark peach	#de7e5d
+jungle green	#048243
+eggshell	#ffffd4
+denim	#3b638c
+yellow brown	#b79400
+dull purple	#84597e
+chocolate brown	#411900
+wine red	#7b0323
+neon blue	#04d9ff
+dirty green	#667e2c
+light tan	#fbeeac
+ice blue	#d7fffe
+cadet blue	#4e7496
+dark mauve	#874c62
+very light blue	#d5ffff
+grey purple	#826d8c
+pastel pink	#ffbacd
+very light green	#d1ffbd
+dark sky blue	#448ee4
+evergreen	#05472a
+dull pink	#d5869d
+aubergine	#3d0734
+mahogany	#4a0100
+reddish orange	#f8481c
+deep green	#02590f
+vomit green	#89a203
+purple pink	#e03fd8
+dusty pink	#d58a94
+faded green	#7bb274
+camo green	#526525
+pinky purple	#c94cbe
+pink purple	#db4bda
+brownish red	#9e3623
+dark rose	#b5485d
+mud	#735c12
+brownish	#9c6d57
+emerald green	#028f1e
+pale brown	#b1916e
+dull blue	#49759c
+burnt umber	#a0450e
+medium green	#39ad48
+clay	#b66a50
+light aqua	#8cffdb
+light olive green	#a4be5c
+brownish orange	#cb7723
+dark aqua	#05696b
+purplish pink	#ce5dae
+dark salmon	#c85a53
+greenish grey	#96ae8d
+jade	#1fa774
+ugly green	#7a9703
+dark beige	#ac9362
+emerald	#01a049
+pale red	#d9544d
+light magenta	#fa5ff7
+sky	#82cafc
+light cyan	#acfffc
+yellow orange	#fcb001
+reddish purple	#910951
+reddish pink	#fe2c54
+orchid	#c875c4
+dirty yellow	#cdc50a
+orange red	#fd411e
+deep red	#9a0200
+orange brown	#be6400
+cobalt blue	#030aa7
+neon pink	#fe019a
+rose pink	#f7879a
+greyish purple	#887191
+raspberry	#b00149
+aqua green	#12e193
+salmon pink	#fe7b7c
+tangerine	#ff9408
+brownish green	#6a6e09
+red brown	#8b2e16
+greenish brown	#696112
+pumpkin	#e17701
+pine green	#0a481e
+charcoal	#343837
+baby pink	#ffb7ce
+cornflower	#6a79f7
+blue violet	#5d06e9
+chocolate	#3d1c02
+greyish green	#82a67d
+scarlet	#be0119
+green yellow	#c9ff27
+dark olive	#373e02
+sienna	#a9561e
+pastel purple	#caa0ff
+terracotta	#ca6641
+aqua blue	#02d8e9
+sage green	#88b378
+blood red	#980002
+deep pink	#cb0162
+grass	#5cac2d
+moss	#769958
+pastel blue	#a2bffe
+bluish green	#10a674
+green blue	#06b48b
+dark tan	#af884a
+greenish blue	#0b8b87
+pale orange	#ffa756
+vomit	#a2a415
+forrest green	#154406
+dark lavender	#856798
+dark violet	#34013f
+purple blue	#632de9
+dark cyan	#0a888a
+olive drab	#6f7632
+pinkish	#d46a7e
+cobalt	#1e488f
+neon purple	#bc13fe
+light turquoise	#7ef4cc
+apple green	#76cd26
+dull green	#74a662
+wine	#80013f
+powder blue	#b1d1fc
+off white	#ffffe4
+electric blue	#0652ff
+dark turquoise	#045c5a
+blue purple	#5729ce
+azure	#069af3
+bright red	#ff000d
+pinkish red	#f10c45
+cornflower blue	#5170d7
+light olive	#acbf69
+grape	#6c3461
+greyish blue	#5e819d
+purplish blue	#601ef9
+yellowish green	#b0dd16
+greenish yellow	#cdfd02
+medium blue	#2c6fbb
+dusty rose	#c0737a
+light violet	#d6b4fc
+midnight blue	#020035
+bluish purple	#703be7
+red orange	#fd3c06
+dark magenta	#960056
+greenish	#40a368
+ocean blue	#03719c
+coral	#fc5a50
+cream	#ffffc2
+reddish brown	#7f2b0a
+burnt sienna	#b04e0f
+brick	#a03623
+sage	#87ae73
+grey green	#789b73
+white	#ffffff
+robin's egg blue	#98eff9
+moss green	#658b38
+steel blue	#5a7d9a
+eggplant	#380835
+light yellow	#fffe7a
+leaf green	#5ca904
+light grey	#d8dcd6
+puke	#a5a502
+pinkish purple	#d648d7
+sea blue	#047495
+pale purple	#b790d4
+slate blue	#5b7c99
+blue grey	#607c8e
+hunter green	#0b4008
+fuchsia	#ed0dd9
+crimson	#8c000f
+pale yellow	#ffff84
+ochre	#bf9005
+mustard yellow	#d2bd0a
+light red	#ff474c
+cerulean	#0485d1
+pale pink	#ffcfdc
+deep blue	#040273
+rust	#a83c09
+light teal	#90e4c1
+slate	#516572
+goldenrod	#fac205
+dark yellow	#d5b60a
+dark grey	#363737
+army green	#4b5d16
+grey blue	#6b8ba4
+seafoam	#80f9ad
+puce	#a57e52
+spring green	#a9f971
+dark orange	#c65102
+sand	#e2ca76
+pastel green	#b0ff9d
+mint	#9ffeb0
+light orange	#fdaa48
+bright pink	#fe01b1
+chartreuse	#c1f80a
+deep purple	#36013f
+dark brown	#341c02
+taupe	#b9a281
+pea green	#8eab12
+puke green	#9aae07
+kelly green	#02ab2e
+seafoam green	#7af9ab
+blue green	#137e6d
+khaki	#aaa662
+burgundy	#610023
+dark teal	#014d4e
+brick red	#8f1402
+royal purple	#4b006e
+plum	#580f41
+mint green	#8fff9f
+gold	#dbb40c
+baby blue	#a2cffe
+yellow green	#c0fb2d
+bright purple	#be03fd
+dark red	#840000
+pale blue	#d0fefe
+grass green	#3f9b0b
+navy	#01153e
+aquamarine	#04d8b2
+burnt orange	#c04e01
+neon green	#0cff0c
+bright blue	#0165fc
+rose	#cf6275
+light pink	#ffd1df
+mustard	#ceb301
+indigo	#380282
+lime	#aaff32
+sea green	#53fca1
+periwinkle	#8e82fe
+dark pink	#cb416b
+olive green	#677a04
+peach	#ffb07c
+pale green	#c7fdb5
+light brown	#ad8150
+hot pink	#ff028d
+black	#000000
+lilac	#cea2fd
+navy blue	#001146
+royal blue	#0504aa
+beige	#e6daa6
+salmon	#ff796c
+olive	#6e750e
+maroon	#650021
+bright green	#01ff07
+dark purple	#35063e
+mauve	#ae7181
+forest green	#06470c
+aqua	#13eac9
+cyan	#00ffff
+tan	#d1b26f
+dark blue	#00035b
+lavender	#c79fef
+turquoise	#06c2ac
+dark green	#033500
+violet	#9a0eea
+light purple	#bf77f6
+lime green	#89fe05
+grey	#929591
+sky blue	#75bbfd
+yellow	#ffff14
+magenta	#c20078
+light green	#96f97b
+orange	#f97306
+teal	#029386
+light blue	#95d0fc
+red	#e50000
+brown	#653700
+pink	#ff81c0
+blue	#0343df
+green	#15b01a
+purple	#7e1e9c